+@using Umbraco.Forms.Core
+@using Umbraco.Forms.Mvc.Models
+@using Umbraco.Forms.Mvc.BusinessLogic
+@using Umbraco.Forms.MVC.Extensions
+@using Umbraco.Forms.Core.Extensions
+
+
+
+
\ No newline at end of file
diff --git a/src/Umbraco.Web.UI/Umbraco/plugins/umbracoContour/Views/Web.config b/src/Umbraco.Web.UI/Umbraco/plugins/umbracoContour/Views/Web.config
new file mode 100644
index 0000000000..a4def2a3db
--- /dev/null
+++ b/src/Umbraco.Web.UI/Umbraco/plugins/umbracoContour/Views/Web.config
@@ -0,0 +1,58 @@
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
diff --git a/src/Umbraco.Web.UI/Umbraco/plugins/umbracoContour/Views/_ViewStart.cshtml b/src/Umbraco.Web.UI/Umbraco/plugins/umbracoContour/Views/_ViewStart.cshtml
new file mode 100644
index 0000000000..efda124b1f
--- /dev/null
+++ b/src/Umbraco.Web.UI/Umbraco/plugins/umbracoContour/Views/_ViewStart.cshtml
@@ -0,0 +1,3 @@
+@{
+ Layout = "~/Views/Shared/_Layout.cshtml";
+}
\ No newline at end of file
diff --git a/src/Umbraco.Web.UI/Umbraco/plugins/umbracoContour/Workflows.asmx b/src/Umbraco.Web.UI/Umbraco/plugins/umbracoContour/Workflows.asmx
new file mode 100644
index 0000000000..cc1852d204
--- /dev/null
+++ b/src/Umbraco.Web.UI/Umbraco/plugins/umbracoContour/Workflows.asmx
@@ -0,0 +1 @@
+<%@ WebService Language="C#" CodeBehind="Workflows.asmx.cs" Class="UmbracoContour.Webservices.Workflows" %>
diff --git a/src/Umbraco.Web.UI/Umbraco/plugins/umbracoContour/archiveForm.aspx b/src/Umbraco.Web.UI/Umbraco/plugins/umbracoContour/archiveForm.aspx
new file mode 100644
index 0000000000..512113d027
--- /dev/null
+++ b/src/Umbraco.Web.UI/Umbraco/plugins/umbracoContour/archiveForm.aspx
@@ -0,0 +1,43 @@
+<%@ Page MasterPageFile="../../masterpages/umbracoDialog.Master" Language="C#" AutoEventWireup="true" CodeBehind="archiveForm.aspx.cs" Inherits="Umbraco.Forms.UI.Dialogs.archiveForm" %>
+
+
+
+
+
+
+
+
+
+
+ <% if (Request["unarchive"] == null)
+ { %>
+ Archiving your form will remove the form from various lists (form picker, ...) and will place the designer in read only mode.
+ <%}
+ else
+ { %>
+ Unarchiving your form will make it possible to edit the form again and the form will also appear in various list (form picker, ...) again.
+ <% } %>
+
+
+
+ <%= umbraco.ui.Text("or") %> <%= umbraco.ui.Text("cancel") %>
+
+
+
+
+ The form '
+
+
+
+
+
diff --git a/src/Umbraco.Web.UI/Umbraco/plugins/umbracoContour/createForm.ascx b/src/Umbraco.Web.UI/Umbraco/plugins/umbracoContour/createForm.ascx
new file mode 100644
index 0000000000..4b4390f2e9
--- /dev/null
+++ b/src/Umbraco.Web.UI/Umbraco/plugins/umbracoContour/createForm.ascx
@@ -0,0 +1,25 @@
+<%@ Control Language="C#" AutoEventWireup="true" CodeBehind="createForm.ascx.cs" Inherits="Umbraco.Forms.UI.Dialogs.createForm" %>
+
+To create a new form, simply give it a name and click the Create button. By Choosing a template, some relevant fields are automaticly added to your form (they can be edited afterwards). How does this work (video)?
+
+Name: * Choose a template (optional):
+
+ None
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ Select fields you want to include
+
+
+
+
+
+
+
+
+
+ Setup foreign keys
+
+
+
+
+
+
+
+
+
+ Set fieldtypes
+
+
+
+
+
+
+
+
+
\ No newline at end of file
diff --git a/src/Umbraco.Web.UI/Umbraco/plugins/umbracoContour/css/TableTools.css b/src/Umbraco.Web.UI/Umbraco/plugins/umbracoContour/css/TableTools.css
new file mode 100644
index 0000000000..9233973105
--- /dev/null
+++ b/src/Umbraco.Web.UI/Umbraco/plugins/umbracoContour/css/TableTools.css
@@ -0,0 +1,97 @@
+
+/* * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * *
+ * TableTools styles
+ */
+.TableTools {
+ padding: 3px 0 3px 3px;
+ border: 1px solid #d0d0d0;
+ background-color: #f0f0f0;
+ float: right;
+ margin-bottom: 1em;
+}
+
+.TableTools_button {
+ position: relative;
+ float: left;
+ margin-right: 3px;
+}
+
+.TableTools_csv {
+ background: url(../images/recordviewericons/csv.png) no-repeat center center;
+ border: 1px solid #f0f0f0;
+}
+
+.TableTools_csv_hover {
+ background: url(../images/recordviewericons/csv_hover.png) no-repeat center center;
+ border: 1px solid #d0d0d0;
+ background-color: #fdfdfd;
+}
+
+.TableTools_xls {
+ background: url(../images/recordviewericons/xls.png) no-repeat center center;
+ border: 1px solid #f0f0f0;
+}
+
+.TableTools_xls_hover {
+ background: url(../images/recordviewericons/xls_hover.png) no-repeat center center;
+ border: 1px solid #d0d0d0;
+ background-color: #fdfdfd;
+}
+
+.TableTools_clipboard {
+ background: url(../images/recordviewericons/copy.png) no-repeat center center;
+ border: 1px solid #f0f0f0;
+}
+
+.TableTools_clipboard_hover {
+ background: url(../images/recordviewericons/copy_hover.png) no-repeat center center;
+ border: 1px solid #d0d0d0;
+ background-color: #fdfdfd;
+}
+
+.TableTools_print {
+ background: url(../images/recordviewericons/print.png) no-repeat center center;
+ border: 1px solid #f0f0f0;
+}
+
+.TableTools_print_hover {
+ background: url(../images/recordviewericons/print_hover.png) no-repeat center center;
+ border: 1px solid #d0d0d0;
+ background-color: #fdfdfd;
+}
+
+.TableTools_PrintInfo {
+ position: absolute;
+ top: 50%;
+ left: 50%;
+ width: 400px;
+ height: 150px;
+ margin-left: -200px;
+ margin-top: -75px;
+ text-align: center;
+ background-color: #3f3f3f;
+ color: white;
+ padding: 10px 30px;
+
+ opacity: 0.9;
+
+ border-radius: 5px;
+ -moz-border-radius: 5px;
+ -webkit-border-radius: 5px;
+
+ box-shadow: 5px 5px 5px rgba(0, 0, 0, 0.5);
+ -moz-box-shadow: 5px 5px 5px rgba(0, 0, 0, 0.5);
+ -webkit-box-shadow: 5px 5px 5px rgba(0, 0, 0, 0.5);
+}
+
+.TableTools_PrintInfo h6 {
+ font-weight: normal;
+ font-size: 28px;
+ line-height: 28px;
+ margin: 1em;
+}
+
+.TableTools_PrintInfo p {
+ font-size: 14px;
+ line-height: 20px;
+}
diff --git a/src/Umbraco.Web.UI/Umbraco/plugins/umbracoContour/css/datatables.css b/src/Umbraco.Web.UI/Umbraco/plugins/umbracoContour/css/datatables.css
new file mode 100644
index 0000000000..e677c0b6a1
--- /dev/null
+++ b/src/Umbraco.Web.UI/Umbraco/plugins/umbracoContour/css/datatables.css
@@ -0,0 +1,264 @@
+/*
+ * File: demo_table.css
+ * CVS: $Id$
+ * Description: CSS descriptions for DataTables demo pages
+ * Author: Allan Jardine
+ * Created: Tue May 12 06:47:22 BST 2009
+ * Modified: $Date$ by $Author$
+ * Language: CSS
+ * Project: DataTables
+ *
+ * Copyright 2009 Allan Jardine. All Rights Reserved.
+ *
+ * ***************************************************************************
+ * DESCRIPTION
+ *
+ * The styles given here are suitable for the demos that are used with the standard DataTables
+ * distribution (see www.datatables.net). You will most likely wish to modify these styles to
+ * meet the layout requirements of your site.
+ *
+ * Common issues:
+ * 'full_numbers' pagination - I use an extra selector on the body tag to ensure that there is
+ * no conflict between the two pagination types. If you want to use full_numbers pagination
+ * ensure that you either have "example_alt_pagination" as a body class name, or better yet,
+ * modify that selector.
+ * Note that the path used for Images is relative. All images are by default located in
+ * ../images/ - relative to this CSS file.
+ */
+
+/* * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * *
+ * DataTables features
+ */
+
+.dataTables_wrapper {
+ position: relative;
+ min-height: 302px;
+ _height: 302px;
+ clear: both;
+}
+
+.dataTables_processing {
+ position: absolute;
+ top: 0px;
+ left: 50%;
+ width: 250px;
+ margin-left: -125px;
+ border: 1px solid #C6D880;
+ text-align: center;
+ color: #264409;
+ font-size: 11px;
+ padding: 2px 0;
+ background:#E6EFC2;
+ }
+
+.dataTables_length {
+ width: 150px;
+ text-align: right;
+ float: right;
+
+}
+
+.dataTables_filter {
+ width: 200px;
+ float: left;
+ text-align: right;
+ display: none;
+}
+
+.dataTables_info {
+ width: 200px;
+ float: left;
+ padding: 10px;
+}
+
+.dataTables_paginate {
+ width: 60px;
+ * width: 60px;
+ float: right;
+ text-align: right;
+ padding: 10px;
+
+}
+
+
+
+/* Pagination nested */
+.paginate_disabled_previous, .paginate_enabled_previous, .paginate_disabled_next, .paginate_enabled_next {
+ height: 24px;
+ width: 24px;
+ margin-left: 5px;
+ float: left;
+}
+
+.paginate_disabled_previous {
+ background-image: url('../images/back.png');
+ visibility: hidden;
+}
+
+.paginate_enabled_previous {
+ background-image: url('../images/back.png');
+}
+
+.paginate_disabled_next {
+ background-image: url('../images/forward.png');
+ visibility: hidden;
+}
+
+.paginate_enabled_next {
+ background-image: url('../images/forward.png');
+}
+
+
+
+/* * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * *
+ * DataTables display
+ */
+table.display {
+ margin: 0 auto;
+ width: 100%;
+ clear: both;
+ padding: 15px 0px 15px 0px;
+}
+
+table.display thead th {
+ padding: 3px 18px 3px 10px;
+ border-bottom: 1px solid #CAC9C9;
+ font-weight: bold;
+ cursor: pointer;
+ * cursor: hand;
+}
+
+
+table.display tr.heading2 td {
+ border-bottom: 1px solid #aaa;
+}
+
+table.display td {
+ padding: 7px 10px;
+ border-bottom: 1px solid #EEEDF4;
+ }
+
+table.display td.center {
+ text-align: center;
+}
+
+tr.selected, tr.selected td{background: #FBEE99; font-weight: bold;}
+
+tfoot td{border: none !Important;}
+
+/* * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * *
+ * DataTables sorting
+ */
+
+.sorting_asc {
+ background: url('../images/sort_asc.png') no-repeat center right;
+}
+
+.sorting_desc {
+ background: url('../images/sort_dsc.png') no-repeat center right;
+}
+
+.sorting {
+ background: url('../images/sort_both.png') no-repeat center right;
+}
+
+
+
+
+/* * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * *
+ * Misc
+ */
+.top, .bottom {
+ padding: 15px;
+ background-color: #F5F5F5;
+ border: 1px solid #CCCCCC;
+}
+
+.top .dataTables_info {
+ float: none;
+}
+
+.clear {
+ clear: both;
+}
+
+.dataTables_empty {
+ text-align: center;
+}
+
+tfoot input {
+ margin: 0.5em 0;
+ color: #444;
+}
+
+tfoot input.search_init {
+ color: #999;
+}
+
+td.group {
+ background-color: #d1cfd0;
+ border-bottom: 2px solid #A19B9E;
+ border-top: 2px solid #A19B9E;
+}
+
+td.details {
+ background-color: #d1cfd0;
+ border: 2px solid #A19B9E;
+}
+
+
+.example_alt_pagination div.dataTables_info {
+ width: 40%;
+}
+
+.paging_full_numbers {
+ width: 400px;
+ height: 22px;
+ line-height: 22px;
+}
+
+.paging_full_numbers span.paginate_button,
+ .paging_full_numbers span.paginate_active {
+ padding: 2px 5px;
+ margin: 0 3px;
+ cursor: pointer;
+ *cursor: hand;
+ color: blue;
+ text-decoration: underline;
+}
+
+.paging_full_numbers span.paginate_button {
+
+}
+
+.paging_full_numbers span.paginate_button:hover {
+
+}
+
+.paging_full_numbers span.paginate_active {
+ color: Black;
+ text-decoration: none;
+ font-weight: bold;
+}
+
+table.display tr.even.row_selected td {
+ background-color: #B0BED9;
+}
+
+table.display tr.odd.row_selected td {
+ background-color: #9FAFD1;
+}
+
+
+
+
+/*
+ * Row highlighting example
+ */
+.ex_highlight #example tbody tr.even:hover, #example tbody tr.even td.highlighted {
+ background-color: #ECFFB3;
+}
+
+.ex_highlight #example tbody tr.odd:hover, #example tbody tr.odd td.highlighted {
+ background-color: #E6FF99;
+}
diff --git a/src/Umbraco.Web.UI/Umbraco/plugins/umbracoContour/css/dd.css b/src/Umbraco.Web.UI/Umbraco/plugins/umbracoContour/css/dd.css
new file mode 100644
index 0000000000..ebe7cfd16a
--- /dev/null
+++ b/src/Umbraco.Web.UI/Umbraco/plugins/umbracoContour/css/dd.css
@@ -0,0 +1,62 @@
+.dd {
+ /*display:inline-block !important;*/
+ text-align:left;
+ background-color:#fff;
+ font-family:Arial, Helvetica, sans-serif;
+ font-size:12px;
+ float:left;
+}
+.dd .ddTitle {
+ background:#f2f2f2;
+ border:1px solid #c3c3c3;
+ padding:3px;
+ text-indent:0;
+ cursor:default;
+ overflow:hidden;
+ height:16px;
+}
+.dd .ddTitle span.arrow {
+ background:url(dd_arrow.gif) no-repeat 0 0; float:right; display:inline-block;width:16px; height:16px; cursor:pointer;
+}
+
+.dd .ddTitle span.textTitle {text-indent:1px; overflow:hidden; line-height:16px;}
+.dd .ddTitle span.textTitle img{text-align:left; padding:0 2px 0 0}
+.dd .ddTitle img.selected {
+ padding:0 3px 0 0;
+ vertical-align:top;
+}
+.dd .ddChild {
+ position:absolute;
+ border:1px solid #c3c3c3;
+ border-top:none;
+ display:none;
+ margin:0;
+ width:auto;
+ overflow:auto;
+ overflow-x:hidden !important;
+ background-color:#ffffff;
+}
+.dd .ddChild .opta a, .dd .ddChild .opta a:visited {padding-left:10px}
+.dd .ddChild a {
+ display:block;
+ padding:3px 0 3px 3px;
+ text-decoration:none;
+ color:#000;
+ overflow:hidden;
+ white-space:nowrap;
+ cursor:pointer;
+}
+.dd .ddChild a:hover {
+ background:#66CCFF;
+}
+.dd .ddChild a img {
+ border:0;
+ padding:0 2px 0 0;
+ vertical-align:middle;
+}
+.dd .ddChild a.selected {
+ background:#66CCFF;
+
+}
+.hidden {display:none;}
+s
\ No newline at end of file
diff --git a/src/Umbraco.Web.UI/Umbraco/plugins/umbracoContour/css/dd_arrow.gif b/src/Umbraco.Web.UI/Umbraco/plugins/umbracoContour/css/dd_arrow.gif
new file mode 100644
index 0000000000..5b29df710b
Binary files /dev/null and b/src/Umbraco.Web.UI/Umbraco/plugins/umbracoContour/css/dd_arrow.gif differ
diff --git a/src/Umbraco.Web.UI/Umbraco/plugins/umbracoContour/css/defaultform.css b/src/Umbraco.Web.UI/Umbraco/plugins/umbracoContour/css/defaultform.css
new file mode 100644
index 0000000000..89659d765e
--- /dev/null
+++ b/src/Umbraco.Web.UI/Umbraco/plugins/umbracoContour/css/defaultform.css
@@ -0,0 +1,130 @@
+
+#contour
+{
+ padding: 10px 0px 10px 0px;
+}
+#contour .contourPageName
+{
+ font-size: 2em !important;
+ line-height: 2em !important;
+}
+
+#contour .contourField {
+ clear: both;
+}
+#contour .contourField div label
+{
+ display: inline;
+}
+
+#contour label.fieldLabel
+{
+ font-weight: bold;
+ display: block;
+ width: 200px;
+ float: left;
+ clear: left;
+ background: transparent !important;
+}
+#contour small
+{
+ display: block;
+ float: left;
+ clear: both;
+ padding: 5px 5px 5px 200px;
+}
+
+
+#contour fieldset
+{
+ padding: 1.4em;
+ margin: 0 0 1.5em 0;
+ border: none !Important;
+}
+
+#contour legend
+{
+ font-weight: bold;
+ font-size: 1.2em;
+ line-height: 1.2em;
+ display: block;
+}
+
+#contour input.text, #contour input.title, #contour textarea, #contour select
+{
+ margin: 0.5em 0;
+ border: 1px solid #bbb;
+}
+#contour input.text:focus, #contour input.title:focus, #contour textarea:focus, #contour select:focus
+{
+ border: 1px solid #666;
+}
+#contour input.text, #contour textarea
+{
+ width: 300px !important;
+ padding: 5px;
+}
+#contour textarea
+{
+ height: 250px;
+}
+#contour input.fileupload
+{
+ height: auto !important;
+}
+
+#contour span.checkboxlist, #contour span.radiobuttonlist, #contour span.checkbox
+{
+ display: block;
+ float: left;
+ padding: 10px;
+}
+
+#contour .checkboxlist input, #contour .radiobuttonlist input, #contour .checkbox input
+{
+ width: auto !important;
+ height: auto !important;
+ border: none !important;
+ display: inline !important;
+}
+
+#contour .hiddenfield
+{
+ display:none;
+}
+
+#contour .contourButton
+{
+ margin-right: 10px;
+ padding: 2px 10px;
+}
+#contour .contourErrorMessage
+{
+ padding: .8em;
+ margin-bottom: .5em;
+ border: 2px solid #FBC2C4;
+}
+#contour .contourErrorMessage, #contour .contourError
+{
+ background: #FBE3E4;
+ color: #8a1f11;
+}
+#contour input.contourError, #contour textarea.contourError, #contour input.input-validation-error, #contour textarea.input-validation-error
+{
+ background: #FBE3E4;
+ border-color: #FBC2C4;
+}
+
+#contour span.contourError, #contour span.field-validation-error
+{
+ color: #8a1f11 !important;
+ background: transparent !important;
+}
+
+#contour #recaptcha_widget_div {
+ margin-left: 200px;
+}
+
+#contour .field-validation-error {
+ padding-left: 5px;
+}
\ No newline at end of file
diff --git a/src/Umbraco.Web.UI/Umbraco/plugins/umbracoContour/css/dialogs.css b/src/Umbraco.Web.UI/Umbraco/plugins/umbracoContour/css/dialogs.css
new file mode 100644
index 0000000000..87485195ce
--- /dev/null
+++ b/src/Umbraco.Web.UI/Umbraco/plugins/umbracoContour/css/dialogs.css
@@ -0,0 +1,95 @@
+body {
+ font-family: Trebuchet MS, Lucida Grande, verdana, arial;
+ font-size: 12px;
+ font-weight: normal;
+ background-color: #fff}
+
+h1
+{
+ color:#999999;
+ font-size:14px;
+ line-height:14px;
+ margin:7px 0 0;
+}
+
+.propertypane {
+ background:#FFFFFF url(/umbraco_client/propertypane/images/propertyBackground.gif) repeat-x scroll center top;
+ border:1px solid #D9D7D7;
+ clear:both;
+ display:block;
+ float:none;
+ line-height:1.1;
+ margin:7px 0 0;
+ padding:5px;
+ position:relative;
+ text-align:left;
+}
+div.propertyPaneFooter {
+ clear:both;
+ color:#FFFFFF;
+ height:1px;
+ overflow:hidden;
+}
+div.propertyItem {
+ clear:both;
+ font-family:Trebuchet MS,Lucida Grande,verdana,arial;
+ font-size:12px;
+ padding-bottom:5px;
+}
+div.propertyItem .propertyItemheader {
+ clear:left;
+ float:left;
+ font-weight:bold;
+ padding-bottom:10px;
+ padding-right:1%;
+ width:16%;
+}
+
+div.propertyItem .propertyItemContent {
+ clear:right;
+ float:left;
+ padding-bottom:5px;
+}
+
+.guiInputStandardSize,
+.propertyFormInput {
+ width:300px;
+ z-index:9999;
+}
+input, select {
+ color:#333333;
+ font-family:Trebuchet MS,Lucida Grande,verdana,arial;
+ font-size:11px;
+ padding: 2px;
+}
+
+small {
+ color:#666666;
+ font-weight:normal;
+}
+
+.dialogcontrols
+{
+ padding-top: 5px;
+ clear:both;
+}
+
+#dialogcontainer
+{
+ overflow:auto;
+}
+
+#fieldMapper{}
+#fieldMapper .mapping{border-bottom: 1px dotted #efefef; padding: 5px 0px 5px 0px;}
+#fieldMapper .mapping div{width: 150px; padding-right: 10px; float: left;}
+#fieldMapper .mapping label{display: block; font-size: 10px;}
+#fieldMapper .mapping a{display: block; color: red; text-decoration: none; float: right; margin-top: 10px; font-size: 12px;}
+
+
+ .docMapper{margin: 10px 0px 10px 20px; border-left: 1px dotted #ccc; padding-left: 10px;}
+
+ .docmapping{border-bottom: 1px dotted #efefef; padding: 5px 0px 5px 0px;}
+ .docmapping label{display: block; font-size: 11px; clear: right; float: left; width: 120px;}
+ .docmapping input ,.docmapping select {width: 200px !Important;}
+
+ .addmapping{margin-bottom:0px;}
\ No newline at end of file
diff --git a/src/Umbraco.Web.UI/Umbraco/plugins/umbracoContour/css/img/add.png b/src/Umbraco.Web.UI/Umbraco/plugins/umbracoContour/css/img/add.png
new file mode 100644
index 0000000000..b0518a0ce8
Binary files /dev/null and b/src/Umbraco.Web.UI/Umbraco/plugins/umbracoContour/css/img/add.png differ
diff --git a/src/Umbraco.Web.UI/Umbraco/plugins/umbracoContour/css/img/add_grey.png b/src/Umbraco.Web.UI/Umbraco/plugins/umbracoContour/css/img/add_grey.png
new file mode 100644
index 0000000000..227426e8a9
Binary files /dev/null and b/src/Umbraco.Web.UI/Umbraco/plugins/umbracoContour/css/img/add_grey.png differ
diff --git a/src/Umbraco.Web.UI/Umbraco/plugins/umbracoContour/css/img/add_small.png b/src/Umbraco.Web.UI/Umbraco/plugins/umbracoContour/css/img/add_small.png
new file mode 100644
index 0000000000..d0a48983e2
Binary files /dev/null and b/src/Umbraco.Web.UI/Umbraco/plugins/umbracoContour/css/img/add_small.png differ
diff --git a/src/Umbraco.Web.UI/Umbraco/plugins/umbracoContour/css/img/bullet_arrow_down.png b/src/Umbraco.Web.UI/Umbraco/plugins/umbracoContour/css/img/bullet_arrow_down.png
new file mode 100644
index 0000000000..9b23c06d7b
Binary files /dev/null and b/src/Umbraco.Web.UI/Umbraco/plugins/umbracoContour/css/img/bullet_arrow_down.png differ
diff --git a/src/Umbraco.Web.UI/Umbraco/plugins/umbracoContour/css/img/bullet_arrow_up.png b/src/Umbraco.Web.UI/Umbraco/plugins/umbracoContour/css/img/bullet_arrow_up.png
new file mode 100644
index 0000000000..24df0f4212
Binary files /dev/null and b/src/Umbraco.Web.UI/Umbraco/plugins/umbracoContour/css/img/bullet_arrow_up.png differ
diff --git a/src/Umbraco.Web.UI/Umbraco/plugins/umbracoContour/css/img/contextMenuBg.gif b/src/Umbraco.Web.UI/Umbraco/plugins/umbracoContour/css/img/contextMenuBg.gif
new file mode 100644
index 0000000000..28ca91665d
Binary files /dev/null and b/src/Umbraco.Web.UI/Umbraco/plugins/umbracoContour/css/img/contextMenuBg.gif differ
diff --git a/src/Umbraco.Web.UI/Umbraco/plugins/umbracoContour/css/img/copy_small.png b/src/Umbraco.Web.UI/Umbraco/plugins/umbracoContour/css/img/copy_small.png
new file mode 100644
index 0000000000..585579aef0
Binary files /dev/null and b/src/Umbraco.Web.UI/Umbraco/plugins/umbracoContour/css/img/copy_small.png differ
diff --git a/src/Umbraco.Web.UI/Umbraco/plugins/umbracoContour/css/img/datasource_small.png b/src/Umbraco.Web.UI/Umbraco/plugins/umbracoContour/css/img/datasource_small.png
new file mode 100644
index 0000000000..50a49cf577
Binary files /dev/null and b/src/Umbraco.Web.UI/Umbraco/plugins/umbracoContour/css/img/datasource_small.png differ
diff --git a/src/Umbraco.Web.UI/Umbraco/plugins/umbracoContour/css/img/delete.png b/src/Umbraco.Web.UI/Umbraco/plugins/umbracoContour/css/img/delete.png
new file mode 100644
index 0000000000..7e781fd89e
Binary files /dev/null and b/src/Umbraco.Web.UI/Umbraco/plugins/umbracoContour/css/img/delete.png differ
diff --git a/src/Umbraco.Web.UI/Umbraco/plugins/umbracoContour/css/img/delete_small.png b/src/Umbraco.Web.UI/Umbraco/plugins/umbracoContour/css/img/delete_small.png
new file mode 100644
index 0000000000..2904b00e45
Binary files /dev/null and b/src/Umbraco.Web.UI/Umbraco/plugins/umbracoContour/css/img/delete_small.png differ
diff --git a/src/Umbraco.Web.UI/Umbraco/plugins/umbracoContour/css/img/edit.png b/src/Umbraco.Web.UI/Umbraco/plugins/umbracoContour/css/img/edit.png
new file mode 100644
index 0000000000..c530f88aa9
Binary files /dev/null and b/src/Umbraco.Web.UI/Umbraco/plugins/umbracoContour/css/img/edit.png differ
diff --git a/src/Umbraco.Web.UI/Umbraco/plugins/umbracoContour/css/img/edit_small.png b/src/Umbraco.Web.UI/Umbraco/plugins/umbracoContour/css/img/edit_small.png
new file mode 100644
index 0000000000..9e2d357b25
Binary files /dev/null and b/src/Umbraco.Web.UI/Umbraco/plugins/umbracoContour/css/img/edit_small.png differ
diff --git a/src/Umbraco.Web.UI/Umbraco/plugins/umbracoContour/css/img/entries.png b/src/Umbraco.Web.UI/Umbraco/plugins/umbracoContour/css/img/entries.png
new file mode 100644
index 0000000000..b9816b48eb
Binary files /dev/null and b/src/Umbraco.Web.UI/Umbraco/plugins/umbracoContour/css/img/entries.png differ
diff --git a/src/Umbraco.Web.UI/Umbraco/plugins/umbracoContour/css/img/options.png b/src/Umbraco.Web.UI/Umbraco/plugins/umbracoContour/css/img/options.png
new file mode 100644
index 0000000000..9cd39dadd8
Binary files /dev/null and b/src/Umbraco.Web.UI/Umbraco/plugins/umbracoContour/css/img/options.png differ
diff --git a/src/Umbraco.Web.UI/Umbraco/plugins/umbracoContour/css/img/remove_gray.png b/src/Umbraco.Web.UI/Umbraco/plugins/umbracoContour/css/img/remove_gray.png
new file mode 100644
index 0000000000..bfd82cc103
Binary files /dev/null and b/src/Umbraco.Web.UI/Umbraco/plugins/umbracoContour/css/img/remove_gray.png differ
diff --git a/src/Umbraco.Web.UI/Umbraco/plugins/umbracoContour/css/img/ui-bg_flat_0_aaaaaa_40x100.png b/src/Umbraco.Web.UI/Umbraco/plugins/umbracoContour/css/img/ui-bg_flat_0_aaaaaa_40x100.png
new file mode 100644
index 0000000000..5b5dab2ab7
Binary files /dev/null and b/src/Umbraco.Web.UI/Umbraco/plugins/umbracoContour/css/img/ui-bg_flat_0_aaaaaa_40x100.png differ
diff --git a/src/Umbraco.Web.UI/Umbraco/plugins/umbracoContour/css/img/ui-bg_flat_75_ffffff_40x100.png b/src/Umbraco.Web.UI/Umbraco/plugins/umbracoContour/css/img/ui-bg_flat_75_ffffff_40x100.png
new file mode 100644
index 0000000000..ac8b229af9
Binary files /dev/null and b/src/Umbraco.Web.UI/Umbraco/plugins/umbracoContour/css/img/ui-bg_flat_75_ffffff_40x100.png differ
diff --git a/src/Umbraco.Web.UI/Umbraco/plugins/umbracoContour/css/img/ui-bg_glass_55_fbf9ee_1x400.png b/src/Umbraco.Web.UI/Umbraco/plugins/umbracoContour/css/img/ui-bg_glass_55_fbf9ee_1x400.png
new file mode 100644
index 0000000000..ad3d6346e0
Binary files /dev/null and b/src/Umbraco.Web.UI/Umbraco/plugins/umbracoContour/css/img/ui-bg_glass_55_fbf9ee_1x400.png differ
diff --git a/src/Umbraco.Web.UI/Umbraco/plugins/umbracoContour/css/img/ui-bg_glass_65_ffffff_1x400.png b/src/Umbraco.Web.UI/Umbraco/plugins/umbracoContour/css/img/ui-bg_glass_65_ffffff_1x400.png
new file mode 100644
index 0000000000..42ccba269b
Binary files /dev/null and b/src/Umbraco.Web.UI/Umbraco/plugins/umbracoContour/css/img/ui-bg_glass_65_ffffff_1x400.png differ
diff --git a/src/Umbraco.Web.UI/Umbraco/plugins/umbracoContour/css/img/ui-bg_glass_75_dadada_1x400.png b/src/Umbraco.Web.UI/Umbraco/plugins/umbracoContour/css/img/ui-bg_glass_75_dadada_1x400.png
new file mode 100644
index 0000000000..5a46b47cb1
Binary files /dev/null and b/src/Umbraco.Web.UI/Umbraco/plugins/umbracoContour/css/img/ui-bg_glass_75_dadada_1x400.png differ
diff --git a/src/Umbraco.Web.UI/Umbraco/plugins/umbracoContour/css/img/ui-bg_glass_75_e6e6e6_1x400.png b/src/Umbraco.Web.UI/Umbraco/plugins/umbracoContour/css/img/ui-bg_glass_75_e6e6e6_1x400.png
new file mode 100644
index 0000000000..86c2baa655
Binary files /dev/null and b/src/Umbraco.Web.UI/Umbraco/plugins/umbracoContour/css/img/ui-bg_glass_75_e6e6e6_1x400.png differ
diff --git a/src/Umbraco.Web.UI/Umbraco/plugins/umbracoContour/css/img/ui-bg_glass_95_fef1ec_1x400.png b/src/Umbraco.Web.UI/Umbraco/plugins/umbracoContour/css/img/ui-bg_glass_95_fef1ec_1x400.png
new file mode 100644
index 0000000000..4443fdc1a1
Binary files /dev/null and b/src/Umbraco.Web.UI/Umbraco/plugins/umbracoContour/css/img/ui-bg_glass_95_fef1ec_1x400.png differ
diff --git a/src/Umbraco.Web.UI/Umbraco/plugins/umbracoContour/css/img/ui-bg_highlight-soft_75_cccccc_1x100.png b/src/Umbraco.Web.UI/Umbraco/plugins/umbracoContour/css/img/ui-bg_highlight-soft_75_cccccc_1x100.png
new file mode 100644
index 0000000000..7c9fa6c6ed
Binary files /dev/null and b/src/Umbraco.Web.UI/Umbraco/plugins/umbracoContour/css/img/ui-bg_highlight-soft_75_cccccc_1x100.png differ
diff --git a/src/Umbraco.Web.UI/Umbraco/plugins/umbracoContour/css/img/ui-icons_222222_256x240.png b/src/Umbraco.Web.UI/Umbraco/plugins/umbracoContour/css/img/ui-icons_222222_256x240.png
new file mode 100644
index 0000000000..b273ff111d
Binary files /dev/null and b/src/Umbraco.Web.UI/Umbraco/plugins/umbracoContour/css/img/ui-icons_222222_256x240.png differ
diff --git a/src/Umbraco.Web.UI/Umbraco/plugins/umbracoContour/css/img/ui-icons_2e83ff_256x240.png b/src/Umbraco.Web.UI/Umbraco/plugins/umbracoContour/css/img/ui-icons_2e83ff_256x240.png
new file mode 100644
index 0000000000..09d1cdc856
Binary files /dev/null and b/src/Umbraco.Web.UI/Umbraco/plugins/umbracoContour/css/img/ui-icons_2e83ff_256x240.png differ
diff --git a/src/Umbraco.Web.UI/Umbraco/plugins/umbracoContour/css/img/ui-icons_454545_256x240.png b/src/Umbraco.Web.UI/Umbraco/plugins/umbracoContour/css/img/ui-icons_454545_256x240.png
new file mode 100644
index 0000000000..59bd45b907
Binary files /dev/null and b/src/Umbraco.Web.UI/Umbraco/plugins/umbracoContour/css/img/ui-icons_454545_256x240.png differ
diff --git a/src/Umbraco.Web.UI/Umbraco/plugins/umbracoContour/css/img/ui-icons_888888_256x240.png b/src/Umbraco.Web.UI/Umbraco/plugins/umbracoContour/css/img/ui-icons_888888_256x240.png
new file mode 100644
index 0000000000..6d02426c11
Binary files /dev/null and b/src/Umbraco.Web.UI/Umbraco/plugins/umbracoContour/css/img/ui-icons_888888_256x240.png differ
diff --git a/src/Umbraco.Web.UI/Umbraco/plugins/umbracoContour/css/img/ui-icons_cd0a0a_256x240.png b/src/Umbraco.Web.UI/Umbraco/plugins/umbracoContour/css/img/ui-icons_cd0a0a_256x240.png
new file mode 100644
index 0000000000..2ab019b73e
Binary files /dev/null and b/src/Umbraco.Web.UI/Umbraco/plugins/umbracoContour/css/img/ui-icons_cd0a0a_256x240.png differ
diff --git a/src/Umbraco.Web.UI/Umbraco/plugins/umbracoContour/css/img/workflow.png b/src/Umbraco.Web.UI/Umbraco/plugins/umbracoContour/css/img/workflow.png
new file mode 100644
index 0000000000..73f79fb563
Binary files /dev/null and b/src/Umbraco.Web.UI/Umbraco/plugins/umbracoContour/css/img/workflow.png differ
diff --git a/src/Umbraco.Web.UI/Umbraco/plugins/umbracoContour/css/img/x.png b/src/Umbraco.Web.UI/Umbraco/plugins/umbracoContour/css/img/x.png
new file mode 100644
index 0000000000..c11f7af69f
Binary files /dev/null and b/src/Umbraco.Web.UI/Umbraco/plugins/umbracoContour/css/img/x.png differ
diff --git a/src/Umbraco.Web.UI/Umbraco/plugins/umbracoContour/css/jquery-ui-1.8.18.custom.css b/src/Umbraco.Web.UI/Umbraco/plugins/umbracoContour/css/jquery-ui-1.8.18.custom.css
new file mode 100644
index 0000000000..385d6591fd
--- /dev/null
+++ b/src/Umbraco.Web.UI/Umbraco/plugins/umbracoContour/css/jquery-ui-1.8.18.custom.css
@@ -0,0 +1,354 @@
+/*
+ * jQuery UI CSS Framework 1.8.18
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Theming/API
+ */
+
+/* Layout helpers
+----------------------------------*/
+.ui-helper-hidden { display: none; }
+.ui-helper-hidden-accessible { position: absolute !important; clip: rect(1px 1px 1px 1px); clip: rect(1px,1px,1px,1px); }
+.ui-helper-reset { margin: 0; padding: 0; border: 0; outline: 0; line-height: 1.3; text-decoration: none; font-size: 100%; list-style: none; }
+.ui-helper-clearfix:before, .ui-helper-clearfix:after { content: ""; display: table; }
+.ui-helper-clearfix:after { clear: both; }
+.ui-helper-clearfix { zoom: 1; }
+.ui-helper-zfix { width: 100%; height: 100%; top: 0; left: 0; position: absolute; opacity: 0; filter:Alpha(Opacity=0); }
+
+
+/* Interaction Cues
+----------------------------------*/
+.ui-state-disabled { cursor: default !important; }
+
+
+/* Icons
+----------------------------------*/
+
+/* states and images */
+.ui-icon { display: block; text-indent: -99999px; overflow: hidden; background-repeat: no-repeat; }
+
+
+/* Misc visuals
+----------------------------------*/
+
+/* Overlays */
+.ui-widget-overlay { position: absolute; top: 0; left: 0; width: 100%; height: 100%; }
+
+
+/*
+ * jQuery UI CSS Framework 1.8.18
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Theming/API
+ *
+ * To view and modify this theme, visit http://jqueryui.com/themeroller/?ffDefault=Verdana,Arial,sans-serif&fwDefault=normal&fsDefault=1.1em&cornerRadius=4px&bgColorHeader=cccccc&bgTextureHeader=03_highlight_soft.png&bgImgOpacityHeader=75&borderColorHeader=aaaaaa&fcHeader=222222&iconColorHeader=222222&bgColorContent=ffffff&bgTextureContent=01_flat.png&bgImgOpacityContent=75&borderColorContent=aaaaaa&fcContent=222222&iconColorContent=222222&bgColorDefault=e6e6e6&bgTextureDefault=02_glass.png&bgImgOpacityDefault=75&borderColorDefault=d3d3d3&fcDefault=555555&iconColorDefault=888888&bgColorHover=dadada&bgTextureHover=02_glass.png&bgImgOpacityHover=75&borderColorHover=999999&fcHover=212121&iconColorHover=454545&bgColorActive=ffffff&bgTextureActive=02_glass.png&bgImgOpacityActive=65&borderColorActive=aaaaaa&fcActive=212121&iconColorActive=454545&bgColorHighlight=fbf9ee&bgTextureHighlight=02_glass.png&bgImgOpacityHighlight=55&borderColorHighlight=fcefa1&fcHighlight=363636&iconColorHighlight=2e83ff&bgColorError=fef1ec&bgTextureError=02_glass.png&bgImgOpacityError=95&borderColorError=cd0a0a&fcError=cd0a0a&iconColorError=cd0a0a&bgColorOverlay=aaaaaa&bgTextureOverlay=01_flat.png&bgImgOpacityOverlay=0&opacityOverlay=30&bgColorShadow=aaaaaa&bgTextureShadow=01_flat.png&bgImgOpacityShadow=0&opacityShadow=30&thicknessShadow=8px&offsetTopShadow=-8px&offsetLeftShadow=-8px&cornerRadiusShadow=8px
+ */
+
+
+/* Component containers
+----------------------------------*/
+.ui-widget { font-family: Verdana,Arial,sans-serif; font-size: 1.1em; }
+.ui-widget .ui-widget { font-size: 1em; }
+.ui-widget input, .ui-widget select, .ui-widget textarea, .ui-widget button { font-family: Verdana,Arial,sans-serif; font-size: 1em; }
+.ui-widget-content { border: 1px solid #aaaaaa; background: #ffffff url(img/ui-bg_flat_75_ffffff_40x100.png) 50% 50% repeat-x; color: #222222; }
+.ui-widget-content a { color: #222222; }
+.ui-widget-header { border: 1px solid #aaaaaa; background: #cccccc url(img/ui-bg_highlight-soft_75_cccccc_1x100.png) 50% 50% repeat-x; color: #222222; font-weight: bold; }
+.ui-widget-header a { color: #222222; }
+
+/* Interaction states
+----------------------------------*/
+.ui-state-default, .ui-widget-content .ui-state-default, .ui-widget-header .ui-state-default { border: 1px solid #d3d3d3; background: #e6e6e6 url(img/ui-bg_glass_75_e6e6e6_1x400.png) 50% 50% repeat-x; font-weight: normal; color: #555555; }
+.ui-state-default a, .ui-state-default a:link, .ui-state-default a:visited { color: #555555; text-decoration: none; }
+.ui-state-hover, .ui-widget-content .ui-state-hover, .ui-widget-header .ui-state-hover, .ui-state-focus, .ui-widget-content .ui-state-focus, .ui-widget-header .ui-state-focus { border: 1px solid #999999; background: #dadada url(img/ui-bg_glass_75_dadada_1x400.png) 50% 50% repeat-x; font-weight: normal; color: #212121; }
+.ui-state-hover a, .ui-state-hover a:hover { color: #212121; text-decoration: none; }
+.ui-state-active, .ui-widget-content .ui-state-active, .ui-widget-header .ui-state-active { border: 1px solid #aaaaaa; background: #ffffff url(img/ui-bg_glass_65_ffffff_1x400.png) 50% 50% repeat-x; font-weight: normal; color: #212121; }
+.ui-state-active a, .ui-state-active a:link, .ui-state-active a:visited { color: #212121; text-decoration: none; }
+.ui-widget :active { outline: none; }
+
+/* Interaction Cues
+----------------------------------*/
+.ui-state-highlight, .ui-widget-content .ui-state-highlight, .ui-widget-header .ui-state-highlight {border: 1px solid #fcefa1; background: #fbf9ee url(img/ui-bg_glass_55_fbf9ee_1x400.png) 50% 50% repeat-x; color: #363636; }
+.ui-state-highlight a, .ui-widget-content .ui-state-highlight a,.ui-widget-header .ui-state-highlight a { color: #363636; }
+.ui-state-error, .ui-widget-content .ui-state-error, .ui-widget-header .ui-state-error {border: 1px solid #cd0a0a; background: #fef1ec url(img/ui-bg_glass_95_fef1ec_1x400.png) 50% 50% repeat-x; color: #cd0a0a; }
+.ui-state-error a, .ui-widget-content .ui-state-error a, .ui-widget-header .ui-state-error a { color: #cd0a0a; }
+.ui-state-error-text, .ui-widget-content .ui-state-error-text, .ui-widget-header .ui-state-error-text { color: #cd0a0a; }
+.ui-priority-primary, .ui-widget-content .ui-priority-primary, .ui-widget-header .ui-priority-primary { font-weight: bold; }
+.ui-priority-secondary, .ui-widget-content .ui-priority-secondary, .ui-widget-header .ui-priority-secondary { opacity: .7; filter:Alpha(Opacity=70); font-weight: normal; }
+.ui-state-disabled, .ui-widget-content .ui-state-disabled, .ui-widget-header .ui-state-disabled { opacity: .35; filter:Alpha(Opacity=35); background-image: none; }
+
+/* Icons
+----------------------------------*/
+
+/* states and images */
+.ui-icon { width: 16px; height: 16px; background-image: url(img/ui-icons_222222_256x240.png); }
+.ui-widget-content .ui-icon {background-image: url(img/ui-icons_222222_256x240.png); }
+.ui-widget-header .ui-icon {background-image: url(img/ui-icons_222222_256x240.png); }
+.ui-state-default .ui-icon { background-image: url(img/ui-icons_888888_256x240.png); }
+.ui-state-hover .ui-icon, .ui-state-focus .ui-icon {background-image: url(img/ui-icons_454545_256x240.png); }
+.ui-state-active .ui-icon {background-image: url(img/ui-icons_454545_256x240.png); }
+.ui-state-highlight .ui-icon {background-image: url(img/ui-icons_2e83ff_256x240.png); }
+.ui-state-error .ui-icon, .ui-state-error-text .ui-icon {background-image: url(img/ui-icons_cd0a0a_256x240.png); }
+
+/* positioning */
+.ui-icon-carat-1-n { background-position: 0 0; }
+.ui-icon-carat-1-ne { background-position: -16px 0; }
+.ui-icon-carat-1-e { background-position: -32px 0; }
+.ui-icon-carat-1-se { background-position: -48px 0; }
+.ui-icon-carat-1-s { background-position: -64px 0; }
+.ui-icon-carat-1-sw { background-position: -80px 0; }
+.ui-icon-carat-1-w { background-position: -96px 0; }
+.ui-icon-carat-1-nw { background-position: -112px 0; }
+.ui-icon-carat-2-n-s { background-position: -128px 0; }
+.ui-icon-carat-2-e-w { background-position: -144px 0; }
+.ui-icon-triangle-1-n { background-position: 0 -16px; }
+.ui-icon-triangle-1-ne { background-position: -16px -16px; }
+.ui-icon-triangle-1-e { background-position: -32px -16px; }
+.ui-icon-triangle-1-se { background-position: -48px -16px; }
+.ui-icon-triangle-1-s { background-position: -64px -16px; }
+.ui-icon-triangle-1-sw { background-position: -80px -16px; }
+.ui-icon-triangle-1-w { background-position: -96px -16px; }
+.ui-icon-triangle-1-nw { background-position: -112px -16px; }
+.ui-icon-triangle-2-n-s { background-position: -128px -16px; }
+.ui-icon-triangle-2-e-w { background-position: -144px -16px; }
+.ui-icon-arrow-1-n { background-position: 0 -32px; }
+.ui-icon-arrow-1-ne { background-position: -16px -32px; }
+.ui-icon-arrow-1-e { background-position: -32px -32px; }
+.ui-icon-arrow-1-se { background-position: -48px -32px; }
+.ui-icon-arrow-1-s { background-position: -64px -32px; }
+.ui-icon-arrow-1-sw { background-position: -80px -32px; }
+.ui-icon-arrow-1-w { background-position: -96px -32px; }
+.ui-icon-arrow-1-nw { background-position: -112px -32px; }
+.ui-icon-arrow-2-n-s { background-position: -128px -32px; }
+.ui-icon-arrow-2-ne-sw { background-position: -144px -32px; }
+.ui-icon-arrow-2-e-w { background-position: -160px -32px; }
+.ui-icon-arrow-2-se-nw { background-position: -176px -32px; }
+.ui-icon-arrowstop-1-n { background-position: -192px -32px; }
+.ui-icon-arrowstop-1-e { background-position: -208px -32px; }
+.ui-icon-arrowstop-1-s { background-position: -224px -32px; }
+.ui-icon-arrowstop-1-w { background-position: -240px -32px; }
+.ui-icon-arrowthick-1-n { background-position: 0 -48px; }
+.ui-icon-arrowthick-1-ne { background-position: -16px -48px; }
+.ui-icon-arrowthick-1-e { background-position: -32px -48px; }
+.ui-icon-arrowthick-1-se { background-position: -48px -48px; }
+.ui-icon-arrowthick-1-s { background-position: -64px -48px; }
+.ui-icon-arrowthick-1-sw { background-position: -80px -48px; }
+.ui-icon-arrowthick-1-w { background-position: -96px -48px; }
+.ui-icon-arrowthick-1-nw { background-position: -112px -48px; }
+.ui-icon-arrowthick-2-n-s { background-position: -128px -48px; }
+.ui-icon-arrowthick-2-ne-sw { background-position: -144px -48px; }
+.ui-icon-arrowthick-2-e-w { background-position: -160px -48px; }
+.ui-icon-arrowthick-2-se-nw { background-position: -176px -48px; }
+.ui-icon-arrowthickstop-1-n { background-position: -192px -48px; }
+.ui-icon-arrowthickstop-1-e { background-position: -208px -48px; }
+.ui-icon-arrowthickstop-1-s { background-position: -224px -48px; }
+.ui-icon-arrowthickstop-1-w { background-position: -240px -48px; }
+.ui-icon-arrowreturnthick-1-w { background-position: 0 -64px; }
+.ui-icon-arrowreturnthick-1-n { background-position: -16px -64px; }
+.ui-icon-arrowreturnthick-1-e { background-position: -32px -64px; }
+.ui-icon-arrowreturnthick-1-s { background-position: -48px -64px; }
+.ui-icon-arrowreturn-1-w { background-position: -64px -64px; }
+.ui-icon-arrowreturn-1-n { background-position: -80px -64px; }
+.ui-icon-arrowreturn-1-e { background-position: -96px -64px; }
+.ui-icon-arrowreturn-1-s { background-position: -112px -64px; }
+.ui-icon-arrowrefresh-1-w { background-position: -128px -64px; }
+.ui-icon-arrowrefresh-1-n { background-position: -144px -64px; }
+.ui-icon-arrowrefresh-1-e { background-position: -160px -64px; }
+.ui-icon-arrowrefresh-1-s { background-position: -176px -64px; }
+.ui-icon-arrow-4 { background-position: 0 -80px; }
+.ui-icon-arrow-4-diag { background-position: -16px -80px; }
+.ui-icon-extlink { background-position: -32px -80px; }
+.ui-icon-newwin { background-position: -48px -80px; }
+.ui-icon-refresh { background-position: -64px -80px; }
+.ui-icon-shuffle { background-position: -80px -80px; }
+.ui-icon-transfer-e-w { background-position: -96px -80px; }
+.ui-icon-transferthick-e-w { background-position: -112px -80px; }
+.ui-icon-folder-collapsed { background-position: 0 -96px; }
+.ui-icon-folder-open { background-position: -16px -96px; }
+.ui-icon-document { background-position: -32px -96px; }
+.ui-icon-document-b { background-position: -48px -96px; }
+.ui-icon-note { background-position: -64px -96px; }
+.ui-icon-mail-closed { background-position: -80px -96px; }
+.ui-icon-mail-open { background-position: -96px -96px; }
+.ui-icon-suitcase { background-position: -112px -96px; }
+.ui-icon-comment { background-position: -128px -96px; }
+.ui-icon-person { background-position: -144px -96px; }
+.ui-icon-print { background-position: -160px -96px; }
+.ui-icon-trash { background-position: -176px -96px; }
+.ui-icon-locked { background-position: -192px -96px; }
+.ui-icon-unlocked { background-position: -208px -96px; }
+.ui-icon-bookmark { background-position: -224px -96px; }
+.ui-icon-tag { background-position: -240px -96px; }
+.ui-icon-home { background-position: 0 -112px; }
+.ui-icon-flag { background-position: -16px -112px; }
+.ui-icon-calendar { background-position: -32px -112px; }
+.ui-icon-cart { background-position: -48px -112px; }
+.ui-icon-pencil { background-position: -64px -112px; }
+.ui-icon-clock { background-position: -80px -112px; }
+.ui-icon-disk { background-position: -96px -112px; }
+.ui-icon-calculator { background-position: -112px -112px; }
+.ui-icon-zoomin { background-position: -128px -112px; }
+.ui-icon-zoomout { background-position: -144px -112px; }
+.ui-icon-search { background-position: -160px -112px; }
+.ui-icon-wrench { background-position: -176px -112px; }
+.ui-icon-gear { background-position: -192px -112px; }
+.ui-icon-heart { background-position: -208px -112px; }
+.ui-icon-star { background-position: -224px -112px; }
+.ui-icon-link { background-position: -240px -112px; }
+.ui-icon-cancel { background-position: 0 -128px; }
+.ui-icon-plus { background-position: -16px -128px; }
+.ui-icon-plusthick { background-position: -32px -128px; }
+.ui-icon-minus { background-position: -48px -128px; }
+.ui-icon-minusthick { background-position: -64px -128px; }
+.ui-icon-close { background-position: -80px -128px; }
+.ui-icon-closethick { background-position: -96px -128px; }
+.ui-icon-key { background-position: -112px -128px; }
+.ui-icon-lightbulb { background-position: -128px -128px; }
+.ui-icon-scissors { background-position: -144px -128px; }
+.ui-icon-clipboard { background-position: -160px -128px; }
+.ui-icon-copy { background-position: -176px -128px; }
+.ui-icon-contact { background-position: -192px -128px; }
+.ui-icon-image { background-position: -208px -128px; }
+.ui-icon-video { background-position: -224px -128px; }
+.ui-icon-script { background-position: -240px -128px; }
+.ui-icon-alert { background-position: 0 -144px; }
+.ui-icon-info { background-position: -16px -144px; }
+.ui-icon-notice { background-position: -32px -144px; }
+.ui-icon-help { background-position: -48px -144px; }
+.ui-icon-check { background-position: -64px -144px; }
+.ui-icon-bullet { background-position: -80px -144px; }
+.ui-icon-radio-off { background-position: -96px -144px; }
+.ui-icon-radio-on { background-position: -112px -144px; }
+.ui-icon-pin-w { background-position: -128px -144px; }
+.ui-icon-pin-s { background-position: -144px -144px; }
+.ui-icon-play { background-position: 0 -160px; }
+.ui-icon-pause { background-position: -16px -160px; }
+.ui-icon-seek-next { background-position: -32px -160px; }
+.ui-icon-seek-prev { background-position: -48px -160px; }
+.ui-icon-seek-end { background-position: -64px -160px; }
+.ui-icon-seek-start { background-position: -80px -160px; }
+/* ui-icon-seek-first is deprecated, use ui-icon-seek-start instead */
+.ui-icon-seek-first { background-position: -80px -160px; }
+.ui-icon-stop { background-position: -96px -160px; }
+.ui-icon-eject { background-position: -112px -160px; }
+.ui-icon-volume-off { background-position: -128px -160px; }
+.ui-icon-volume-on { background-position: -144px -160px; }
+.ui-icon-power { background-position: 0 -176px; }
+.ui-icon-signal-diag { background-position: -16px -176px; }
+.ui-icon-signal { background-position: -32px -176px; }
+.ui-icon-battery-0 { background-position: -48px -176px; }
+.ui-icon-battery-1 { background-position: -64px -176px; }
+.ui-icon-battery-2 { background-position: -80px -176px; }
+.ui-icon-battery-3 { background-position: -96px -176px; }
+.ui-icon-circle-plus { background-position: 0 -192px; }
+.ui-icon-circle-minus { background-position: -16px -192px; }
+.ui-icon-circle-close { background-position: -32px -192px; }
+.ui-icon-circle-triangle-e { background-position: -48px -192px; }
+.ui-icon-circle-triangle-s { background-position: -64px -192px; }
+.ui-icon-circle-triangle-w { background-position: -80px -192px; }
+.ui-icon-circle-triangle-n { background-position: -96px -192px; }
+.ui-icon-circle-arrow-e { background-position: -112px -192px; }
+.ui-icon-circle-arrow-s { background-position: -128px -192px; }
+.ui-icon-circle-arrow-w { background-position: -144px -192px; }
+.ui-icon-circle-arrow-n { background-position: -160px -192px; }
+.ui-icon-circle-zoomin { background-position: -176px -192px; }
+.ui-icon-circle-zoomout { background-position: -192px -192px; }
+.ui-icon-circle-check { background-position: -208px -192px; }
+.ui-icon-circlesmall-plus { background-position: 0 -208px; }
+.ui-icon-circlesmall-minus { background-position: -16px -208px; }
+.ui-icon-circlesmall-close { background-position: -32px -208px; }
+.ui-icon-squaresmall-plus { background-position: -48px -208px; }
+.ui-icon-squaresmall-minus { background-position: -64px -208px; }
+.ui-icon-squaresmall-close { background-position: -80px -208px; }
+.ui-icon-grip-dotted-vertical { background-position: 0 -224px; }
+.ui-icon-grip-dotted-horizontal { background-position: -16px -224px; }
+.ui-icon-grip-solid-vertical { background-position: -32px -224px; }
+.ui-icon-grip-solid-horizontal { background-position: -48px -224px; }
+.ui-icon-gripsmall-diagonal-se { background-position: -64px -224px; }
+.ui-icon-grip-diagonal-se { background-position: -80px -224px; }
+
+
+/* Misc visuals
+----------------------------------*/
+
+/* Corner radius */
+.ui-corner-all, .ui-corner-top, .ui-corner-left, .ui-corner-tl { -moz-border-radius-topleft: 4px; -webkit-border-top-left-radius: 4px; -khtml-border-top-left-radius: 4px; border-top-left-radius: 4px; }
+.ui-corner-all, .ui-corner-top, .ui-corner-right, .ui-corner-tr { -moz-border-radius-topright: 4px; -webkit-border-top-right-radius: 4px; -khtml-border-top-right-radius: 4px; border-top-right-radius: 4px; }
+.ui-corner-all, .ui-corner-bottom, .ui-corner-left, .ui-corner-bl { -moz-border-radius-bottomleft: 4px; -webkit-border-bottom-left-radius: 4px; -khtml-border-bottom-left-radius: 4px; border-bottom-left-radius: 4px; }
+.ui-corner-all, .ui-corner-bottom, .ui-corner-right, .ui-corner-br { -moz-border-radius-bottomright: 4px; -webkit-border-bottom-right-radius: 4px; -khtml-border-bottom-right-radius: 4px; border-bottom-right-radius: 4px; }
+
+/* Overlays */
+.ui-widget-overlay { background: #aaaaaa url(img/ui-bg_flat_0_aaaaaa_40x100.png) 50% 50% repeat-x; opacity: .30;filter:Alpha(Opacity=30); }
+.ui-widget-shadow { margin: -8px 0 0 -8px; padding: 8px; background: #aaaaaa url(img/ui-bg_flat_0_aaaaaa_40x100.png) 50% 50% repeat-x; opacity: .30;filter:Alpha(Opacity=30); -moz-border-radius: 8px; -khtml-border-radius: 8px; -webkit-border-radius: 8px; border-radius: 8px; }/*
+ * jQuery UI Datepicker 1.8.18
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Datepicker#theming
+ */
+.ui-datepicker { width: 17em; padding: .2em .2em 0; display: none; }
+.ui-datepicker .ui-datepicker-header { position:relative; padding:.2em 0; }
+.ui-datepicker .ui-datepicker-prev, .ui-datepicker .ui-datepicker-next { position:absolute; top: 2px; width: 1.8em; height: 1.8em; }
+.ui-datepicker .ui-datepicker-prev-hover, .ui-datepicker .ui-datepicker-next-hover { top: 1px; }
+.ui-datepicker .ui-datepicker-prev { left:2px; }
+.ui-datepicker .ui-datepicker-next { right:2px; }
+.ui-datepicker .ui-datepicker-prev-hover { left:1px; }
+.ui-datepicker .ui-datepicker-next-hover { right:1px; }
+.ui-datepicker .ui-datepicker-prev span, .ui-datepicker .ui-datepicker-next span { display: block; position: absolute; left: 50%; margin-left: -8px; top: 50%; margin-top: -8px; }
+.ui-datepicker .ui-datepicker-title { margin: 0 2.3em; line-height: 1.8em; text-align: center; }
+.ui-datepicker .ui-datepicker-title select { font-size:1em; margin:1px 0; }
+.ui-datepicker select.ui-datepicker-month-year {width: 100%;}
+.ui-datepicker select.ui-datepicker-month,
+.ui-datepicker select.ui-datepicker-year { width: 49%;}
+.ui-datepicker table {width: 100%; font-size: .9em; border-collapse: collapse; margin:0 0 .4em; }
+.ui-datepicker th { padding: .7em .3em; text-align: center; font-weight: bold; border: 0; }
+.ui-datepicker td { border: 0; padding: 1px; }
+.ui-datepicker td span, .ui-datepicker td a { display: block; padding: .2em; text-align: right; text-decoration: none; }
+.ui-datepicker .ui-datepicker-buttonpane { background-image: none; margin: .7em 0 0 0; padding:0 .2em; border-left: 0; border-right: 0; border-bottom: 0; }
+.ui-datepicker .ui-datepicker-buttonpane button { float: right; margin: .5em .2em .4em; cursor: pointer; padding: .2em .6em .3em .6em; width:auto; overflow:visible; }
+.ui-datepicker .ui-datepicker-buttonpane button.ui-datepicker-current { float:left; }
+
+/* with multiple calendars */
+.ui-datepicker.ui-datepicker-multi { width:auto; }
+.ui-datepicker-multi .ui-datepicker-group { float:left; }
+.ui-datepicker-multi .ui-datepicker-group table { width:95%; margin:0 auto .4em; }
+.ui-datepicker-multi-2 .ui-datepicker-group { width:50%; }
+.ui-datepicker-multi-3 .ui-datepicker-group { width:33.3%; }
+.ui-datepicker-multi-4 .ui-datepicker-group { width:25%; }
+.ui-datepicker-multi .ui-datepicker-group-last .ui-datepicker-header { border-left-width:0; }
+.ui-datepicker-multi .ui-datepicker-group-middle .ui-datepicker-header { border-left-width:0; }
+.ui-datepicker-multi .ui-datepicker-buttonpane { clear:left; }
+.ui-datepicker-row-break { clear:both; width:100%; font-size:0em; }
+
+/* RTL support */
+.ui-datepicker-rtl { direction: rtl; }
+.ui-datepicker-rtl .ui-datepicker-prev { right: 2px; left: auto; }
+.ui-datepicker-rtl .ui-datepicker-next { left: 2px; right: auto; }
+.ui-datepicker-rtl .ui-datepicker-prev:hover { right: 1px; left: auto; }
+.ui-datepicker-rtl .ui-datepicker-next:hover { left: 1px; right: auto; }
+.ui-datepicker-rtl .ui-datepicker-buttonpane { clear:right; }
+.ui-datepicker-rtl .ui-datepicker-buttonpane button { float: left; }
+.ui-datepicker-rtl .ui-datepicker-buttonpane button.ui-datepicker-current { float:right; }
+.ui-datepicker-rtl .ui-datepicker-group { float:right; }
+.ui-datepicker-rtl .ui-datepicker-group-last .ui-datepicker-header { border-right-width:0; border-left-width:1px; }
+.ui-datepicker-rtl .ui-datepicker-group-middle .ui-datepicker-header { border-right-width:0; border-left-width:1px; }
+
+/* IE6 IFRAME FIX (taken from datepicker 1.5.3 */
+.ui-datepicker-cover {
+ display: none; /*sorry for IE5*/
+ display/**/: block; /*sorry for IE5*/
+ position: absolute; /*must have*/
+ z-index: -1; /*must have*/
+ filter: mask(); /*must have*/
+ top: -4px; /*must have*/
+ left: -4px; /*must have*/
+ width: 200px; /*must have*/
+ height: 200px; /*must have*/
+}
\ No newline at end of file
diff --git a/src/Umbraco.Web.UI/Umbraco/plugins/umbracoContour/css/style.css b/src/Umbraco.Web.UI/Umbraco/plugins/umbracoContour/css/style.css
new file mode 100644
index 0000000000..3f96e72795
--- /dev/null
+++ b/src/Umbraco.Web.UI/Umbraco/plugins/umbracoContour/css/style.css
@@ -0,0 +1,633 @@
+/* CSS Reset */
+
+html, body, div, span, applet, object, iframe, h1, h2, h3, h4, h5, h6, p, blockquote, pre, a, abbr, acronym, address, big, cite, code, del, dfn, em, font, img, ins, kbd, q, s, samp, small, strike, strong, sub, sup, tt, var, b, u, i, center, dl, dt, dd, ol, ul, li, fieldset, form, label, legend, table, caption, tbody, tfoot, thead, tr, th, td
+{
+ margin: 0;
+ padding: 0;
+ border: 0;
+ outline: 0;
+ font-size: 100%;
+ vertical-align: baseline;
+ background: transparent;
+}
+/* adjust toolbar menu after reset */
+.editorArrow, .editorArrowOver
+{
+ margin: 0 4px 0 0;
+ }
+.editorIcon
+{
+ margin: 2px;
+ padding: 0;
+}
+.editorIconOver
+{
+ margin: 1px;
+ padding: 0;
+}
+.sl {margin-top: 3px;}
+.menubar table
+{
+ margin: 0 0 0 3px;
+}
+body
+{
+ line-height: 1;
+}
+ol, ul
+{
+ list-style: none;
+}
+blockquote, q
+{
+ quotes: none;
+}
+blockquote:before, blockquote:after, q:before, q:after
+{
+ content: '';
+ content: none;
+}
+
+/* remember to define focus styles! */
+:focus
+{
+ outline: 0;
+}
+
+/* remember to highlight inserts somehow! */
+ins
+{
+ text-decoration: none;
+}
+del
+{
+ text-decoration: line-through;
+}
+
+/* tables still need 'cellspacing="0"' in the markup */
+table
+{
+ border-collapse: collapse;
+ border-spacing: 0;
+}
+
+
+/* Modal */
+
+#simplemodal-overlay
+{
+ background-color: #ccc;
+ cursor: wait;
+}
+
+#simplemodal-container
+{
+ height: 400px;
+ width: 600px;
+ background-color: #fff;
+ border: 3px solid #ccc;
+}
+
+#simplemodal-container a.modalCloseImg
+{
+ background: url(img/x.png) no-repeat;
+ width: 25px;
+ height: 29px;
+ display: inline;
+ z-index: 3200;
+ position: absolute;
+ top: -14px;
+ right: -18px;
+ cursor: pointer;
+}
+
+
+.modal
+{
+ padding: 8px;
+}
+
+/* Design Surface */
+
+a.iconButton
+{
+ display: block;
+ padding: 20px 20px 0px 0px;
+ width: 0px;
+ height: 0px;
+ overflow: hidden;
+/* background: no-repeat center center url(../../../images/false.png);*/
+}
+
+a.add
+{
+ background: url(img/add_small.png) no-repeat;
+ margin-left: 5px;
+}
+a.delete
+{
+ background: url(img/delete_small.png) no-repeat;
+ margin-left: 5px;
+}
+a.copy
+{
+ background: url(img/copy_small.png) no-repeat;
+ margin-left: 5px;
+}
+a.update
+{
+ background: url(img/edit_small.png) no-repeat;
+ margin-left: 5px;
+}
+
+.handle
+{
+ cursor: move;
+ display: block;
+ padding: 30px 30px 0px 0px;
+ width: 0px;
+ height: 0px;
+ overflow: hidden;
+}
+.handle:hover
+{
+ cursor: move;
+ display: block;
+ padding: 30px 30px 0px 0px;
+ width: 0px;
+ height: 0px;
+ overflow: hidden;
+ background: transparent no-repeat 8px -34px url(../images/drag.png);
+}
+.activefield .handle
+{
+ cursor: move;
+ display: block;
+ padding: 30px 30px 0px 0px;
+ width: 0px;
+ height: 0px;
+ overflow: hidden;
+ background: transparent no-repeat 8px 11px url(../images/drag.png);
+}
+
+#formbuilder
+{
+ padding: 10px;
+}
+
+#actions
+{
+ padding-bottom: 10px;
+}
+
+#designsurface
+{
+ min-width: 600px;
+ width: 98%;
+ min-height: 50px;
+ padding-top: 0px;
+ padding-bottom: 10px;
+ margin-top: 0px;
+}
+
+
+.page
+{
+ padding: 0px;
+ margin: 5px;
+ position: relative;
+}
+
+.pageheader
+{
+ border-bottom: 1px solid #efefef;
+ padding: 3px;
+ margin-bottom: 5px;
+ font-size: 125%;
+ height: 20px;
+}
+
+.pageheader .pagename
+{
+ float: left;
+}
+
+.pageheader a.iconButton
+{
+ float: right;
+
+}
+
+.fieldset
+{
+ position: relative;
+ padding: 5px 0px 5px 20px;
+ margin: 0px;
+}
+
+.fieldset .handle
+{
+ position: absolute;
+ left: -5px;
+ top: 1px;
+}
+
+.fieldsetheader
+{
+ font-size: 110%;
+ padding: 5px;
+ border-bottom: 1px solid #efefef;
+ margin-bottom: 5px;
+ height: 17px;
+ padding-right: 3px;
+}
+
+.fieldsetheader .fieldsetname
+{
+ float: left;
+}
+.fieldsetheader a.iconButton
+{
+ float: right;
+ margin-left: 5px;
+}
+
+.fieldControl
+{
+ float: left;
+ padding-left: 10px;
+}
+
+.field
+{
+ position: relative;
+ background-color: #fff;
+ padding: 15px 0px 15px 20px;
+ margin: 0;
+ padding-right: 0px;
+
+}
+
+.field .handle
+{
+ left: -5px;
+ top:4px;
+}
+
+.field a.iconButton
+{
+ position: relative;
+ float: right;
+ display: none;
+}
+.fieldexamplelabel, .fieldControl
+{
+ position: relative;
+}
+.activefield
+{
+ background-color: #e7fbe0;
+}
+
+.activefield a.iconButton
+{
+ display: block;
+}
+
+.field label.fieldexamplelabel, #FieldModal label.fieldexamplelabel
+{
+ clear: left;
+ float: left;
+ font-weight: bold;
+ padding-bottom: 10px;
+ padding-right: 10px;
+ width: 180px;
+}
+
+#toggleadditionalsettings, #toggleconditions
+{
+ padding: 3px 0px 0px 15px;
+ cursor: pointer;
+ background: transparent no-repeat url(img/bullet_arrow_down.png);
+}
+.leftPad10
+{
+ padding-left: 10px;
+}
+
+.fieldsetcontainer
+{
+ min-height: 10px;
+}
+
+.fieldcontainer
+{
+ min-height: 10px;
+}
+
+#fieldprevalues, #fieldprevalueslist, #fieldprevalueslist li
+{
+
+}
+
+.fieldeditprevalues
+{
+ margin-top: 5px;
+}
+
+#editprevaluelist li
+{
+ display: block;
+
+ clear:both;
+
+ height: 20px;
+}
+
+#editprevaluelist li .prevaluetext
+{
+ float:left;
+}
+
+#editprevaluelist .iconButton
+{
+ display: inline;
+ margin: 0;
+ padding: 20px 20px 0 0;
+}
+
+#prevalueform fieldset
+{
+ padding: 5px;
+ border: 1px solid #368216;
+ width: 250px;
+ margin: 5px;
+}
+
+#prevalueform h1
+{
+ margin-bottom: 5px;
+ font-weight: bold;
+}
+
+#fieldprevalueslist li
+{
+ background-color: #DDDDDD;
+}
+
+.disabled
+{
+ color: #CCCCCC;
+ cursor: default;
+}
+
+.mandatory
+{
+ color: #FF0000;
+}
+
+
+
+/* INLINE FORMS */
+#FieldModal
+{
+ margin: 10px 10px 10px 0px;
+ padding: 10px;
+ border: 2px dotted #368216;
+ background-color: #d0f4c5;
+}
+#FieldModal h1
+{
+ display: none;
+}
+.modalform label
+{
+ width: 100px;
+ float: left;
+ clear: left;
+ padding-right: 10px;
+}
+.modalform p
+{
+ padding: 10px 5px;
+}
+.modalform .fieldContainer
+{
+ margin: 10px 0px;
+ padding-left: 5px;
+}
+.formControl
+{
+ float: left;
+ clear: right;
+}
+
+.ui-sortable-helper
+{
+ border: 2px dashed #ccc;
+}
+.ui-sortable-helper .handle
+{
+ background: none;
+}
+
+/* Fieldtype previews */
+input.textfield, textarea.textarea
+{
+ color: #333333;
+ font-family: Trebuchet MS,Lucida Grande,verdana,arial;
+ font-size: 12px;
+ padding: 2px;
+ width: 250px;
+}
+
+select.dropdownlist
+{
+}
+
+#stepsnavigation{padding: 10px; border-top: 1px solid #efefef; margin-top: 15px; }
+
+/* WORKFLOWS */
+#workflows
+{
+ text-align: center;
+ margin-bottom: 30px;
+}
+#workflows .stateholder
+{
+ font-size: 12px;
+ border: 2px dashed #BFBFBF;
+ background: #F4F4F4;
+ padding: 15px;
+ width: 70%;
+ margin: auto;
+ margin-top: 30px;
+
+}
+
+#workflows .stateholder h2
+{
+ font-size: 1.5em !important;
+ color: #ccc;
+ padding: 5px;
+ margin: 0px;
+}
+
+#workflows .advanced
+{
+ display: none;
+ border-color: #D7D7D7;
+ background: #FFFCDF;
+}
+#workflows .stateholder a.iconButton
+{
+ cursor: pointer;
+ float: right;
+ margin-left: 5px;
+}
+
+#workflows .empty
+{
+ padding: 10px;
+}
+
+#workflows .iconButton
+{
+ display: block !important;
+}
+
+#workflows button
+{
+ font-size: 1em;
+}
+
+#workflows .arrow
+{
+ background: no-repeat center center url(../images/down-arrow.gif);
+ padding: 40px 40px 0px 0px;
+ overflow: hidden;
+ width: 0px;
+ height: 0px;
+ margin: auto;
+ margin-top: 20px;
+}
+
+#workflows .sortablepropertypane
+{
+ padding: 10px;
+ margin: 5px;
+ background: #fff;
+ cursor: move;
+}
+
+
+.notification{
+ background:#FFF6BF;
+ color:#514721;
+ border: #FFD324 2px solid;
+ padding: 15px;
+ font-size: 1em;
+ margin-bottom: 20px;
+ margin-top: 10px;
+ margin-left: 10px;
+ margin-right: 10px;
+ }
+
+label.error
+{
+ background-color:#D0F4C5;
+ border-style:none;
+ padding:0;
+ width:200px;
+ float:none;
+ padding-left:10px;
+}
+
+.field
+{
+ clear:both;
+ height:auto;
+}
+
+.iconButton
+{
+ z-index: 50;
+}
+
+/* entries viewer */
+.recordOption
+{
+ display:block;
+ height:0;
+ overflow:hidden;
+ padding:16px 16px 0 0;
+ width:0;
+ background:url("img/options.png") no-repeat scroll 0 0 transparent;
+ float:left;
+}
+
+#recordContextMenu
+{
+ background:url("img/contextMenuBg.gif") repeat-y scroll left center #F0F0F0;
+ display: block;
+ border:1px solid #979797;
+ width: 180px;
+ position: absolute;
+ padding:3px;
+}
+
+
+
+#recordContextMenu li
+{
+ padding:2px;
+ color:#1A1818;
+ cursor:pointer;
+ font-family:Arial,Lucida Grande;
+ font-size:11px;
+ height:20px;
+ margin:1px;
+ background-repeat:no-repeat;
+ background-position:left center;
+}
+
+#recordContextMenu li div
+{
+ padding-left: 30px;
+
+
+}
+
+#recordContextMenu li.activemenuitem
+{
+ background:#dcecf3;
+ border:1px solid #a8d8eb;
+ padding-top:1px;
+ padding-bottom:1px;
+ padding-left:1px;
+ background-repeat:no-repeat;
+ background-position:left center;
+}
+
+#columnToggler .hidden
+{
+ color: #cccccc;
+}
+
+.inlineEditor input{
+ width:100px !important;
+}
+
+.field .grey {
+ color: #CCC;
+}
+
+#editprevaluelist .move{
+ background: url(../images/drag.png) no-repeat;
+ cursor: move;
+ display: none;
+}
+
+#editprevaluelist .activeprevalue .move {
+ display: block;
+}
\ No newline at end of file
diff --git a/src/Umbraco.Web.UI/Umbraco/plugins/umbracoContour/editDataSource.aspx b/src/Umbraco.Web.UI/Umbraco/plugins/umbracoContour/editDataSource.aspx
new file mode 100644
index 0000000000..7f7a98e52d
--- /dev/null
+++ b/src/Umbraco.Web.UI/Umbraco/plugins/umbracoContour/editDataSource.aspx
@@ -0,0 +1,126 @@
+<%@ Page MasterPageFile="../../masterpages/umbracoPage.Master" Language="C#" AutoEventWireup="true" CodeBehind="editDataSource.aspx.cs" Inherits="Umbraco.Forms.UI.Pages.editDataSource" %>
+<%@ Register Namespace="umbraco.uicontrols" Assembly="controls" TagPrefix="umb" %>
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ Create new form
+
+
+
+ Forms using this workflow
+
+
+
+
+
+
+
+
\ No newline at end of file
diff --git a/src/Umbraco.Web.UI/Umbraco/plugins/umbracoContour/editForm.aspx b/src/Umbraco.Web.UI/Umbraco/plugins/umbracoContour/editForm.aspx
new file mode 100644
index 0000000000..82deb8125d
--- /dev/null
+++ b/src/Umbraco.Web.UI/Umbraco/plugins/umbracoContour/editForm.aspx
@@ -0,0 +1,203 @@
+<%@ Page MasterPageFile="../../masterpages/umbracoPage.Master" Language="C#" AutoEventWireup="true" CodeBehind="editForm.aspx.cs" Inherits="Umbraco.Forms.UI.Pages.editForm" %>
+<%@ Register Namespace="umbraco.uicontrols" Assembly="controls" TagPrefix="umb" %>
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ <%= Request["guid"] %>
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ If unchecked, this will disable entries viewing and easy access to the reacords through the xslt libraries.
+
+
+
+
+
+
+
+
+
+
+
diff --git a/src/Umbraco.Web.UI/Umbraco/plugins/umbracoContour/editFormEntries.aspx b/src/Umbraco.Web.UI/Umbraco/plugins/umbracoContour/editFormEntries.aspx
new file mode 100644
index 0000000000..0f8440c238
--- /dev/null
+++ b/src/Umbraco.Web.UI/Umbraco/plugins/umbracoContour/editFormEntries.aspx
@@ -0,0 +1,395 @@
+<%@ Page MasterPageFile="../../masterpages/umbracoPage.Master" Language="C#" AutoEventWireup="true" CodeBehind="editFormEntries.aspx.cs" Inherits="Umbraco.Forms.UI.Pages.editFormEntries" %>
+<%@ Register Namespace="umbraco.uicontrols" Assembly="controls" TagPrefix="umb" %>
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ Get all
+
+ Reload
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
\ No newline at end of file
diff --git a/src/Umbraco.Web.UI/Umbraco/plugins/umbracoContour/editFormWorkflows.aspx b/src/Umbraco.Web.UI/Umbraco/plugins/umbracoContour/editFormWorkflows.aspx
new file mode 100644
index 0000000000..8661cf33f3
--- /dev/null
+++ b/src/Umbraco.Web.UI/Umbraco/plugins/umbracoContour/editFormWorkflows.aspx
@@ -0,0 +1,209 @@
+<%@ Page MasterPageFile="../../masterpages/umbracoPage.Master" Language="C#" AutoEventWireup="true" CodeBehind="editFormWorkflows.aspx.cs" Inherits="Umbraco.Forms.UI.Pages.editFormWorkflows" %>
+
+<%@ Register Assembly="System.Web.Extensions, Version=3.5.0.0, Culture=neutral, PublicKeyToken=31bf3856ad364e35"
+ Namespace="System.Web.UI" TagPrefix="asp" %>
+<%@ Register Namespace="umbraco.uicontrols" Assembly="controls" TagPrefix="umb" %>
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ A form comes with a basic workflow which allows you to attach extra functionality on each step of the forms life-cycle.
+
+
+
+
+
+ Use these steps to integrate with 3rd party systems, modify data or perform basic filtering
+
+
+ There are even more events to use if you turn on the Advanced mode
+
+
+ Back to Simple mode
+
+
+
+
+
+
+
+
+
+
+
diff --git a/src/Umbraco.Web.UI/Umbraco/plugins/umbracoContour/editFormsSecurity.aspx b/src/Umbraco.Web.UI/Umbraco/plugins/umbracoContour/editFormsSecurity.aspx
new file mode 100644
index 0000000000..9c6a6d6caf
--- /dev/null
+++ b/src/Umbraco.Web.UI/Umbraco/plugins/umbracoContour/editFormsSecurity.aspx
@@ -0,0 +1,41 @@
+<%@ Page MasterPageFile="../../masterpages/umbracoPage.Master" Language="C#" AutoEventWireup="true" CodeBehind="editFormsSecurity.aspx.cs" Inherits="Umbraco.Forms.UI.Pages.editFormsSecurity" %>
+
+<%@ Register Assembly="System.Web.Extensions, Version=3.5.0.0, Culture=neutral, PublicKeyToken=31bf3856ad364e35"
+ Namespace="System.Web.UI" TagPrefix="asp" %>
+<%@ Register Namespace="umbraco.uicontrols" Assembly="controls" TagPrefix="umb" %>
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
\ No newline at end of file
diff --git a/src/Umbraco.Web.UI/Umbraco/plugins/umbracoContour/editPrevalueProvider.aspx b/src/Umbraco.Web.UI/Umbraco/plugins/umbracoContour/editPrevalueProvider.aspx
new file mode 100644
index 0000000000..cd26476f3a
--- /dev/null
+++ b/src/Umbraco.Web.UI/Umbraco/plugins/umbracoContour/editPrevalueProvider.aspx
@@ -0,0 +1,7 @@
+<%@ Page MasterPageFile="../../masterpages/umbracoPage.Master" Language="C#" AutoEventWireup="true" CodeBehind="editPrevalueProvider.aspx.cs" Inherits="Umbraco.Forms.UI.Pages.editPrevalues" %>
+<%@ Register Namespace="umbraco.uicontrols" Assembly="controls" TagPrefix="umb" %>
+
+
+
+
+
diff --git a/src/Umbraco.Web.UI/Umbraco/plugins/umbracoContour/editPrevalueSource.aspx b/src/Umbraco.Web.UI/Umbraco/plugins/umbracoContour/editPrevalueSource.aspx
new file mode 100644
index 0000000000..fc373c3811
--- /dev/null
+++ b/src/Umbraco.Web.UI/Umbraco/plugins/umbracoContour/editPrevalueSource.aspx
@@ -0,0 +1,88 @@
+<%@ Page MasterPageFile="../../masterpages/umbracoPage.Master" Language="C#" AutoEventWireup="true" CodeBehind="editPrevalueSource.aspx.cs" Inherits="Umbraco.Forms.UI.Pages.editPrevalues" %>
+<%@ Register Namespace="umbraco.uicontrols" Assembly="controls" TagPrefix="umb" %>
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
Prevalues overview:
+
+
+
+
+
+ <%# ((Umbraco.Forms.Core.PreValue)Container.DataItem).Id %>
+
+
+ <%# ((Umbraco.Forms.Core.PreValue)Container.DataItem).Value%>
+
+
+
+
+
+
+
+
+
+
+
diff --git a/src/Umbraco.Web.UI/Umbraco/plugins/umbracoContour/editPrevalues.aspx b/src/Umbraco.Web.UI/Umbraco/plugins/umbracoContour/editPrevalues.aspx
new file mode 100644
index 0000000000..7624771581
--- /dev/null
+++ b/src/Umbraco.Web.UI/Umbraco/plugins/umbracoContour/editPrevalues.aspx
@@ -0,0 +1,7 @@
+<%@ Page MasterPageFile="../../masterpages/umbracoPage.Master" Language="C#" AutoEventWireup="true" CodeBehind="editPrevalues.aspx.cs" Inherits="Umbraco.Forms.UI.Pages.editPrevalues" %>
+<%@ Register Namespace="umbraco.uicontrols" Assembly="controls" TagPrefix="umb" %>
+
+
+
+
+
diff --git a/src/Umbraco.Web.UI/Umbraco/plugins/umbracoContour/editWorkflow.aspx b/src/Umbraco.Web.UI/Umbraco/plugins/umbracoContour/editWorkflow.aspx
new file mode 100644
index 0000000000..709742805c
--- /dev/null
+++ b/src/Umbraco.Web.UI/Umbraco/plugins/umbracoContour/editWorkflow.aspx
@@ -0,0 +1,27 @@
+<%@ Page MasterPageFile="../../masterpages/umbracoPage.Master" Language="C#" AutoEventWireup="true" CodeBehind="editWorkflow.aspx.cs" Inherits="Umbraco.Forms.UI.Pages.editWorkflow" %>
+<%@ Register Namespace="umbraco.uicontrols" Assembly="controls" TagPrefix="umb" %>
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
\ No newline at end of file
diff --git a/src/Umbraco.Web.UI/Umbraco/plugins/umbracoContour/editWorkflowDialog.aspx b/src/Umbraco.Web.UI/Umbraco/plugins/umbracoContour/editWorkflowDialog.aspx
new file mode 100644
index 0000000000..6b3aebde13
--- /dev/null
+++ b/src/Umbraco.Web.UI/Umbraco/plugins/umbracoContour/editWorkflowDialog.aspx
@@ -0,0 +1,59 @@
+<%@ Page Language="C#" MasterPageFile="../../masterpages/umbracoPage.Master" AutoEventWireup="true" CodeBehind="editWorkflowDialog.aspx.cs" Inherits="Umbraco.Forms.UI.Dialogs.editWorkflowDialog" %>
+<%@ Register Assembly="System.Web.Extensions, Version=3.5.0.0, Culture=neutral, PublicKeyToken=31bf3856ad364e35"
+ Namespace="System.Web.UI" TagPrefix="asp" %>
+<%@ Register Namespace="umbraco.uicontrols" Assembly="controls" TagPrefix="umb" %>
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
diff --git a/src/Umbraco.Web.UI/Umbraco/plugins/umbracoContour/executeRecordAction.aspx b/src/Umbraco.Web.UI/Umbraco/plugins/umbracoContour/executeRecordAction.aspx
new file mode 100644
index 0000000000..09c8110ad9
--- /dev/null
+++ b/src/Umbraco.Web.UI/Umbraco/plugins/umbracoContour/executeRecordAction.aspx
@@ -0,0 +1,39 @@
+<%@ Page Language="C#" AutoEventWireup="true" MasterPageFile="../../masterpages/umbracoDialog.Master" CodeBehind="executeRecordAction.aspx.cs" Inherits="Umbraco.Forms.UI.Dialogs.executeRecordAction" %>
+<%@ Register Assembly="System.Web.Extensions, Version=3.5.0.0, Culture=neutral, PublicKeyToken=31bf3856ad364e35"
+ Namespace="System.Web.UI" TagPrefix="asp" %>
+<%@ Register Namespace="umbraco.uicontrols" Assembly="controls" TagPrefix="umb" %>
+
+
+
+
+
+
+
+
+
+
\ No newline at end of file
diff --git a/src/Umbraco.Web.UI/Umbraco/plugins/umbracoContour/exportForm.aspx b/src/Umbraco.Web.UI/Umbraco/plugins/umbracoContour/exportForm.aspx
new file mode 100644
index 0000000000..f91824e1a9
--- /dev/null
+++ b/src/Umbraco.Web.UI/Umbraco/plugins/umbracoContour/exportForm.aspx
@@ -0,0 +1 @@
+<%@ Page Language="C#" AutoEventWireup="true" CodeBehind="exportForm.aspx.cs" Inherits="Umbraco.Forms.UI.Pages.exportForm" %>
diff --git a/src/Umbraco.Web.UI/Umbraco/plugins/umbracoContour/exportFormEntriesDialog.aspx b/src/Umbraco.Web.UI/Umbraco/plugins/umbracoContour/exportFormEntriesDialog.aspx
new file mode 100644
index 0000000000..aa90d70e8f
--- /dev/null
+++ b/src/Umbraco.Web.UI/Umbraco/plugins/umbracoContour/exportFormEntriesDialog.aspx
@@ -0,0 +1,67 @@
+<%@ Page Language="C#" AutoEventWireup="true" CodeBehind="exportFormEntriesDialog.aspx.cs" Inherits="Umbraco.Forms.UI.Dialogs.exportFormEntriesDialog" %>
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ or cancel
+
+
+
+
+
+
+
+
diff --git a/src/Umbraco.Web.UI/Umbraco/plugins/umbracoContour/formPickerCreateFormDialog.aspx b/src/Umbraco.Web.UI/Umbraco/plugins/umbracoContour/formPickerCreateFormDialog.aspx
new file mode 100644
index 0000000000..71d0ec5a8b
--- /dev/null
+++ b/src/Umbraco.Web.UI/Umbraco/plugins/umbracoContour/formPickerCreateFormDialog.aspx
@@ -0,0 +1,264 @@
+<%@ Page MasterPageFile="../../masterpages/umbracoDialog.Master" Language="C#" AutoEventWireup="true" CodeBehind="formPickerCreateFormDialog.aspx.cs" Inherits="Umbraco.Forms.UI.Dialogs.formPickerCreateFormDialog" %>
+<%@ Register Assembly="System.Web.Extensions, Version=3.5.0.0, Culture=neutral, PublicKeyToken=31bf3856ad364e35"
+ Namespace="System.Web.UI" TagPrefix="asp" %>
+<%@ Register Namespace="umbraco.uicontrols" Assembly="controls" TagPrefix="umb" %>
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ None
+
+
+
+
+
+
+ or
+ cancel
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ If unchecked, this will disable entries viewing and easy access to the reacords through the xslt libraries.
+
+
+
+
+
+ or
+ cancel
+
+
+
\ No newline at end of file
diff --git a/src/Umbraco.Web.UI/Umbraco/plugins/umbracoContour/formPickerDialog.aspx b/src/Umbraco.Web.UI/Umbraco/plugins/umbracoContour/formPickerDialog.aspx
new file mode 100644
index 0000000000..2f889bbc27
--- /dev/null
+++ b/src/Umbraco.Web.UI/Umbraco/plugins/umbracoContour/formPickerDialog.aspx
@@ -0,0 +1,62 @@
+<%@ Page Language="C#" AutoEventWireup="true" CodeBehind="formPickerDialog.aspx.cs" Inherits="Umbraco.Forms.UI.Dialogs.formPickerDialog" %>
+<%@ Register TagPrefix="ui" Namespace="umbraco.uicontrols" Assembly="controls" %>
+
+
+
+
+
+
+
diff --git a/src/Umbraco.Web.UI/Umbraco/plugins/umbracoContour/previewFormDialog.aspx b/src/Umbraco.Web.UI/Umbraco/plugins/umbracoContour/previewFormDialog.aspx
new file mode 100644
index 0000000000..504928771d
--- /dev/null
+++ b/src/Umbraco.Web.UI/Umbraco/plugins/umbracoContour/previewFormDialog.aspx
@@ -0,0 +1,41 @@
+<%@ Page Language="C#" AutoEventWireup="true" CodeBehind="previewFormDialog.aspx.cs" Inherits="Umbraco.Forms.UI.Dialogs.previewFormDialog" %>
+
+
+
+
+
+ Form Test
+ Form Test
+
+ Notice: This is a fully functional version of your form and will act as any normal form would. Complete with workflows and
+ datastorage.
+
+
+
+
+ Print view Please use your browser's print function to "+
+ "print this table. Press escape when finished.", /* The 'fading' message */
+ "sTitle": "",
+ "sSwfPath": "scripts/ZeroClipboard.swf",
+ "iButtonHeight": 30,
+ "iButtonWidth": 30,
+ "sCsvBoundary": "'",
+ "_iNextId": 1 /* Internal useage - but needs to be global */
+};
+
+
+(function($) {
+/*
+ * Function: TableTools
+ * Purpose: TableTools "class"
+ * Returns: same as _fnInit
+ * Inputs: same as _fnInit
+ */
+function TableTools ( oInit )
+{
+ /* * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * *
+ * Private parameters
+ * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * */
+ var _oSettings;
+ var nTools = null;
+ var _nTableWrapper;
+ var _aoPrintHidden = [];
+ var _iPrintScroll = 0;
+ var _nPrintMessage = null;
+ var _DTSettings;
+ var _sLastData;
+ var _iId;
+
+
+ /* * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * *
+ * Initialisation
+ */
+
+ /*
+ * Function: _fnInit
+ * Purpose: Initialise the table tools
+ * Returns: node: - The created node for the table tools wrapping
+ * Inputs: object:oInit - object with:
+ * oDTSettings - DataTables settings
+ */
+ function _fnInit( oInit )
+ {
+ _nTools = document.createElement('div');
+ _nTools.className = "TableTools";
+ _iId = TableToolsInit._iNextId++;
+
+ /* Copy the init object */
+ _oSettings = $.extend( true, {}, TableToolsInit );
+
+ _DTSettings = oInit.oDTSettings;
+
+ _nTableWrapper = fnFindParentClass( _DTSettings.nTable, "dataTables_wrapper" );
+
+ ZeroClipboard.moviePath = _oSettings.sSwfPath;
+
+ if ( _oSettings.oFeatures.bCopy ) {
+ fnFeatureClipboard();
+ }
+ if ( _oSettings.oFeatures.bCsv ) {
+ fnFeatureSaveCSV();
+ }
+ if ( _oSettings.oFeatures.bXls ) {
+ fnFeatureSaveXLS();
+ }
+ if ( _oSettings.oFeatures.bPrint ) {
+ fnFeaturePrint();
+ }
+
+ return _nTools;
+ }
+
+
+ /* * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * *
+ * Feature buttons
+ */
+
+ /*
+ * Function: fnFeatureSaveCSV
+ * Purpose: Add a button for saving a CSV file
+ * Returns: -
+ * Inputs: -
+ */
+ function fnFeatureSaveCSV ()
+ {
+ var sBaseClass = "TableTools_button TableTools_csv";
+ var nButton = document.createElement( 'div' );
+ nButton.id = "ToolTables_CSV_"+_iId;
+ nButton.style.height = _oSettings.iButtonHeight+'px';
+ nButton.style.width = _oSettings.iButtonWidth+'px';
+ nButton.className = sBaseClass;
+ _nTools.appendChild( nButton );
+
+ var clip = new ZeroClipboard.Client();
+ clip.setHandCursor( true );
+ clip.setAction( 'save' );
+ clip.setCharSet( 'UTF8' );
+ clip.setBomInc( _oSettings.oBom.bCsv );
+ clip.setFileName( fnGetTitle()+'.csv' );
+
+ clip.addEventListener('mouseOver', function(client) {
+ nButton.className = sBaseClass+'_hover';
+ } );
+
+ clip.addEventListener('mouseOut', function(client) {
+ nButton.className = sBaseClass;
+ } );
+
+ clip.addEventListener('mouseDown', function(client) {
+ fnFlashSetText( clip, fnGetDataTablesData(",", TableToolsInit.sCsvBoundary) );
+ } );
+
+ fnGlue( clip, nButton, "ToolTables_CSV_"+_iId, "Save as CSV" );
+ }
+
+
+ /*
+ * Function: fnFeatureSaveXLS
+ * Purpose: Add a button for saving an XLS file
+ * Returns: -
+ * Inputs: -
+ */
+ function fnFeatureSaveXLS ()
+ {
+ var sBaseClass = "TableTools_button TableTools_xls";
+ var nButton = document.createElement( 'div' );
+ nButton.id = "ToolTables_XLS_"+_iId;
+ nButton.style.height = _oSettings.iButtonHeight+'px';
+ nButton.style.width = _oSettings.iButtonWidth+'px';
+ nButton.className = sBaseClass;
+ _nTools.appendChild( nButton );
+
+ var clip = new ZeroClipboard.Client();
+ clip.setHandCursor( true );
+ clip.setAction( 'save' );
+ clip.setCharSet( 'UTF16LE' );
+ clip.setBomInc( _oSettings.oBom.bXls );
+ clip.setFileName( fnGetTitle()+'.xls' );
+
+ clip.addEventListener('mouseOver', function(client) {
+ nButton.className = sBaseClass+'_hover';
+ } );
+
+ clip.addEventListener('mouseOut', function(client) {
+ nButton.className = sBaseClass;
+ } );
+
+ clip.addEventListener('mouseDown', function(client) {
+ fnFlashSetText( clip, fnGetDataTablesData("\t") );
+ } );
+
+ fnGlue( clip, nButton, "ToolTables_XLS_"+_iId, "Save for Excel" );
+ }
+
+
+ /*
+ * Function: fnFeatureClipboard
+ * Purpose: Add a button for copying data to clipboard
+ * Returns: -
+ * Inputs: -
+ */
+ function fnFeatureClipboard ()
+ {
+ var sBaseClass = "TableTools_button TableTools_clipboard";
+ var nButton = document.createElement( 'div' );
+ nButton.id = "ToolTables_Copy_"+_iId;
+ nButton.style.height = _oSettings.iButtonHeight+'px';
+ nButton.style.width = _oSettings.iButtonWidth+'px';
+ nButton.className = sBaseClass;
+ _nTools.appendChild( nButton );
+
+ var clip = new ZeroClipboard.Client();
+ clip.setHandCursor( true );
+ clip.setAction( 'copy' );
+
+ clip.addEventListener('mouseOver', function(client) {
+ nButton.className = sBaseClass+'_hover';
+ } );
+
+ clip.addEventListener('mouseOut', function(client) {
+ nButton.className = sBaseClass;
+ } );
+
+ clip.addEventListener('mouseDown', function(client) {
+ fnFlashSetText( clip, fnGetDataTablesData("\t") );
+ } );
+
+ clip.addEventListener('complete', function (client, text) {
+ var aData = _sLastData.split('\n');
+ alert( 'Copied '+(aData.length-1)+' rows to the clipboard' );
+ } );
+
+ fnGlue( clip, nButton, "ToolTables_Copy_"+_iId, "Copy to clipboard" );
+ }
+
+
+ /*
+ * Function: fnFeaturePrint
+ * Purpose: Add a button for printing data
+ * Returns: -
+ * Inputs: -
+ * Notes: Fun one this function. In order to print the table, we want the table to retain
+ * it's position in the DOM, so all styles still apply, but we don't want to print all the
+ * other nonesense. So we hide that nonesese and add an event handler for 'esc' which will
+ * restore a normal view.
+ */
+ function fnFeaturePrint ()
+ {
+ var sBaseClass = "TableTools_button TableTools_print";
+ var nButton = document.createElement( 'div' );
+ nButton.style.height = _oSettings.iButtonHeight+'px';
+ nButton.style.width = _oSettings.iButtonWidth+'px';
+ nButton.className = sBaseClass;
+ nButton.title = "Print table";
+ _nTools.appendChild( nButton );
+
+ /* Could do this in CSS - but might as well be consistent with the flash buttons */
+ $(nButton).hover( function(client) {
+ nButton.className = sBaseClass+'_hover';
+ }, function(client) {
+ nButton.className = sBaseClass;
+ } );
+
+ $(nButton).click( function() {
+ /* Parse through the DOM hiding everything that isn't needed for the table */
+ fnPrintHideNodes( _DTSettings.nTable );
+
+ /* Show the whole table */
+ _iPrintSaveStart = _DTSettings._iDisplayStart;
+ _iPrintSaveLength = _DTSettings._iDisplayLength;
+ _DTSettings._iDisplayStart = 0;
+ _DTSettings._iDisplayLength = -1;
+ _DTSettings.oApi._fnCalculateEnd( _DTSettings );
+ _DTSettings.oApi._fnDraw( _DTSettings );
+
+ /* Remove the other DataTables feature nodes - but leave the table! and info div */
+ var anFeature = _DTSettings.anFeatures;
+ for ( var cFeature in anFeature )
+ {
+ if ( cFeature != 'i' && cFeature != 't' )
+ {
+ _aoPrintHidden.push( {
+ "node": anFeature[cFeature],
+ "display": "block"
+ } );
+ anFeature[cFeature].style.display = "none";
+ }
+ }
+
+ /* Add a node telling the user what is going on */
+ var nInfo = document.createElement( "div" );
+ nInfo.className = "TableTools_PrintInfo";
+ nInfo.innerHTML = _oSettings.sPrintInfo;
+ document.body.appendChild( nInfo );
+
+ /* Add a message at the top of the page */
+ if ( _oSettings.sPrintMessage !== "" )
+ {
+ _nPrintMessage = document.createElement( "p" );
+ _nPrintMessage.className = "TableTools_PrintMessage";
+ _nPrintMessage.innerHTML = _oSettings.sPrintMessage;
+ document.body.insertBefore( _nPrintMessage, document.body.childNodes[0] );
+ }
+
+ /* Cache the scrolling and the jump to the top of the t=page */
+ _iPrintScroll = $(window).scrollTop();
+ window.scrollTo( 0, 0 );
+
+ $(document).bind( "keydown", null, fnPrintEnd );
+
+ setTimeout( function() {
+ $(nInfo).fadeOut( "normal", function() {
+ document.body.removeChild( nInfo );
+ } );
+ }, 2000 );
+ } );
+ }
+
+
+ /* * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * *
+ * Printing functions
+ */
+
+ /*
+ * Function: fnPrintEnd
+ * Purpose: Printing is finished, resume normal display
+ * Returns: -
+ * Inputs: event
+ */
+ function fnPrintEnd ( e )
+ {
+ /* Only interested in the escape key */
+ if ( e.keyCode == 27 )
+ {
+ /* Show all hidden nodes */
+ fnPrintShowNodes();
+
+ /* Restore the scroll */
+ window.scrollTo( 0, _iPrintScroll );
+
+ /* Drop the print message */
+ if ( _nPrintMessage )
+ {
+ document.body.removeChild( _nPrintMessage );
+ _nPrintMessage = null;
+ }
+
+ /* Restore the table length */
+ _DTSettings._iDisplayStart = _iPrintSaveStart;
+ _DTSettings._iDisplayLength = _iPrintSaveLength;
+ _DTSettings.oApi._fnCalculateEnd( _DTSettings );
+ _DTSettings.oApi._fnDraw( _DTSettings );
+
+ $(document).unbind( "keydown", fnPrintEnd );
+ }
+ }
+
+
+ /*
+ * Function: fnPrintShowNodes
+ * Purpose: Resume the display of all TableTools hidden nodes
+ * Returns: -
+ * Inputs: -
+ */
+ function fnPrintShowNodes( )
+ {
+ for ( var i=0, iLen=_aoPrintHidden.length ; i= 8 && iIndex > aData[i].length - 8 )
+ {
+ sInner = aData[i].substr( iIndex );
+ aData[i] = aData[i].substr( 0, iIndex );
+ }
+
+ n.innerHTML = aData[i];
+ sReturn += n.childNodes[0].nodeValue;
+ }
+
+ return sReturn;
+ }
+
+
+ //function fnHtmlDecode( sData )
+ //{
+ // var n = document.createElement('div');
+ // n.innerHTML = sData;
+ // return n.childNodes[0].nodeValue;
+ //}
+
+
+ /*
+ * Function: fnChunkData
+ * Purpose: Break a string up into an array of smaller strings
+ * Returns: array strings: - string array
+ * Inputs: string:sData - data to be broken up
+ * int:iSize - chunk size
+ */
+ function fnChunkData( sData, iSize )
+ {
+ var asReturn = [];
+ var iStrlen = sData.length;
+
+ for ( var i=0 ; i/g, "" );
+ if ( sLoopData.indexOf( '&' ) != -1 )
+ {
+ sLoopData = fnHtmlDecode( sLoopData );
+ }
+
+ sData += fnBoundData( sLoopData, sBoundary, regex ) + sSeperator;
+ }
+ }
+ sData = sData.slice( 0, sSeperator.length*-1 );
+ sData += sNewline;
+
+ /* Rows */
+ for ( j=0, jLen=_DTSettings.aiDisplay.length ; j]+)).*?>/gi, '$1$2$3')
+ sLoopData = sLoopData.replace( /<.*?>/g, "" );
+ }
+ else
+ {
+ sLoopData = mTypeData+"";
+ }
+
+ /* Trim and clean the data */
+ sLoopData = sLoopData.replace(/^\s+/, '').replace(/\s+$/, '');
+ if ( sLoopData.indexOf( '&' ) != -1 )
+ {
+ sLoopData = fnHtmlDecode( sLoopData );
+ }
+
+ /* Bound it and add it to the total data */
+ sData += fnBoundData( sLoopData, sBoundary, regex ) + sSeperator;
+ }
+ }
+ sData = sData.slice( 0, sSeperator.length*-1 );
+ sData += sNewline;
+ }
+
+ /* Remove the last new line */
+ sData.slice( 0, -1 );
+
+ /* Add the footer */
+ if ( _oSettings.bIncFooter )
+ {
+ for ( i=0, iLen=_DTSettings.aoColumns.length ; i/g, "" );
+ if ( sLoopData.indexOf( '&' ) != -1 )
+ {
+ sLoopData = fnHtmlDecode( sLoopData );
+ }
+
+ sData += fnBoundData( sLoopData, sBoundary, regex ) + sSeperator;
+ }
+ }
+ sData = sData.slice( 0, sSeperator.length*-1 );
+ }
+
+ /* No pointers here - this is a string copy :-) */
+ _sLastData = sData;
+ return sData;
+ }
+
+
+ /* Initialise our new object */
+ return _fnInit( oInit );
+}
+
+
+/*
+ * Register a new feature with DataTables
+ */
+if ( typeof $.fn.dataTable == "function" && typeof $.fn.dataTableExt.sVersion != "undefined" )
+{
+ $.fn.dataTableExt.aoFeatures.push( {
+ "fnInit": function( oSettings ) {
+ return new TableTools( { "oDTSettings": oSettings } );
+ },
+ "cFeature": "T",
+ "sFeature": "TableTools"
+ } );
+}
+else
+{
+ alert( "Warning: TableTools requires DataTables 1.5 or greater - "+
+ "www.datatables.net/download");
+}
+})(jQuery);
diff --git a/src/Umbraco.Web.UI/Umbraco/plugins/umbracoContour/scripts/ZeroClipboard.js b/src/Umbraco.Web.UI/Umbraco/plugins/umbracoContour/scripts/ZeroClipboard.js
new file mode 100644
index 0000000000..7e91b12ffc
--- /dev/null
+++ b/src/Umbraco.Web.UI/Umbraco/plugins/umbracoContour/scripts/ZeroClipboard.js
@@ -0,0 +1,340 @@
+// Simple Set Clipboard System
+// Author: Joseph Huckaby
+
+var ZeroClipboard = {
+
+ version: "1.0.4-mod",
+ clients: {}, // registered upload clients on page, indexed by id
+ moviePath: 'ZeroClipboard.swf', // URL to movie
+ nextId: 1, // ID of next movie
+
+ $: function(thingy) {
+ // simple DOM lookup utility function
+ if (typeof(thingy) == 'string') thingy = document.getElementById(thingy);
+ if (!thingy.addClass) {
+ // extend element with a few useful methods
+ thingy.hide = function() { this.style.display = 'none'; };
+ thingy.show = function() { this.style.display = ''; };
+ thingy.addClass = function(name) { this.removeClass(name); this.className += ' ' + name; };
+ thingy.removeClass = function(name) {
+ this.className = this.className.replace( new RegExp("\\s*" + name + "\\s*"), " ").replace(/^\s+/, '').replace(/\s+$/, '');
+ };
+ thingy.hasClass = function(name) {
+ return !!this.className.match( new RegExp("\\s*" + name + "\\s*") );
+ }
+ }
+ return thingy;
+ },
+
+ setMoviePath: function(path) {
+ // set path to ZeroClipboard.swf
+ this.moviePath = path;
+ },
+
+ dispatch: function(id, eventName, args) {
+ // receive event from flash movie, send to client
+ var client = this.clients[id];
+ if (client) {
+ client.receiveEvent(eventName, args);
+ }
+ },
+
+ register: function(id, client) {
+ // register new client to receive events
+ this.clients[id] = client;
+ },
+
+ getDOMObjectPosition: function(obj) {
+ // get absolute coordinates for dom element
+ var info = {
+ left: 0,
+ top: 0,
+ width: obj.width ? obj.width : obj.offsetWidth,
+ height: obj.height ? obj.height : obj.offsetHeight
+ };
+
+ if ( obj.style.width != "" )
+ info.width = obj.style.width.replace("px","");
+
+ if ( obj.style.height != "" )
+ info.height = obj.style.height.replace("px","");
+
+ while (obj) {
+ info.left += obj.offsetLeft;
+ info.top += obj.offsetTop;
+ obj = obj.offsetParent;
+ }
+
+ return info;
+ },
+
+ Client: function(elem) {
+ // constructor for new simple upload client
+ this.handlers = {};
+
+ // unique ID
+ this.id = ZeroClipboard.nextId++;
+ this.movieId = 'ZeroClipboardMovie_' + this.id;
+
+ // register client with singleton to receive flash events
+ ZeroClipboard.register(this.id, this);
+
+ // create movie
+ if (elem) this.glue(elem);
+ }
+};
+
+ZeroClipboard.Client.prototype = {
+
+ id: 0, // unique ID for us
+ ready: false, // whether movie is ready to receive events or not
+ movie: null, // reference to movie object
+ clipText: '', // text to copy to clipboard
+ fileName: '', // default file save name
+ action: 'copy', // action to perform
+ handCursorEnabled: true, // whether to show hand cursor, or default pointer cursor
+ cssEffects: true, // enable CSS mouse effects on dom container
+ handlers: null, // user event handlers
+
+ glue: function(elem, title) {
+ // glue to DOM element
+ // elem can be ID or actual DOM element object
+ this.domElement = ZeroClipboard.$(elem);
+
+ // float just above object, or zIndex 99 if dom element isn't set
+ var zIndex = 99;
+ if (this.domElement.style.zIndex) {
+ zIndex = parseInt(this.domElement.style.zIndex) + 1;
+ }
+
+ // find X/Y position of domElement
+ var box = ZeroClipboard.getDOMObjectPosition(this.domElement);
+
+ // create floating DIV above element
+ this.div = document.createElement('div');
+ var style = this.div.style;
+ style.position = 'absolute';
+ style.left = '0px';
+ style.top = '0px';
+ style.width = '' + box.width + 'px';
+ style.height = '' + box.height + 'px';
+ style.zIndex = zIndex;
+ if ( typeof title != "undefined" ) {
+ this.div.title = title;
+ }
+
+ // style.backgroundColor = '#f00'; // debug
+ this.domElement.appendChild(this.div);
+
+ this.div.innerHTML = this.getHTML( box.width, box.height );
+ },
+
+ getHTML: function(width, height) {
+ // return HTML for movie
+ var html = '';
+ var flashvars = 'id=' + this.id +
+ '&width=' + width +
+ '&height=' + height;
+
+ if (navigator.userAgent.match(/MSIE/)) {
+ // IE gets an OBJECT tag
+ var protocol = location.href.match(/^https/i) ? 'https://' : 'http://';
+ html += '"+$("#fieldcaption").val()+"
";
+
+ var examplefield = GetFieldPreview(fieldtype).replace("{caption}",fieldcaption);
+
+ $(fieldcontainer).append("");
+
+ $("#"+newfieldid).attr('fieldcaption',fieldcaption);
+ $("#"+newfieldid).attr('fieldtype',fieldtype);
+ $("#"+newfieldid).attr('fieldmandatory',fieldmandatory);
+ $("#"+newfieldid).attr('fieldregex',fieldregex);
+
+ //does it have prevalues
+ if($("#fieldtype option:selected").attr('prevalues') == "1")
+ {
+ $("#"+newfieldid).attr('fieldhasprevalues','1');
+ }
+ else
+ {
+ $("#"+newfieldid).attr('fieldhasprevalues','0');
+ }
+
+ myDesignSurface.AddField(fieldsetid,newfieldid,fieldcaption,fieldtype,fieldmandatory,fieldregex);
+
+
+ var prevaluecontainer = '#' + newfieldid + ' .fieldprevalues';
+
+ var previewprevalue = "";
+
+ $("#fieldprevalueslist").children().each(function() {
+ var child = $(this);
+
+ var prevalue = child.children(":first-child").text();
+ var prevalueid = child.attr("id");
+
+ $(prevaluecontainer).append(""+prevalue+"
");
+
+ previewprevalue += GetFieldPrevaluePreview(fieldtype).replace("{caption}",prevalue);
+ //todo
+ //myDesignSurface.AddPrevalue(fieldid,prevalueid,value);
+
+ });
+
+ examplefield = examplefield.replace("{prevalues}",previewprevalue);
+
+
+ $("#"+newfieldid + " .fieldexample").append(examplefield);
+
+ $.modal.close();
+
+
+
+
+
+
+}
+
+
+function ShowUpdateFieldDialog(field)
+{
+ /* Set Captions */
+ $('#FieldModal h1').text(lang_updatefield);
+ $('#FieldModal #fieldform .submit').attr('value',lang_updatefield);
+
+ /* Set Current Values */
+ var fieldcaption = $("#"+field).attr('fieldcaption');
+ $("#fieldcaption").val(fieldcaption);
+
+ var fieldtype = $("#"+field).attr('fieldtype');
+ $("#fieldtype").val(fieldtype);
+
+ var fieldmandatory = $("#"+field).attr('fieldmandatory');
+ if(fieldmandatory == 'true' || fieldmandatory == '1')
+ {
+ $("#fieldmandatory").attr('checked', true);
+ }
+ else
+ {
+ $("#fieldmandatory").attr('checked', false);
+ }
+
+ var fieldregex = $("#"+field).attr('fieldregex');
+ $("#fieldregex").val(fieldregex);
+
+ $('#FieldModal').modal();
+
+ /* Prevalues */
+ $('#fieldprevalueslist').children().remove();
+ if($("#"+field).attr('fieldhasprevalues') == "1")
+ {
+ //Show prevalue part
+ $("#fieldprevalues").show();
+
+ //Populate prevalues
+
+ $('#' + field + " .fieldprevalues").children().each(function() {
+ child = $(this);
+
+ var prevalue =child.text();
+ var prevalueid = "dialog" + child.attr("id");
+
+ $("#fieldprevalueslist").append("" + prevalue + " "+lang_delete+" " + prevalue + "
");
+
+ previewprevalue += GetFieldPrevaluePreview(newtype).replace("{caption}", prevalue);
+ //todo
+ //myDesignSurface.AddPrevalue(fieldid,prevalueid,value);
+
+ });
+
+
+ examplefield = examplefield.replace("{prevalues}", previewprevalue);
+
+
+
+ }
+ else
+ {
+ $("#"+field).attr('fieldhasprevalues','0');
+ }
+
+ $('#' + field + ' .fieldexample').append(examplefield);
+
+ $.modal.close();
+
+ myDesignSurface.UpdateField(field,newcaption,newtype,newmandatory,newregex);
+}
+
+function DeleteField(field)
+{
+ if(ConfirmDelete())
+ {
+ $("#" +field).hide('blind',{},500,function() {
+ $("#" +field).remove();
+ myDesignSurface.DeleteField(field);
+ });
+
+
+ }
+}
+
+function AddPrevalue()
+{
+ var prevalue = $("#fieldnewprevalue").val();
+
+ var prevaluenumber = $("#fieldprevalueslist").children().size() + 1;
+
+ var prevalueid = "prevalue_" + prevaluenumber;
+
+ if(prevalue.length > 0)
+ {
+ $("#fieldprevalueslist").append("" + prevalue + " "+lang_delete+" =0||o.inArray(this.name,K)>=0)}else{if(o.nodeName(this,"select")){var N=o.makeArray(K);o("option",this).each(function(){this.selected=(o.inArray(this.value,N)>=0||o.inArray(this.text,N)>=0)});if(!N.length){this.selectedIndex=-1}}else{this.value=K}}})},html:function(E){return E===g?(this[0]?this[0].innerHTML.replace(/ jQuery\d+="(?:\d+|null)"/g,""):null):this.empty().append(E)},replaceWith:function(E){return this.after(E).remove()},eq:function(E){return this.slice(E,+E+1)},slice:function(){return this.pushStack(Array.prototype.slice.apply(this,arguments),"slice",Array.prototype.slice.call(arguments).join(","))},map:function(E){return this.pushStack(o.map(this,function(G,F){return E.call(G,F,G)}))},andSelf:function(){return this.add(this.prevObject)},domManip:function(J,M,L){if(this[0]){var I=(this[0].ownerDocument||this[0]).createDocumentFragment(),F=o.clean(J,(this[0].ownerDocument||this[0]),I),H=I.firstChild;if(H){for(var G=0,E=this.length;G1||G>0?I.cloneNode(true):I)}}if(F){o.each(F,z)}}return this;function K(N,O){return M&&o.nodeName(N,"table")&&o.nodeName(O,"tr")?(N.getElementsByTagName("tbody")[0]||N.appendChild(N.ownerDocument.createElement("tbody"))):N}}};o.fn.init.prototype=o.fn;function z(E,F){if(F.src){o.ajax({url:F.src,async:false,dataType:"script"})}else{o.globalEval(F.text||F.textContent||F.innerHTML||"")}if(F.parentNode){F.parentNode.removeChild(F)}}function e(){return +new Date}o.extend=o.fn.extend=function(){var J=arguments[0]||{},H=1,I=arguments.length,E=false,G;if(typeof J==="boolean"){E=J;J=arguments[1]||{};H=2}if(typeof J!=="object"&&!o.isFunction(J)){J={}}if(I==H){J=this;--H}for(;H-1}},swap:function(H,G,I){var E={};for(var F in G){E[F]=H.style[F];H.style[F]=G[F]}I.call(H);for(var F in G){H.style[F]=E[F]}},css:function(H,F,J,E){if(F=="width"||F=="height"){var L,G={position:"absolute",visibility:"hidden",display:"block"},K=F=="width"?["Left","Right"]:["Top","Bottom"];function I(){L=F=="width"?H.offsetWidth:H.offsetHeight;if(E==="border"){return}o.each(K,function(){if(!E){L-=parseFloat(o.curCSS(H,"padding"+this,true))||0}if(E==="margin"){L+=parseFloat(o.curCSS(H,"margin"+this,true))||0}else{L-=parseFloat(o.curCSS(H,"border"+this+"Width",true))||0}})}if(H.offsetWidth!==0){I()}else{o.swap(H,G,I)}return Math.max(0,Math.round(L))}return o.curCSS(H,F,J)},curCSS:function(I,F,G){var L,E=I.style;if(F=="opacity"&&!o.support.opacity){L=o.attr(E,"opacity");return L==""?"1":L}if(F.match(/float/i)){F=w}if(!G&&E&&E[F]){L=E[F]}else{if(q.getComputedStyle){if(F.match(/float/i)){F="float"}F=F.replace(/([A-Z])/g,"-$1").toLowerCase();var M=q.getComputedStyle(I,null);if(M){L=M.getPropertyValue(F)}if(F=="opacity"&&L==""){L="1"}}else{if(I.currentStyle){var J=F.replace(/\-(\w)/g,function(N,O){return O.toUpperCase()});L=I.currentStyle[F]||I.currentStyle[J];if(!/^\d+(px)?$/i.test(L)&&/^\d/.test(L)){var H=E.left,K=I.runtimeStyle.left;I.runtimeStyle.left=I.currentStyle.left;E.left=L||0;L=E.pixelLeft+"px";E.left=H;I.runtimeStyle.left=K}}}}return L},clean:function(F,K,I){K=K||document;if(typeof K.createElement==="undefined"){K=K.ownerDocument||K[0]&&K[0].ownerDocument||document}if(!I&&F.length===1&&typeof F[0]==="string"){var H=/^<(\w+)\s*\/?>$/.exec(F[0]);if(H){return[K.createElement(H[1])]}}var G=[],E=[],L=K.createElement("div");o.each(F,function(P,S){if(typeof S==="number"){S+=""}if(!S){return}if(typeof S==="string"){S=S.replace(/(<(\w+)[^>]*?)\/>/g,function(U,V,T){return T.match(/^(abbr|br|col|img|input|link|meta|param|hr|area|embed)$/i)?U:V+">"});var O=S.replace(/^\s+/,"").substring(0,10).toLowerCase();var Q=!O.indexOf("",""]||!O.indexOf("",""]||O.match(/^<(thead|tbody|tfoot|colg|cap)/)&&[1,""]||!O.indexOf(""," "]||(!O.indexOf(""," "," "]||!o.support.htmlSerialize&&[1,"div","
"]||[0,"",""];L.innerHTML=Q[1]+S+Q[2];while(Q[0]--){L=L.lastChild}if(!o.support.tbody){var R=/"&&!R?L.childNodes:[];for(var M=N.length-1;M>=0;--M){if(o.nodeName(N[M],"tbody")&&!N[M].childNodes.length){N[M].parentNode.removeChild(N[M])}}}if(!o.support.leadingWhitespace&&/^\s/.test(S)){L.insertBefore(K.createTextNode(S.match(/^\s*/)[0]),L.firstChild)}S=o.makeArray(L.childNodes)}if(S.nodeType){G.push(S)}else{G=o.merge(G,S)}});if(I){for(var J=0;G[J];J++){if(o.nodeName(G[J],"script")&&(!G[J].type||G[J].type.toLowerCase()==="text/javascript")){E.push(G[J].parentNode?G[J].parentNode.removeChild(G[J]):G[J])}else{if(G[J].nodeType===1){G.splice.apply(G,[J+1,0].concat(o.makeArray(G[J].getElementsByTagName("script"))))}I.appendChild(G[J])}}return E}return G},attr:function(J,G,K){if(!J||J.nodeType==3||J.nodeType==8){return g}var H=!o.isXMLDoc(J),L=K!==g;G=H&&o.props[G]||G;if(J.tagName){var F=/href|src|style/.test(G);if(G=="selected"&&J.parentNode){J.parentNode.selectedIndex}if(G in J&&H&&!F){if(L){if(G=="type"&&o.nodeName(J,"input")&&J.parentNode){throw"type property can't be changed"}J[G]=K}if(o.nodeName(J,"form")&&J.getAttributeNode(G)){return J.getAttributeNode(G).nodeValue}if(G=="tabIndex"){var I=J.getAttributeNode("tabIndex");return I&&I.specified?I.value:J.nodeName.match(/(button|input|object|select|textarea)/i)?0:J.nodeName.match(/^(a|area)$/i)&&J.href?0:g}return J[G]}if(!o.support.style&&H&&G=="style"){return o.attr(J.style,"cssText",K)}if(L){J.setAttribute(G,""+K)}var E=!o.support.hrefNormalized&&H&&F?J.getAttribute(G,2):J.getAttribute(G);return E===null?g:E}if(!o.support.opacity&&G=="opacity"){if(L){J.zoom=1;J.filter=(J.filter||"").replace(/alpha\([^)]*\)/,"")+(parseInt(K)+""=="NaN"?"":"alpha(opacity="+K*100+")")}return J.filter&&J.filter.indexOf("opacity=")>=0?(parseFloat(J.filter.match(/opacity=([^)]*)/)[1])/100)+"":""}G=G.replace(/-([a-z])/ig,function(M,N){return N.toUpperCase()});if(L){J[G]=K}return J[G]},trim:function(E){return(E||"").replace(/^\s+|\s+$/g,"")},makeArray:function(G){var E=[];if(G!=null){var F=G.length;if(F==null||typeof G==="string"||o.isFunction(G)||G.setInterval){E[0]=G}else{while(F){E[--F]=G[F]}}}return E},inArray:function(G,H){for(var E=0,F=H.length;E0?this.clone(true):this).get();o.fn[F].apply(o(L[K]),I);J=J.concat(I)}return this.pushStack(J,E,G)}});o.each({removeAttr:function(E){o.attr(this,E,"");if(this.nodeType==1){this.removeAttribute(E)}},addClass:function(E){o.className.add(this,E)},removeClass:function(E){o.className.remove(this,E)},toggleClass:function(F,E){if(typeof E!=="boolean"){E=!o.className.has(this,F)}o.className[E?"add":"remove"](this,F)},remove:function(E){if(!E||o.filter(E,[this]).length){o("*",this).add([this]).each(function(){o.event.remove(this);o.removeData(this)});if(this.parentNode){this.parentNode.removeChild(this)}}},empty:function(){o(this).children().remove();while(this.firstChild){this.removeChild(this.firstChild)}}},function(E,F){o.fn[E]=function(){return this.each(F,arguments)}});function j(E,F){return E[0]&&parseInt(o.curCSS(E[0],F,true),10)||0}var h="jQuery"+e(),v=0,A={};o.extend({cache:{},data:function(F,E,G){F=F==l?A:F;var H=F[h];if(!H){H=F[h]=++v}if(E&&!o.cache[H]){o.cache[H]={}}if(G!==g){o.cache[H][E]=G}return E?o.cache[H][E]:H},removeData:function(F,E){F=F==l?A:F;var H=F[h];if(E){if(o.cache[H]){delete o.cache[H][E];E="";for(E in o.cache[H]){break}if(!E){o.removeData(F)}}}else{try{delete F[h]}catch(G){if(F.removeAttribute){F.removeAttribute(h)}}delete o.cache[H]}},queue:function(F,E,H){if(F){E=(E||"fx")+"queue";var G=o.data(F,E);if(!G||o.isArray(H)){G=o.data(F,E,o.makeArray(H))}else{if(H){G.push(H)}}}return G},dequeue:function(H,G){var E=o.queue(H,G),F=E.shift();if(!G||G==="fx"){F=E[0]}if(F!==g){F.call(H)}}});o.fn.extend({data:function(E,G){var H=E.split(".");H[1]=H[1]?"."+H[1]:"";if(G===g){var F=this.triggerHandler("getData"+H[1]+"!",[H[0]]);if(F===g&&this.length){F=o.data(this[0],E)}return F===g&&H[1]?this.data(H[0]):F}else{return this.trigger("setData"+H[1]+"!",[H[0],G]).each(function(){o.data(this,E,G)})}},removeData:function(E){return this.each(function(){o.removeData(this,E)})},queue:function(E,F){if(typeof E!=="string"){F=E;E="fx"}if(F===g){return o.queue(this[0],E)}return this.each(function(){var G=o.queue(this,E,F);if(E=="fx"&&G.length==1){G[0].call(this)}})},dequeue:function(E){return this.each(function(){o.dequeue(this,E)})}});
+/*
+ * Sizzle CSS Selector Engine - v0.9.3
+ * Copyright 2009, The Dojo Foundation
+ * Released under the MIT, BSD, and GPL Licenses.
+ * More information: http://sizzlejs.com/
+ */
+(function(){var R=/((?:\((?:\([^()]+\)|[^()]+)+\)|\[(?:\[[^[\]]*\]|['"][^'"]*['"]|[^[\]'"]+)+\]|\\.|[^ >+~,(\[\\]+)+|[>+~])(\s*,\s*)?/g,L=0,H=Object.prototype.toString;var F=function(Y,U,ab,ac){ab=ab||[];U=U||document;if(U.nodeType!==1&&U.nodeType!==9){return[]}if(!Y||typeof Y!=="string"){return ab}var Z=[],W,af,ai,T,ad,V,X=true;R.lastIndex=0;while((W=R.exec(Y))!==null){Z.push(W[1]);if(W[2]){V=RegExp.rightContext;break}}if(Z.length>1&&M.exec(Y)){if(Z.length===2&&I.relative[Z[0]]){af=J(Z[0]+Z[1],U)}else{af=I.relative[Z[0]]?[U]:F(Z.shift(),U);while(Z.length){Y=Z.shift();if(I.relative[Y]){Y+=Z.shift()}af=J(Y,af)}}}else{var ae=ac?{expr:Z.pop(),set:E(ac)}:F.find(Z.pop(),Z.length===1&&U.parentNode?U.parentNode:U,Q(U));af=F.filter(ae.expr,ae.set);if(Z.length>0){ai=E(af)}else{X=false}while(Z.length){var ah=Z.pop(),ag=ah;if(!I.relative[ah]){ah=""}else{ag=Z.pop()}if(ag==null){ag=U}I.relative[ah](ai,ag,Q(U))}}if(!ai){ai=af}if(!ai){throw"Syntax error, unrecognized expression: "+(ah||Y)}if(H.call(ai)==="[object Array]"){if(!X){ab.push.apply(ab,ai)}else{if(U.nodeType===1){for(var aa=0;ai[aa]!=null;aa++){if(ai[aa]&&(ai[aa]===true||ai[aa].nodeType===1&&K(U,ai[aa]))){ab.push(af[aa])}}}else{for(var aa=0;ai[aa]!=null;aa++){if(ai[aa]&&ai[aa].nodeType===1){ab.push(af[aa])}}}}}else{E(ai,ab)}if(V){F(V,U,ab,ac);if(G){hasDuplicate=false;ab.sort(G);if(hasDuplicate){for(var aa=1;aa":function(Z,U,aa){var X=typeof U==="string";if(X&&!/\W/.test(U)){U=aa?U:U.toUpperCase();for(var V=0,T=Z.length;V=0)){if(!V){T.push(Y)}}else{if(V){U[X]=false}}}}return false},ID:function(T){return T[1].replace(/\\/g,"")},TAG:function(U,T){for(var V=0;T[V]===false;V++){}return T[V]&&Q(T[V])?U[1]:U[1].toUpperCase()},CHILD:function(T){if(T[1]=="nth"){var U=/(-?)(\d*)n((?:\+|-)?\d*)/.exec(T[2]=="even"&&"2n"||T[2]=="odd"&&"2n+1"||!/\D/.test(T[2])&&"0n+"+T[2]||T[2]);T[2]=(U[1]+(U[2]||1))-0;T[3]=U[3]-0}T[0]=L++;return T},ATTR:function(X,U,V,T,Y,Z){var W=X[1].replace(/\\/g,"");if(!Z&&I.attrMap[W]){X[1]=I.attrMap[W]}if(X[2]==="~="){X[4]=" "+X[4]+" "}return X},PSEUDO:function(X,U,V,T,Y){if(X[1]==="not"){if(X[3].match(R).length>1||/^\w/.test(X[3])){X[3]=F(X[3],null,null,U)}else{var W=F.filter(X[3],U,V,true^Y);if(!V){T.push.apply(T,W)}return false}}else{if(I.match.POS.test(X[0])||I.match.CHILD.test(X[0])){return true}}return X},POS:function(T){T.unshift(true);return T}},filters:{enabled:function(T){return T.disabled===false&&T.type!=="hidden"},disabled:function(T){return T.disabled===true},checked:function(T){return T.checked===true},selected:function(T){T.parentNode.selectedIndex;return T.selected===true},parent:function(T){return !!T.firstChild},empty:function(T){return !T.firstChild},has:function(V,U,T){return !!F(T[3],V).length},header:function(T){return/h\d/i.test(T.nodeName)},text:function(T){return"text"===T.type},radio:function(T){return"radio"===T.type},checkbox:function(T){return"checkbox"===T.type},file:function(T){return"file"===T.type},password:function(T){return"password"===T.type},submit:function(T){return"submit"===T.type},image:function(T){return"image"===T.type},reset:function(T){return"reset"===T.type},button:function(T){return"button"===T.type||T.nodeName.toUpperCase()==="BUTTON"},input:function(T){return/input|select|textarea|button/i.test(T.nodeName)}},setFilters:{first:function(U,T){return T===0},last:function(V,U,T,W){return U===W.length-1},even:function(U,T){return T%2===0},odd:function(U,T){return T%2===1},lt:function(V,U,T){return UT[3]-0},nth:function(V,U,T){return T[3]-0==U},eq:function(V,U,T){return T[3]-0==U}},filter:{PSEUDO:function(Z,V,W,aa){var U=V[1],X=I.filters[U];if(X){return X(Z,W,V,aa)}else{if(U==="contains"){return(Z.textContent||Z.innerText||"").indexOf(V[3])>=0}else{if(U==="not"){var Y=V[3];for(var W=0,T=Y.length;W=0)}}},ID:function(U,T){return U.nodeType===1&&U.getAttribute("id")===T},TAG:function(U,T){return(T==="*"&&U.nodeType===1)||U.nodeName===T},CLASS:function(U,T){return(" "+(U.className||U.getAttribute("class"))+" ").indexOf(T)>-1},ATTR:function(Y,W){var V=W[1],T=I.attrHandle[V]?I.attrHandle[V](Y):Y[V]!=null?Y[V]:Y.getAttribute(V),Z=T+"",X=W[2],U=W[4];return T==null?X==="!=":X==="="?Z===U:X==="*="?Z.indexOf(U)>=0:X==="~="?(" "+Z+" ").indexOf(U)>=0:!U?Z&&T!==false:X==="!="?Z!=U:X==="^="?Z.indexOf(U)===0:X==="$="?Z.substr(Z.length-U.length)===U:X==="|="?Z===U||Z.substr(0,U.length+1)===U+"-":false},POS:function(X,U,V,Y){var T=U[2],W=I.setFilters[T];if(W){return W(X,V,U,Y)}}}};var M=I.match.POS;for(var O in I.match){I.match[O]=RegExp(I.match[O].source+/(?![^\[]*\])(?![^\(]*\))/.source)}var E=function(U,T){U=Array.prototype.slice.call(U);if(T){T.push.apply(T,U);return T}return U};try{Array.prototype.slice.call(document.documentElement.childNodes)}catch(N){E=function(X,W){var U=W||[];if(H.call(X)==="[object Array]"){Array.prototype.push.apply(U,X)}else{if(typeof X.length==="number"){for(var V=0,T=X.length;V
";if(U.querySelectorAll&&U.querySelectorAll(".TEST").length===0){return}F=function(Y,X,V,W){X=X||document;if(!W&&X.nodeType===9&&!Q(X)){try{return E(X.querySelectorAll(Y),V)}catch(Z){}}return T(Y,X,V,W)};F.find=T.find;F.filter=T.filter;F.selectors=T.selectors;F.matches=T.matches})()}if(document.getElementsByClassName&&document.documentElement.getElementsByClassName){(function(){var T=document.createElement("div");T.innerHTML="
";if(T.getElementsByClassName("e").length===0){return}T.lastChild.className="e";if(T.getElementsByClassName("e").length===1){return}I.order.splice(1,0,"CLASS");I.find.CLASS=function(U,V,W){if(typeof V.getElementsByClassName!=="undefined"&&!W){return V.getElementsByClassName(U[1])}}})()}function P(U,Z,Y,ad,aa,ac){var ab=U=="previousSibling"&&!ac;for(var W=0,V=ad.length;W0){X=T;break}}}T=T[U]}ad[W]=X}}}var K=document.compareDocumentPosition?function(U,T){return U.compareDocumentPosition(T)&16}:function(U,T){return U!==T&&(U.contains?U.contains(T):true)};var Q=function(T){return T.nodeType===9&&T.documentElement.nodeName!=="HTML"||!!T.ownerDocument&&Q(T.ownerDocument)};var J=function(T,aa){var W=[],X="",Y,V=aa.nodeType?[aa]:aa;while((Y=I.match.PSEUDO.exec(T))){X+=Y[0];T=T.replace(I.match.PSEUDO,"")}T=I.relative[T]?T+"*":T;for(var Z=0,U=V.length;Z0||T.offsetHeight>0};F.selectors.filters.animated=function(T){return o.grep(o.timers,function(U){return T===U.elem}).length};o.multiFilter=function(V,T,U){if(U){V=":not("+V+")"}return F.matches(V,T)};o.dir=function(V,U){var T=[],W=V[U];while(W&&W!=document){if(W.nodeType==1){T.push(W)}W=W[U]}return T};o.nth=function(X,T,V,W){T=T||1;var U=0;for(;X;X=X[V]){if(X.nodeType==1&&++U==T){break}}return X};o.sibling=function(V,U){var T=[];for(;V;V=V.nextSibling){if(V.nodeType==1&&V!=U){T.push(V)}}return T};return;l.Sizzle=F})();o.event={add:function(I,F,H,K){if(I.nodeType==3||I.nodeType==8){return}if(I.setInterval&&I!=l){I=l}if(!H.guid){H.guid=this.guid++}if(K!==g){var G=H;H=this.proxy(G);H.data=K}var E=o.data(I,"events")||o.data(I,"events",{}),J=o.data(I,"handle")||o.data(I,"handle",function(){return typeof o!=="undefined"&&!o.event.triggered?o.event.handle.apply(arguments.callee.elem,arguments):g});J.elem=I;o.each(F.split(/\s+/),function(M,N){var O=N.split(".");N=O.shift();H.type=O.slice().sort().join(".");var L=E[N];if(o.event.specialAll[N]){o.event.specialAll[N].setup.call(I,K,O)}if(!L){L=E[N]={};if(!o.event.special[N]||o.event.special[N].setup.call(I,K,O)===false){if(I.addEventListener){I.addEventListener(N,J,false)}else{if(I.attachEvent){I.attachEvent("on"+N,J)}}}}L[H.guid]=H;o.event.global[N]=true});I=null},guid:1,global:{},remove:function(K,H,J){if(K.nodeType==3||K.nodeType==8){return}var G=o.data(K,"events"),F,E;if(G){if(H===g||(typeof H==="string"&&H.charAt(0)==".")){for(var I in G){this.remove(K,I+(H||""))}}else{if(H.type){J=H.handler;H=H.type}o.each(H.split(/\s+/),function(M,O){var Q=O.split(".");O=Q.shift();var N=RegExp("(^|\\.)"+Q.slice().sort().join(".*\\.")+"(\\.|$)");if(G[O]){if(J){delete G[O][J.guid]}else{for(var P in G[O]){if(N.test(G[O][P].type)){delete G[O][P]}}}if(o.event.specialAll[O]){o.event.specialAll[O].teardown.call(K,Q)}for(F in G[O]){break}if(!F){if(!o.event.special[O]||o.event.special[O].teardown.call(K,Q)===false){if(K.removeEventListener){K.removeEventListener(O,o.data(K,"handle"),false)}else{if(K.detachEvent){K.detachEvent("on"+O,o.data(K,"handle"))}}}F=null;delete G[O]}}})}for(F in G){break}if(!F){var L=o.data(K,"handle");if(L){L.elem=null}o.removeData(K,"events");o.removeData(K,"handle")}}},trigger:function(I,K,H,E){var G=I.type||I;if(!E){I=typeof I==="object"?I[h]?I:o.extend(o.Event(G),I):o.Event(G);if(G.indexOf("!")>=0){I.type=G=G.slice(0,-1);I.exclusive=true}if(!H){I.stopPropagation();if(this.global[G]){o.each(o.cache,function(){if(this.events&&this.events[G]){o.event.trigger(I,K,this.handle.elem)}})}}if(!H||H.nodeType==3||H.nodeType==8){return g}I.result=g;I.target=H;K=o.makeArray(K);K.unshift(I)}I.currentTarget=H;var J=o.data(H,"handle");if(J){J.apply(H,K)}if((!H[G]||(o.nodeName(H,"a")&&G=="click"))&&H["on"+G]&&H["on"+G].apply(H,K)===false){I.result=false}if(!E&&H[G]&&!I.isDefaultPrevented()&&!(o.nodeName(H,"a")&&G=="click")){this.triggered=true;try{H[G]()}catch(L){}}this.triggered=false;if(!I.isPropagationStopped()){var F=H.parentNode||H.ownerDocument;if(F){o.event.trigger(I,K,F,true)}}},handle:function(K){var J,E;K=arguments[0]=o.event.fix(K||l.event);K.currentTarget=this;var L=K.type.split(".");K.type=L.shift();J=!L.length&&!K.exclusive;var I=RegExp("(^|\\.)"+L.slice().sort().join(".*\\.")+"(\\.|$)");E=(o.data(this,"events")||{})[K.type];for(var G in E){var H=E[G];if(J||I.test(H.type)){K.handler=H;K.data=H.data;var F=H.apply(this,arguments);if(F!==g){K.result=F;if(F===false){K.preventDefault();K.stopPropagation()}}if(K.isImmediatePropagationStopped()){break}}}},props:"altKey attrChange attrName bubbles button cancelable charCode clientX clientY ctrlKey currentTarget data detail eventPhase fromElement handler keyCode metaKey newValue originalTarget pageX pageY prevValue relatedNode relatedTarget screenX screenY shiftKey srcElement target toElement view wheelDelta which".split(" "),fix:function(H){if(H[h]){return H}var F=H;H=o.Event(F);for(var G=this.props.length,J;G;){J=this.props[--G];H[J]=F[J]}if(!H.target){H.target=H.srcElement||document}if(H.target.nodeType==3){H.target=H.target.parentNode}if(!H.relatedTarget&&H.fromElement){H.relatedTarget=H.fromElement==H.target?H.toElement:H.fromElement}if(H.pageX==null&&H.clientX!=null){var I=document.documentElement,E=document.body;H.pageX=H.clientX+(I&&I.scrollLeft||E&&E.scrollLeft||0)-(I.clientLeft||0);H.pageY=H.clientY+(I&&I.scrollTop||E&&E.scrollTop||0)-(I.clientTop||0)}if(!H.which&&((H.charCode||H.charCode===0)?H.charCode:H.keyCode)){H.which=H.charCode||H.keyCode}if(!H.metaKey&&H.ctrlKey){H.metaKey=H.ctrlKey}if(!H.which&&H.button){H.which=(H.button&1?1:(H.button&2?3:(H.button&4?2:0)))}return H},proxy:function(F,E){E=E||function(){return F.apply(this,arguments)};E.guid=F.guid=F.guid||E.guid||this.guid++;return E},special:{ready:{setup:B,teardown:function(){}}},specialAll:{live:{setup:function(E,F){o.event.add(this,F[0],c)},teardown:function(G){if(G.length){var E=0,F=RegExp("(^|\\.)"+G[0]+"(\\.|$)");o.each((o.data(this,"events").live||{}),function(){if(F.test(this.type)){E++}});if(E<1){o.event.remove(this,G[0],c)}}}}}};o.Event=function(E){if(!this.preventDefault){return new o.Event(E)}if(E&&E.type){this.originalEvent=E;this.type=E.type}else{this.type=E}this.timeStamp=e();this[h]=true};function k(){return false}function u(){return true}o.Event.prototype={preventDefault:function(){this.isDefaultPrevented=u;var E=this.originalEvent;if(!E){return}if(E.preventDefault){E.preventDefault()}E.returnValue=false},stopPropagation:function(){this.isPropagationStopped=u;var E=this.originalEvent;if(!E){return}if(E.stopPropagation){E.stopPropagation()}E.cancelBubble=true},stopImmediatePropagation:function(){this.isImmediatePropagationStopped=u;this.stopPropagation()},isDefaultPrevented:k,isPropagationStopped:k,isImmediatePropagationStopped:k};var a=function(F){var E=F.relatedTarget;while(E&&E!=this){try{E=E.parentNode}catch(G){E=this}}if(E!=this){F.type=F.data;o.event.handle.apply(this,arguments)}};o.each({mouseover:"mouseenter",mouseout:"mouseleave"},function(F,E){o.event.special[E]={setup:function(){o.event.add(this,F,a,E)},teardown:function(){o.event.remove(this,F,a)}}});o.fn.extend({bind:function(F,G,E){return F=="unload"?this.one(F,G,E):this.each(function(){o.event.add(this,F,E||G,E&&G)})},one:function(G,H,F){var E=o.event.proxy(F||H,function(I){o(this).unbind(I,E);return(F||H).apply(this,arguments)});return this.each(function(){o.event.add(this,G,E,F&&H)})},unbind:function(F,E){return this.each(function(){o.event.remove(this,F,E)})},trigger:function(E,F){return this.each(function(){o.event.trigger(E,F,this)})},triggerHandler:function(E,G){if(this[0]){var F=o.Event(E);F.preventDefault();F.stopPropagation();o.event.trigger(F,G,this[0]);return F.result}},toggle:function(G){var E=arguments,F=1;while(F=0){var E=G.slice(I,G.length);G=G.slice(0,I)}var H="GET";if(J){if(o.isFunction(J)){K=J;J=null}else{if(typeof J==="object"){J=o.param(J);H="POST"}}}var F=this;o.ajax({url:G,type:H,dataType:"html",data:J,complete:function(M,L){if(L=="success"||L=="notmodified"){F.html(E?o("
").append(M.responseText.replace(//g,"")).find(E):M.responseText)}if(K){F.each(K,[M.responseText,L,M])}}});return this},serialize:function(){return o.param(this.serializeArray())},serializeArray:function(){return this.map(function(){return this.elements?o.makeArray(this.elements):this}).filter(function(){return this.name&&!this.disabled&&(this.checked||/select|textarea/i.test(this.nodeName)||/text|hidden|password|search/i.test(this.type))}).map(function(E,F){var G=o(this).val();return G==null?null:o.isArray(G)?o.map(G,function(I,H){return{name:F.name,value:I}}):{name:F.name,value:G}}).get()}});o.each("ajaxStart,ajaxStop,ajaxComplete,ajaxError,ajaxSuccess,ajaxSend".split(","),function(E,F){o.fn[F]=function(G){return this.bind(F,G)}});var r=e();o.extend({get:function(E,G,H,F){if(o.isFunction(G)){H=G;G=null}return o.ajax({type:"GET",url:E,data:G,success:H,dataType:F})},getScript:function(E,F){return o.get(E,null,F,"script")},getJSON:function(E,F,G){return o.get(E,F,G,"json")},post:function(E,G,H,F){if(o.isFunction(G)){H=G;G={}}return o.ajax({type:"POST",url:E,data:G,success:H,dataType:F})},ajaxSetup:function(E){o.extend(o.ajaxSettings,E)},ajaxSettings:{url:location.href,global:true,type:"GET",contentType:"application/x-www-form-urlencoded",processData:true,async:true,xhr:function(){return l.ActiveXObject?new ActiveXObject("Microsoft.XMLHTTP"):new XMLHttpRequest()},accepts:{xml:"application/xml, text/xml",html:"text/html",script:"text/javascript, application/javascript",json:"application/json, text/javascript",text:"text/plain",_default:"*/*"}},lastModified:{},ajax:function(M){M=o.extend(true,M,o.extend(true,{},o.ajaxSettings,M));var W,F=/=\?(&|$)/g,R,V,G=M.type.toUpperCase();if(M.data&&M.processData&&typeof M.data!=="string"){M.data=o.param(M.data)}if(M.dataType=="jsonp"){if(G=="GET"){if(!M.url.match(F)){M.url+=(M.url.match(/\?/)?"&":"?")+(M.jsonp||"callback")+"=?"}}else{if(!M.data||!M.data.match(F)){M.data=(M.data?M.data+"&":"")+(M.jsonp||"callback")+"=?"}}M.dataType="json"}if(M.dataType=="json"&&(M.data&&M.data.match(F)||M.url.match(F))){W="jsonp"+r++;if(M.data){M.data=(M.data+"").replace(F,"="+W+"$1")}M.url=M.url.replace(F,"="+W+"$1");M.dataType="script";l[W]=function(X){V=X;I();L();l[W]=g;try{delete l[W]}catch(Y){}if(H){H.removeChild(T)}}}if(M.dataType=="script"&&M.cache==null){M.cache=false}if(M.cache===false&&G=="GET"){var E=e();var U=M.url.replace(/(\?|&)_=.*?(&|$)/,"$1_="+E+"$2");M.url=U+((U==M.url)?(M.url.match(/\?/)?"&":"?")+"_="+E:"")}if(M.data&&G=="GET"){M.url+=(M.url.match(/\?/)?"&":"?")+M.data;M.data=null}if(M.global&&!o.active++){o.event.trigger("ajaxStart")}var Q=/^(\w+:)?\/\/([^\/?#]+)/.exec(M.url);if(M.dataType=="script"&&G=="GET"&&Q&&(Q[1]&&Q[1]!=location.protocol||Q[2]!=location.host)){var H=document.getElementsByTagName("head")[0];var T=document.createElement("script");T.src=M.url;if(M.scriptCharset){T.charset=M.scriptCharset}if(!W){var O=false;T.onload=T.onreadystatechange=function(){if(!O&&(!this.readyState||this.readyState=="loaded"||this.readyState=="complete")){O=true;I();L();T.onload=T.onreadystatechange=null;H.removeChild(T)}}}H.appendChild(T);return g}var K=false;var J=M.xhr();if(M.username){J.open(G,M.url,M.async,M.username,M.password)}else{J.open(G,M.url,M.async)}try{if(M.data){J.setRequestHeader("Content-Type",M.contentType)}if(M.ifModified){J.setRequestHeader("If-Modified-Since",o.lastModified[M.url]||"Thu, 01 Jan 1970 00:00:00 GMT")}J.setRequestHeader("X-Requested-With","XMLHttpRequest");J.setRequestHeader("Accept",M.dataType&&M.accepts[M.dataType]?M.accepts[M.dataType]+", */*":M.accepts._default)}catch(S){}if(M.beforeSend&&M.beforeSend(J,M)===false){if(M.global&&!--o.active){o.event.trigger("ajaxStop")}J.abort();return false}if(M.global){o.event.trigger("ajaxSend",[J,M])}var N=function(X){if(J.readyState==0){if(P){clearInterval(P);P=null;if(M.global&&!--o.active){o.event.trigger("ajaxStop")}}}else{if(!K&&J&&(J.readyState==4||X=="timeout")){K=true;if(P){clearInterval(P);P=null}R=X=="timeout"?"timeout":!o.httpSuccess(J)?"error":M.ifModified&&o.httpNotModified(J,M.url)?"notmodified":"success";if(R=="success"){try{V=o.httpData(J,M.dataType,M)}catch(Z){R="parsererror"}}if(R=="success"){var Y;try{Y=J.getResponseHeader("Last-Modified")}catch(Z){}if(M.ifModified&&Y){o.lastModified[M.url]=Y}if(!W){I()}}else{o.handleError(M,J,R)}L();if(X){J.abort()}if(M.async){J=null}}}};if(M.async){var P=setInterval(N,13);if(M.timeout>0){setTimeout(function(){if(J&&!K){N("timeout")}},M.timeout)}}try{J.send(M.data)}catch(S){o.handleError(M,J,null,S)}if(!M.async){N()}function I(){if(M.success){M.success(V,R)}if(M.global){o.event.trigger("ajaxSuccess",[J,M])}}function L(){if(M.complete){M.complete(J,R)}if(M.global){o.event.trigger("ajaxComplete",[J,M])}if(M.global&&!--o.active){o.event.trigger("ajaxStop")}}return J},handleError:function(F,H,E,G){if(F.error){F.error(H,E,G)}if(F.global){o.event.trigger("ajaxError",[H,F,G])}},active:0,httpSuccess:function(F){try{return !F.status&&location.protocol=="file:"||(F.status>=200&&F.status<300)||F.status==304||F.status==1223}catch(E){}return false},httpNotModified:function(G,E){try{var H=G.getResponseHeader("Last-Modified");return G.status==304||H==o.lastModified[E]}catch(F){}return false},httpData:function(J,H,G){var F=J.getResponseHeader("content-type"),E=H=="xml"||!H&&F&&F.indexOf("xml")>=0,I=E?J.responseXML:J.responseText;if(E&&I.documentElement.tagName=="parsererror"){throw"parsererror"}if(G&&G.dataFilter){I=G.dataFilter(I,H)}if(typeof I==="string"){if(H=="script"){o.globalEval(I)}if(H=="json"){I=l["eval"]("("+I+")")}}return I},param:function(E){var G=[];function H(I,J){G[G.length]=encodeURIComponent(I)+"="+encodeURIComponent(J)}if(o.isArray(E)||E.jquery){o.each(E,function(){H(this.name,this.value)})}else{for(var F in E){if(o.isArray(E[F])){o.each(E[F],function(){H(F,this)})}else{H(F,o.isFunction(E[F])?E[F]():E[F])}}}return G.join("&").replace(/%20/g,"+")}});var m={},n,d=[["height","marginTop","marginBottom","paddingTop","paddingBottom"],["width","marginLeft","marginRight","paddingLeft","paddingRight"],["opacity"]];function t(F,E){var G={};o.each(d.concat.apply([],d.slice(0,E)),function(){G[this]=F});return G}o.fn.extend({show:function(J,L){if(J){return this.animate(t("show",3),J,L)}else{for(var H=0,F=this.length;H=0;H--){if(G[H].elem==this){if(E){G[H](true)}G.splice(H,1)}}});if(!E){this.dequeue()}return this}});o.each({slideDown:t("show",1),slideUp:t("hide",1),slideToggle:t("toggle",1),fadeIn:{opacity:"show"},fadeOut:{opacity:"hide"}},function(E,F){o.fn[E]=function(G,H){return this.animate(F,G,H)}});o.extend({speed:function(G,H,F){var E=typeof G==="object"?G:{complete:F||!F&&H||o.isFunction(G)&&G,duration:G,easing:F&&H||H&&!o.isFunction(H)&&H};E.duration=o.fx.off?0:typeof E.duration==="number"?E.duration:o.fx.speeds[E.duration]||o.fx.speeds._default;E.old=E.complete;E.complete=function(){if(E.queue!==false){o(this).dequeue()}if(o.isFunction(E.old)){E.old.call(this)}};return E},easing:{linear:function(G,H,E,F){return E+F*G},swing:function(G,H,E,F){return((-Math.cos(G*Math.PI)/2)+0.5)*F+E}},timers:[],fx:function(F,E,G){this.options=E;this.elem=F;this.prop=G;if(!E.orig){E.orig={}}}});o.fx.prototype={update:function(){if(this.options.step){this.options.step.call(this.elem,this.now,this)}(o.fx.step[this.prop]||o.fx.step._default)(this);if((this.prop=="height"||this.prop=="width")&&this.elem.style){this.elem.style.display="block"}},cur:function(F){if(this.elem[this.prop]!=null&&(!this.elem.style||this.elem.style[this.prop]==null)){return this.elem[this.prop]}var E=parseFloat(o.css(this.elem,this.prop,F));return E&&E>-10000?E:parseFloat(o.curCSS(this.elem,this.prop))||0},custom:function(I,H,G){this.startTime=e();this.start=I;this.end=H;this.unit=G||this.unit||"px";this.now=this.start;this.pos=this.state=0;var E=this;function F(J){return E.step(J)}F.elem=this.elem;if(F()&&o.timers.push(F)&&!n){n=setInterval(function(){var K=o.timers;for(var J=0;J=this.options.duration+this.startTime){this.now=this.end;this.pos=this.state=1;this.update();this.options.curAnim[this.prop]=true;var E=true;for(var F in this.options.curAnim){if(this.options.curAnim[F]!==true){E=false}}if(E){if(this.options.display!=null){this.elem.style.overflow=this.options.overflow;this.elem.style.display=this.options.display;if(o.css(this.elem,"display")=="none"){this.elem.style.display="block"}}if(this.options.hide){o(this.elem).hide()}if(this.options.hide||this.options.show){for(var I in this.options.curAnim){o.attr(this.elem.style,I,this.options.orig[I])}}this.options.complete.call(this.elem)}return false}else{var J=G-this.startTime;this.state=J/this.options.duration;this.pos=o.easing[this.options.easing||(o.easing.swing?"swing":"linear")](this.state,J,0,1,this.options.duration);this.now=this.start+((this.end-this.start)*this.pos);this.update()}return true}};o.extend(o.fx,{speeds:{slow:600,fast:200,_default:400},step:{opacity:function(E){o.attr(E.elem.style,"opacity",E.now)},_default:function(E){if(E.elem.style&&E.elem.style[E.prop]!=null){E.elem.style[E.prop]=E.now+E.unit}else{E.elem[E.prop]=E.now}}}});if(document.documentElement.getBoundingClientRect){o.fn.offset=function(){if(!this[0]){return{top:0,left:0}}if(this[0]===this[0].ownerDocument.body){return o.offset.bodyOffset(this[0])}var G=this[0].getBoundingClientRect(),J=this[0].ownerDocument,F=J.body,E=J.documentElement,L=E.clientTop||F.clientTop||0,K=E.clientLeft||F.clientLeft||0,I=G.top+(self.pageYOffset||o.boxModel&&E.scrollTop||F.scrollTop)-L,H=G.left+(self.pageXOffset||o.boxModel&&E.scrollLeft||F.scrollLeft)-K;return{top:I,left:H}}}else{o.fn.offset=function(){if(!this[0]){return{top:0,left:0}}if(this[0]===this[0].ownerDocument.body){return o.offset.bodyOffset(this[0])}o.offset.initialized||o.offset.initialize();var J=this[0],G=J.offsetParent,F=J,O=J.ownerDocument,M,H=O.documentElement,K=O.body,L=O.defaultView,E=L.getComputedStyle(J,null),N=J.offsetTop,I=J.offsetLeft;while((J=J.parentNode)&&J!==K&&J!==H){M=L.getComputedStyle(J,null);N-=J.scrollTop,I-=J.scrollLeft;if(J===G){N+=J.offsetTop,I+=J.offsetLeft;if(o.offset.doesNotAddBorder&&!(o.offset.doesAddBorderForTableAndCells&&/^t(able|d|h)$/i.test(J.tagName))){N+=parseInt(M.borderTopWidth,10)||0,I+=parseInt(M.borderLeftWidth,10)||0}F=G,G=J.offsetParent}if(o.offset.subtractsBorderForOverflowNotVisible&&M.overflow!=="visible"){N+=parseInt(M.borderTopWidth,10)||0,I+=parseInt(M.borderLeftWidth,10)||0}E=M}if(E.position==="relative"||E.position==="static"){N+=K.offsetTop,I+=K.offsetLeft}if(E.position==="fixed"){N+=Math.max(H.scrollTop,K.scrollTop),I+=Math.max(H.scrollLeft,K.scrollLeft)}return{top:N,left:I}}}o.offset={initialize:function(){if(this.initialized){return}var L=document.body,F=document.createElement("div"),H,G,N,I,M,E,J=L.style.marginTop,K='';M={position:"absolute",top:0,left:0,margin:0,border:0,width:"1px",height:"1px",visibility:"hidden"};for(E in M){F.style[E]=M[E]}F.innerHTML=K;L.insertBefore(F,L.firstChild);H=F.firstChild,G=H.firstChild,I=H.nextSibling.firstChild.firstChild;this.doesNotAddBorder=(G.offsetTop!==5);this.doesAddBorderForTableAndCells=(I.offsetTop===5);H.style.overflow="hidden",H.style.position="relative";this.subtractsBorderForOverflowNotVisible=(G.offsetTop===-5);L.style.marginTop="1px";this.doesNotIncludeMarginInBodyOffset=(L.offsetTop===0);L.style.marginTop=J;L.removeChild(F);this.initialized=true},bodyOffset:function(E){o.offset.initialized||o.offset.initialize();var G=E.offsetTop,F=E.offsetLeft;if(o.offset.doesNotIncludeMarginInBodyOffset){G+=parseInt(o.curCSS(E,"marginTop",true),10)||0,F+=parseInt(o.curCSS(E,"marginLeft",true),10)||0}return{top:G,left:F}}};o.fn.extend({position:function(){var I=0,H=0,F;if(this[0]){var G=this.offsetParent(),J=this.offset(),E=/^body|html$/i.test(G[0].tagName)?{top:0,left:0}:G.offset();J.top-=j(this,"marginTop");J.left-=j(this,"marginLeft");E.top+=j(G,"borderTopWidth");E.left+=j(G,"borderLeftWidth");F={top:J.top-E.top,left:J.left-E.left}}return F},offsetParent:function(){var E=this[0].offsetParent||document.body;while(E&&(!/^body|html$/i.test(E.tagName)&&o.css(E,"position")=="static")){E=E.offsetParent}return o(E)}});o.each(["Left","Top"],function(F,E){var G="scroll"+E;o.fn[G]=function(H){if(!this[0]){return null}return H!==g?this.each(function(){this==l||this==document?l.scrollTo(!F?H:o(l).scrollLeft(),F?H:o(l).scrollTop()):this[G]=H}):this[0]==l||this[0]==document?self[F?"pageYOffset":"pageXOffset"]||o.boxModel&&document.documentElement[G]||document.body[G]:this[0][G]}});o.each(["Height","Width"],function(I,G){var E=I?"Left":"Top",H=I?"Right":"Bottom",F=G.toLowerCase();o.fn["inner"+G]=function(){return this[0]?o.css(this[0],F,false,"padding"):null};o.fn["outer"+G]=function(K){return this[0]?o.css(this[0],F,false,K?"margin":"border"):null};var J=G.toLowerCase();o.fn[J]=function(K){return this[0]==l?document.compatMode=="CSS1Compat"&&document.documentElement["client"+G]||document.body["client"+G]:this[0]==document?Math.max(document.documentElement["client"+G],document.body["scroll"+G],document.documentElement["scroll"+G],document.body["offset"+G],document.documentElement["offset"+G]):K===g?(this.length?o.css(this[0],J):null):this.css(J,typeof K==="string"?K:K+"px")}})})();
\ No newline at end of file
diff --git a/src/Umbraco.Web.UI/Umbraco/plugins/umbracoContour/scripts/jquery-1.5.1.min.js b/src/Umbraco.Web.UI/Umbraco/plugins/umbracoContour/scripts/jquery-1.5.1.min.js
new file mode 100644
index 0000000000..eec584bc58
--- /dev/null
+++ b/src/Umbraco.Web.UI/Umbraco/plugins/umbracoContour/scripts/jquery-1.5.1.min.js
@@ -0,0 +1,19 @@
+/*!
+* Note: While Microsoft is not the author of this file, Microsoft is
+* offering you a license subject to the terms of the Microsoft Software
+* License Terms for Microsoft ASP.NET Model View Controller 3.
+* Microsoft reserves all other rights. The notices below are provided
+* for informational purposes only and are not the license terms under
+* which Microsoft distributed this file.
+*
+* jQuery JavaScript Library v1.5.1
+* http://jquery.com/
+* Copyright 2011, John Resig
+*
+* Includes Sizzle.js
+* http://sizzlejs.com/
+* Copyright 2011, The Dojo Foundation
+*
+* Date: Thu Nov 11 19:04:53 2010 -0500
+*/
+(function(a,b){function cg(a){return d.isWindow(a)?a:a.nodeType===9?a.defaultView||a.parentWindow:!1}function cd(a){if(!bZ[a]){var b=d("<"+a+">").appendTo("body"),c=b.css("display");b.remove();if(c==="none"||c==="")c="block";bZ[a]=c}return bZ[a]}function cc(a,b){var c={};d.each(cb.concat.apply([],cb.slice(0,b)),function(){c[this]=a});return c}function bY(){try{return new a.ActiveXObject("Microsoft.XMLHTTP")}catch(b){}}function bX(){try{return new a.XMLHttpRequest}catch(b){}}function bW(){d(a).unload(function(){for(var a in bU)bU[a](0,1)})}function bQ(a,c){a.dataFilter&&(c=a.dataFilter(c,a.dataType));var e=a.dataTypes,f={},g,h,i=e.length,j,k=e[0],l,m,n,o,p;for(g=1;g=0===c})}function N(a){return!a||!a.parentNode||a.parentNode.nodeType===11}function F(a,b){return(a&&a!=="*"?a+".":"")+b.replace(r,"`").replace(s,"&")}function E(a){var b,c,e,f,g,h,i,j,k,l,m,n,o,q=[],r=[],s=d._data(this,"events");if(a.liveFired!==this&&s&&s.live&&!a.target.disabled&&(!a.button||a.type!=="click")){a.namespace&&(n=new RegExp("(^|\\.)"+a.namespace.split(".").join("\\.(?:.*\\.)?")+"(\\.|$)")),a.liveFired=this;var t=s.live.slice(0);for(i=0;ic)break;a.currentTarget=f.elem,a.data=f.handleObj.data,a.handleObj=f.handleObj,o=f.handleObj.origHandler.apply(f.elem,arguments);if(o===!1||a.isPropagationStopped()){c=f.level,o===!1&&(b=!1);if(a.isImmediatePropagationStopped())break}}return b}}function C(a,c,e){var f=d.extend({},e[0]);f.type=a,f.originalEvent={},f.liveFired=b,d.event.handle.call(c,f),f.isDefaultPrevented()&&e[0].preventDefault()}function w(){return!0}function v(){return!1}function g(a){for(var b in a)if(b!=="toJSON")return!1;return!0}function f(a,c,f){if(f===b&&a.nodeType===1){f=a.getAttribute("data-"+c);if(typeof f==="string"){try{f=f==="true"?!0:f==="false"?!1:f==="null"?null:d.isNaN(f)?e.test(f)?d.parseJSON(f):f:parseFloat(f)}catch(g){}d.data(a,c,f)}else f=b}return f}var c=a.document,d=function(){function I(){if(!d.isReady){try{c.documentElement.doScroll("left")}catch(a){setTimeout(I,1);return}d.ready()}}var d=function(a,b){return new d.fn.init(a,b,g)},e=a.jQuery,f=a.$,g,h=/^(?:[^<]*(<[\w\W]+>)[^>]*$|#([\w\-]+)$)/,i=/\S/,j=/^\s+/,k=/\s+$/,l=/\d/,m=/^<(\w+)\s*\/?>(?:<\/\1>)?$/,n=/^[\],:{}\s]*$/,o=/\\(?:["\\\/bfnrt]|u[0-9a-fA-F]{4})/g,p=/"[^"\\\n\r]*"|true|false|null|-?\d+(?:\.\d*)?(?:[eE][+\-]?\d+)?/g,q=/(?:^|:|,)(?:\s*\[)+/g,r=/(webkit)[ \/]([\w.]+)/,s=/(opera)(?:.*version)?[ \/]([\w.]+)/,t=/(msie) ([\w.]+)/,u=/(mozilla)(?:.*? rv:([\w.]+))?/,v=navigator.userAgent,w,x=!1,y,z="then done fail isResolved isRejected promise".split(" "),A,B=Object.prototype.toString,C=Object.prototype.hasOwnProperty,D=Array.prototype.push,E=Array.prototype.slice,F=String.prototype.trim,G=Array.prototype.indexOf,H={};d.fn=d.prototype={constructor:d,init:function(a,e,f){var g,i,j,k;if(!a)return this;if(a.nodeType){this.context=this[0]=a,this.length=1;return this}if(a==="body"&&!e&&c.body){this.context=c,this[0]=c.body,this.selector="body",this.length=1;return this}if(typeof a==="string"){g=h.exec(a);if(!g||!g[1]&&e)return!e||e.jquery?(e||f).find(a):this.constructor(e).find(a);if(g[1]){e=e instanceof d?e[0]:e,k=e?e.ownerDocument||e:c,j=m.exec(a),j?d.isPlainObject(e)?(a=[c.createElement(j[1])],d.fn.attr.call(a,e,!0)):a=[k.createElement(j[1])]:(j=d.buildFragment([g[1]],[k]),a=(j.cacheable?d.clone(j.fragment):j.fragment).childNodes);return d.merge(this,a)}i=c.getElementById(g[2]);if(i&&i.parentNode){if(i.id!==g[2])return f.find(a);this.length=1,this[0]=i}this.context=c,this.selector=a;return this}if(d.isFunction(a))return f.ready(a);a.selector!==b&&(this.selector=a.selector,this.context=a.context);return d.makeArray(a,this)},selector:"",jquery:"1.5.1",length:0,size:function(){return this.length},toArray:function(){return E.call(this,0)},get:function(a){return a==null?this.toArray():a<0?this[this.length+a]:this[a]},pushStack:function(a,b,c){var e=this.constructor();d.isArray(a)?D.apply(e,a):d.merge(e,a),e.prevObject=this,e.context=this.context,b==="find"?e.selector=this.selector+(this.selector?" ":"")+c:b&&(e.selector=this.selector+"."+b+"("+c+")");return e},each:function(a,b){return d.each(this,a,b)},ready:function(a){d.bindReady(),y.done(a);return this},eq:function(a){return a===-1?this.slice(a):this.slice(a,+a+1)},first:function(){return this.eq(0)},last:function(){return this.eq(-1)},slice:function(){return this.pushStack(E.apply(this,arguments),"slice",E.call(arguments).join(","))},map:function(a){return this.pushStack(d.map(this,function(b,c){return a.call(b,c,b)}))},end:function(){return this.prevObject||this.constructor(null)},push:D,sort:[].sort,splice:[].splice},d.fn.init.prototype=d.fn,d.extend=d.fn.extend=function(){var a,c,e,f,g,h,i=arguments[0]||{},j=1,k=arguments.length,l=!1;typeof i==="boolean"&&(l=i,i=arguments[1]||{},j=2),typeof i!=="object"&&!d.isFunction(i)&&(i={}),k===j&&(i=this,--j);for(;j0)return;y.resolveWith(c,[d]),d.fn.trigger&&d(c).trigger("ready").unbind("ready")}},bindReady:function(){if(!x){x=!0;if(c.readyState==="complete")return setTimeout(d.ready,1);if(c.addEventListener)c.addEventListener("DOMContentLoaded",A,!1),a.addEventListener("load",d.ready,!1);else if(c.attachEvent){c.attachEvent("onreadystatechange",A),a.attachEvent("onload",d.ready);var b=!1;try{b=a.frameElement==null}catch(e){}c.documentElement.doScroll&&b&&I()}}},isFunction:function(a){return d.type(a)==="function"},isArray:Array.isArray||function(a){return d.type(a)==="array"},isWindow:function(a){return a&&typeof a==="object"&&"setInterval"in a},isNaN:function(a){return a==null||!l.test(a)||isNaN(a)},type:function(a){return a==null?String(a):H[B.call(a)]||"object"},isPlainObject:function(a){if(!a||d.type(a)!=="object"||a.nodeType||d.isWindow(a))return!1;if(a.constructor&&!C.call(a,"constructor")&&!C.call(a.constructor.prototype,"isPrototypeOf"))return!1;var c;for(c in a){}return c===b||C.call(a,c)},isEmptyObject:function(a){for(var b in a)return!1;return!0},error:function(a){throw a},parseJSON:function(b){if(typeof b!=="string"||!b)return null;b=d.trim(b);if(n.test(b.replace(o,"@").replace(p,"]").replace(q,"")))return a.JSON&&a.JSON.parse?a.JSON.parse(b):(new Function("return "+b))();d.error("Invalid JSON: "+b)},parseXML:function(b,c,e){a.DOMParser?(e=new DOMParser,c=e.parseFromString(b,"text/xml")):(c=new ActiveXObject("Microsoft.XMLDOM"),c.async="false",c.loadXML(b)),e=c.documentElement,(!e||!e.nodeName||e.nodeName==="parsererror")&&d.error("Invalid XML: "+b);return c},noop:function(){},globalEval:function(a){if(a&&i.test(a)){var b=c.head||c.getElementsByTagName("head")[0]||c.documentElement,e=c.createElement("script");d.support.scriptEval()?e.appendChild(c.createTextNode(a)):e.text=a,b.insertBefore(e,b.firstChild),b.removeChild(e)}},nodeName:function(a,b){return a.nodeName&&a.nodeName.toUpperCase()===b.toUpperCase()},each:function(a,c,e){var f,g=0,h=a.length,i=h===b||d.isFunction(a);if(e){if(i){for(f in a)if(c.apply(a[f],e)===!1)break}else for(;g1){var f=E.call(arguments,0),g=b,h=function(a){return function(b){f[a]=arguments.length>1?E.call(arguments,0):b,--g||c.resolveWith(e,f)}};while(b--)a=f[b],a&&d.isFunction(a.promise)?a.promise().then(h(b),c.reject):--g;g||c.resolveWith(e,f)}else c!==a&&c.resolve(a);return e},uaMatch:function(a){a=a.toLowerCase();var b=r.exec(a)||s.exec(a)||t.exec(a)||a.indexOf("compatible")<0&&u.exec(a)||[];return{browser:b[1]||"",version:b[2]||"0"}},sub:function(){function a(b,c){return new a.fn.init(b,c)}d.extend(!0,a,this),a.superclass=this,a.fn=a.prototype=this(),a.fn.constructor=a,a.subclass=this.subclass,a.fn.init=function b(b,c){c&&c instanceof d&&!(c instanceof a)&&(c=a(c));return d.fn.init.call(this,b,c,e)},a.fn.init.prototype=a.fn;var e=a(c);return a},browser:{}}),y=d._Deferred(),d.each("Boolean Number String Function Array Date RegExp Object".split(" "),function(a,b){H["[object "+b+"]"]=b.toLowerCase()}),w=d.uaMatch(v),w.browser&&(d.browser[w.browser]=!0,d.browser.version=w.version),d.browser.webkit&&(d.browser.safari=!0),G&&(d.inArray=function(a,b){return G.call(b,a)}),i.test(" ")&&(j=/^[\s\xA0]+/,k=/[\s\xA0]+$/),g=d(c),c.addEventListener?A=function(){c.removeEventListener("DOMContentLoaded",A,!1),d.ready()}:c.attachEvent&&(A=function(){c.readyState==="complete"&&(c.detachEvent("onreadystatechange",A),d.ready())});return d}();(function(){d.support={};var b=c.createElement("div");b.style.display="none",b.innerHTML=" a
",d.support.shrinkWrapBlocks=a.offsetWidth!==2),a.innerHTML="";var e=a.getElementsByTagName("td");d.support.reliableHiddenOffsets=e[0].offsetHeight===0,e[0].style.display="",e[1].style.display="none",d.support.reliableHiddenOffsets=d.support.reliableHiddenOffsets&&e[0].offsetHeight===0,a.innerHTML="",b.removeChild(a).style.display="none",a=e=null}});var n=function(a){var b=c.createElement("div");a="on"+a;if(!b.attachEvent)return!0;var d=a in b;d||(b.setAttribute(a,"return;"),d=typeof b[a]==="function"),b=null;return d};d.support.submitBubbles=n("submit"),d.support.changeBubbles=n("change"),b=e=f=null}})();var e=/^(?:\{.*\}|\[.*\])$/;d.extend({cache:{},uuid:0,expando:"jQuery"+(d.fn.jquery+Math.random()).replace(/\D/g,""),noData:{embed:!0,object:"clsid:D27CDB6E-AE6D-11cf-96B8-444553540000",applet:!0},hasData:function(a){a=a.nodeType?d.cache[a[d.expando]]:a[d.expando];return!!a&&!g(a)},data:function(a,c,e,f){if(d.acceptData(a)){var g=d.expando,h=typeof c==="string",i,j=a.nodeType,k=j?d.cache:a,l=j?a[d.expando]:a[d.expando]&&d.expando;if((!l||f&&l&&!k[l][g])&&h&&e===b)return;l||(j?a[d.expando]=l=++d.uuid:l=d.expando),k[l]||(k[l]={},j||(k[l].toJSON=d.noop));if(typeof c==="object"||typeof c==="function")f?k[l][g]=d.extend(k[l][g],c):k[l]=d.extend(k[l],c);i=k[l],f&&(i[g]||(i[g]={}),i=i[g]),e!==b&&(i[c]=e);if(c==="events"&&!i[c])return i[g]&&i[g].events;return h?i[c]:i}},removeData:function(b,c,e){if(d.acceptData(b)){var f=d.expando,h=b.nodeType,i=h?d.cache:b,j=h?b[d.expando]:d.expando;if(!i[j])return;if(c){var k=e?i[j][f]:i[j];if(k){delete k[c];if(!g(k))return}}if(e){delete i[j][f];if(!g(i[j]))return}var l=i[j][f];d.support.deleteExpando||i!=a?delete i[j]:i[j]=null,l?(i[j]={},h||(i[j].toJSON=d.noop),i[j][f]=l):h&&(d.support.deleteExpando?delete b[d.expando]:b.removeAttribute?b.removeAttribute(d.expando):b[d.expando]=null)}},_data:function(a,b,c){return d.data(a,b,c,!0)},acceptData:function(a){if(a.nodeName){var b=d.noData[a.nodeName.toLowerCase()];if(b)return b!==!0&&a.getAttribute("classid")===b}return!0}}),d.fn.extend({data:function(a,c){var e=null;if(typeof a==="undefined"){if(this.length){e=d.data(this[0]);if(this[0].nodeType===1){var g=this[0].attributes,h;for(var i=0,j=g.length;i-1)return!0;return!1},val:function(a){if(!arguments.length){var c=this[0];if(c){if(d.nodeName(c,"option")){var e=c.attributes.value;return!e||e.specified?c.value:c.text}if(d.nodeName(c,"select")){var f=c.selectedIndex,g=[],h=c.options,i=c.type==="select-one";if(f<0)return null;for(var k=i?f:0,l=i?f+1:h.length;k=0;else if(d.nodeName(this,"select")){var f=d.makeArray(e);d("option",this).each(function(){this.selected=d.inArray(d(this).val(),f)>=0}),f.length||(this.selectedIndex=-1)}else this.value=e}})}}),d.extend({attrFn:{val:!0,css:!0,html:!0,text:!0,data:!0,width:!0,height:!0,offset:!0},attr:function(a,c,e,f){if(!a||a.nodeType===3||a.nodeType===8||a.nodeType===2)return b;if(f&&c in d.attrFn)return d(a)[c](e);var g=a.nodeType!==1||!d.isXMLDoc(a),h=e!==b;c=g&&d.props[c]||c;if(a.nodeType===1){var i=k.test(c);if(c==="selected"&&!d.support.optSelected){var j=a.parentNode;j&&(j.selectedIndex,j.parentNode&&j.parentNode.selectedIndex)}if((c in a||a[c]!==b)&&g&&!i){h&&(c==="type"&&l.test(a.nodeName)&&a.parentNode&&d.error("type property can't be changed"),e===null?a.nodeType===1&&a.removeAttribute(c):a[c]=e);if(d.nodeName(a,"form")&&a.getAttributeNode(c))return a.getAttributeNode(c).nodeValue;if(c==="tabIndex"){var o=a.getAttributeNode("tabIndex");return o&&o.specified?o.value:m.test(a.nodeName)||n.test(a.nodeName)&&a.href?0:b}return a[c]}if(!d.support.style&&g&&c==="style"){h&&(a.style.cssText=""+e);return a.style.cssText}h&&a.setAttribute(c,""+e);if(!a.attributes[c]&&(a.hasAttribute&&!a.hasAttribute(c)))return b;var p=!d.support.hrefNormalized&&g&&i?a.getAttribute(c,2):a.getAttribute(c);return p===null?b:p}h&&(a[c]=e);return a[c]}});var p=/\.(.*)$/,q=/^(?:textarea|input|select)$/i,r=/\./g,s=/ /g,t=/[^\w\s.|`]/g,u=function(a){return a.replace(t,"\\$&")};d.event={add:function(c,e,f,g){if(c.nodeType!==3&&c.nodeType!==8){try{d.isWindow(c)&&(c!==a&&!c.frameElement)&&(c=a)}catch(h){}if(f===!1)f=v;else if(!f)return;var i,j;f.handler&&(i=f,f=i.handler),f.guid||(f.guid=d.guid++);var k=d._data(c);if(!k)return;var l=k.events,m=k.handle;l||(k.events=l={}),m||(k.handle=m=function(){return typeof d!=="undefined"&&!d.event.triggered?d.event.handle.apply(m.elem,arguments):b}),m.elem=c,e=e.split(" ");var n,o=0,p;while(n=e[o++]){j=i?d.extend({},i):{handler:f,data:g},n.indexOf(".")>-1?(p=n.split("."),n=p.shift(),j.namespace=p.slice(0).sort().join(".")):(p=[],j.namespace=""),j.type=n,j.guid||(j.guid=f.guid);var q=l[n],r=d.event.special[n]||{};if(!q){q=l[n]=[];if(!r.setup||r.setup.call(c,g,p,m)===!1)c.addEventListener?c.addEventListener(n,m,!1):c.attachEvent&&c.attachEvent("on"+n,m)}r.add&&(r.add.call(c,j),j.handler.guid||(j.handler.guid=f.guid)),q.push(j),d.event.global[n]=!0}c=null}},global:{},remove:function(a,c,e,f){if(a.nodeType!==3&&a.nodeType!==8){e===!1&&(e=v);var g,h,i,j,k=0,l,m,n,o,p,q,r,s=d.hasData(a)&&d._data(a),t=s&&s.events;if(!s||!t)return;c&&c.type&&(e=c.handler,c=c.type);if(!c||typeof c==="string"&&c.charAt(0)==="."){c=c||"";for(h in t)d.event.remove(a,h+c);return}c=c.split(" ");while(h=c[k++]){r=h,q=null,l=h.indexOf(".")<0,m=[],l||(m=h.split("."),h=m.shift(),n=new RegExp("(^|\\.)"+d.map(m.slice(0).sort(),u).join("\\.(?:.*\\.)?")+"(\\.|$)")),p=t[h];if(!p)continue;if(!e){for(j=0;j=0&&(a.type=f=f.slice(0,-1),a.exclusive=!0),e||(a.stopPropagation(),d.event.global[f]&&d.each(d.cache,function(){var b=d.expando,e=this[b];e&&e.events&&e.events[f]&&d.event.trigger(a,c,e.handle.elem)}));if(!e||e.nodeType===3||e.nodeType===8)return b;a.result=b,a.target=e,c=d.makeArray(c),c.unshift(a)}a.currentTarget=e;var h=d._data(e,"handle");h&&h.apply(e,c);var i=e.parentNode||e.ownerDocument;try{e&&e.nodeName&&d.noData[e.nodeName.toLowerCase()]||e["on"+f]&&e["on"+f].apply(e,c)===!1&&(a.result=!1,a.preventDefault())}catch(j){}if(!a.isPropagationStopped()&&i)d.event.trigger(a,c,i,!0);else if(!a.isDefaultPrevented()){var k,l=a.target,m=f.replace(p,""),n=d.nodeName(l,"a")&&m==="click",o=d.event.special[m]||{};if((!o._default||o._default.call(e,a)===!1)&&!n&&!(l&&l.nodeName&&d.noData[l.nodeName.toLowerCase()])){try{l[m]&&(k=l["on"+m],k&&(l["on"+m]=null),d.event.triggered=!0,l[m]())}catch(q){}k&&(l["on"+m]=k),d.event.triggered=!1}}},handle:function(c){var e,f,g,h,i,j=[],k=d.makeArray(arguments);c=k[0]=d.event.fix(c||a.event),c.currentTarget=this,e=c.type.indexOf(".")<0&&!c.exclusive,e||(g=c.type.split("."),c.type=g.shift(),j=g.slice(0).sort(),h=new RegExp("(^|\\.)"+j.join("\\.(?:.*\\.)?")+"(\\.|$)")),c.namespace=c.namespace||j.join("."),i=d._data(this,"events"),f=(i||{})[c.type];if(i&&f){f=f.slice(0);for(var l=0,m=f.length;l-1?d.map(a.options,function(a){return a.selected}).join("-"):"":a.nodeName.toLowerCase()==="select"&&(c=a.selectedIndex);return c},B=function B(a){var c=a.target,e,f;if(q.test(c.nodeName)&&!c.readOnly){e=d._data(c,"_change_data"),f=A(c),(a.type!=="focusout"||c.type!=="radio")&&d._data(c,"_change_data",f);if(e===b||f===e)return;if(e!=null||f)a.type="change",a.liveFired=b,d.event.trigger(a,arguments[1],c)}};d.event.special.change={filters:{focusout:B,beforedeactivate:B,click:function(a){var b=a.target,c=b.type;(c==="radio"||c==="checkbox"||b.nodeName.toLowerCase()==="select")&&B.call(this,a)},keydown:function(a){var b=a.target,c=b.type;(a.keyCode===13&&b.nodeName.toLowerCase()!=="textarea"||a.keyCode===32&&(c==="checkbox"||c==="radio")||c==="select-multiple")&&B.call(this,a)},beforeactivate:function(a){var b=a.target;d._data(b,"_change_data",A(b))}},setup:function(a,b){if(this.type==="file")return!1;for(var c in z)d.event.add(this,c+".specialChange",z[c]);return q.test(this.nodeName)},teardown:function(a){d.event.remove(this,".specialChange");return q.test(this.nodeName)}},z=d.event.special.change.filters,z.focus=z.beforeactivate}c.addEventListener&&d.each({focus:"focusin",blur:"focusout"},function(a,b){function c(a){a=d.event.fix(a),a.type=b;return d.event.handle.call(this,a)}d.event.special[b]={setup:function(){this.addEventListener(a,c,!0)},teardown:function(){this.removeEventListener(a,c,!0)}}}),d.each(["bind","one"],function(a,c){d.fn[c]=function(a,e,f){if(typeof a==="object"){for(var g in a)this[c](g,e,a[g],f);return this}if(d.isFunction(e)||e===!1)f=e,e=b;var h=c==="one"?d.proxy(f,function(a){d(this).unbind(a,h);return f.apply(this,arguments)}):f;if(a==="unload"&&c!=="one")this.one(a,e,f);else for(var i=0,j=this.length;i0?this.bind(b,a,c):this.trigger(b)},d.attrFn&&(d.attrFn[b]=!0)}),function(){function u(a,b,c,d,e,f){for(var g=0,h=d.length;g0){j=i;break}}i=i[a]}d[g]=j}}}function t(a,b,c,d,e,f){for(var g=0,h=d.length;g+~,(\[\\]+)+|[>+~])(\s*,\s*)?((?:.|\r|\n)*)/g,e=0,f=Object.prototype.toString,g=!1,h=!0,i=/\\/g,j=/\W/;[0,0].sort(function(){h=!1;return 0});var k=function(b,d,e,g){e=e||[],d=d||c;var h=d;if(d.nodeType!==1&&d.nodeType!==9)return[];if(!b||typeof b!=="string")return e;var i,j,n,o,q,r,s,t,u=!0,w=k.isXML(d),x=[],y=b;do{a.exec(""),i=a.exec(y);if(i){y=i[3],x.push(i[1]);if(i[2]){o=i[3];break}}}while(i);if(x.length>1&&m.exec(b))if(x.length===2&&l.relative[x[0]])j=v(x[0]+x[1],d);else{j=l.relative[x[0]]?[d]:k(x.shift(),d);while(x.length)b=x.shift(),l.relative[b]&&(b+=x.shift()),j=v(b,j)}else{!g&&x.length>1&&d.nodeType===9&&!w&&l.match.ID.test(x[0])&&!l.match.ID.test(x[x.length-1])&&(q=k.find(x.shift(),d,w),d=q.expr?k.filter(q.expr,q.set)[0]:q.set[0]);if(d){q=g?{expr:x.pop(),set:p(g)}:k.find(x.pop(),x.length===1&&(x[0]==="~"||x[0]==="+")&&d.parentNode?d.parentNode:d,w),j=q.expr?k.filter(q.expr,q.set):q.set,x.length>0?n=p(j):u=!1;while(x.length)r=x.pop(),s=r,l.relative[r]?s=x.pop():r="",s==null&&(s=d),l.relative[r](n,s,w)}else n=x=[]}n||(n=j),n||k.error(r||b);if(f.call(n)==="[object Array]")if(u)if(d&&d.nodeType===1)for(t=0;n[t]!=null;t++)n[t]&&(n[t]===!0||n[t].nodeType===1&&k.contains(d,n[t]))&&e.push(j[t]);else for(t=0;n[t]!=null;t++)n[t]&&n[t].nodeType===1&&e.push(j[t]);else e.push.apply(e,n);else p(n,e);o&&(k(o,h,e,g),k.uniqueSort(e));return e};k.uniqueSort=function(a){if(r){g=h,a.sort(r);if(g)for(var b=1;b0},k.find=function(a,b,c){var d;if(!a)return[];for(var e=0,f=l.order.length;e":function(a,b){var c,d=typeof b==="string",e=0,f=a.length;if(d&&!j.test(b)){b=b.toLowerCase();for(;e=0)?c||d.push(h):c&&(b[g]=!1));return!1},ID:function(a){return a[1].replace(i,"")},TAG:function(a,b){return a[1].replace(i,"").toLowerCase()},CHILD:function(a){if(a[1]==="nth"){a[2]||k.error(a[0]),a[2]=a[2].replace(/^\+|\s*/g,"");var b=/(-?)(\d*)(?:n([+\-]?\d*))?/.exec(a[2]==="even"&&"2n"||a[2]==="odd"&&"2n+1"||!/\D/.test(a[2])&&"0n+"+a[2]||a[2]);a[2]=b[1]+(b[2]||1)-0,a[3]=b[3]-0}else a[2]&&k.error(a[0]);a[0]=e++;return a},ATTR:function(a,b,c,d,e,f){var g=a[1]=a[1].replace(i,"");!f&&l.attrMap[g]&&(a[1]=l.attrMap[g]),a[4]=(a[4]||a[5]||"").replace(i,""),a[2]==="~="&&(a[4]=" "+a[4]+" ");return a},PSEUDO:function(b,c,d,e,f){if(b[1]==="not")if((a.exec(b[3])||"").length>1||/^\w/.test(b[3]))b[3]=k(b[3],null,null,c);else{var g=k.filter(b[3],c,d,!0^f);d||e.push.apply(e,g);return!1}else if(l.match.POS.test(b[0])||l.match.CHILD.test(b[0]))return!0;return b},POS:function(a){a.unshift(!0);return a}},filters:{enabled:function(a){return a.disabled===!1&&a.type!=="hidden"},disabled:function(a){return a.disabled===!0},checked:function(a){return a.checked===!0},selected:function(a){a.parentNode&&a.parentNode.selectedIndex;return a.selected===!0},parent:function(a){return!!a.firstChild},empty:function(a){return!a.firstChild},has:function(a,b,c){return!!k(c[3],a).length},header:function(a){return/h\d/i.test(a.nodeName)},text:function(a){return"text"===a.getAttribute("type")},radio:function(a){return"radio"===a.type},checkbox:function(a){return"checkbox"===a.type},file:function(a){return"file"===a.type},password:function(a){return"password"===a.type},submit:function(a){return"submit"===a.type},image:function(a){return"image"===a.type},reset:function(a){return"reset"===a.type},button:function(a){return"button"===a.type||a.nodeName.toLowerCase()==="button"},input:function(a){return/input|select|textarea|button/i.test(a.nodeName)}},setFilters:{first:function(a,b){return b===0},last:function(a,b,c,d){return b===d.length-1},even:function(a,b){return b%2===0},odd:function(a,b){return b%2===1},lt:function(a,b,c){return bc[3]-0},nth:function(a,b,c){return c[3]-0===b},eq:function(a,b,c){return c[3]-0===b}},filter:{PSEUDO:function(a,b,c,d){var e=b[1],f=l.filters[e];if(f)return f(a,c,b,d);if(e==="contains")return(a.textContent||a.innerText||k.getText([a])||"").indexOf(b[3])>=0;if(e==="not"){var g=b[3];for(var h=0,i=g.length;h=0}},ID:function(a,b){return a.nodeType===1&&a.getAttribute("id")===b},TAG:function(a,b){return b==="*"&&a.nodeType===1||a.nodeName.toLowerCase()===b},CLASS:function(a,b){return(" "+(a.className||a.getAttribute("class"))+" ").indexOf(b)>-1},ATTR:function(a,b){var c=b[1],d=l.attrHandle[c]?l.attrHandle[c](a):a[c]!=null?a[c]:a.getAttribute(c),e=d+"",f=b[2],g=b[4];return d==null?f==="!=":f==="="?e===g:f==="*="?e.indexOf(g)>=0:f==="~="?(" "+e+" ").indexOf(g)>=0:g?f==="!="?e!==g:f==="^="?e.indexOf(g)===0:f==="$="?e.substr(e.length-g.length)===g:f==="|="?e===g||e.substr(0,g.length+1)===g+"-":!1:e&&d!==!1},POS:function(a,b,c,d){var e=b[2],f=l.setFilters[e];if(f)return f(a,c,b,d)}}},m=l.match.POS,n=function(a,b){return"\\"+(b-0+1)};for(var o in l.match)l.match[o]=new RegExp(l.match[o].source+/(?![^\[]*\])(?![^\(]*\))/.source),l.leftMatch[o]=new RegExp(/(^(?:.|\r|\n)*?)/.source+l.match[o].source.replace(/\\(\d+)/g,n));var p=function(a,b){a=Array.prototype.slice.call(a,0);if(b){b.push.apply(b,a);return b}return a};try{Array.prototype.slice.call(c.documentElement.childNodes,0)[0].nodeType}catch(q){p=function(a,b){var c=0,d=b||[];if(f.call(a)==="[object Array]")Array.prototype.push.apply(d,a);else if(typeof a.length==="number")for(var e=a.length;c
";if(!b.querySelectorAll||b.querySelectorAll(".TEST").length!==0){k=function(b,e,f,g){e=e||c;if(!g&&!k.isXML(e)){var h=/^(\w+$)|^\.([\w\-]+$)|^#([\w\-]+$)/.exec(b);if(h&&(e.nodeType===1||e.nodeType===9)){if(h[1])return p(e.getElementsByTagName(b),f);if(h[2]&&l.find.CLASS&&e.getElementsByClassName)return p(e.getElementsByClassName(h[2]),f)}if(e.nodeType===9){if(b==="body"&&e.body)return p([e.body],f);if(h&&h[3]){var i=e.getElementById(h[3]);if(!i||!i.parentNode)return p([],f);if(i.id===h[3])return p([i],f)}try{return p(e.querySelectorAll(b),f)}catch(j){}}else if(e.nodeType===1&&e.nodeName.toLowerCase()!=="object"){var m=e,n=e.getAttribute("id"),o=n||d,q=e.parentNode,r=/^\s*[+~]/.test(b);n?o=o.replace(/'/g,"\\$&"):e.setAttribute("id",o),r&&q&&(e=e.parentNode);try{if(!r||q)return p(e.querySelectorAll("[id='"+o+"'] "+b),f)}catch(s){}finally{n||m.removeAttribute("id")}}}return a(b,e,f,g)};for(var e in a)k[e]=a[e];b=null}}(),function(){var a=c.documentElement,b=a.matchesSelector||a.mozMatchesSelector||a.webkitMatchesSelector||a.msMatchesSelector,d=!1;try{b.call(c.documentElement,"[test!='']:sizzle")}catch(e){d=!0}b&&(k.matchesSelector=function(a,c){c=c.replace(/\=\s*([^'"\]]*)\s*\]/g,"='$1']");if(!k.isXML(a))try{if(d||!l.match.PSEUDO.test(c)&&!/!=/.test(c))return b.call(a,c)}catch(e){}return k(c,null,null,[a]).length>0})}(),function(){var a=c.createElement("div");a.innerHTML="
";if(a.getElementsByClassName&&a.getElementsByClassName("e").length!==0){a.lastChild.className="e";if(a.getElementsByClassName("e").length===1)return;l.order.splice(1,0,"CLASS"),l.find.CLASS=function(a,b,c){if(typeof b.getElementsByClassName!=="undefined"&&!c)return b.getElementsByClassName(a[1])},a=null}}(),c.documentElement.contains?k.contains=function(a,b){return a!==b&&(a.contains?a.contains(b):!0)}:c.documentElement.compareDocumentPosition?k.contains=function(a,b){return!!(a.compareDocumentPosition(b)&16)}:k.contains=function(){return!1},k.isXML=function(a){var b=(a?a.ownerDocument||a:0).documentElement;return b?b.nodeName!=="HTML":!1};var v=function(a,b){var c,d=[],e="",f=b.nodeType?[b]:b;while(c=l.match.PSEUDO.exec(a))e+=c[0],a=a.replace(l.match.PSEUDO,"");a=l.relative[a]?a+"*":a;for(var g=0,h=f.length;g0)for(var g=c;g0},closest:function(a,b){var c=[],e,f,g=this[0];if(d.isArray(a)){var h,i,j={},k=1;if(g&&a.length){for(e=0,f=a.length;e-1:d(g).is(h))&&c.push({selector:i,elem:g,level:k});g=g.parentNode,k++}}return c}var l=L.test(a)?d(a,b||this.context):null;for(e=0,f=this.length;e-1:d.find.matchesSelector(g,a)){c.push(g);break}g=g.parentNode;if(!g||!g.ownerDocument||g===b)break}}c=c.length>1?d.unique(c):c;return this.pushStack(c,"closest",a)},index:function(a){if(!a||typeof a==="string")return d.inArray(this[0],a?d(a):this.parent().children());return d.inArray(a.jquery?a[0]:a,this)},add:function(a,b){var c=typeof a==="string"?d(a,b):d.makeArray(a),e=d.merge(this.get(),c);return this.pushStack(N(c[0])||N(e[0])?e:d.unique(e))},andSelf:function(){return this.add(this.prevObject)}}),d.each({parent:function(a){var b=a.parentNode;return b&&b.nodeType!==11?b:null},parents:function(a){return d.dir(a,"parentNode")},parentsUntil:function(a,b,c){return d.dir(a,"parentNode",c)},next:function(a){return d.nth(a,2,"nextSibling")},prev:function(a){return d.nth(a,2,"previousSibling")},nextAll:function(a){return d.dir(a,"nextSibling")},prevAll:function(a){return d.dir(a,"previousSibling")},nextUntil:function(a,b,c){return d.dir(a,"nextSibling",c)},prevUntil:function(a,b,c){return d.dir(a,"previousSibling",c)},siblings:function(a){return d.sibling(a.parentNode.firstChild,a)},children:function(a){return d.sibling(a.firstChild)},contents:function(a){return d.nodeName(a,"iframe")?a.contentDocument||a.contentWindow.document:d.makeArray(a.childNodes)}},function(a,b){d.fn[a]=function(c,e){var f=d.map(this,b,c),g=K.call(arguments);G.test(a)||(e=c),e&&typeof e==="string"&&(f=d.filter(e,f)),f=this.length>1&&!M[a]?d.unique(f):f,(this.length>1||I.test(e))&&H.test(a)&&(f=f.reverse());return this.pushStack(f,a,g.join(","))}}),d.extend({filter:function(a,b,c){c&&(a=":not("+a+")");return b.length===1?d.find.matchesSelector(b[0],a)?[b[0]]:[]:d.find.matches(a,b)},dir:function(a,c,e){var f=[],g=a[c];while(g&&g.nodeType!==9&&(e===b||g.nodeType!==1||!d(g).is(e)))g.nodeType===1&&f.push(g),g=g[c];return f},nth:function(a,b,c,d){b=b||1;var e=0;for(;a;a=a[c])if(a.nodeType===1&&++e===b)break;return a},sibling:function(a,b){var c=[];for(;a;a=a.nextSibling)a.nodeType===1&&a!==b&&c.push(a);return c}});var P=/ jQuery\d+="(?:\d+|null)"/g,Q=/^\s+/,R=/<(?!area|br|col|embed|hr|img|input|link|meta|param)(([\w:]+)[^>]*)\/>/ig,S=/<([\w:]+)/,T=/",""],legend:[1,""," "],thead:[1,""],tr:[2,""],td:[3,""],col:[2,""],area:[1,""," "],_default:[0,"",""]};X.optgroup=X.option,X.tbody=X.tfoot=X.colgroup=X.caption=X.thead,X.th=X.td,d.support.htmlSerialize||(X._default=[1,"div","
"]),d.fn.extend({text:function(a){if(d.isFunction(a))return this.each(function(b){var c=d(this);c.text(a.call(this,b,c.text()))});if(typeof a!=="object"&&a!==b)return this.empty().append((this[0]&&this[0].ownerDocument||c).createTextNode(a));return d.text(this)},wrapAll:function(a){if(d.isFunction(a))return this.each(function(b){d(this).wrapAll(a.call(this,b))});if(this[0]){var b=d(a,this[0].ownerDocument).eq(0).clone(!0);this[0].parentNode&&b.insertBefore(this[0]),b.map(function(){var a=this;while(a.firstChild&&a.firstChild.nodeType===1)a=a.firstChild;return a}).append(this)}return this},wrapInner:function(a){if(d.isFunction(a))return this.each(function(b){d(this).wrapInner(a.call(this,b))});return this.each(function(){var b=d(this),c=b.contents();c.length?c.wrapAll(a):b.append(a)})},wrap:function(a){return this.each(function(){d(this).wrapAll(a)})},unwrap:function(){return this.parent().each(function(){d.nodeName(this,"body")||d(this).replaceWith(this.childNodes)}).end()},append:function(){return this.domManip(arguments,!0,function(a){this.nodeType===1&&this.appendChild(a)})},prepend:function(){return this.domManip(arguments,!0,function(a){this.nodeType===1&&this.insertBefore(a,this.firstChild)})},before:function(){if(this[0]&&this[0].parentNode)return this.domManip(arguments,!1,function(a){this.parentNode.insertBefore(a,this)});if(arguments.length){var a=d(arguments[0]);a.push.apply(a,this.toArray());return this.pushStack(a,"before",arguments)}},after:function(){if(this[0]&&this[0].parentNode)return this.domManip(arguments,!1,function(a){this.parentNode.insertBefore(a,this.nextSibling)});if(arguments.length){var a=this.pushStack(this,"after",arguments);a.push.apply(a,d(arguments[0]).toArray());return a}},remove:function(a,b){for(var c=0,e;(e=this[c])!=null;c++)if(!a||d.filter(a,[e]).length)!b&&e.nodeType===1&&(d.cleanData(e.getElementsByTagName("*")),d.cleanData([e])),e.parentNode&&e.parentNode.removeChild(e);return this},empty:function(){for(var a=0,b;(b=this[a])!=null;a++){b.nodeType===1&&d.cleanData(b.getElementsByTagName("*"));while(b.firstChild)b.removeChild(b.firstChild)}return this},clone:function(a,b){a=a==null?!1:a,b=b==null?a:b;return this.map(function(){return d.clone(this,a,b)})},html:function(a){if(a===b)return this[0]&&this[0].nodeType===1?this[0].innerHTML.replace(P,""):null;if(typeof a!=="string"||V.test(a)||!d.support.leadingWhitespace&&Q.test(a)||X[(S.exec(a)||["",""])[1].toLowerCase()])d.isFunction(a)?this.each(function(b){var c=d(this);c.html(a.call(this,b,c.html()))}):this.empty().append(a);else{a=a.replace(R,"<$1>");try{for(var c=0,e=this.length;c1&&l0?this.clone(!0):this).get();d(f[h])[b](j),e=e.concat(j)}return this.pushStack(e,a,f.selector)}}),d.extend({clone:function(a,b,c){var e=a.cloneNode(!0),f,g,h;if((!d.support.noCloneEvent||!d.support.noCloneChecked)&&(a.nodeType===1||a.nodeType===11)&&!d.isXMLDoc(a)){$(a,e),f=_(a),g=_(e);for(h=0;f[h];++h)$(f[h],g[h])}if(b){Z(a,e);if(c){f=_(a),g=_(e);for(h=0;f[h];++h)Z(f[h],g[h])}}return e},clean:function(a,b,e,f){b=b||c,typeof b.createElement==="undefined"&&(b=b.ownerDocument||b[0]&&b[0].ownerDocument||c);var g=[];for(var h=0,i;(i=a[h])!=null;h++){typeof i==="number"&&(i+="");if(!i)continue;if(typeof i!=="string"||U.test(i)){if(typeof i==="string"){i=i.replace(R,"<$1>");var j=(S.exec(i)||["",""])[1].toLowerCase(),k=X[j]||X._default,l=k[0],m=b.createElement("div");m.innerHTML=k[1]+i+k[2];while(l--)m=m.lastChild;if(!d.support.tbody){var n=T.test(i),o=j==="table"&&!n?m.firstChild&&m.firstChild.childNodes:k[1]===""&&!n?m.childNodes:[];for(var p=o.length-1;p>=0;--p)d.nodeName(o[p],"tbody")&&!o[p].childNodes.length&&o[p].parentNode.removeChild(o[p])}!d.support.leadingWhitespace&&Q.test(i)&&m.insertBefore(b.createTextNode(Q.exec(i)[0]),m.firstChild),i=m.childNodes}}else i=b.createTextNode(i);i.nodeType?g.push(i):g=d.merge(g,i)}if(e)for(h=0;g[h];h++)!f||!d.nodeName(g[h],"script")||g[h].type&&g[h].type.toLowerCase()!=="text/javascript"?(g[h].nodeType===1&&g.splice.apply(g,[h+1,0].concat(d.makeArray(g[h].getElementsByTagName("script")))),e.appendChild(g[h])):f.push(g[h].parentNode?g[h].parentNode.removeChild(g[h]):g[h]);return g},cleanData:function(a){var b,c,e=d.cache,f=d.expando,g=d.event.special,h=d.support.deleteExpando;for(var i=0,j;(j=a[i])!=null;i++){if(j.nodeName&&d.noData[j.nodeName.toLowerCase()])continue;c=j[d.expando];if(c){b=e[c]&&e[c][f];if(b&&b.events){for(var k in b.events)g[k]?d.event.remove(j,k):d.removeEvent(j,k,b.handle);b.handle&&(b.handle.elem=null)}h?delete j[d.expando]:j.removeAttribute&&j.removeAttribute(d.expando),delete e[c]}}}});var bb=/alpha\([^)]*\)/i,bc=/opacity=([^)]*)/,bd=/-([a-z])/ig,be=/([A-Z])/g,bf=/^-?\d+(?:px)?$/i,bg=/^-?\d/,bh={position:"absolute",visibility:"hidden",display:"block"},bi=["Left","Right"],bj=["Top","Bottom"],bk,bl,bm,bn=function(a,b){return b.toUpperCase()};d.fn.css=function(a,c){if(arguments.length===2&&c===b)return this;return d.access(this,a,c,!0,function(a,c,e){return e!==b?d.style(a,c,e):d.css(a,c)})},d.extend({cssHooks:{opacity:{get:function(a,b){if(b){var c=bk(a,"opacity","opacity");return c===""?"1":c}return a.style.opacity}}},cssNumber:{zIndex:!0,fontWeight:!0,opacity:!0,zoom:!0,lineHeight:!0},cssProps:{"float":d.support.cssFloat?"cssFloat":"styleFloat"},style:function(a,c,e,f){if(a&&a.nodeType!==3&&a.nodeType!==8&&a.style){var g,h=d.camelCase(c),i=a.style,j=d.cssHooks[h];c=d.cssProps[h]||h;if(e===b){if(j&&"get"in j&&(g=j.get(a,!1,f))!==b)return g;return i[c]}if(typeof e==="number"&&isNaN(e)||e==null)return;typeof e==="number"&&!d.cssNumber[h]&&(e+="px");if(!j||!("set"in j)||(e=j.set(a,e))!==b)try{i[c]=e}catch(k){}}},css:function(a,c,e){var f,g=d.camelCase(c),h=d.cssHooks[g];c=d.cssProps[g]||g;if(h&&"get"in h&&(f=h.get(a,!0,e))!==b)return f;if(bk)return bk(a,c,g)},swap:function(a,b,c){var d={};for(var e in b)d[e]=a.style[e],a.style[e]=b[e];c.call(a);for(e in b)a.style[e]=d[e]},camelCase:function(a){return a.replace(bd,bn)}}),d.curCSS=d.css,d.each(["height","width"],function(a,b){d.cssHooks[b]={get:function(a,c,e){var f;if(c){a.offsetWidth!==0?f=bo(a,b,e):d.swap(a,bh,function(){f=bo(a,b,e)});if(f<=0){f=bk(a,b,b),f==="0px"&&bm&&(f=bm(a,b,b));if(f!=null)return f===""||f==="auto"?"0px":f}if(f<0||f==null){f=a.style[b];return f===""||f==="auto"?"0px":f}return typeof f==="string"?f:f+"px"}},set:function(a,b){if(!bf.test(b))return b;b=parseFloat(b);if(b>=0)return b+"px"}}}),d.support.opacity||(d.cssHooks.opacity={get:function(a,b){return bc.test((b&&a.currentStyle?a.currentStyle.filter:a.style.filter)||"")?parseFloat(RegExp.$1)/100+"":b?"1":""},set:function(a,b){var c=a.style;c.zoom=1;var e=d.isNaN(b)?"":"alpha(opacity="+b*100+")",f=c.filter||"";c.filter=bb.test(f)?f.replace(bb,e):c.filter+" "+e}}),c.defaultView&&c.defaultView.getComputedStyle&&(bl=function(a,c,e){var f,g,h;e=e.replace(be,"-$1").toLowerCase();if(!(g=a.ownerDocument.defaultView))return b;if(h=g.getComputedStyle(a,null))f=h.getPropertyValue(e),f===""&&!d.contains(a.ownerDocument.documentElement,a)&&(f=d.style(a,e));return f}),c.documentElement.currentStyle&&(bm=function(a,b){var c,d=a.currentStyle&&a.currentStyle[b],e=a.runtimeStyle&&a.runtimeStyle[b],f=a.style;!bf.test(d)&&bg.test(d)&&(c=f.left,e&&(a.runtimeStyle.left=a.currentStyle.left),f.left=b==="fontSize"?"1em":d||0,d=f.pixelLeft+"px",f.left=c,e&&(a.runtimeStyle.left=e));return d===""?"auto":d}),bk=bl||bm,d.expr&&d.expr.filters&&(d.expr.filters.hidden=function(a){var b=a.offsetWidth,c=a.offsetHeight;return b===0&&c===0||!d.support.reliableHiddenOffsets&&(a.style.display||d.css(a,"display"))==="none"},d.expr.filters.visible=function(a){return!d.expr.filters.hidden(a)});var bp=/%20/g,bq=/\[\]$/,br=/\r?\n/g,bs=/#.*$/,bt=/^(.*?):[ \t]*([^\r\n]*)\r?$/mg,bu=/^(?:color|date|datetime|email|hidden|month|number|password|range|search|tel|text|time|url|week)$/i,bv=/(?:^file|^widget|\-extension):$/,bw=/^(?:GET|HEAD)$/,bx=/^\/\//,by=/\?/,bz=/)<[^<]*)*<\/script>/gi,bA=/^(?:select|textarea)/i,bB=/\s+/,bC=/([?&])_=[^&]*/,bD=/(^|\-)([a-z])/g,bE=function(a,b,c){return b+c.toUpperCase()},bF=/^([\w\+\.\-]+:)\/\/([^\/?#:]*)(?::(\d+))?/,bG=d.fn.load,bH={},bI={},bJ,bK;try{bJ=c.location.href}catch(bL){bJ=c.createElement("a"),bJ.href="",bJ=bJ.href}bK=bF.exec(bJ.toLowerCase()),d.fn.extend({load:function(a,c,e){if(typeof a!=="string"&&bG)return bG.apply(this,arguments);if(!this.length)return this;var f=a.indexOf(" ");if(f>=0){var g=a.slice(f,a.length);a=a.slice(0,f)}var h="GET";c&&(d.isFunction(c)?(e=c,c=b):typeof c==="object"&&(c=d.param(c,d.ajaxSettings.traditional),h="POST"));var i=this;d.ajax({url:a,type:h,dataType:"html",data:c,complete:function(a,b,c){c=a.responseText,a.isResolved()&&(a.done(function(a){c=a}),i.html(g?d("").append(c.replace(bz,"")).find(g):c)),e&&i.each(e,[c,b,a])}});return this},serialize:function(){return d.param(this.serializeArray())},serializeArray:function(){return this.map(function(){return this.elements?d.makeArray(this.elements):this}).filter(function(){return this.name&&!this.disabled&&(this.checked||bA.test(this.nodeName)||bu.test(this.type))}).map(function(a,b){var c=d(this).val();return c==null?null:d.isArray(c)?d.map(c,function(a,c){return{name:b.name,value:a.replace(br,"\r\n")}}):{name:b.name,value:c.replace(br,"\r\n")}}).get()}}),d.each("ajaxStart ajaxStop ajaxComplete ajaxError ajaxSuccess ajaxSend".split(" "),function(a,b){d.fn[b]=function(a){return this.bind(b,a)}}),d.each(["get","post"],function(a,c){d[c]=function(a,e,f,g){d.isFunction(e)&&(g=g||f,f=e,e=b);return d.ajax({type:c,url:a,data:e,success:f,dataType:g})}}),d.extend({getScript:function(a,c){return d.get(a,b,c,"script")},getJSON:function(a,b,c){return d.get(a,b,c,"json")},ajaxSetup:function(a,b){b?d.extend(!0,a,d.ajaxSettings,b):(b=a,a=d.extend(!0,d.ajaxSettings,b));for(var c in {context:1,url:1})c in b?a[c]=b[c]:c in d.ajaxSettings&&(a[c]=d.ajaxSettings[c]);return a},ajaxSettings:{url:bJ,isLocal:bv.test(bK[1]),global:!0,type:"GET",contentType:"application/x-www-form-urlencoded",processData:!0,async:!0,accepts:{xml:"application/xml, text/xml",html:"text/html",text:"text/plain",json:"application/json, text/javascript","*":"*/*"},contents:{xml:/xml/,html:/html/,json:/json/},responseFields:{xml:"responseXML",text:"responseText"},converters:{"* text":a.String,"text html":!0,"text json":d.parseJSON,"text xml":d.parseXML}},ajaxPrefilter:bM(bH),ajaxTransport:bM(bI),ajax:function(a,c){function v(a,c,l,n){if(r!==2){r=2,p&&clearTimeout(p),o=b,m=n||"",u.readyState=a?4:0;var q,t,v,w=l?bP(e,u,l):b,x,y;if(a>=200&&a<300||a===304){if(e.ifModified){if(x=u.getResponseHeader("Last-Modified"))d.lastModified[k]=x;if(y=u.getResponseHeader("Etag"))d.etag[k]=y}if(a===304)c="notmodified",q=!0;else try{t=bQ(e,w),c="success",q=!0}catch(z){c="parsererror",v=z}}else{v=c;if(!c||a)c="error",a<0&&(a=0)}u.status=a,u.statusText=c,q?h.resolveWith(f,[t,c,u]):h.rejectWith(f,[u,c,v]),u.statusCode(j),j=b,s&&g.trigger("ajax"+(q?"Success":"Error"),[u,e,q?t:v]),i.resolveWith(f,[u,c]),s&&(g.trigger("ajaxComplete",[u,e]),--d.active||d.event.trigger("ajaxStop"))}}typeof a==="object"&&(c=a,a=b),c=c||{};var e=d.ajaxSetup({},c),f=e.context||e,g=f!==e&&(f.nodeType||f instanceof d)?d(f):d.event,h=d.Deferred(),i=d._Deferred(),j=e.statusCode||{},k,l={},m,n,o,p,q,r=0,s,t,u={readyState:0,setRequestHeader:function(a,b){r||(l[a.toLowerCase().replace(bD,bE)]=b);return this},getAllResponseHeaders:function(){return r===2?m:null},getResponseHeader:function(a){var c;if(r===2){if(!n){n={};while(c=bt.exec(m))n[c[1].toLowerCase()]=c[2]}c=n[a.toLowerCase()]}return c===b?null:c},overrideMimeType:function(a){r||(e.mimeType=a);return this},abort:function(a){a=a||"abort",o&&o.abort(a),v(0,a);return this}};h.promise(u),u.success=u.done,u.error=u.fail,u.complete=i.done,u.statusCode=function(a){if(a){var b;if(r<2)for(b in a)j[b]=[j[b],a[b]];else b=a[u.status],u.then(b,b)}return this},e.url=((a||e.url)+"").replace(bs,"").replace(bx,bK[1]+"//"),e.dataTypes=d.trim(e.dataType||"*").toLowerCase().split(bB),e.crossDomain||(q=bF.exec(e.url.toLowerCase()),e.crossDomain=q&&(q[1]!=bK[1]||q[2]!=bK[2]||(q[3]||(q[1]==="http:"?80:443))!=(bK[3]||(bK[1]==="http:"?80:443)))),e.data&&e.processData&&typeof e.data!=="string"&&(e.data=d.param(e.data,e.traditional)),bN(bH,e,c,u);if(r===2)return!1;s=e.global,e.type=e.type.toUpperCase(),e.hasContent=!bw.test(e.type),s&&d.active++===0&&d.event.trigger("ajaxStart");if(!e.hasContent){e.data&&(e.url+=(by.test(e.url)?"&":"?")+e.data),k=e.url;if(e.cache===!1){var w=d.now(),x=e.url.replace(bC,"$1_="+w);e.url=x+(x===e.url?(by.test(e.url)?"&":"?")+"_="+w:"")}}if(e.data&&e.hasContent&&e.contentType!==!1||c.contentType)l["Content-Type"]=e.contentType;e.ifModified&&(k=k||e.url,d.lastModified[k]&&(l["If-Modified-Since"]=d.lastModified[k]),d.etag[k]&&(l["If-None-Match"]=d.etag[k])),l.Accept=e.dataTypes[0]&&e.accepts[e.dataTypes[0]]?e.accepts[e.dataTypes[0]]+(e.dataTypes[0]!=="*"?", */*; q=0.01":""):e.accepts["*"];for(t in e.headers)u.setRequestHeader(t,e.headers[t]);if(e.beforeSend&&(e.beforeSend.call(f,u,e)===!1||r===2)){u.abort();return!1}for(t in {success:1,error:1,complete:1})u[t](e[t]);o=bN(bI,e,c,u);if(o){u.readyState=1,s&&g.trigger("ajaxSend",[u,e]),e.async&&e.timeout>0&&(p=setTimeout(function(){u.abort("timeout")},e.timeout));try{r=1,o.send(l,v)}catch(y){status<2?v(-1,y):d.error(y)}}else v(-1,"No Transport");return u},param:function(a,c){var e=[],f=function(a,b){b=d.isFunction(b)?b():b,e[e.length]=encodeURIComponent(a)+"="+encodeURIComponent(b)};c===b&&(c=d.ajaxSettings.traditional);if(d.isArray(a)||a.jquery&&!d.isPlainObject(a))d.each(a,function(){f(this.name,this.value)});else for(var g in a)bO(g,a[g],c,f);return e.join("&").replace(bp,"+")}}),d.extend({active:0,lastModified:{},etag:{}});var bR=d.now(),bS=/(\=)\?(&|$)|()\?\?()/i;d.ajaxSetup({jsonp:"callback",jsonpCallback:function(){return d.expando+"_"+bR++}}),d.ajaxPrefilter("json jsonp",function(b,c,e){var f=typeof b.data==="string";if(b.dataTypes[0]==="jsonp"||c.jsonpCallback||c.jsonp!=null||b.jsonp!==!1&&(bS.test(b.url)||f&&bS.test(b.data))){var g,h=b.jsonpCallback=d.isFunction(b.jsonpCallback)?b.jsonpCallback():b.jsonpCallback,i=a[h],j=b.url,k=b.data,l="$1"+h+"$2",m=function(){a[h]=i,g&&d.isFunction(i)&&a[h](g[0])};b.jsonp!==!1&&(j=j.replace(bS,l),b.url===j&&(f&&(k=k.replace(bS,l)),b.data===k&&(j+=(/\?/.test(j)?"&":"?")+b.jsonp+"="+h))),b.url=j,b.data=k,a[h]=function(a){g=[a]},e.then(m,m),b.converters["script json"]=function(){g||d.error(h+" was not called");return g[0]},b.dataTypes[0]="json";return"script"}}),d.ajaxSetup({accepts:{script:"text/javascript, application/javascript, application/ecmascript, application/x-ecmascript"},contents:{script:/javascript|ecmascript/},converters:{"text script":function(a){d.globalEval(a);return a}}}),d.ajaxPrefilter("script",function(a){a.cache===b&&(a.cache=!1),a.crossDomain&&(a.type="GET",a.global=!1)}),d.ajaxTransport("script",function(a){if(a.crossDomain){var d,e=c.head||c.getElementsByTagName("head")[0]||c.documentElement;return{send:function(f,g){d=c.createElement("script"),d.async="async",a.scriptCharset&&(d.charset=a.scriptCharset),d.src=a.url,d.onload=d.onreadystatechange=function(a,c){if(!d.readyState||/loaded|complete/.test(d.readyState))d.onload=d.onreadystatechange=null,e&&d.parentNode&&e.removeChild(d),d=b,c||g(200,"success")},e.insertBefore(d,e.firstChild)},abort:function(){d&&d.onload(0,1)}}}});var bT=d.now(),bU,bV;d.ajaxSettings.xhr=a.ActiveXObject?function(){return!this.isLocal&&bX()||bY()}:bX,bV=d.ajaxSettings.xhr(),d.support.ajax=!!bV,d.support.cors=bV&&"withCredentials"in bV,bV=b,d.support.ajax&&d.ajaxTransport(function(a){if(!a.crossDomain||d.support.cors){var c;return{send:function(e,f){var g=a.xhr(),h,i;a.username?g.open(a.type,a.url,a.async,a.username,a.password):g.open(a.type,a.url,a.async);if(a.xhrFields)for(i in a.xhrFields)g[i]=a.xhrFields[i];a.mimeType&&g.overrideMimeType&&g.overrideMimeType(a.mimeType),(!a.crossDomain||a.hasContent)&&!e["X-Requested-With"]&&(e["X-Requested-With"]="XMLHttpRequest");try{for(i in e)g.setRequestHeader(i,e[i])}catch(j){}g.send(a.hasContent&&a.data||null),c=function(e,i){var j,k,l,m,n;try{if(c&&(i||g.readyState===4)){c=b,h&&(g.onreadystatechange=d.noop,delete bU[h]);if(i)g.readyState!==4&&g.abort();else{j=g.status,l=g.getAllResponseHeaders(),m={},n=g.responseXML,n&&n.documentElement&&(m.xml=n),m.text=g.responseText;try{k=g.statusText}catch(o){k=""}j||!a.isLocal||a.crossDomain?j===1223&&(j=204):j=m.text?200:404}}}catch(p){i||f(-1,p)}m&&f(j,k,m,l)},a.async&&g.readyState!==4?(bU||(bU={},bW()),h=bT++,g.onreadystatechange=bU[h]=c):c()},abort:function(){c&&c(0,1)}}}});var bZ={},b$=/^(?:toggle|show|hide)$/,b_=/^([+\-]=)?([\d+.\-]+)([a-z%]*)$/i,ca,cb=[["height","marginTop","marginBottom","paddingTop","paddingBottom"],["width","marginLeft","marginRight","paddingLeft","paddingRight"],["opacity"]];d.fn.extend({show:function(a,b,c){var e,f;if(a||a===0)return this.animate(cc("show",3),a,b,c);for(var g=0,h=this.length;g
=0;a--)c[a].elem===this&&(b&&c[a](!0),c.splice(a,1))}),b||this.dequeue();return this}}),d.each({slideDown:cc("show",1),slideUp:cc("hide",1),slideToggle:cc("toggle",1),fadeIn:{opacity:"show"},fadeOut:{opacity:"hide"},fadeToggle:{opacity:"toggle"}},function(a,b){d.fn[a]=function(a,c,d){return this.animate(b,a,c,d)}}),d.extend({speed:function(a,b,c){var e=a&&typeof a==="object"?d.extend({},a):{complete:c||!c&&b||d.isFunction(a)&&a,duration:a,easing:c&&b||b&&!d.isFunction(b)&&b};e.duration=d.fx.off?0:typeof e.duration==="number"?e.duration:e.duration in d.fx.speeds?d.fx.speeds[e.duration]:d.fx.speeds._default,e.old=e.complete,e.complete=function(){e.queue!==!1&&d(this).dequeue(),d.isFunction(e.old)&&e.old.call(this)};return e},easing:{linear:function(a,b,c,d){return c+d*a},swing:function(a,b,c,d){return(-Math.cos(a*Math.PI)/2+.5)*d+c}},timers:[],fx:function(a,b,c){this.options=b,this.elem=a,this.prop=c,b.orig||(b.orig={})}}),d.fx.prototype={update:function(){this.options.step&&this.options.step.call(this.elem,this.now,this),(d.fx.step[this.prop]||d.fx.step._default)(this)},cur:function(){if(this.elem[this.prop]!=null&&(!this.elem.style||this.elem.style[this.prop]==null))return this.elem[this.prop];var a,b=d.css(this.elem,this.prop);return isNaN(a=parseFloat(b))?!b||b==="auto"?0:b:a},custom:function(a,b,c){function g(a){return e.step(a)}var e=this,f=d.fx;this.startTime=d.now(),this.start=a,this.end=b,this.unit=c||this.unit||(d.cssNumber[this.prop]?"":"px"),this.now=this.start,this.pos=this.state=0,g.elem=this.elem,g()&&d.timers.push(g)&&!ca&&(ca=setInterval(f.tick,f.interval))},show:function(){this.options.orig[this.prop]=d.style(this.elem,this.prop),this.options.show=!0,this.custom(this.prop==="width"||this.prop==="height"?1:0,this.cur()),d(this.elem).show()},hide:function(){this.options.orig[this.prop]=d.style(this.elem,this.prop),this.options.hide=!0,this.custom(this.cur(),0)},step:function(a){var b=d.now(),c=!0;if(a||b>=this.options.duration+this.startTime){this.now=this.end,this.pos=this.state=1,this.update(),this.options.curAnim[this.prop]=!0;for(var e in this.options.curAnim)this.options.curAnim[e]!==!0&&(c=!1);if(c){if(this.options.overflow!=null&&!d.support.shrinkWrapBlocks){var f=this.elem,g=this.options;d.each(["","X","Y"],function(a,b){f.style["overflow"+b]=g.overflow[a]})}this.options.hide&&d(this.elem).hide();if(this.options.hide||this.options.show)for(var h in this.options.curAnim)d.style(this.elem,h,this.options.orig[h]);this.options.complete.call(this.elem)}return!1}var i=b-this.startTime;this.state=i/this.options.duration;var j=this.options.specialEasing&&this.options.specialEasing[this.prop],k=this.options.easing||(d.easing.swing?"swing":"linear");this.pos=d.easing[j||k](this.state,i,0,1,this.options.duration),this.now=this.start+(this.end-this.start)*this.pos,this.update();return!0}},d.extend(d.fx,{tick:function(){var a=d.timers;for(var b=0;b
0){return true}m[j]=1;l=(m[j]>0);m[j]=0;return l},isOverAxis:function(k,j,l){return(k>j)&&(k<(j+l))},isOver:function(o,k,n,m,j,l){return c.ui.isOverAxis(o,n,j)&&c.ui.isOverAxis(k,m,l)},keyCode:{BACKSPACE:8,CAPS_LOCK:20,COMMA:188,CONTROL:17,DELETE:46,DOWN:40,END:35,ENTER:13,ESCAPE:27,HOME:36,INSERT:45,LEFT:37,NUMPAD_ADD:107,NUMPAD_DECIMAL:110,NUMPAD_DIVIDE:111,NUMPAD_ENTER:108,NUMPAD_MULTIPLY:106,NUMPAD_SUBTRACT:109,PAGE_DOWN:34,PAGE_UP:33,PERIOD:190,RIGHT:39,SHIFT:16,SPACE:32,TAB:9,UP:38}};if(d){var f=c.attr,e=c.fn.removeAttr,h="http://www.w3.org/2005/07/aaa",a=/^aria-/,b=/^wairole:/;c.attr=function(k,j,l){var m=l!==undefined;return(j=="role"?(m?f.call(this,k,j,"wairole:"+l):(f.apply(this,arguments)||"").replace(b,"")):(a.test(j)?(m?k.setAttributeNS(h,j.replace(a,"aaa:"),l):f.call(this,k,j.replace(a,"aaa:"))):f.apply(this,arguments)))};c.fn.removeAttr=function(j){return(a.test(j)?this.each(function(){this.removeAttributeNS(h,j.replace(a,""))}):e.call(this,j))}}c.fn.extend({remove:function(){c("*",this).add(this).each(function(){c(this).triggerHandler("remove")});return i.apply(this,arguments)},enableSelection:function(){return this.attr("unselectable","off").css("MozUserSelect","").unbind("selectstart.ui")},disableSelection:function(){return this.attr("unselectable","on").css("MozUserSelect","none").bind("selectstart.ui",function(){return false})},scrollParent:function(){var j;if((c.browser.msie&&(/(static|relative)/).test(this.css("position")))||(/absolute/).test(this.css("position"))){j=this.parents().filter(function(){return(/(relative|absolute|fixed)/).test(c.curCSS(this,"position",1))&&(/(auto|scroll)/).test(c.curCSS(this,"overflow",1)+c.curCSS(this,"overflow-y",1)+c.curCSS(this,"overflow-x",1))}).eq(0)}else{j=this.parents().filter(function(){return(/(auto|scroll)/).test(c.curCSS(this,"overflow",1)+c.curCSS(this,"overflow-y",1)+c.curCSS(this,"overflow-x",1))}).eq(0)}return(/fixed/).test(this.css("position"))||!j.length?c(document):j}});c.extend(c.expr[":"],{data:function(l,k,j){return !!c.data(l,j[3])},focusable:function(k){var l=k.nodeName.toLowerCase(),j=c.attr(k,"tabindex");return(/input|select|textarea|button|object/.test(l)?!k.disabled:"a"==l||"area"==l?k.href||!isNaN(j):!isNaN(j))&&!c(k)["area"==l?"parents":"closest"](":hidden").length},tabbable:function(k){var j=c.attr(k,"tabindex");return(isNaN(j)||j>=0)&&c(k).is(":focusable")}});function g(m,n,o,l){function k(q){var p=c[m][n][q]||[];return(typeof p=="string"?p.split(/,?\s+/):p)}var j=k("getter");if(l.length==1&&typeof l[0]=="string"){j=j.concat(k("getterSetter"))}return(c.inArray(o,j)!=-1)}c.widget=function(k,j){var l=k.split(".")[0];k=k.split(".")[1];c.fn[k]=function(p){var n=(typeof p=="string"),o=Array.prototype.slice.call(arguments,1);if(n&&p.substring(0,1)=="_"){return this}if(n&&g(l,k,p,o)){var m=c.data(this[0],k);return(m?m[p].apply(m,o):undefined)}return this.each(function(){var q=c.data(this,k);(!q&&!n&&c.data(this,k,new c[l][k](this,p))._init());(q&&n&&c.isFunction(q[p])&&q[p].apply(q,o))})};c[l]=c[l]||{};c[l][k]=function(o,n){var m=this;this.namespace=l;this.widgetName=k;this.widgetEventPrefix=c[l][k].eventPrefix||k;this.widgetBaseClass=l+"-"+k;this.options=c.extend({},c.widget.defaults,c[l][k].defaults,c.metadata&&c.metadata.get(o)[k],n);this.element=c(o).bind("setData."+k,function(q,p,r){if(q.target==o){return m._setData(p,r)}}).bind("getData."+k,function(q,p){if(q.target==o){return m._getData(p)}}).bind("remove",function(){return m.destroy()})};c[l][k].prototype=c.extend({},c.widget.prototype,j);c[l][k].getterSetter="option"};c.widget.prototype={_init:function(){},destroy:function(){this.element.removeData(this.widgetName).removeClass(this.widgetBaseClass+"-disabled "+this.namespace+"-state-disabled").removeAttr("aria-disabled")},option:function(l,m){var k=l,j=this;if(typeof l=="string"){if(m===undefined){return this._getData(l)}k={};k[l]=m}c.each(k,function(n,o){j._setData(n,o)})},_getData:function(j){return this.options[j]},_setData:function(j,k){this.options[j]=k;if(j=="disabled"){this.element[k?"addClass":"removeClass"](this.widgetBaseClass+"-disabled "+this.namespace+"-state-disabled").attr("aria-disabled",k)}},enable:function(){this._setData("disabled",false)},disable:function(){this._setData("disabled",true)},_trigger:function(l,m,n){var p=this.options[l],j=(l==this.widgetEventPrefix?l:this.widgetEventPrefix+l);m=c.Event(m);m.type=j;if(m.originalEvent){for(var k=c.event.props.length,o;k;){o=c.event.props[--k];m[o]=m.originalEvent[o]}}this.element.trigger(m,n);return !(c.isFunction(p)&&p.call(this.element[0],m,n)===false||m.isDefaultPrevented())}};c.widget.defaults={disabled:false};c.ui.mouse={_mouseInit:function(){var j=this;this.element.bind("mousedown."+this.widgetName,function(k){return j._mouseDown(k)}).bind("click."+this.widgetName,function(k){if(j._preventClickEvent){j._preventClickEvent=false;k.stopImmediatePropagation();return false}});if(c.browser.msie){this._mouseUnselectable=this.element.attr("unselectable");this.element.attr("unselectable","on")}this.started=false},_mouseDestroy:function(){this.element.unbind("."+this.widgetName);(c.browser.msie&&this.element.attr("unselectable",this._mouseUnselectable))},_mouseDown:function(l){l.originalEvent=l.originalEvent||{};if(l.originalEvent.mouseHandled){return}(this._mouseStarted&&this._mouseUp(l));this._mouseDownEvent=l;var k=this,m=(l.which==1),j=(typeof this.options.cancel=="string"?c(l.target).parents().add(l.target).filter(this.options.cancel).length:false);if(!m||j||!this._mouseCapture(l)){return true}this.mouseDelayMet=!this.options.delay;if(!this.mouseDelayMet){this._mouseDelayTimer=setTimeout(function(){k.mouseDelayMet=true},this.options.delay)}if(this._mouseDistanceMet(l)&&this._mouseDelayMet(l)){this._mouseStarted=(this._mouseStart(l)!==false);if(!this._mouseStarted){l.preventDefault();return true}}this._mouseMoveDelegate=function(n){return k._mouseMove(n)};this._mouseUpDelegate=function(n){return k._mouseUp(n)};c(document).bind("mousemove."+this.widgetName,this._mouseMoveDelegate).bind("mouseup."+this.widgetName,this._mouseUpDelegate);(c.browser.safari||l.preventDefault());l.originalEvent.mouseHandled=true;return true},_mouseMove:function(j){if(c.browser.msie&&!j.button){return this._mouseUp(j)}if(this._mouseStarted){this._mouseDrag(j);return j.preventDefault()}if(this._mouseDistanceMet(j)&&this._mouseDelayMet(j)){this._mouseStarted=(this._mouseStart(this._mouseDownEvent,j)!==false);(this._mouseStarted?this._mouseDrag(j):this._mouseUp(j))}return !this._mouseStarted},_mouseUp:function(j){c(document).unbind("mousemove."+this.widgetName,this._mouseMoveDelegate).unbind("mouseup."+this.widgetName,this._mouseUpDelegate);if(this._mouseStarted){this._mouseStarted=false;this._preventClickEvent=(j.target==this._mouseDownEvent.target);this._mouseStop(j)}return false},_mouseDistanceMet:function(j){return(Math.max(Math.abs(this._mouseDownEvent.pageX-j.pageX),Math.abs(this._mouseDownEvent.pageY-j.pageY))>=this.options.distance)},_mouseDelayMet:function(j){return this.mouseDelayMet},_mouseStart:function(j){},_mouseDrag:function(j){},_mouseStop:function(j){},_mouseCapture:function(j){return true}};c.ui.mouse.defaults={cancel:null,distance:1,delay:0}})(jQuery);;/*
+ * jQuery UI Draggable 1.7.2
+ *
+ * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Draggables
+ *
+ * Depends:
+ * ui.core.js
+ */
+(function(a){a.widget("ui.draggable",a.extend({},a.ui.mouse,{_init:function(){if(this.options.helper=="original"&&!(/^(?:r|a|f)/).test(this.element.css("position"))){this.element[0].style.position="relative"}(this.options.addClasses&&this.element.addClass("ui-draggable"));(this.options.disabled&&this.element.addClass("ui-draggable-disabled"));this._mouseInit()},destroy:function(){if(!this.element.data("draggable")){return}this.element.removeData("draggable").unbind(".draggable").removeClass("ui-draggable ui-draggable-dragging ui-draggable-disabled");this._mouseDestroy()},_mouseCapture:function(b){var c=this.options;if(this.helper||c.disabled||a(b.target).is(".ui-resizable-handle")){return false}this.handle=this._getHandle(b);if(!this.handle){return false}return true},_mouseStart:function(b){var c=this.options;this.helper=this._createHelper(b);this._cacheHelperProportions();if(a.ui.ddmanager){a.ui.ddmanager.current=this}this._cacheMargins();this.cssPosition=this.helper.css("position");this.scrollParent=this.helper.scrollParent();this.offset=this.element.offset();this.offset={top:this.offset.top-this.margins.top,left:this.offset.left-this.margins.left};a.extend(this.offset,{click:{left:b.pageX-this.offset.left,top:b.pageY-this.offset.top},parent:this._getParentOffset(),relative:this._getRelativeOffset()});this.originalPosition=this._generatePosition(b);this.originalPageX=b.pageX;this.originalPageY=b.pageY;if(c.cursorAt){this._adjustOffsetFromHelper(c.cursorAt)}if(c.containment){this._setContainment()}this._trigger("start",b);this._cacheHelperProportions();if(a.ui.ddmanager&&!c.dropBehaviour){a.ui.ddmanager.prepareOffsets(this,b)}this.helper.addClass("ui-draggable-dragging");this._mouseDrag(b,true);return true},_mouseDrag:function(b,d){this.position=this._generatePosition(b);this.positionAbs=this._convertPositionTo("absolute");if(!d){var c=this._uiHash();this._trigger("drag",b,c);this.position=c.position}if(!this.options.axis||this.options.axis!="y"){this.helper[0].style.left=this.position.left+"px"}if(!this.options.axis||this.options.axis!="x"){this.helper[0].style.top=this.position.top+"px"}if(a.ui.ddmanager){a.ui.ddmanager.drag(this,b)}return false},_mouseStop:function(c){var d=false;if(a.ui.ddmanager&&!this.options.dropBehaviour){d=a.ui.ddmanager.drop(this,c)}if(this.dropped){d=this.dropped;this.dropped=false}if((this.options.revert=="invalid"&&!d)||(this.options.revert=="valid"&&d)||this.options.revert===true||(a.isFunction(this.options.revert)&&this.options.revert.call(this.element,d))){var b=this;a(this.helper).animate(this.originalPosition,parseInt(this.options.revertDuration,10),function(){b._trigger("stop",c);b._clear()})}else{this._trigger("stop",c);this._clear()}return false},_getHandle:function(b){var c=!this.options.handle||!a(this.options.handle,this.element).length?true:false;a(this.options.handle,this.element).find("*").andSelf().each(function(){if(this==b.target){c=true}});return c},_createHelper:function(c){var d=this.options;var b=a.isFunction(d.helper)?a(d.helper.apply(this.element[0],[c])):(d.helper=="clone"?this.element.clone():this.element);if(!b.parents("body").length){b.appendTo((d.appendTo=="parent"?this.element[0].parentNode:d.appendTo))}if(b[0]!=this.element[0]&&!(/(fixed|absolute)/).test(b.css("position"))){b.css("position","absolute")}return b},_adjustOffsetFromHelper:function(b){if(b.left!=undefined){this.offset.click.left=b.left+this.margins.left}if(b.right!=undefined){this.offset.click.left=this.helperProportions.width-b.right+this.margins.left}if(b.top!=undefined){this.offset.click.top=b.top+this.margins.top}if(b.bottom!=undefined){this.offset.click.top=this.helperProportions.height-b.bottom+this.margins.top}},_getParentOffset:function(){this.offsetParent=this.helper.offsetParent();var b=this.offsetParent.offset();if(this.cssPosition=="absolute"&&this.scrollParent[0]!=document&&a.ui.contains(this.scrollParent[0],this.offsetParent[0])){b.left+=this.scrollParent.scrollLeft();b.top+=this.scrollParent.scrollTop()}if((this.offsetParent[0]==document.body)||(this.offsetParent[0].tagName&&this.offsetParent[0].tagName.toLowerCase()=="html"&&a.browser.msie)){b={top:0,left:0}}return{top:b.top+(parseInt(this.offsetParent.css("borderTopWidth"),10)||0),left:b.left+(parseInt(this.offsetParent.css("borderLeftWidth"),10)||0)}},_getRelativeOffset:function(){if(this.cssPosition=="relative"){var b=this.element.position();return{top:b.top-(parseInt(this.helper.css("top"),10)||0)+this.scrollParent.scrollTop(),left:b.left-(parseInt(this.helper.css("left"),10)||0)+this.scrollParent.scrollLeft()}}else{return{top:0,left:0}}},_cacheMargins:function(){this.margins={left:(parseInt(this.element.css("marginLeft"),10)||0),top:(parseInt(this.element.css("marginTop"),10)||0)}},_cacheHelperProportions:function(){this.helperProportions={width:this.helper.outerWidth(),height:this.helper.outerHeight()}},_setContainment:function(){var e=this.options;if(e.containment=="parent"){e.containment=this.helper[0].parentNode}if(e.containment=="document"||e.containment=="window"){this.containment=[0-this.offset.relative.left-this.offset.parent.left,0-this.offset.relative.top-this.offset.parent.top,a(e.containment=="document"?document:window).width()-this.helperProportions.width-this.margins.left,(a(e.containment=="document"?document:window).height()||document.body.parentNode.scrollHeight)-this.helperProportions.height-this.margins.top]}if(!(/^(document|window|parent)$/).test(e.containment)&&e.containment.constructor!=Array){var c=a(e.containment)[0];if(!c){return}var d=a(e.containment).offset();var b=(a(c).css("overflow")!="hidden");this.containment=[d.left+(parseInt(a(c).css("borderLeftWidth"),10)||0)+(parseInt(a(c).css("paddingLeft"),10)||0)-this.margins.left,d.top+(parseInt(a(c).css("borderTopWidth"),10)||0)+(parseInt(a(c).css("paddingTop"),10)||0)-this.margins.top,d.left+(b?Math.max(c.scrollWidth,c.offsetWidth):c.offsetWidth)-(parseInt(a(c).css("borderLeftWidth"),10)||0)-(parseInt(a(c).css("paddingRight"),10)||0)-this.helperProportions.width-this.margins.left,d.top+(b?Math.max(c.scrollHeight,c.offsetHeight):c.offsetHeight)-(parseInt(a(c).css("borderTopWidth"),10)||0)-(parseInt(a(c).css("paddingBottom"),10)||0)-this.helperProportions.height-this.margins.top]}else{if(e.containment.constructor==Array){this.containment=e.containment}}},_convertPositionTo:function(f,h){if(!h){h=this.position}var c=f=="absolute"?1:-1;var e=this.options,b=this.cssPosition=="absolute"&&!(this.scrollParent[0]!=document&&a.ui.contains(this.scrollParent[0],this.offsetParent[0]))?this.offsetParent:this.scrollParent,g=(/(html|body)/i).test(b[0].tagName);return{top:(h.top+this.offset.relative.top*c+this.offset.parent.top*c-(a.browser.safari&&this.cssPosition=="fixed"?0:(this.cssPosition=="fixed"?-this.scrollParent.scrollTop():(g?0:b.scrollTop()))*c)),left:(h.left+this.offset.relative.left*c+this.offset.parent.left*c-(a.browser.safari&&this.cssPosition=="fixed"?0:(this.cssPosition=="fixed"?-this.scrollParent.scrollLeft():g?0:b.scrollLeft())*c))}},_generatePosition:function(e){var h=this.options,b=this.cssPosition=="absolute"&&!(this.scrollParent[0]!=document&&a.ui.contains(this.scrollParent[0],this.offsetParent[0]))?this.offsetParent:this.scrollParent,i=(/(html|body)/i).test(b[0].tagName);if(this.cssPosition=="relative"&&!(this.scrollParent[0]!=document&&this.scrollParent[0]!=this.offsetParent[0])){this.offset.relative=this._getRelativeOffset()}var d=e.pageX;var c=e.pageY;if(this.originalPosition){if(this.containment){if(e.pageX-this.offset.click.leftthis.containment[2]){d=this.containment[2]+this.offset.click.left}if(e.pageY-this.offset.click.top>this.containment[3]){c=this.containment[3]+this.offset.click.top}}if(h.grid){var g=this.originalPageY+Math.round((c-this.originalPageY)/h.grid[1])*h.grid[1];c=this.containment?(!(g-this.offset.click.topthis.containment[3])?g:(!(g-this.offset.click.topthis.containment[2])?f:(!(f-this.offset.click.left').css({width:this.offsetWidth+"px",height:this.offsetHeight+"px",position:"absolute",opacity:"0.001",zIndex:1000}).css(a(this).offset()).appendTo("body")})},stop:function(b,c){a("div.ui-draggable-iframeFix").each(function(){this.parentNode.removeChild(this)})}});a.ui.plugin.add("draggable","opacity",{start:function(c,d){var b=a(d.helper),e=a(this).data("draggable").options;if(b.css("opacity")){e._opacity=b.css("opacity")}b.css("opacity",e.opacity)},stop:function(b,c){var d=a(this).data("draggable").options;if(d._opacity){a(c.helper).css("opacity",d._opacity)}}});a.ui.plugin.add("draggable","scroll",{start:function(c,d){var b=a(this).data("draggable");if(b.scrollParent[0]!=document&&b.scrollParent[0].tagName!="HTML"){b.overflowOffset=b.scrollParent.offset()}},drag:function(d,e){var c=a(this).data("draggable"),f=c.options,b=false;if(c.scrollParent[0]!=document&&c.scrollParent[0].tagName!="HTML"){if(!f.axis||f.axis!="x"){if((c.overflowOffset.top+c.scrollParent[0].offsetHeight)-d.pageY=0;v--){var s=g.snapElements[v].left,n=s+g.snapElements[v].width,m=g.snapElements[v].top,A=m+g.snapElements[v].height;if(!((s-y=p&&n<=k)||(m>=p&&m<=k)||(nk))&&((e>=g&&e<=c)||(d>=g&&d<=c)||(ec));break;default:return false;break}};a.ui.ddmanager={current:null,droppables:{"default":[]},prepareOffsets:function(e,g){var b=a.ui.ddmanager.droppables[e.options.scope];var f=g?g.type:null;var h=(e.currentItem||e.element).find(":data(droppable)").andSelf();droppablesLoop:for(var d=0;d').css({position:this.element.css("position"),width:this.element.outerWidth(),height:this.element.outerHeight(),top:this.element.css("top"),left:this.element.css("left")}));this.element=this.element.parent().data("resizable",this.element.data("resizable"));this.elementIsWrapper=true;this.element.css({marginLeft:this.originalElement.css("marginLeft"),marginTop:this.originalElement.css("marginTop"),marginRight:this.originalElement.css("marginRight"),marginBottom:this.originalElement.css("marginBottom")});this.originalElement.css({marginLeft:0,marginTop:0,marginRight:0,marginBottom:0});this.originalResizeStyle=this.originalElement.css("resize");this.originalElement.css("resize","none");this._proportionallyResizeElements.push(this.originalElement.css({position:"static",zoom:1,display:"block"}));this.originalElement.css({margin:this.originalElement.css("margin")});this._proportionallyResize()}this.handles=j.handles||(!c(".ui-resizable-handle",this.element).length?"e,s,se":{n:".ui-resizable-n",e:".ui-resizable-e",s:".ui-resizable-s",w:".ui-resizable-w",se:".ui-resizable-se",sw:".ui-resizable-sw",ne:".ui-resizable-ne",nw:".ui-resizable-nw"});if(this.handles.constructor==String){if(this.handles=="all"){this.handles="n,e,s,w,se,sw,ne,nw"}var k=this.handles.split(",");this.handles={};for(var f=0;f');if(/sw|se|ne|nw/.test(h)){g.css({zIndex:++j.zIndex})}if("se"==h){g.addClass("ui-icon ui-icon-gripsmall-diagonal-se")}this.handles[h]=".ui-resizable-"+h;this.element.append(g)}}this._renderAxis=function(p){p=p||this.element;for(var m in this.handles){if(this.handles[m].constructor==String){this.handles[m]=c(this.handles[m],this.element).show()}if(this.elementIsWrapper&&this.originalElement[0].nodeName.match(/textarea|input|select|button/i)){var n=c(this.handles[m],this.element),o=0;o=/sw|ne|nw|se|n|s/.test(m)?n.outerHeight():n.outerWidth();var l=["padding",/ne|nw|n/.test(m)?"Top":/se|sw|s/.test(m)?"Bottom":/^e$/.test(m)?"Right":"Left"].join("");p.css(l,o);this._proportionallyResize()}if(!c(this.handles[m]).length){continue}}};this._renderAxis(this.element);this._handles=c(".ui-resizable-handle",this.element).disableSelection();this._handles.mouseover(function(){if(!e.resizing){if(this.className){var i=this.className.match(/ui-resizable-(se|sw|ne|nw|n|e|s|w)/i)}e.axis=i&&i[1]?i[1]:"se"}});if(j.autoHide){this._handles.hide();c(this.element).addClass("ui-resizable-autohide").hover(function(){c(this).removeClass("ui-resizable-autohide");e._handles.show()},function(){if(!e.resizing){c(this).addClass("ui-resizable-autohide");e._handles.hide()}})}this._mouseInit()},destroy:function(){this._mouseDestroy();var d=function(f){c(f).removeClass("ui-resizable ui-resizable-disabled ui-resizable-resizing").removeData("resizable").unbind(".resizable").find(".ui-resizable-handle").remove()};if(this.elementIsWrapper){d(this.element);var e=this.element;e.parent().append(this.originalElement.css({position:e.css("position"),width:e.outerWidth(),height:e.outerHeight(),top:e.css("top"),left:e.css("left")})).end().remove()}this.originalElement.css("resize",this.originalResizeStyle);d(this.originalElement)},_mouseCapture:function(e){var f=false;for(var d in this.handles){if(c(this.handles[d])[0]==e.target){f=true}}return this.options.disabled||!!f},_mouseStart:function(f){var i=this.options,e=this.element.position(),d=this.element;this.resizing=true;this.documentScroll={top:c(document).scrollTop(),left:c(document).scrollLeft()};if(d.is(".ui-draggable")||(/absolute/).test(d.css("position"))){d.css({position:"absolute",top:e.top,left:e.left})}if(c.browser.opera&&(/relative/).test(d.css("position"))){d.css({position:"relative",top:"auto",left:"auto"})}this._renderProxy();var j=b(this.helper.css("left")),g=b(this.helper.css("top"));if(i.containment){j+=c(i.containment).scrollLeft()||0;g+=c(i.containment).scrollTop()||0}this.offset=this.helper.offset();this.position={left:j,top:g};this.size=this._helper?{width:d.outerWidth(),height:d.outerHeight()}:{width:d.width(),height:d.height()};this.originalSize=this._helper?{width:d.outerWidth(),height:d.outerHeight()}:{width:d.width(),height:d.height()};this.originalPosition={left:j,top:g};this.sizeDiff={width:d.outerWidth()-d.width(),height:d.outerHeight()-d.height()};this.originalMousePosition={left:f.pageX,top:f.pageY};this.aspectRatio=(typeof i.aspectRatio=="number")?i.aspectRatio:((this.originalSize.width/this.originalSize.height)||1);var h=c(".ui-resizable-"+this.axis).css("cursor");c("body").css("cursor",h=="auto"?this.axis+"-resize":h);d.addClass("ui-resizable-resizing");this._propagate("start",f);return true},_mouseDrag:function(d){var g=this.helper,f=this.options,l={},p=this,i=this.originalMousePosition,m=this.axis;var q=(d.pageX-i.left)||0,n=(d.pageY-i.top)||0;var h=this._change[m];if(!h){return false}var k=h.apply(this,[d,q,n]),j=c.browser.msie&&c.browser.version<7,e=this.sizeDiff;if(this._aspectRatio||d.shiftKey){k=this._updateRatio(k,d)}k=this._respectSize(k,d);this._propagate("resize",d);g.css({top:this.position.top+"px",left:this.position.left+"px",width:this.size.width+"px",height:this.size.height+"px"});if(!this._helper&&this._proportionallyResizeElements.length){this._proportionallyResize()}this._updateCache(k);this._trigger("resize",d,this.ui());return false},_mouseStop:function(g){this.resizing=false;var h=this.options,l=this;if(this._helper){var f=this._proportionallyResizeElements,d=f.length&&(/textarea/i).test(f[0].nodeName),e=d&&c.ui.hasScroll(f[0],"left")?0:l.sizeDiff.height,j=d?0:l.sizeDiff.width;var m={width:(l.size.width-j),height:(l.size.height-e)},i=(parseInt(l.element.css("left"),10)+(l.position.left-l.originalPosition.left))||null,k=(parseInt(l.element.css("top"),10)+(l.position.top-l.originalPosition.top))||null;if(!h.animate){this.element.css(c.extend(m,{top:k,left:i}))}l.helper.height(l.size.height);l.helper.width(l.size.width);if(this._helper&&!h.animate){this._proportionallyResize()}}c("body").css("cursor","auto");this.element.removeClass("ui-resizable-resizing");this._propagate("stop",g);if(this._helper){this.helper.remove()}return false},_updateCache:function(d){var e=this.options;this.offset=this.helper.offset();if(a(d.left)){this.position.left=d.left}if(a(d.top)){this.position.top=d.top}if(a(d.height)){this.size.height=d.height}if(a(d.width)){this.size.width=d.width}},_updateRatio:function(g,f){var h=this.options,i=this.position,e=this.size,d=this.axis;if(g.height){g.width=(e.height*this.aspectRatio)}else{if(g.width){g.height=(e.width/this.aspectRatio)}}if(d=="sw"){g.left=i.left+(e.width-g.width);g.top=null}if(d=="nw"){g.top=i.top+(e.height-g.height);g.left=i.left+(e.width-g.width)}return g},_respectSize:function(k,f){var i=this.helper,h=this.options,q=this._aspectRatio||f.shiftKey,p=this.axis,s=a(k.width)&&h.maxWidth&&(h.maxWidthk.width),r=a(k.height)&&h.minHeight&&(h.minHeight>k.height);if(g){k.width=h.minWidth}if(r){k.height=h.minHeight}if(s){k.width=h.maxWidth}if(l){k.height=h.maxHeight}var e=this.originalPosition.left+this.originalSize.width,n=this.position.top+this.size.height;var j=/sw|nw|w/.test(p),d=/nw|ne|n/.test(p);if(g&&j){k.left=e-h.minWidth}if(s&&j){k.left=e-h.maxWidth}if(r&&d){k.top=n-h.minHeight}if(l&&d){k.top=n-h.maxHeight}var m=!k.width&&!k.height;if(m&&!k.left&&k.top){k.top=null}else{if(m&&!k.top&&k.left){k.left=null}}return k},_proportionallyResize:function(){var j=this.options;if(!this._proportionallyResizeElements.length){return}var f=this.helper||this.element;for(var e=0;e');var d=c.browser.msie&&c.browser.version<7,f=(d?1:0),g=(d?2:-1);this.helper.addClass(this._helper).css({width:this.element.outerWidth()+g,height:this.element.outerHeight()+g,position:"absolute",left:this.elementOffset.left-f+"px",top:this.elementOffset.top-f+"px",zIndex:++h.zIndex});this.helper.appendTo("body").disableSelection()}else{this.helper=this.element}},_change:{e:function(f,e,d){return{width:this.originalSize.width+e}},w:function(g,e,d){var i=this.options,f=this.originalSize,h=this.originalPosition;return{left:h.left+e,width:f.width-e}},n:function(g,e,d){var i=this.options,f=this.originalSize,h=this.originalPosition;return{top:h.top+d,height:f.height-d}},s:function(f,e,d){return{height:this.originalSize.height+d}},se:function(f,e,d){return c.extend(this._change.s.apply(this,arguments),this._change.e.apply(this,[f,e,d]))},sw:function(f,e,d){return c.extend(this._change.s.apply(this,arguments),this._change.w.apply(this,[f,e,d]))},ne:function(f,e,d){return c.extend(this._change.n.apply(this,arguments),this._change.e.apply(this,[f,e,d]))},nw:function(f,e,d){return c.extend(this._change.n.apply(this,arguments),this._change.w.apply(this,[f,e,d]))}},_propagate:function(e,d){c.ui.plugin.call(this,e,[d,this.ui()]);(e!="resize"&&this._trigger(e,d,this.ui()))},plugins:{},ui:function(){return{originalElement:this.originalElement,element:this.element,helper:this.helper,position:this.position,size:this.size,originalSize:this.originalSize,originalPosition:this.originalPosition}}}));c.extend(c.ui.resizable,{version:"1.7.2",eventPrefix:"resize",defaults:{alsoResize:false,animate:false,animateDuration:"slow",animateEasing:"swing",aspectRatio:false,autoHide:false,cancel:":input,option",containment:false,delay:0,distance:1,ghost:false,grid:false,handles:"e,s,se",helper:false,maxHeight:null,maxWidth:null,minHeight:10,minWidth:10,zIndex:1000}});c.ui.plugin.add("resizable","alsoResize",{start:function(e,f){var d=c(this).data("resizable"),g=d.options;_store=function(h){c(h).each(function(){c(this).data("resizable-alsoresize",{width:parseInt(c(this).width(),10),height:parseInt(c(this).height(),10),left:parseInt(c(this).css("left"),10),top:parseInt(c(this).css("top"),10)})})};if(typeof(g.alsoResize)=="object"&&!g.alsoResize.parentNode){if(g.alsoResize.length){g.alsoResize=g.alsoResize[0];_store(g.alsoResize)}else{c.each(g.alsoResize,function(h,i){_store(h)})}}else{_store(g.alsoResize)}},resize:function(f,h){var e=c(this).data("resizable"),i=e.options,g=e.originalSize,k=e.originalPosition;var j={height:(e.size.height-g.height)||0,width:(e.size.width-g.width)||0,top:(e.position.top-k.top)||0,left:(e.position.left-k.left)||0},d=function(l,m){c(l).each(function(){var p=c(this),q=c(this).data("resizable-alsoresize"),o={},n=m&&m.length?m:["width","height","top","left"];c.each(n||["width","height","top","left"],function(r,t){var s=(q[t]||0)+(j[t]||0);if(s&&s>=0){o[t]=s||null}});if(/relative/.test(p.css("position"))&&c.browser.opera){e._revertToRelativePosition=true;p.css({position:"absolute",top:"auto",left:"auto"})}p.css(o)})};if(typeof(i.alsoResize)=="object"&&!i.alsoResize.nodeType){c.each(i.alsoResize,function(l,m){d(l,m)})}else{d(i.alsoResize)}},stop:function(e,f){var d=c(this).data("resizable");if(d._revertToRelativePosition&&c.browser.opera){d._revertToRelativePosition=false;el.css({position:"relative"})}c(this).removeData("resizable-alsoresize-start")}});c.ui.plugin.add("resizable","animate",{stop:function(h,m){var n=c(this).data("resizable"),i=n.options;var g=n._proportionallyResizeElements,d=g.length&&(/textarea/i).test(g[0].nodeName),e=d&&c.ui.hasScroll(g[0],"left")?0:n.sizeDiff.height,k=d?0:n.sizeDiff.width;var f={width:(n.size.width-k),height:(n.size.height-e)},j=(parseInt(n.element.css("left"),10)+(n.position.left-n.originalPosition.left))||null,l=(parseInt(n.element.css("top"),10)+(n.position.top-n.originalPosition.top))||null;n.element.animate(c.extend(f,l&&j?{top:l,left:j}:{}),{duration:i.animateDuration,easing:i.animateEasing,step:function(){var o={width:parseInt(n.element.css("width"),10),height:parseInt(n.element.css("height"),10),top:parseInt(n.element.css("top"),10),left:parseInt(n.element.css("left"),10)};if(g&&g.length){c(g[0]).css({width:o.width,height:o.height})}n._updateCache(o);n._propagate("resize",h)}})}});c.ui.plugin.add("resizable","containment",{start:function(e,q){var s=c(this).data("resizable"),i=s.options,k=s.element;var f=i.containment,j=(f instanceof c)?f.get(0):(/parent/.test(f))?k.parent().get(0):f;if(!j){return}s.containerElement=c(j);if(/document/.test(f)||f==document){s.containerOffset={left:0,top:0};s.containerPosition={left:0,top:0};s.parentData={element:c(document),left:0,top:0,width:c(document).width(),height:c(document).height()||document.body.parentNode.scrollHeight}}else{var m=c(j),h=[];c(["Top","Right","Left","Bottom"]).each(function(p,o){h[p]=b(m.css("padding"+o))});s.containerOffset=m.offset();s.containerPosition=m.position();s.containerSize={height:(m.innerHeight()-h[3]),width:(m.innerWidth()-h[1])};var n=s.containerOffset,d=s.containerSize.height,l=s.containerSize.width,g=(c.ui.hasScroll(j,"left")?j.scrollWidth:l),r=(c.ui.hasScroll(j)?j.scrollHeight:d);s.parentData={element:j,left:n.left,top:n.top,width:g,height:r}}},resize:function(f,p){var s=c(this).data("resizable"),h=s.options,e=s.containerSize,n=s.containerOffset,l=s.size,m=s.position,q=s._aspectRatio||f.shiftKey,d={top:0,left:0},g=s.containerElement;if(g[0]!=document&&(/static/).test(g.css("position"))){d=n}if(m.left<(s._helper?n.left:0)){s.size.width=s.size.width+(s._helper?(s.position.left-n.left):(s.position.left-d.left));if(q){s.size.height=s.size.width/h.aspectRatio}s.position.left=h.helper?n.left:0}if(m.top<(s._helper?n.top:0)){s.size.height=s.size.height+(s._helper?(s.position.top-n.top):s.position.top);if(q){s.size.width=s.size.height*h.aspectRatio}s.position.top=s._helper?n.top:0}s.offset.left=s.parentData.left+s.position.left;s.offset.top=s.parentData.top+s.position.top;var k=Math.abs((s._helper?s.offset.left-d.left:(s.offset.left-d.left))+s.sizeDiff.width),r=Math.abs((s._helper?s.offset.top-d.top:(s.offset.top-n.top))+s.sizeDiff.height);var j=s.containerElement.get(0)==s.element.parent().get(0),i=/relative|absolute/.test(s.containerElement.css("position"));if(j&&i){k-=s.parentData.left}if(k+s.size.width>=s.parentData.width){s.size.width=s.parentData.width-k;if(q){s.size.height=s.size.width/s.aspectRatio}}if(r+s.size.height>=s.parentData.height){s.size.height=s.parentData.height-r;if(q){s.size.width=s.size.height*s.aspectRatio}}},stop:function(e,m){var p=c(this).data("resizable"),f=p.options,k=p.position,l=p.containerOffset,d=p.containerPosition,g=p.containerElement;var i=c(p.helper),q=i.offset(),n=i.outerWidth()-p.sizeDiff.width,j=i.outerHeight()-p.sizeDiff.height;if(p._helper&&!f.animate&&(/relative/).test(g.css("position"))){c(this).css({left:q.left-d.left-l.left,width:n,height:j})}if(p._helper&&!f.animate&&(/static/).test(g.css("position"))){c(this).css({left:q.left-d.left-l.left,width:n,height:j})}}});c.ui.plugin.add("resizable","ghost",{start:function(f,g){var d=c(this).data("resizable"),h=d.options,e=d.size;d.ghost=d.originalElement.clone();d.ghost.css({opacity:0.25,display:"block",position:"relative",height:e.height,width:e.width,margin:0,left:0,top:0}).addClass("ui-resizable-ghost").addClass(typeof h.ghost=="string"?h.ghost:"");d.ghost.appendTo(d.helper)},resize:function(e,f){var d=c(this).data("resizable"),g=d.options;if(d.ghost){d.ghost.css({position:"relative",height:d.size.height,width:d.size.width})}},stop:function(e,f){var d=c(this).data("resizable"),g=d.options;if(d.ghost&&d.helper){d.helper.get(0).removeChild(d.ghost.get(0))}}});c.ui.plugin.add("resizable","grid",{resize:function(d,l){var n=c(this).data("resizable"),g=n.options,j=n.size,h=n.originalSize,i=n.originalPosition,m=n.axis,k=g._aspectRatio||d.shiftKey;g.grid=typeof g.grid=="number"?[g.grid,g.grid]:g.grid;var f=Math.round((j.width-h.width)/(g.grid[0]||1))*(g.grid[0]||1),e=Math.round((j.height-h.height)/(g.grid[1]||1))*(g.grid[1]||1);if(/^(se|s|e)$/.test(m)){n.size.width=h.width+f;n.size.height=h.height+e}else{if(/^(ne)$/.test(m)){n.size.width=h.width+f;n.size.height=h.height+e;n.position.top=i.top-e}else{if(/^(sw)$/.test(m)){n.size.width=h.width+f;n.size.height=h.height+e;n.position.left=i.left-f}else{n.size.width=h.width+f;n.size.height=h.height+e;n.position.top=i.top-e;n.position.left=i.left-f}}}}});var b=function(d){return parseInt(d,10)||0};var a=function(d){return !isNaN(parseInt(d,10))}})(jQuery);;/*
+ * jQuery UI Selectable 1.7.2
+ *
+ * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Selectables
+ *
+ * Depends:
+ * ui.core.js
+ */
+(function(a){a.widget("ui.selectable",a.extend({},a.ui.mouse,{_init:function(){var b=this;this.element.addClass("ui-selectable");this.dragged=false;var c;this.refresh=function(){c=a(b.options.filter,b.element[0]);c.each(function(){var d=a(this);var e=d.offset();a.data(this,"selectable-item",{element:this,$element:d,left:e.left,top:e.top,right:e.left+d.outerWidth(),bottom:e.top+d.outerHeight(),startselected:false,selected:d.hasClass("ui-selected"),selecting:d.hasClass("ui-selecting"),unselecting:d.hasClass("ui-unselecting")})})};this.refresh();this.selectees=c.addClass("ui-selectee");this._mouseInit();this.helper=a(document.createElement("div")).css({border:"1px dotted black"}).addClass("ui-selectable-helper")},destroy:function(){this.element.removeClass("ui-selectable ui-selectable-disabled").removeData("selectable").unbind(".selectable");this._mouseDestroy()},_mouseStart:function(d){var b=this;this.opos=[d.pageX,d.pageY];if(this.options.disabled){return}var c=this.options;this.selectees=a(c.filter,this.element[0]);this._trigger("start",d);a(c.appendTo).append(this.helper);this.helper.css({"z-index":100,position:"absolute",left:d.clientX,top:d.clientY,width:0,height:0});if(c.autoRefresh){this.refresh()}this.selectees.filter(".ui-selected").each(function(){var e=a.data(this,"selectable-item");e.startselected=true;if(!d.metaKey){e.$element.removeClass("ui-selected");e.selected=false;e.$element.addClass("ui-unselecting");e.unselecting=true;b._trigger("unselecting",d,{unselecting:e.element})}});a(d.target).parents().andSelf().each(function(){var e=a.data(this,"selectable-item");if(e){e.$element.removeClass("ui-unselecting").addClass("ui-selecting");e.unselecting=false;e.selecting=true;e.selected=true;b._trigger("selecting",d,{selecting:e.element});return false}})},_mouseDrag:function(i){var c=this;this.dragged=true;if(this.options.disabled){return}var e=this.options;var d=this.opos[0],h=this.opos[1],b=i.pageX,g=i.pageY;if(d>b){var f=b;b=d;d=f}if(h>g){var f=g;g=h;h=f}this.helper.css({left:d,top:h,width:b-d,height:g-h});this.selectees.each(function(){var j=a.data(this,"selectable-item");if(!j||j.element==c.element[0]){return}var k=false;if(e.tolerance=="touch"){k=(!(j.left>b||j.rightg||j.bottomd&&j.righth&&j.bottom=0;b--){this.items[b].item.removeData("sortable-item")}},_mouseCapture:function(e,f){if(this.reverting){return false}if(this.options.disabled||this.options.type=="static"){return false}this._refreshItems(e);var d=null,c=this,b=a(e.target).parents().each(function(){if(a.data(this,"sortable-item")==c){d=a(this);return false}});if(a.data(e.target,"sortable-item")==c){d=a(e.target)}if(!d){return false}if(this.options.handle&&!f){var g=false;a(this.options.handle,d).find("*").andSelf().each(function(){if(this==e.target){g=true}});if(!g){return false}}this.currentItem=d;this._removeCurrentsFromItems();return true},_mouseStart:function(e,f,b){var g=this.options,c=this;this.currentContainer=this;this.refreshPositions();this.helper=this._createHelper(e);this._cacheHelperProportions();this._cacheMargins();this.scrollParent=this.helper.scrollParent();this.offset=this.currentItem.offset();this.offset={top:this.offset.top-this.margins.top,left:this.offset.left-this.margins.left};this.helper.css("position","absolute");this.cssPosition=this.helper.css("position");a.extend(this.offset,{click:{left:e.pageX-this.offset.left,top:e.pageY-this.offset.top},parent:this._getParentOffset(),relative:this._getRelativeOffset()});this.originalPosition=this._generatePosition(e);this.originalPageX=e.pageX;this.originalPageY=e.pageY;if(g.cursorAt){this._adjustOffsetFromHelper(g.cursorAt)}this.domPosition={prev:this.currentItem.prev()[0],parent:this.currentItem.parent()[0]};if(this.helper[0]!=this.currentItem[0]){this.currentItem.hide()}this._createPlaceholder();if(g.containment){this._setContainment()}if(g.cursor){if(a("body").css("cursor")){this._storedCursor=a("body").css("cursor")}a("body").css("cursor",g.cursor)}if(g.opacity){if(this.helper.css("opacity")){this._storedOpacity=this.helper.css("opacity")}this.helper.css("opacity",g.opacity)}if(g.zIndex){if(this.helper.css("zIndex")){this._storedZIndex=this.helper.css("zIndex")}this.helper.css("zIndex",g.zIndex)}if(this.scrollParent[0]!=document&&this.scrollParent[0].tagName!="HTML"){this.overflowOffset=this.scrollParent.offset()}this._trigger("start",e,this._uiHash());if(!this._preserveHelperProportions){this._cacheHelperProportions()}if(!b){for(var d=this.containers.length-1;d>=0;d--){this.containers[d]._trigger("activate",e,c._uiHash(this))}}if(a.ui.ddmanager){a.ui.ddmanager.current=this}if(a.ui.ddmanager&&!g.dropBehaviour){a.ui.ddmanager.prepareOffsets(this,e)}this.dragging=true;this.helper.addClass("ui-sortable-helper");this._mouseDrag(e);return true},_mouseDrag:function(f){this.position=this._generatePosition(f);this.positionAbs=this._convertPositionTo("absolute");if(!this.lastPositionAbs){this.lastPositionAbs=this.positionAbs}if(this.options.scroll){var g=this.options,b=false;if(this.scrollParent[0]!=document&&this.scrollParent[0].tagName!="HTML"){if((this.overflowOffset.top+this.scrollParent[0].offsetHeight)-f.pageY=0;d--){var e=this.items[d],c=e.item[0],h=this._intersectsWithPointer(e);if(!h){continue}if(c!=this.currentItem[0]&&this.placeholder[h==1?"next":"prev"]()[0]!=c&&!a.ui.contains(this.placeholder[0],c)&&(this.options.type=="semi-dynamic"?!a.ui.contains(this.element[0],c):true)){this.direction=h==1?"down":"up";if(this.options.tolerance=="pointer"||this._intersectsWithSides(e)){this._rearrange(f,e)}else{break}this._trigger("change",f,this._uiHash());break}}this._contactContainers(f);if(a.ui.ddmanager){a.ui.ddmanager.drag(this,f)}this._trigger("sort",f,this._uiHash());this.lastPositionAbs=this.positionAbs;return false},_mouseStop:function(c,d){if(!c){return}if(a.ui.ddmanager&&!this.options.dropBehaviour){a.ui.ddmanager.drop(this,c)}if(this.options.revert){var b=this;var e=b.placeholder.offset();b.reverting=true;a(this.helper).animate({left:e.left-this.offset.parent.left-b.margins.left+(this.offsetParent[0]==document.body?0:this.offsetParent[0].scrollLeft),top:e.top-this.offset.parent.top-b.margins.top+(this.offsetParent[0]==document.body?0:this.offsetParent[0].scrollTop)},parseInt(this.options.revert,10)||500,function(){b._clear(c)})}else{this._clear(c,d)}return false},cancel:function(){var b=this;if(this.dragging){this._mouseUp();if(this.options.helper=="original"){this.currentItem.css(this._storedCSS).removeClass("ui-sortable-helper")}else{this.currentItem.show()}for(var c=this.containers.length-1;c>=0;c--){this.containers[c]._trigger("deactivate",null,b._uiHash(this));if(this.containers[c].containerCache.over){this.containers[c]._trigger("out",null,b._uiHash(this));this.containers[c].containerCache.over=0}}}if(this.placeholder[0].parentNode){this.placeholder[0].parentNode.removeChild(this.placeholder[0])}if(this.options.helper!="original"&&this.helper&&this.helper[0].parentNode){this.helper.remove()}a.extend(this,{helper:null,dragging:false,reverting:false,_noFinalSort:null});if(this.domPosition.prev){a(this.domPosition.prev).after(this.currentItem)}else{a(this.domPosition.parent).prepend(this.currentItem)}return true},serialize:function(d){var b=this._getItemsAsjQuery(d&&d.connected);var c=[];d=d||{};a(b).each(function(){var e=(a(d.item||this).attr(d.attribute||"id")||"").match(d.expression||(/(.+)[-=_](.+)/));if(e){c.push((d.key||e[1]+"[]")+"="+(d.key&&d.expression?e[1]:e[2]))}});return c.join("&")},toArray:function(d){var b=this._getItemsAsjQuery(d&&d.connected);var c=[];d=d||{};b.each(function(){c.push(a(d.item||this).attr(d.attribute||"id")||"")});return c},_intersectsWith:function(m){var e=this.positionAbs.left,d=e+this.helperProportions.width,k=this.positionAbs.top,j=k+this.helperProportions.height;var f=m.left,c=f+m.width,n=m.top,i=n+m.height;var o=this.offset.click.top,h=this.offset.click.left;var g=(k+o)>n&&(k+o)f&&(e+h)m[this.floating?"width":"height"])){return g}else{return(f0?"down":"up")},_getDragHorizontalDirection:function(){var b=this.positionAbs.left-this.lastPositionAbs.left;return b!=0&&(b>0?"right":"left")},refresh:function(b){this._refreshItems(b);this.refreshPositions()},_connectWith:function(){var b=this.options;return b.connectWith.constructor==String?[b.connectWith]:b.connectWith},_getItemsAsjQuery:function(b){var l=this;var g=[];var e=[];var h=this._connectWith();if(h&&b){for(var d=h.length-1;d>=0;d--){var k=a(h[d]);for(var c=k.length-1;c>=0;c--){var f=a.data(k[c],"sortable");if(f&&f!=this&&!f.options.disabled){e.push([a.isFunction(f.options.items)?f.options.items.call(f.element):a(f.options.items,f.element).not(".ui-sortable-helper"),f])}}}}e.push([a.isFunction(this.options.items)?this.options.items.call(this.element,null,{options:this.options,item:this.currentItem}):a(this.options.items,this.element).not(".ui-sortable-helper"),this]);for(var d=e.length-1;d>=0;d--){e[d][0].each(function(){g.push(this)})}return a(g)},_removeCurrentsFromItems:function(){var d=this.currentItem.find(":data(sortable-item)");for(var c=0;c=0;e--){var m=a(l[e]);for(var d=m.length-1;d>=0;d--){var g=a.data(m[d],"sortable");if(g&&g!=this&&!g.options.disabled){f.push([a.isFunction(g.options.items)?g.options.items.call(g.element[0],b,{item:this.currentItem}):a(g.options.items,g.element),g]);this.containers.push(g)}}}}for(var e=f.length-1;e>=0;e--){var k=f[e][1];var c=f[e][0];for(var d=0,n=c.length;d=0;d--){var e=this.items[d];if(e.instance!=this.currentContainer&&this.currentContainer&&e.item[0]!=this.currentItem[0]){continue}var c=this.options.toleranceElement?a(this.options.toleranceElement,e.item):e.item;if(!b){e.width=c.outerWidth();e.height=c.outerHeight()}var f=c.offset();e.left=f.left;e.top=f.top}if(this.options.custom&&this.options.custom.refreshContainers){this.options.custom.refreshContainers.call(this)}else{for(var d=this.containers.length-1;d>=0;d--){var f=this.containers[d].element.offset();this.containers[d].containerCache.left=f.left;this.containers[d].containerCache.top=f.top;this.containers[d].containerCache.width=this.containers[d].element.outerWidth();this.containers[d].containerCache.height=this.containers[d].element.outerHeight()}}},_createPlaceholder:function(d){var b=d||this,e=b.options;if(!e.placeholder||e.placeholder.constructor==String){var c=e.placeholder;e.placeholder={element:function(){var f=a(document.createElement(b.currentItem[0].nodeName)).addClass(c||b.currentItem[0].className+" ui-sortable-placeholder").removeClass("ui-sortable-helper")[0];if(!c){f.style.visibility="hidden"}return f},update:function(f,g){if(c&&!e.forcePlaceholderSize){return}if(!g.height()){g.height(b.currentItem.innerHeight()-parseInt(b.currentItem.css("paddingTop")||0,10)-parseInt(b.currentItem.css("paddingBottom")||0,10))}if(!g.width()){g.width(b.currentItem.innerWidth()-parseInt(b.currentItem.css("paddingLeft")||0,10)-parseInt(b.currentItem.css("paddingRight")||0,10))}}}}b.placeholder=a(e.placeholder.element.call(b.element,b.currentItem));b.currentItem.after(b.placeholder);e.placeholder.update(b,b.placeholder)},_contactContainers:function(d){for(var c=this.containers.length-1;c>=0;c--){if(this._intersectsWith(this.containers[c].containerCache)){if(!this.containers[c].containerCache.over){if(this.currentContainer!=this.containers[c]){var h=10000;var g=null;var e=this.positionAbs[this.containers[c].floating?"left":"top"];for(var b=this.items.length-1;b>=0;b--){if(!a.ui.contains(this.containers[c].element[0],this.items[b].item[0])){continue}var f=this.items[b][this.containers[c].floating?"left":"top"];if(Math.abs(f-e)this.containment[2]){d=this.containment[2]+this.offset.click.left}if(e.pageY-this.offset.click.top>this.containment[3]){c=this.containment[3]+this.offset.click.top}}if(h.grid){var g=this.originalPageY+Math.round((c-this.originalPageY)/h.grid[1])*h.grid[1];c=this.containment?(!(g-this.offset.click.topthis.containment[3])?g:(!(g-this.offset.click.topthis.containment[2])?f:(!(f-this.offset.click.left=0;c--){if(a.ui.contains(this.containers[c].element[0],this.currentItem[0])&&!e){f.push((function(g){return function(h){g._trigger("receive",h,this._uiHash(this))}}).call(this,this.containers[c]));f.push((function(g){return function(h){g._trigger("update",h,this._uiHash(this))}}).call(this,this.containers[c]))}}}for(var c=this.containers.length-1;c>=0;c--){if(!e){f.push((function(g){return function(h){g._trigger("deactivate",h,this._uiHash(this))}}).call(this,this.containers[c]))}if(this.containers[c].containerCache.over){f.push((function(g){return function(h){g._trigger("out",h,this._uiHash(this))}}).call(this,this.containers[c]));this.containers[c].containerCache.over=0}}if(this._storedCursor){a("body").css("cursor",this._storedCursor)}if(this._storedOpacity){this.helper.css("opacity",this._storedOpacity)}if(this._storedZIndex){this.helper.css("zIndex",this._storedZIndex=="auto"?"":this._storedZIndex)}this.dragging=false;if(this.cancelHelperRemoval){if(!e){this._trigger("beforeStop",d,this._uiHash());for(var c=0;c *",opacity:false,placeholder:false,revert:false,scroll:true,scrollSensitivity:20,scrollSpeed:20,scope:"default",tolerance:"intersect",zIndex:1000}})})(jQuery);;/*
+ * jQuery UI Accordion 1.7.2
+ *
+ * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Accordion
+ *
+ * Depends:
+ * ui.core.js
+ */
+(function(a){a.widget("ui.accordion",{_init:function(){var d=this.options,b=this;this.running=0;if(d.collapsible==a.ui.accordion.defaults.collapsible&&d.alwaysOpen!=a.ui.accordion.defaults.alwaysOpen){d.collapsible=!d.alwaysOpen}if(d.navigation){var c=this.element.find("a").filter(d.navigationFilter);if(c.length){if(c.filter(d.header).length){this.active=c}else{this.active=c.parent().parent().prev();c.addClass("ui-accordion-content-active")}}}this.element.addClass("ui-accordion ui-widget ui-helper-reset");if(this.element[0].nodeName=="UL"){this.element.children("li").addClass("ui-accordion-li-fix")}this.headers=this.element.find(d.header).addClass("ui-accordion-header ui-helper-reset ui-state-default ui-corner-all").bind("mouseenter.accordion",function(){a(this).addClass("ui-state-hover")}).bind("mouseleave.accordion",function(){a(this).removeClass("ui-state-hover")}).bind("focus.accordion",function(){a(this).addClass("ui-state-focus")}).bind("blur.accordion",function(){a(this).removeClass("ui-state-focus")});this.headers.next().addClass("ui-accordion-content ui-helper-reset ui-widget-content ui-corner-bottom");this.active=this._findActive(this.active||d.active).toggleClass("ui-state-default").toggleClass("ui-state-active").toggleClass("ui-corner-all").toggleClass("ui-corner-top");this.active.next().addClass("ui-accordion-content-active");a("
")).appendTo(document.body).hide().addClass(a+m.dialogClass).css({position:"absolute",overflow:"hidden",zIndex:m.zIndex}).attr("tabIndex",-1).css("outline",0).keydown(function(n){(m.closeOnEscape&&n.keyCode&&n.keyCode==c.ui.keyCode.ESCAPE&&l.close(n))}).attr({role:"dialog","aria-labelledby":e}).mousedown(function(n){l.moveToTop(false,n)}),g=this.element.show().removeAttr("title").addClass("ui-dialog-content ui-widget-content").appendTo(k),f=(this.uiDialogTitlebar=c("
")).addClass("ui-dialog-titlebar ui-widget-header ui-corner-all ui-helper-clearfix").prependTo(k),i=c('
").addClass("ui-dialog-buttonpane ui-widget-content ui-helper-clearfix");this.uiDialog.find(".ui-dialog-buttonpane").remove();(typeof g=="object"&&g!==null&&c.each(g,function(){return !(d=true)}));if(d){c.each(g,function(h,i){c('
").appendTo(document.body).addClass("ui-widget-overlay").css({width:this.width(),height:this.height()});(e.options.bgiframe&&c.fn.bgiframe&&d.bgiframe());this.instances.push(d);return d},destroy:function(d){this.instances.splice(c.inArray(this.instances,d),1);if(this.instances.length===0){c([document,window]).unbind(".dialog-overlay")}d.remove();var e=0;c.each(this.instances,function(){e=Math.max(e,this.css("z-index"))});this.maxZ=e},height:function(){if(c.browser.msie&&c.browser.version<7){var e=Math.max(document.documentElement.scrollHeight,document.body.scrollHeight);var d=Math.max(document.documentElement.offsetHeight,document.body.offsetHeight);if(e");if(!c.values){c.values=[this._valueMin(),this._valueMin()]}if(c.values.length&&c.values.length!=2){c.values=[c.values[0],c.values[0]]}}else{this.range=a("
")}this.range.appendTo(this.element).addClass("ui-slider-range");if(c.range=="min"||c.range=="max"){this.range.addClass("ui-slider-range-"+c.range)}this.range.addClass("ui-widget-header")}if(a(".ui-slider-handle",this.element).length==0){a('').appendTo(this.element).addClass("ui-slider-handle")}}this.handles=a(".ui-slider-handle",this.element).addClass("ui-state-default ui-corner-all");this.handle=this.handles.eq(0);this.handles.add(this.range).filter("a").click(function(d){d.preventDefault()}).hover(function(){if(!c.disabled){a(this).addClass("ui-state-hover")}},function(){a(this).removeClass("ui-state-hover")}).focus(function(){if(!c.disabled){a(".ui-slider .ui-state-focus").removeClass("ui-state-focus");a(this).addClass("ui-state-focus")}else{a(this).blur()}}).blur(function(){a(this).removeClass("ui-state-focus")});this.handles.each(function(d){a(this).data("index.ui-slider-handle",d)});this.handles.keydown(function(i){var f=true;var e=a(this).data("index.ui-slider-handle");if(b.options.disabled){return}switch(i.keyCode){case a.ui.keyCode.HOME:case a.ui.keyCode.END:case a.ui.keyCode.UP:case a.ui.keyCode.RIGHT:case a.ui.keyCode.DOWN:case a.ui.keyCode.LEFT:f=false;if(!b._keySliding){b._keySliding=true;a(this).addClass("ui-state-active");b._start(i,e)}break}var g,d,h=b._step();if(b.options.values&&b.options.values.length){g=d=b.values(e)}else{g=d=b.value()}switch(i.keyCode){case a.ui.keyCode.HOME:d=b._valueMin();break;case a.ui.keyCode.END:d=b._valueMax();break;case a.ui.keyCode.UP:case a.ui.keyCode.RIGHT:if(g==b._valueMax()){return}d=g+h;break;case a.ui.keyCode.DOWN:case a.ui.keyCode.LEFT:if(g==b._valueMin()){return}d=g-h;break}b._slide(i,e,d);return f}).keyup(function(e){var d=a(this).data("index.ui-slider-handle");if(b._keySliding){b._stop(e,d);b._change(e,d);b._keySliding=false;a(this).removeClass("ui-state-active")}});this._refreshValue()},destroy:function(){this.handles.remove();this.range.remove();this.element.removeClass("ui-slider ui-slider-horizontal ui-slider-vertical ui-slider-disabled ui-widget ui-widget-content ui-corner-all").removeData("slider").unbind(".slider");this._mouseDestroy()},_mouseCapture:function(d){var e=this.options;if(e.disabled){return false}this.elementSize={width:this.element.outerWidth(),height:this.element.outerHeight()};this.elementOffset=this.element.offset();var h={x:d.pageX,y:d.pageY};var j=this._normValueFromMouse(h);var c=this._valueMax()-this._valueMin()+1,f;var k=this,i;this.handles.each(function(l){var m=Math.abs(j-k.values(l));if(c>m){c=m;f=a(this);i=l}});if(e.range==true&&this.values(1)==e.min){f=a(this.handles[++i])}this._start(d,i);k._handleIndex=i;f.addClass("ui-state-active").focus();var g=f.offset();var b=!a(d.target).parents().andSelf().is(".ui-slider-handle");this._clickOffset=b?{left:0,top:0}:{left:d.pageX-g.left-(f.width()/2),top:d.pageY-g.top-(f.height()/2)-(parseInt(f.css("borderTopWidth"),10)||0)-(parseInt(f.css("borderBottomWidth"),10)||0)+(parseInt(f.css("marginTop"),10)||0)};j=this._normValueFromMouse(h);this._slide(d,i,j);return true},_mouseStart:function(b){return true},_mouseDrag:function(d){var b={x:d.pageX,y:d.pageY};var c=this._normValueFromMouse(b);this._slide(d,this._handleIndex,c);return false},_mouseStop:function(b){this.handles.removeClass("ui-state-active");this._stop(b,this._handleIndex);this._change(b,this._handleIndex);this._handleIndex=null;this._clickOffset=null;return false},_detectOrientation:function(){this.orientation=this.options.orientation=="vertical"?"vertical":"horizontal"},_normValueFromMouse:function(d){var c,h;if("horizontal"==this.orientation){c=this.elementSize.width;h=d.x-this.elementOffset.left-(this._clickOffset?this._clickOffset.left:0)}else{c=this.elementSize.height;h=d.y-this.elementOffset.top-(this._clickOffset?this._clickOffset.top:0)}var f=(h/c);if(f>1){f=1}if(f<0){f=0}if("vertical"==this.orientation){f=1-f}var e=this._valueMax()-this._valueMin(),i=f*e,b=i%this.options.step,g=this._valueMin()+i-b;if(b>(this.options.step/2)){g+=this.options.step}return parseFloat(g.toFixed(5))},_start:function(d,c){var b={handle:this.handles[c],value:this.value()};if(this.options.values&&this.options.values.length){b.value=this.values(c);b.values=this.values()}this._trigger("start",d,b)},_slide:function(f,e,d){var g=this.handles[e];if(this.options.values&&this.options.values.length){var b=this.values(e?0:1);if((this.options.values.length==2&&this.options.range===true)&&((e==0&&d>b)||(e==1&&d1){this.options.values[b]=e;this._refreshValue(c);if(!d){this._change(null,b)}}if(arguments.length){if(this.options.values&&this.options.values.length){return this._values(b)}else{return this.value()}}else{return this._values()}},_setData:function(b,d,c){a.widget.prototype._setData.apply(this,arguments);switch(b){case"disabled":if(d){this.handles.filter(".ui-state-focus").blur();this.handles.removeClass("ui-state-hover");this.handles.attr("disabled","disabled")}else{this.handles.removeAttr("disabled")}case"orientation":this._detectOrientation();this.element.removeClass("ui-slider-horizontal ui-slider-vertical").addClass("ui-slider-"+this.orientation);this._refreshValue(c);break;case"value":this._refreshValue(c);break}},_step:function(){var b=this.options.step;return b},_value:function(){var b=this.options.value;if(bthis._valueMax()){b=this._valueMax()}return b},_values:function(b){if(arguments.length){var c=this.options.values[b];if(cthis._valueMax()){c=this._valueMax()}return c}else{return this.options.values}},_valueMin:function(){var b=this.options.min;return b},_valueMax:function(){var b=this.options.max;return b},_refreshValue:function(c){var f=this.options.range,d=this.options,l=this;if(this.options.values&&this.options.values.length){var i,h;this.handles.each(function(p,n){var o=(l.values(p)-l._valueMin())/(l._valueMax()-l._valueMin())*100;var m={};m[l.orientation=="horizontal"?"left":"bottom"]=o+"%";a(this).stop(1,1)[c?"animate":"css"](m,d.animate);if(l.options.range===true){if(l.orientation=="horizontal"){(p==0)&&l.range.stop(1,1)[c?"animate":"css"]({left:o+"%"},d.animate);(p==1)&&l.range[c?"animate":"css"]({width:(o-lastValPercent)+"%"},{queue:false,duration:d.animate})}else{(p==0)&&l.range.stop(1,1)[c?"animate":"css"]({bottom:(o)+"%"},d.animate);(p==1)&&l.range[c?"animate":"css"]({height:(o-lastValPercent)+"%"},{queue:false,duration:d.animate})}}lastValPercent=o})}else{var j=this.value(),g=this._valueMin(),k=this._valueMax(),e=k!=g?(j-g)/(k-g)*100:0;var b={};b[l.orientation=="horizontal"?"left":"bottom"]=e+"%";this.handle.stop(1,1)[c?"animate":"css"](b,d.animate);(f=="min")&&(this.orientation=="horizontal")&&this.range.stop(1,1)[c?"animate":"css"]({width:e+"%"},d.animate);(f=="max")&&(this.orientation=="horizontal")&&this.range[c?"animate":"css"]({width:(100-e)+"%"},{queue:false,duration:d.animate});(f=="min")&&(this.orientation=="vertical")&&this.range.stop(1,1)[c?"animate":"css"]({height:e+"%"},d.animate);(f=="max")&&(this.orientation=="vertical")&&this.range[c?"animate":"css"]({height:(100-e)+"%"},{queue:false,duration:d.animate})}}}));a.extend(a.ui.slider,{getter:"value values",version:"1.7.2",eventPrefix:"slide",defaults:{animate:false,delay:0,distance:0,max:100,min:0,orientation:"horizontal",range:false,step:1,value:0,values:null}})})(jQuery);;/*
+ * jQuery UI Tabs 1.7.2
+ *
+ * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Tabs
+ *
+ * Depends:
+ * ui.core.js
+ */
+(function(a){a.widget("ui.tabs",{_init:function(){if(this.options.deselectable!==undefined){this.options.collapsible=this.options.deselectable}this._tabify(true)},_setData:function(b,c){if(b=="selected"){if(this.options.collapsible&&c==this.options.selected){return}this.select(c)}else{this.options[b]=c;if(b=="deselectable"){this.options.collapsible=c}this._tabify()}},_tabId:function(b){return b.title&&b.title.replace(/\s/g,"_").replace(/[^A-Za-z0-9\-_:\.]/g,"")||this.options.idPrefix+a.data(b)},_sanitizeSelector:function(b){return b.replace(/:/g,"\\:")},_cookie:function(){var b=this.cookie||(this.cookie=this.options.cookie.name||"ui-tabs-"+a.data(this.list[0]));return a.cookie.apply(null,[b].concat(a.makeArray(arguments)))},_ui:function(c,b){return{tab:c,panel:b,index:this.anchors.index(c)}},_cleanup:function(){this.lis.filter(".ui-state-processing").removeClass("ui-state-processing").find("span:data(label.tabs)").each(function(){var b=a(this);b.html(b.data("label.tabs")).removeData("label.tabs")})},_tabify:function(n){this.list=this.element.children("ul:first");this.lis=a("li:has(a[href])",this.list);this.anchors=this.lis.map(function(){return a("a",this)[0]});this.panels=a([]);var p=this,d=this.options;var c=/^#.+/;this.anchors.each(function(r,o){var q=a(o).attr("href");var s=q.split("#")[0],u;if(s&&(s===location.toString().split("#")[0]||(u=a("base")[0])&&s===u.href)){q=o.hash;o.href=q}if(c.test(q)){p.panels=p.panels.add(p._sanitizeSelector(q))}else{if(q!="#"){a.data(o,"href.tabs",q);a.data(o,"load.tabs",q.replace(/#.*$/,""));var w=p._tabId(o);o.href="#"+w;var v=a("#"+w);if(!v.length){v=a(d.panelTemplate).attr("id",w).addClass("ui-tabs-panel ui-widget-content ui-corner-bottom").insertAfter(p.panels[r-1]||p.list);v.data("destroy.tabs",true)}p.panels=p.panels.add(v)}else{d.disabled.push(r)}}});if(n){this.element.addClass("ui-tabs ui-widget ui-widget-content ui-corner-all");this.list.addClass("ui-tabs-nav ui-helper-reset ui-helper-clearfix ui-widget-header ui-corner-all");this.lis.addClass("ui-state-default ui-corner-top");this.panels.addClass("ui-tabs-panel ui-widget-content ui-corner-bottom");if(d.selected===undefined){if(location.hash){this.anchors.each(function(q,o){if(o.hash==location.hash){d.selected=q;return false}})}if(typeof d.selected!="number"&&d.cookie){d.selected=parseInt(p._cookie(),10)}if(typeof d.selected!="number"&&this.lis.filter(".ui-tabs-selected").length){d.selected=this.lis.index(this.lis.filter(".ui-tabs-selected"))}d.selected=d.selected||0}else{if(d.selected===null){d.selected=-1}}d.selected=((d.selected>=0&&this.anchors[d.selected])||d.selected<0)?d.selected:0;d.disabled=a.unique(d.disabled.concat(a.map(this.lis.filter(".ui-state-disabled"),function(q,o){return p.lis.index(q)}))).sort();if(a.inArray(d.selected,d.disabled)!=-1){d.disabled.splice(a.inArray(d.selected,d.disabled),1)}this.panels.addClass("ui-tabs-hide");this.lis.removeClass("ui-tabs-selected ui-state-active");if(d.selected>=0&&this.anchors.length){this.panels.eq(d.selected).removeClass("ui-tabs-hide");this.lis.eq(d.selected).addClass("ui-tabs-selected ui-state-active");p.element.queue("tabs",function(){p._trigger("show",null,p._ui(p.anchors[d.selected],p.panels[d.selected]))});this.load(d.selected)}a(window).bind("unload",function(){p.lis.add(p.anchors).unbind(".tabs");p.lis=p.anchors=p.panels=null})}else{d.selected=this.lis.index(this.lis.filter(".ui-tabs-selected"))}this.element[d.collapsible?"addClass":"removeClass"]("ui-tabs-collapsible");if(d.cookie){this._cookie(d.selected,d.cookie)}for(var g=0,m;(m=this.lis[g]);g++){a(m)[a.inArray(g,d.disabled)!=-1&&!a(m).hasClass("ui-tabs-selected")?"addClass":"removeClass"]("ui-state-disabled")}if(d.cache===false){this.anchors.removeData("cache.tabs")}this.lis.add(this.anchors).unbind(".tabs");if(d.event!="mouseover"){var f=function(o,i){if(i.is(":not(.ui-state-disabled)")){i.addClass("ui-state-"+o)}};var j=function(o,i){i.removeClass("ui-state-"+o)};this.lis.bind("mouseover.tabs",function(){f("hover",a(this))});this.lis.bind("mouseout.tabs",function(){j("hover",a(this))});this.anchors.bind("focus.tabs",function(){f("focus",a(this).closest("li"))});this.anchors.bind("blur.tabs",function(){j("focus",a(this).closest("li"))})}var b,h;if(d.fx){if(a.isArray(d.fx)){b=d.fx[0];h=d.fx[1]}else{b=h=d.fx}}function e(i,o){i.css({display:""});if(a.browser.msie&&o.opacity){i[0].style.removeAttribute("filter")}}var k=h?function(i,o){a(i).closest("li").removeClass("ui-state-default").addClass("ui-tabs-selected ui-state-active");o.hide().removeClass("ui-tabs-hide").animate(h,h.duration||"normal",function(){e(o,h);p._trigger("show",null,p._ui(i,o[0]))})}:function(i,o){a(i).closest("li").removeClass("ui-state-default").addClass("ui-tabs-selected ui-state-active");o.removeClass("ui-tabs-hide");p._trigger("show",null,p._ui(i,o[0]))};var l=b?function(o,i){i.animate(b,b.duration||"normal",function(){p.lis.removeClass("ui-tabs-selected ui-state-active").addClass("ui-state-default");i.addClass("ui-tabs-hide");e(i,b);p.element.dequeue("tabs")})}:function(o,i,q){p.lis.removeClass("ui-tabs-selected ui-state-active").addClass("ui-state-default");i.addClass("ui-tabs-hide");p.element.dequeue("tabs")};this.anchors.bind(d.event+".tabs",function(){var o=this,r=a(this).closest("li"),i=p.panels.filter(":not(.ui-tabs-hide)"),q=a(p._sanitizeSelector(this.hash));if((r.hasClass("ui-tabs-selected")&&!d.collapsible)||r.hasClass("ui-state-disabled")||r.hasClass("ui-state-processing")||p._trigger("select",null,p._ui(this,q[0]))===false){this.blur();return false}d.selected=p.anchors.index(this);p.abort();if(d.collapsible){if(r.hasClass("ui-tabs-selected")){d.selected=-1;if(d.cookie){p._cookie(d.selected,d.cookie)}p.element.queue("tabs",function(){l(o,i)}).dequeue("tabs");this.blur();return false}else{if(!i.length){if(d.cookie){p._cookie(d.selected,d.cookie)}p.element.queue("tabs",function(){k(o,q)});p.load(p.anchors.index(this));this.blur();return false}}}if(d.cookie){p._cookie(d.selected,d.cookie)}if(q.length){if(i.length){p.element.queue("tabs",function(){l(o,i)})}p.element.queue("tabs",function(){k(o,q)});p.load(p.anchors.index(this))}else{throw"jQuery UI Tabs: Mismatching fragment identifier."}if(a.browser.msie){this.blur()}});this.anchors.bind("click.tabs",function(){return false})},destroy:function(){var b=this.options;this.abort();this.element.unbind(".tabs").removeClass("ui-tabs ui-widget ui-widget-content ui-corner-all ui-tabs-collapsible").removeData("tabs");this.list.removeClass("ui-tabs-nav ui-helper-reset ui-helper-clearfix ui-widget-header ui-corner-all");this.anchors.each(function(){var c=a.data(this,"href.tabs");if(c){this.href=c}var d=a(this).unbind(".tabs");a.each(["href","load","cache"],function(e,f){d.removeData(f+".tabs")})});this.lis.unbind(".tabs").add(this.panels).each(function(){if(a.data(this,"destroy.tabs")){a(this).remove()}else{a(this).removeClass(["ui-state-default","ui-corner-top","ui-tabs-selected","ui-state-active","ui-state-hover","ui-state-focus","ui-state-disabled","ui-tabs-panel","ui-widget-content","ui-corner-bottom","ui-tabs-hide"].join(" "))}});if(b.cookie){this._cookie(null,b.cookie)}},add:function(e,d,c){if(c===undefined){c=this.anchors.length}var b=this,g=this.options,i=a(g.tabTemplate.replace(/#\{href\}/g,e).replace(/#\{label\}/g,d)),h=!e.indexOf("#")?e.replace("#",""):this._tabId(a("a",i)[0]);i.addClass("ui-state-default ui-corner-top").data("destroy.tabs",true);var f=a("#"+h);if(!f.length){f=a(g.panelTemplate).attr("id",h).data("destroy.tabs",true)}f.addClass("ui-tabs-panel ui-widget-content ui-corner-bottom ui-tabs-hide");if(c>=this.lis.length){i.appendTo(this.list);f.appendTo(this.list[0].parentNode)}else{i.insertBefore(this.lis[c]);f.insertBefore(this.panels[c])}g.disabled=a.map(g.disabled,function(k,j){return k>=c?++k:k});this._tabify();if(this.anchors.length==1){i.addClass("ui-tabs-selected ui-state-active");f.removeClass("ui-tabs-hide");this.element.queue("tabs",function(){b._trigger("show",null,b._ui(b.anchors[0],b.panels[0]))});this.load(0)}this._trigger("add",null,this._ui(this.anchors[c],this.panels[c]))},remove:function(b){var d=this.options,e=this.lis.eq(b).remove(),c=this.panels.eq(b).remove();if(e.hasClass("ui-tabs-selected")&&this.anchors.length>1){this.select(b+(b+1=b?--g:g});this._tabify();this._trigger("remove",null,this._ui(e.find("a")[0],c[0]))},enable:function(b){var c=this.options;if(a.inArray(b,c.disabled)==-1){return}this.lis.eq(b).removeClass("ui-state-disabled");c.disabled=a.grep(c.disabled,function(e,d){return e!=b});this._trigger("enable",null,this._ui(this.anchors[b],this.panels[b]))},disable:function(c){var b=this,d=this.options;if(c!=d.selected){this.lis.eq(c).addClass("ui-state-disabled");d.disabled.push(c);d.disabled.sort();this._trigger("disable",null,this._ui(this.anchors[c],this.panels[c]))}},select:function(b){if(typeof b=="string"){b=this.anchors.index(this.anchors.filter("[href$="+b+"]"))}else{if(b===null){b=-1}}if(b==-1&&this.options.collapsible){b=this.options.selected}this.anchors.eq(b).trigger(this.options.event+".tabs")},load:function(e){var c=this,g=this.options,b=this.anchors.eq(e)[0],d=a.data(b,"load.tabs");this.abort();if(!d||this.element.queue("tabs").length!==0&&a.data(b,"cache.tabs")){this.element.dequeue("tabs");return}this.lis.eq(e).addClass("ui-state-processing");if(g.spinner){var f=a("span",b);f.data("label.tabs",f.html()).html(g.spinner)}this.xhr=a.ajax(a.extend({},g.ajaxOptions,{url:d,success:function(i,h){a(c._sanitizeSelector(b.hash)).html(i);c._cleanup();if(g.cache){a.data(b,"cache.tabs",true)}c._trigger("load",null,c._ui(c.anchors[e],c.panels[e]));try{g.ajaxOptions.success(i,h)}catch(j){}c.element.dequeue("tabs")}}))},abort:function(){this.element.queue([]);this.panels.stop(false,true);if(this.xhr){this.xhr.abort();delete this.xhr}this._cleanup()},url:function(c,b){this.anchors.eq(c).removeData("cache.tabs").data("load.tabs",b)},length:function(){return this.anchors.length}});a.extend(a.ui.tabs,{version:"1.7.2",getter:"length",defaults:{ajaxOptions:null,cache:false,cookie:null,collapsible:false,disabled:[],event:"click",fx:null,idPrefix:"ui-tabs-",panelTemplate:"
",spinner:"Loading… ",tabTemplate:'#{label} ')}$.extend(Datepicker.prototype,{markerClassName:"hasDatepicker",log:function(){if(this.debug){console.log.apply("",arguments)}},setDefaults:function(settings){extendRemove(this._defaults,settings||{});return this},_attachDatepicker:function(target,settings){var inlineSettings=null;for(var attrName in this._defaults){var attrValue=target.getAttribute("date:"+attrName);if(attrValue){inlineSettings=inlineSettings||{};try{inlineSettings[attrName]=eval(attrValue)}catch(err){inlineSettings[attrName]=attrValue}}}var nodeName=target.nodeName.toLowerCase();var inline=(nodeName=="div"||nodeName=="span");if(!target.id){target.id="dp"+(++this.uuid)}var inst=this._newInst($(target),inline);inst.settings=$.extend({},settings||{},inlineSettings||{});if(nodeName=="input"){this._connectDatepicker(target,inst)}else{if(inline){this._inlineDatepicker(target,inst)}}},_newInst:function(target,inline){var id=target[0].id.replace(/([:\[\]\.])/g,"\\\\$1");return{id:id,input:target,selectedDay:0,selectedMonth:0,selectedYear:0,drawMonth:0,drawYear:0,inline:inline,dpDiv:(!inline?this.dpDiv:$('
'))}},_connectDatepicker:function(target,inst){var input=$(target);inst.append=$([]);inst.trigger=$([]);if(input.hasClass(this.markerClassName)){return}var appendText=this._get(inst,"appendText");var isRTL=this._get(inst,"isRTL");if(appendText){inst.append=$(''+appendText+" ");input[isRTL?"before":"after"](inst.append)}var showOn=this._get(inst,"showOn");if(showOn=="focus"||showOn=="both"){input.focus(this._showDatepicker)}if(showOn=="button"||showOn=="both"){var buttonText=this._get(inst,"buttonText");var buttonImage=this._get(inst,"buttonImage");inst.trigger=$(this._get(inst,"buttonImageOnly")?$("-1)}},_showDatepicker:function(input){input=input.target||input;if(input.nodeName.toLowerCase()!="input"){input=$("input",input.parentNode)[0]}if($.datepicker._isDisabledDatepicker(input)||$.datepicker._lastInput==input){return}var inst=$.datepicker._getInst(input);var beforeShow=$.datepicker._get(inst,"beforeShow");extendRemove(inst.settings,(beforeShow?beforeShow.apply(input,[input,inst]):{}));$.datepicker._hideDatepicker(null,"");$.datepicker._lastInput=input;$.datepicker._setDateFromField(inst);if($.datepicker._inDialog){input.value=""}if(!$.datepicker._pos){$.datepicker._pos=$.datepicker._findPos(input);$.datepicker._pos[1]+=input.offsetHeight}var isFixed=false;$(input).parents().each(function(){isFixed|=$(this).css("position")=="fixed";return !isFixed});if(isFixed&&$.browser.opera){$.datepicker._pos[0]-=document.documentElement.scrollLeft;$.datepicker._pos[1]-=document.documentElement.scrollTop}var offset={left:$.datepicker._pos[0],top:$.datepicker._pos[1]};$.datepicker._pos=null;inst.rangeStart=null;inst.dpDiv.css({position:"absolute",display:"block",top:"-1000px"});$.datepicker._updateDatepicker(inst);offset=$.datepicker._checkOffset(inst,offset,isFixed);inst.dpDiv.css({position:($.datepicker._inDialog&&$.blockUI?"static":(isFixed?"fixed":"absolute")),display:"none",left:offset.left+"px",top:offset.top+"px"});if(!inst.inline){var showAnim=$.datepicker._get(inst,"showAnim")||"show";var duration=$.datepicker._get(inst,"duration");var postProcess=function(){$.datepicker._datepickerShowing=true;if($.browser.msie&&parseInt($.browser.version,10)<7){$("iframe.ui-datepicker-cover").css({width:inst.dpDiv.width()+4,height:inst.dpDiv.height()+4})}};if($.effects&&$.effects[showAnim]){inst.dpDiv.show(showAnim,$.datepicker._get(inst,"showOptions"),duration,postProcess)}else{inst.dpDiv[showAnim](duration,postProcess)}if(duration==""){postProcess()}if(inst.input[0].type!="hidden"){inst.input[0].focus()}$.datepicker._curInst=inst}},_updateDatepicker:function(inst){var dims={width:inst.dpDiv.width()+4,height:inst.dpDiv.height()+4};var self=this;inst.dpDiv.empty().append(this._generateHTML(inst)).find("iframe.ui-datepicker-cover").css({width:dims.width,height:dims.height}).end().find("button, .ui-datepicker-prev, .ui-datepicker-next, .ui-datepicker-calendar td a").bind("mouseout",function(){$(this).removeClass("ui-state-hover");if(this.className.indexOf("ui-datepicker-prev")!=-1){$(this).removeClass("ui-datepicker-prev-hover")}if(this.className.indexOf("ui-datepicker-next")!=-1){$(this).removeClass("ui-datepicker-next-hover")}}).bind("mouseover",function(){if(!self._isDisabledDatepicker(inst.inline?inst.dpDiv.parent()[0]:inst.input[0])){$(this).parents(".ui-datepicker-calendar").find("a").removeClass("ui-state-hover");$(this).addClass("ui-state-hover");if(this.className.indexOf("ui-datepicker-prev")!=-1){$(this).addClass("ui-datepicker-prev-hover")}if(this.className.indexOf("ui-datepicker-next")!=-1){$(this).addClass("ui-datepicker-next-hover")}}}).end().find("."+this._dayOverClass+" a").trigger("mouseover").end();var numMonths=this._getNumberOfMonths(inst);var cols=numMonths[1];var width=17;if(cols>1){inst.dpDiv.addClass("ui-datepicker-multi-"+cols).css("width",(width*cols)+"em")}else{inst.dpDiv.removeClass("ui-datepicker-multi-2 ui-datepicker-multi-3 ui-datepicker-multi-4").width("")}inst.dpDiv[(numMonths[0]!=1||numMonths[1]!=1?"add":"remove")+"Class"]("ui-datepicker-multi");inst.dpDiv[(this._get(inst,"isRTL")?"add":"remove")+"Class"]("ui-datepicker-rtl");if(inst.input&&inst.input[0].type!="hidden"&&inst==$.datepicker._curInst){$(inst.input[0]).focus()}},_checkOffset:function(inst,offset,isFixed){var dpWidth=inst.dpDiv.outerWidth();var dpHeight=inst.dpDiv.outerHeight();var inputWidth=inst.input?inst.input.outerWidth():0;var inputHeight=inst.input?inst.input.outerHeight():0;var viewWidth=(window.innerWidth||document.documentElement.clientWidth||document.body.clientWidth)+$(document).scrollLeft();var viewHeight=(window.innerHeight||document.documentElement.clientHeight||document.body.clientHeight)+$(document).scrollTop();offset.left-=(this._get(inst,"isRTL")?(dpWidth-inputWidth):0);offset.left-=(isFixed&&offset.left==inst.input.offset().left)?$(document).scrollLeft():0;offset.top-=(isFixed&&offset.top==(inst.input.offset().top+inputHeight))?$(document).scrollTop():0;offset.left-=(offset.left+dpWidth>viewWidth&&viewWidth>dpWidth)?Math.abs(offset.left+dpWidth-viewWidth):0;offset.top-=(offset.top+dpHeight>viewHeight&&viewHeight>dpHeight)?Math.abs(offset.top+dpHeight+inputHeight*2-viewHeight):0;return offset},_findPos:function(obj){while(obj&&(obj.type=="hidden"||obj.nodeType!=1)){obj=obj.nextSibling}var position=$(obj).offset();return[position.left,position.top]},_hideDatepicker:function(input,duration){var inst=this._curInst;if(!inst||(input&&inst!=$.data(input,PROP_NAME))){return}if(inst.stayOpen){this._selectDate("#"+inst.id,this._formatDate(inst,inst.currentDay,inst.currentMonth,inst.currentYear))}inst.stayOpen=false;if(this._datepickerShowing){duration=(duration!=null?duration:this._get(inst,"duration"));var showAnim=this._get(inst,"showAnim");var postProcess=function(){$.datepicker._tidyDialog(inst)};if(duration!=""&&$.effects&&$.effects[showAnim]){inst.dpDiv.hide(showAnim,$.datepicker._get(inst,"showOptions"),duration,postProcess)}else{inst.dpDiv[(duration==""?"hide":(showAnim=="slideDown"?"slideUp":(showAnim=="fadeIn"?"fadeOut":"hide")))](duration,postProcess)}if(duration==""){this._tidyDialog(inst)}var onClose=this._get(inst,"onClose");if(onClose){onClose.apply((inst.input?inst.input[0]:null),[(inst.input?inst.input.val():""),inst])}this._datepickerShowing=false;this._lastInput=null;if(this._inDialog){this._dialogInput.css({position:"absolute",left:"0",top:"-100px"});if($.blockUI){$.unblockUI();$("body").append(this.dpDiv)}}this._inDialog=false}this._curInst=null},_tidyDialog:function(inst){inst.dpDiv.removeClass(this._dialogClass).unbind(".ui-datepicker-calendar")},_checkExternalClick:function(event){if(!$.datepicker._curInst){return}var $target=$(event.target);if(($target.parents("#"+$.datepicker._mainDivId).length==0)&&!$target.hasClass($.datepicker.markerClassName)&&!$target.hasClass($.datepicker._triggerClass)&&$.datepicker._datepickerShowing&&!($.datepicker._inDialog&&$.blockUI)){$.datepicker._hideDatepicker(null,"")}},_adjustDate:function(id,offset,period){var target=$(id);var inst=this._getInst(target[0]);if(this._isDisabledDatepicker(target[0])){return}this._adjustInstDate(inst,offset+(period=="M"?this._get(inst,"showCurrentAtPos"):0),period);this._updateDatepicker(inst)},_gotoToday:function(id){var target=$(id);var inst=this._getInst(target[0]);if(this._get(inst,"gotoCurrent")&&inst.currentDay){inst.selectedDay=inst.currentDay;inst.drawMonth=inst.selectedMonth=inst.currentMonth;inst.drawYear=inst.selectedYear=inst.currentYear}else{var date=new Date();inst.selectedDay=date.getDate();inst.drawMonth=inst.selectedMonth=date.getMonth();inst.drawYear=inst.selectedYear=date.getFullYear()}this._notifyChange(inst);this._adjustDate(target)},_selectMonthYear:function(id,select,period){var target=$(id);var inst=this._getInst(target[0]);inst._selectingMonthYear=false;inst["selected"+(period=="M"?"Month":"Year")]=inst["draw"+(period=="M"?"Month":"Year")]=parseInt(select.options[select.selectedIndex].value,10);this._notifyChange(inst);this._adjustDate(target)},_clickMonthYear:function(id){var target=$(id);var inst=this._getInst(target[0]);if(inst.input&&inst._selectingMonthYear&&!$.browser.msie){inst.input[0].focus()}inst._selectingMonthYear=!inst._selectingMonthYear},_selectDay:function(id,month,year,td){var target=$(id);if($(td).hasClass(this._unselectableClass)||this._isDisabledDatepicker(target[0])){return}var inst=this._getInst(target[0]);inst.selectedDay=inst.currentDay=$("a",td).html();inst.selectedMonth=inst.currentMonth=month;inst.selectedYear=inst.currentYear=year;if(inst.stayOpen){inst.endDay=inst.endMonth=inst.endYear=null}this._selectDate(id,this._formatDate(inst,inst.currentDay,inst.currentMonth,inst.currentYear));if(inst.stayOpen){inst.rangeStart=this._daylightSavingAdjust(new Date(inst.currentYear,inst.currentMonth,inst.currentDay));this._updateDatepicker(inst)}},_clearDate:function(id){var target=$(id);var inst=this._getInst(target[0]);inst.stayOpen=false;inst.endDay=inst.endMonth=inst.endYear=inst.rangeStart=null;this._selectDate(target,"")},_selectDate:function(id,dateStr){var target=$(id);var inst=this._getInst(target[0]);dateStr=(dateStr!=null?dateStr:this._formatDate(inst));if(inst.input){inst.input.val(dateStr)}this._updateAlternate(inst);var onSelect=this._get(inst,"onSelect");if(onSelect){onSelect.apply((inst.input?inst.input[0]:null),[dateStr,inst])}else{if(inst.input){inst.input.trigger("change")}}if(inst.inline){this._updateDatepicker(inst)}else{if(!inst.stayOpen){this._hideDatepicker(null,this._get(inst,"duration"));this._lastInput=inst.input[0];if(typeof(inst.input[0])!="object"){inst.input[0].focus()}this._lastInput=null}}},_updateAlternate:function(inst){var altField=this._get(inst,"altField");if(altField){var altFormat=this._get(inst,"altFormat")||this._get(inst,"dateFormat");var date=this._getDate(inst);dateStr=this.formatDate(altFormat,date,this._getFormatConfig(inst));$(altField).each(function(){$(this).val(dateStr)})}},noWeekends:function(date){var day=date.getDay();return[(day>0&&day<6),""]},iso8601Week:function(date){var checkDate=new Date(date.getFullYear(),date.getMonth(),date.getDate());var firstMon=new Date(checkDate.getFullYear(),1-1,4);var firstDay=firstMon.getDay()||7;firstMon.setDate(firstMon.getDate()+1-firstDay);if(firstDay<4&&checkDatenew Date(checkDate.getFullYear(),12-1,28)){firstDay=new Date(checkDate.getFullYear()+1,1-1,4).getDay()||7;if(firstDay>4&&(checkDate.getDay()||7)0&&iValue="0"&&value.charAt(iValue)<="9"){num=num*10+parseInt(value.charAt(iValue++),10);size--}if(size==origSize){throw"Missing number at position "+iValue}return num};var getName=function(match,shortNames,longNames){var names=(lookAhead(match)?longNames:shortNames);var size=0;for(var j=0;j0&&iValue-1){month=1;day=doy;do{var dim=this._getDaysInMonth(year,month-1);if(day<=dim){break}month++;day-=dim}while(true)}var date=this._daylightSavingAdjust(new Date(year,month-1,day));if(date.getFullYear()!=year||date.getMonth()+1!=month||date.getDate()!=day){throw"Invalid date"}return date},ATOM:"yy-mm-dd",COOKIE:"D, dd M yy",ISO_8601:"yy-mm-dd",RFC_822:"D, d M y",RFC_850:"DD, dd-M-y",RFC_1036:"D, d M y",RFC_1123:"D, d M yy",RFC_2822:"D, d M yy",RSS:"D, d M y",TIMESTAMP:"@",W3C:"yy-mm-dd",formatDate:function(format,date,settings){if(!date){return""}var dayNamesShort=(settings?settings.dayNamesShort:null)||this._defaults.dayNamesShort;var dayNames=(settings?settings.dayNames:null)||this._defaults.dayNames;var monthNamesShort=(settings?settings.monthNamesShort:null)||this._defaults.monthNamesShort;var monthNames=(settings?settings.monthNames:null)||this._defaults.monthNames;var lookAhead=function(match){var matches=(iFormat+1=0;m--){doy+=this._getDaysInMonth(date.getFullYear(),m)}output+=formatNumber("o",doy,3);break;case"m":output+=formatNumber("m",date.getMonth()+1,2);break;case"M":output+=formatName("M",date.getMonth(),monthNamesShort,monthNames);break;case"y":output+=(lookAhead("y")?date.getFullYear():(date.getYear()%100<10?"0":"")+date.getYear()%100);break;case"@":output+=date.getTime();break;case"'":if(lookAhead("'")){output+="'"}else{literal=true}break;default:output+=format.charAt(iFormat)}}}}return output},_possibleChars:function(format){var chars="";var literal=false;for(var iFormat=0;iFormatmaxDate?maxDate:date);return date},_determineDate:function(date,defaultDate){var offsetNumeric=function(offset){var date=new Date();date.setDate(date.getDate()+offset);return date};var offsetString=function(offset,getDaysInMonth){var date=new Date();var year=date.getFullYear();var month=date.getMonth();var day=date.getDate();var pattern=/([+-]?[0-9]+)\s*(d|D|w|W|m|M|y|Y)?/g;var matches=pattern.exec(offset);while(matches){switch(matches[2]||"d"){case"d":case"D":day+=parseInt(matches[1],10);break;case"w":case"W":day+=parseInt(matches[1],10)*7;break;case"m":case"M":month+=parseInt(matches[1],10);day=Math.min(day,getDaysInMonth(year,month));break;case"y":case"Y":year+=parseInt(matches[1],10);day=Math.min(day,getDaysInMonth(year,month));break}matches=pattern.exec(offset)}return new Date(year,month,day)};date=(date==null?defaultDate:(typeof date=="string"?offsetString(date,this._getDaysInMonth):(typeof date=="number"?(isNaN(date)?defaultDate:offsetNumeric(date)):date)));date=(date&&date.toString()=="Invalid Date"?defaultDate:date);if(date){date.setHours(0);date.setMinutes(0);date.setSeconds(0);date.setMilliseconds(0)}return this._daylightSavingAdjust(date)},_daylightSavingAdjust:function(date){if(!date){return null}date.setHours(date.getHours()>12?date.getHours()+2:0);return date},_setDate:function(inst,date,endDate){var clear=!(date);var origMonth=inst.selectedMonth;var origYear=inst.selectedYear;date=this._determineDate(date,new Date());inst.selectedDay=inst.currentDay=date.getDate();inst.drawMonth=inst.selectedMonth=inst.currentMonth=date.getMonth();inst.drawYear=inst.selectedYear=inst.currentYear=date.getFullYear();if(origMonth!=inst.selectedMonth||origYear!=inst.selectedYear){this._notifyChange(inst)}this._adjustInstDate(inst);if(inst.input){inst.input.val(clear?"":this._formatDate(inst))}},_getDate:function(inst){var startDate=(!inst.currentYear||(inst.input&&inst.input.val()=="")?null:this._daylightSavingAdjust(new Date(inst.currentYear,inst.currentMonth,inst.currentDay)));return startDate},_generateHTML:function(inst){var today=new Date();today=this._daylightSavingAdjust(new Date(today.getFullYear(),today.getMonth(),today.getDate()));var isRTL=this._get(inst,"isRTL");var showButtonPanel=this._get(inst,"showButtonPanel");var hideIfNoPrevNext=this._get(inst,"hideIfNoPrevNext");var navigationAsDateFormat=this._get(inst,"navigationAsDateFormat");var numMonths=this._getNumberOfMonths(inst);var showCurrentAtPos=this._get(inst,"showCurrentAtPos");var stepMonths=this._get(inst,"stepMonths");var stepBigMonths=this._get(inst,"stepBigMonths");var isMultiMonth=(numMonths[0]!=1||numMonths[1]!=1);var currentDate=this._daylightSavingAdjust((!inst.currentDay?new Date(9999,9,9):new Date(inst.currentYear,inst.currentMonth,inst.currentDay)));var minDate=this._getMinMaxDate(inst,"min",true);var maxDate=this._getMinMaxDate(inst,"max");var drawMonth=inst.drawMonth-showCurrentAtPos;var drawYear=inst.drawYear;if(drawMonth<0){drawMonth+=12;drawYear--}if(maxDate){var maxDraw=this._daylightSavingAdjust(new Date(maxDate.getFullYear(),maxDate.getMonth()-numMonths[1]+1,maxDate.getDate()));maxDraw=(minDate&&maxDrawmaxDraw){drawMonth--;if(drawMonth<0){drawMonth=11;drawYear--}}}inst.drawMonth=drawMonth;inst.drawYear=drawYear;var prevText=this._get(inst,"prevText");prevText=(!navigationAsDateFormat?prevText:this.formatDate(prevText,this._daylightSavingAdjust(new Date(drawYear,drawMonth-stepMonths,1)),this._getFormatConfig(inst)));var prev=(this._canAdjustMonth(inst,-1,drawYear,drawMonth)?''+prevText+" '+prevText+" '+nextText+" '+nextText+" '+this._get(inst,"closeText")+" ":"");var buttonPanel=(showButtonPanel)?''+(isRTL?controls:"")+(this._isInRange(inst,gotoDate)?'"+currentText+" ":"")+(isRTL?"":controls)+"
":"";var firstDay=parseInt(this._get(inst,"firstDay"),10);firstDay=(isNaN(firstDay)?0:firstDay);var dayNames=this._get(inst,"dayNames");var dayNamesShort=this._get(inst,"dayNamesShort");var dayNamesMin=this._get(inst,"dayNamesMin");var monthNames=this._get(inst,"monthNames");var monthNamesShort=this._get(inst,"monthNamesShort");var beforeShowDay=this._get(inst,"beforeShowDay");var showOtherMonths=this._get(inst,"showOtherMonths");var calculateWeek=this._get(inst,"calculateWeek")||this.iso8601Week;var endDate=inst.endDay?this._daylightSavingAdjust(new Date(inst.endYear,inst.endMonth,inst.endDay)):currentDate;var defaultDate=this._getDefaultDate(inst);var html="";for(var row=0;row'+(/all|left/.test(cornerClass)&&row==0?(isRTL?next:prev):"")+(/all|right/.test(cornerClass)&&row==0?(isRTL?prev:next):"")+this._generateMonthYearHeader(inst,drawMonth,drawYear,minDate,maxDate,selectedDate,row>0||col>0,monthNames,monthNamesShort)+'';var thead="";for(var dow=0;dow<7;dow++){var day=(dow+firstDay)%7;thead+="=5?' class="ui-datepicker-week-end"':"")+'>'+dayNamesMin[day]+" "}calender+=thead+" ";var daysInMonth=this._getDaysInMonth(drawYear,drawMonth);if(drawYear==inst.selectedYear&&drawMonth==inst.selectedMonth){inst.selectedDay=Math.min(inst.selectedDay,daysInMonth)}var leadDays=(this._getFirstDayOfMonth(drawYear,drawMonth)-firstDay+7)%7;var numRows=(isMultiMonth?6:Math.ceil((leadDays+daysInMonth)/7));var printDate=this._daylightSavingAdjust(new Date(drawYear,drawMonth,1-leadDays));for(var dRow=0;dRow";var tbody="";for(var dow=0;dow<7;dow++){var daySettings=(beforeShowDay?beforeShowDay.apply((inst.input?inst.input[0]:null),[printDate]):[true,""]);var otherMonth=(printDate.getMonth()!=drawMonth);var unselectable=otherMonth||!daySettings[0]||(minDate&&printDatemaxDate);tbody+='=currentDate.getTime()&&printDate.getTime()<=endDate.getTime()?" "+this._currentClass:"")+(printDate.getTime()==today.getTime()?" ui-datepicker-today":""))+'"'+((!otherMonth||showOtherMonths)&&daySettings[2]?' title="'+daySettings[2]+'"':"")+(unselectable?"":" onclick=\"DP_jQuery.datepicker._selectDay('#"+inst.id+"',"+drawMonth+","+drawYear+', this);return false;"')+">"+(otherMonth?(showOtherMonths?printDate.getDate():" "):(unselectable?''+printDate.getDate()+" ":'=currentDate.getTime()&&printDate.getTime()<=endDate.getTime()?" ui-state-active":"")+'" href="#">'+printDate.getDate()+" "))+" ";printDate.setDate(printDate.getDate()+1);printDate=this._daylightSavingAdjust(printDate)}calender+=tbody+""}drawMonth++;if(drawMonth>11){drawMonth=0;drawYear++}calender+="
"+(isMultiMonth?""+((numMonths[0]>0&&col==numMonths[1]-1)?'
':""):"");group+=calender}html+=group}html+=buttonPanel+($.browser.msie&&parseInt($.browser.version,10)<7&&!inst.inline?'':"");inst._keyEvent=false;return html},_generateMonthYearHeader:function(inst,drawMonth,drawYear,minDate,maxDate,selectedDate,secondary,monthNames,monthNamesShort){minDate=(inst.rangeStart&&minDate&&selectedDate "}else{var inMinYear=(minDate&&minDate.getFullYear()==drawYear);var inMaxYear=(maxDate&&maxDate.getFullYear()==drawYear);monthHtml+='";for(var month=0;month<12;month++){if((!inMinYear||month>=minDate.getMonth())&&(!inMaxYear||month<=maxDate.getMonth())){monthHtml+='"+monthNamesShort[month]+" "}}monthHtml+=" "}if(!showMonthAfterYear){html+=monthHtml+((secondary||changeMonth||changeYear)&&(!(changeMonth&&changeYear))?" ":"")}if(secondary||!changeYear){html+=''+drawYear+" "}else{var years=this._get(inst,"yearRange").split(":");var year=0;var endYear=0;if(years.length!=2){year=drawYear-10;endYear=drawYear+10}else{if(years[0].charAt(0)=="+"||years[0].charAt(0)=="-"){year=drawYear+parseInt(years[0],10);endYear=drawYear+parseInt(years[1],10)}else{year=parseInt(years[0],10);endYear=parseInt(years[1],10)}}year=(minDate?Math.max(year,minDate.getFullYear()):year);endYear=(maxDate?Math.min(endYear,maxDate.getFullYear()):endYear);html+='";for(;year<=endYear;year++){html+='"+year+" "}html+=" "}if(showMonthAfterYear){html+=(secondary||changeMonth||changeYear?" ":"")+monthHtml}html+="";return html},_adjustInstDate:function(inst,offset,period){var year=inst.drawYear+(period=="Y"?offset:0);var month=inst.drawMonth+(period=="M"?offset:0);var day=Math.min(inst.selectedDay,this._getDaysInMonth(year,month))+(period=="D"?offset:0);var date=this._daylightSavingAdjust(new Date(year,month,day));var minDate=this._getMinMaxDate(inst,"min",true);var maxDate=this._getMinMaxDate(inst,"max");date=(minDate&&datemaxDate?maxDate:date);inst.selectedDay=date.getDate();inst.drawMonth=inst.selectedMonth=date.getMonth();inst.drawYear=inst.selectedYear=date.getFullYear();if(period=="M"||period=="Y"){this._notifyChange(inst)}},_notifyChange:function(inst){var onChange=this._get(inst,"onChangeMonthYear");if(onChange){onChange.apply((inst.input?inst.input[0]:null),[inst.selectedYear,inst.selectedMonth+1,inst])}},_getNumberOfMonths:function(inst){var numMonths=this._get(inst,"numberOfMonths");return(numMonths==null?[1,1]:(typeof numMonths=="number"?[1,numMonths]:numMonths))},_getMinMaxDate:function(inst,minMax,checkRange){var date=this._determineDate(this._get(inst,minMax+"Date"),null);return(!checkRange||!inst.rangeStart?date:(!date||inst.rangeStart>date?inst.rangeStart:date))},_getDaysInMonth:function(year,month){return 32-new Date(year,month,32).getDate()},_getFirstDayOfMonth:function(year,month){return new Date(year,month,1).getDay()},_canAdjustMonth:function(inst,offset,curYear,curMonth){var numMonths=this._getNumberOfMonths(inst);var date=this._daylightSavingAdjust(new Date(curYear,curMonth+(offset<0?offset:numMonths[1]),1));if(offset<0){date.setDate(this._getDaysInMonth(date.getFullYear(),date.getMonth()))}return this._isInRange(inst,date)},_isInRange:function(inst,date){var newMinDate=(!inst.rangeStart?null:this._daylightSavingAdjust(new Date(inst.selectedYear,inst.selectedMonth,inst.selectedDay)));newMinDate=(newMinDate&&inst.rangeStart=minDate)&&(!maxDate||date<=maxDate))},_getFormatConfig:function(inst){var shortYearCutoff=this._get(inst,"shortYearCutoff");shortYearCutoff=(typeof shortYearCutoff!="string"?shortYearCutoff:new Date().getFullYear()%100+parseInt(shortYearCutoff,10));return{shortYearCutoff:shortYearCutoff,dayNamesShort:this._get(inst,"dayNamesShort"),dayNames:this._get(inst,"dayNames"),monthNamesShort:this._get(inst,"monthNamesShort"),monthNames:this._get(inst,"monthNames")}},_formatDate:function(inst,day,month,year){if(!day){inst.currentDay=inst.selectedDay;inst.currentMonth=inst.selectedMonth;inst.currentYear=inst.selectedYear}var date=(day?(typeof day=="object"?day:this._daylightSavingAdjust(new Date(year,month,day))):this._daylightSavingAdjust(new Date(inst.currentYear,inst.currentMonth,inst.currentDay)));return this.formatDate(this._get(inst,"dateFormat"),date,this._getFormatConfig(inst))}});function extendRemove(target,props){$.extend(target,props);for(var name in props){if(props[name]==null||props[name]==undefined){target[name]=props[name]}}return target}function isArray(a){return(a&&(($.browser.safari&&typeof a=="object"&&a.length)||(a.constructor&&a.constructor.toString().match(/\Array\(\)/))))}$.fn.datepicker=function(options){if(!$.datepicker.initialized){$(document).mousedown($.datepicker._checkExternalClick).find("body").append($.datepicker.dpDiv);$.datepicker.initialized=true}var otherArgs=Array.prototype.slice.call(arguments,1);if(typeof options=="string"&&(options=="isDisabled"||options=="getDate")){return $.datepicker["_"+options+"Datepicker"].apply($.datepicker,[this[0]].concat(otherArgs))}if(options=="option"&&arguments.length==2&&typeof arguments[1]=="string"){return $.datepicker["_"+options+"Datepicker"].apply($.datepicker,[this[0]].concat(otherArgs))}return this.each(function(){typeof options=="string"?$.datepicker["_"+options+"Datepicker"].apply($.datepicker,[this].concat(otherArgs)):$.datepicker._attachDatepicker(this,options)})};$.datepicker=new Datepicker();$.datepicker.initialized=false;$.datepicker.uuid=new Date().getTime();$.datepicker.version="1.7.2";window.DP_jQuery=$})(jQuery);;/*
+ * jQuery UI Progressbar 1.7.2
+ *
+ * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Progressbar
+ *
+ * Depends:
+ * ui.core.js
+ */
+(function(a){a.widget("ui.progressbar",{_init:function(){this.element.addClass("ui-progressbar ui-widget ui-widget-content ui-corner-all").attr({role:"progressbar","aria-valuemin":this._valueMin(),"aria-valuemax":this._valueMax(),"aria-valuenow":this._value()});this.valueDiv=a('').appendTo(this.element);this._refreshValue()},destroy:function(){this.element.removeClass("ui-progressbar ui-widget ui-widget-content ui-corner-all").removeAttr("role").removeAttr("aria-valuemin").removeAttr("aria-valuemax").removeAttr("aria-valuenow").removeData("progressbar").unbind(".progressbar");this.valueDiv.remove();a.widget.prototype.destroy.apply(this,arguments)},value:function(b){if(b===undefined){return this._value()}this._setData("value",b);return this},_setData:function(b,c){switch(b){case"value":this.options.value=c;this._refreshValue();this._trigger("change",null,{});break}a.widget.prototype._setData.apply(this,arguments)},_value:function(){var b=this.options.value;if(bthis._valueMax()){b=this._valueMax()}return b},_valueMin:function(){var b=0;return b},_valueMax:function(){var b=100;return b},_refreshValue:function(){var b=this.value();this.valueDiv[b==this._valueMax()?"addClass":"removeClass"]("ui-corner-right");this.valueDiv.width(b+"%");this.element.attr("aria-valuenow",b)}});a.extend(a.ui.progressbar,{version:"1.7.2",defaults:{value:0}})})(jQuery);;/*
+ * jQuery UI Effects 1.7.2
+ *
+ * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Effects/
+ */
+jQuery.effects||(function(d){d.effects={version:"1.7.2",save:function(g,h){for(var f=0;f');var j=f.parent();if(f.css("position")=="static"){j.css({position:"relative"});f.css({position:"relative"})}else{var i=f.css("top");if(isNaN(parseInt(i,10))){i="auto"}var h=f.css("left");if(isNaN(parseInt(h,10))){h="auto"}j.css({position:f.css("position"),top:i,left:h,zIndex:f.css("z-index")}).show();f.css({position:"relative",top:0,left:0})}j.css(g);return j},removeWrapper:function(f){if(f.parent().is(".ui-effects-wrapper")){return f.parent().replaceWith(f)}return f},setTransition:function(g,i,f,h){h=h||{};d.each(i,function(k,j){unit=g.cssUnit(j);if(unit[0]>0){h[j]=unit[0]*f+unit[1]}});return h},animateClass:function(h,i,k,j){var f=(typeof k=="function"?k:(j?j:null));var g=(typeof k=="string"?k:null);return this.each(function(){var q={};var o=d(this);var p=o.attr("style")||"";if(typeof p=="object"){p=p.cssText}if(h.toggle){o.hasClass(h.toggle)?h.remove=h.toggle:h.add=h.toggle}var l=d.extend({},(document.defaultView?document.defaultView.getComputedStyle(this,null):this.currentStyle));if(h.add){o.addClass(h.add)}if(h.remove){o.removeClass(h.remove)}var m=d.extend({},(document.defaultView?document.defaultView.getComputedStyle(this,null):this.currentStyle));if(h.add){o.removeClass(h.add)}if(h.remove){o.addClass(h.remove)}for(var r in m){if(typeof m[r]!="function"&&m[r]&&r.indexOf("Moz")==-1&&r.indexOf("length")==-1&&m[r]!=l[r]&&(r.match(/color/i)||(!r.match(/color/i)&&!isNaN(parseInt(m[r],10))))&&(l.position!="static"||(l.position=="static"&&!r.match(/left|top|bottom|right/)))){q[r]=m[r]}}o.animate(q,i,g,function(){if(typeof d(this).attr("style")=="object"){d(this).attr("style")["cssText"]="";d(this).attr("style")["cssText"]=p}else{d(this).attr("style",p)}if(h.add){d(this).addClass(h.add)}if(h.remove){d(this).removeClass(h.remove)}if(f){f.apply(this,arguments)}})})}};function c(g,f){var i=g[1]&&g[1].constructor==Object?g[1]:{};if(f){i.mode=f}var h=g[1]&&g[1].constructor!=Object?g[1]:(i.duration?i.duration:g[2]);h=d.fx.off?0:typeof h==="number"?h:d.fx.speeds[h]||d.fx.speeds._default;var j=i.callback||(d.isFunction(g[1])&&g[1])||(d.isFunction(g[2])&&g[2])||(d.isFunction(g[3])&&g[3]);return[g[0],i,h,j]}d.fn.extend({_show:d.fn.show,_hide:d.fn.hide,__toggle:d.fn.toggle,_addClass:d.fn.addClass,_removeClass:d.fn.removeClass,_toggleClass:d.fn.toggleClass,effect:function(g,f,h,i){return d.effects[g]?d.effects[g].call(this,{method:g,options:f||{},duration:h,callback:i}):null},show:function(){if(!arguments[0]||(arguments[0].constructor==Number||(/(slow|normal|fast)/).test(arguments[0]))){return this._show.apply(this,arguments)}else{return this.effect.apply(this,c(arguments,"show"))}},hide:function(){if(!arguments[0]||(arguments[0].constructor==Number||(/(slow|normal|fast)/).test(arguments[0]))){return this._hide.apply(this,arguments)}else{return this.effect.apply(this,c(arguments,"hide"))}},toggle:function(){if(!arguments[0]||(arguments[0].constructor==Number||(/(slow|normal|fast)/).test(arguments[0]))||(d.isFunction(arguments[0])||typeof arguments[0]=="boolean")){return this.__toggle.apply(this,arguments)}else{return this.effect.apply(this,c(arguments,"toggle"))}},addClass:function(g,f,i,h){return f?d.effects.animateClass.apply(this,[{add:g},f,i,h]):this._addClass(g)},removeClass:function(g,f,i,h){return f?d.effects.animateClass.apply(this,[{remove:g},f,i,h]):this._removeClass(g)},toggleClass:function(g,f,i,h){return((typeof f!=="boolean")&&f)?d.effects.animateClass.apply(this,[{toggle:g},f,i,h]):this._toggleClass(g,f)},morph:function(f,h,g,j,i){return d.effects.animateClass.apply(this,[{add:h,remove:f},g,j,i])},switchClass:function(){return this.morph.apply(this,arguments)},cssUnit:function(f){var g=this.css(f),h=[];d.each(["em","px","%","pt"],function(j,k){if(g.indexOf(k)>0){h=[parseFloat(g),k]}});return h}});d.each(["backgroundColor","borderBottomColor","borderLeftColor","borderRightColor","borderTopColor","color","outlineColor"],function(g,f){d.fx.step[f]=function(h){if(h.state==0){h.start=e(h.elem,f);h.end=b(h.end)}h.elem.style[f]="rgb("+[Math.max(Math.min(parseInt((h.pos*(h.end[0]-h.start[0]))+h.start[0],10),255),0),Math.max(Math.min(parseInt((h.pos*(h.end[1]-h.start[1]))+h.start[1],10),255),0),Math.max(Math.min(parseInt((h.pos*(h.end[2]-h.start[2]))+h.start[2],10),255),0)].join(",")+")"}});function b(g){var f;if(g&&g.constructor==Array&&g.length==3){return g}if(f=/rgb\(\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*\)/.exec(g)){return[parseInt(f[1],10),parseInt(f[2],10),parseInt(f[3],10)]}if(f=/rgb\(\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*\)/.exec(g)){return[parseFloat(f[1])*2.55,parseFloat(f[2])*2.55,parseFloat(f[3])*2.55]}if(f=/#([a-fA-F0-9]{2})([a-fA-F0-9]{2})([a-fA-F0-9]{2})/.exec(g)){return[parseInt(f[1],16),parseInt(f[2],16),parseInt(f[3],16)]}if(f=/#([a-fA-F0-9])([a-fA-F0-9])([a-fA-F0-9])/.exec(g)){return[parseInt(f[1]+f[1],16),parseInt(f[2]+f[2],16),parseInt(f[3]+f[3],16)]}if(f=/rgba\(0, 0, 0, 0\)/.exec(g)){return a.transparent}return a[d.trim(g).toLowerCase()]}function e(h,f){var g;do{g=d.curCSS(h,f);if(g!=""&&g!="transparent"||d.nodeName(h,"body")){break}f="backgroundColor"}while(h=h.parentNode);return b(g)}var a={aqua:[0,255,255],azure:[240,255,255],beige:[245,245,220],black:[0,0,0],blue:[0,0,255],brown:[165,42,42],cyan:[0,255,255],darkblue:[0,0,139],darkcyan:[0,139,139],darkgrey:[169,169,169],darkgreen:[0,100,0],darkkhaki:[189,183,107],darkmagenta:[139,0,139],darkolivegreen:[85,107,47],darkorange:[255,140,0],darkorchid:[153,50,204],darkred:[139,0,0],darksalmon:[233,150,122],darkviolet:[148,0,211],fuchsia:[255,0,255],gold:[255,215,0],green:[0,128,0],indigo:[75,0,130],khaki:[240,230,140],lightblue:[173,216,230],lightcyan:[224,255,255],lightgreen:[144,238,144],lightgrey:[211,211,211],lightpink:[255,182,193],lightyellow:[255,255,224],lime:[0,255,0],magenta:[255,0,255],maroon:[128,0,0],navy:[0,0,128],olive:[128,128,0],orange:[255,165,0],pink:[255,192,203],purple:[128,0,128],violet:[128,0,128],red:[255,0,0],silver:[192,192,192],white:[255,255,255],yellow:[255,255,0],transparent:[255,255,255]};d.easing.jswing=d.easing.swing;d.extend(d.easing,{def:"easeOutQuad",swing:function(g,h,f,j,i){return d.easing[d.easing.def](g,h,f,j,i)},easeInQuad:function(g,h,f,j,i){return j*(h/=i)*h+f},easeOutQuad:function(g,h,f,j,i){return -j*(h/=i)*(h-2)+f},easeInOutQuad:function(g,h,f,j,i){if((h/=i/2)<1){return j/2*h*h+f}return -j/2*((--h)*(h-2)-1)+f},easeInCubic:function(g,h,f,j,i){return j*(h/=i)*h*h+f},easeOutCubic:function(g,h,f,j,i){return j*((h=h/i-1)*h*h+1)+f},easeInOutCubic:function(g,h,f,j,i){if((h/=i/2)<1){return j/2*h*h*h+f}return j/2*((h-=2)*h*h+2)+f},easeInQuart:function(g,h,f,j,i){return j*(h/=i)*h*h*h+f},easeOutQuart:function(g,h,f,j,i){return -j*((h=h/i-1)*h*h*h-1)+f},easeInOutQuart:function(g,h,f,j,i){if((h/=i/2)<1){return j/2*h*h*h*h+f}return -j/2*((h-=2)*h*h*h-2)+f},easeInQuint:function(g,h,f,j,i){return j*(h/=i)*h*h*h*h+f},easeOutQuint:function(g,h,f,j,i){return j*((h=h/i-1)*h*h*h*h+1)+f},easeInOutQuint:function(g,h,f,j,i){if((h/=i/2)<1){return j/2*h*h*h*h*h+f}return j/2*((h-=2)*h*h*h*h+2)+f},easeInSine:function(g,h,f,j,i){return -j*Math.cos(h/i*(Math.PI/2))+j+f},easeOutSine:function(g,h,f,j,i){return j*Math.sin(h/i*(Math.PI/2))+f},easeInOutSine:function(g,h,f,j,i){return -j/2*(Math.cos(Math.PI*h/i)-1)+f},easeInExpo:function(g,h,f,j,i){return(h==0)?f:j*Math.pow(2,10*(h/i-1))+f},easeOutExpo:function(g,h,f,j,i){return(h==i)?f+j:j*(-Math.pow(2,-10*h/i)+1)+f},easeInOutExpo:function(g,h,f,j,i){if(h==0){return f}if(h==i){return f+j}if((h/=i/2)<1){return j/2*Math.pow(2,10*(h-1))+f}return j/2*(-Math.pow(2,-10*--h)+2)+f},easeInCirc:function(g,h,f,j,i){return -j*(Math.sqrt(1-(h/=i)*h)-1)+f},easeOutCirc:function(g,h,f,j,i){return j*Math.sqrt(1-(h=h/i-1)*h)+f},easeInOutCirc:function(g,h,f,j,i){if((h/=i/2)<1){return -j/2*(Math.sqrt(1-h*h)-1)+f}return j/2*(Math.sqrt(1-(h-=2)*h)+1)+f},easeInElastic:function(g,i,f,m,l){var j=1.70158;var k=0;var h=m;if(i==0){return f}if((i/=l)==1){return f+m}if(!k){k=l*0.3}if(h").css({position:"absolute",visibility:"visible",left:-d*(g/e),top:-f*(c/k)}).parent().addClass("ui-effects-explode").css({position:"absolute",overflow:"hidden",width:g/e,height:c/k,left:l.left+d*(g/e)+(b.options.mode=="show"?(d-Math.floor(e/2))*(g/e):0),top:l.top+f*(c/k)+(b.options.mode=="show"?(f-Math.floor(k/2))*(c/k):0),opacity:b.options.mode=="show"?0:1}).animate({left:l.left+d*(g/e)+(b.options.mode=="show"?0:(d-Math.floor(e/2))*(g/e)),top:l.top+f*(c/k)+(b.options.mode=="show"?0:(f-Math.floor(k/2))*(c/k)),opacity:b.options.mode=="show"?1:0},b.duration||500)}}setTimeout(function(){b.options.mode=="show"?h.css({visibility:"visible"}):h.css({visibility:"visible"}).hide();if(b.callback){b.callback.apply(h[0])}h.dequeue();a("div.ui-effects-explode").remove()},b.duration||500)})}})(jQuery);;/*
+ * jQuery UI Effects Fold 1.7.2
+ *
+ * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Effects/Fold
+ *
+ * Depends:
+ * effects.core.js
+ */
+(function(a){a.effects.fold=function(b){return this.queue(function(){var e=a(this),k=["position","top","left"];var h=a.effects.setMode(e,b.options.mode||"hide");var o=b.options.size||15;var n=!(!b.options.horizFirst);var g=b.duration?b.duration/2:a.fx.speeds._default/2;a.effects.save(e,k);e.show();var d=a.effects.createWrapper(e).css({overflow:"hidden"});var i=((h=="show")!=n);var f=i?["width","height"]:["height","width"];var c=i?[d.width(),d.height()]:[d.height(),d.width()];var j=/([0-9]+)%/.exec(o);if(j){o=parseInt(j[1],10)/100*c[h=="hide"?0:1]}if(h=="show"){d.css(n?{height:0,width:o}:{height:o,width:0})}var m={},l={};m[f[0]]=h=="show"?c[0]:o;l[f[1]]=h=="show"?c[1]:0;d.animate(m,g,b.options.easing).animate(l,g,b.options.easing,function(){if(h=="hide"){e.hide()}a.effects.restore(e,k);a.effects.removeWrapper(e);if(b.callback){b.callback.apply(e[0],arguments)}e.dequeue()})})}})(jQuery);;/*
+ * jQuery UI Effects Highlight 1.7.2
+ *
+ * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Effects/Highlight
+ *
+ * Depends:
+ * effects.core.js
+ */
+(function(a){a.effects.highlight=function(b){return this.queue(function(){var e=a(this),d=["backgroundImage","backgroundColor","opacity"];var h=a.effects.setMode(e,b.options.mode||"show");var c=b.options.color||"#ffff99";var g=e.css("backgroundColor");a.effects.save(e,d);e.show();e.css({backgroundImage:"none",backgroundColor:c});var f={backgroundColor:g};if(h=="hide"){f.opacity=0}e.animate(f,{queue:false,duration:b.duration,easing:b.options.easing,complete:function(){if(h=="hide"){e.hide()}a.effects.restore(e,d);if(h=="show"&&a.browser.msie){this.style.removeAttribute("filter")}if(b.callback){b.callback.apply(this,arguments)}e.dequeue()}})})}})(jQuery);;/*
+ * jQuery UI Effects Pulsate 1.7.2
+ *
+ * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Effects/Pulsate
+ *
+ * Depends:
+ * effects.core.js
+ */
+(function(a){a.effects.pulsate=function(b){return this.queue(function(){var d=a(this);var g=a.effects.setMode(d,b.options.mode||"show");var f=b.options.times||5;var e=b.duration?b.duration/2:a.fx.speeds._default/2;if(g=="hide"){f--}if(d.is(":hidden")){d.css("opacity",0);d.show();d.animate({opacity:1},e,b.options.easing);f=f-2}for(var c=0;c').appendTo(document.body).addClass(b.options.className).css({top:d.top,left:d.left,height:f.innerHeight(),width:f.innerWidth(),position:"absolute"}).animate(g,b.duration,b.options.easing,function(){c.remove();(b.callback&&b.callback.apply(f[0],arguments));f.dequeue()})})}})(jQuery);;
\ No newline at end of file
diff --git a/src/Umbraco.Web.UI/Umbraco/plugins/umbracoContour/scripts/jquery-ui-1.8.11.min.js b/src/Umbraco.Web.UI/Umbraco/plugins/umbracoContour/scripts/jquery-ui-1.8.11.min.js
new file mode 100644
index 0000000000..89ff61bcba
--- /dev/null
+++ b/src/Umbraco.Web.UI/Umbraco/plugins/umbracoContour/scripts/jquery-ui-1.8.11.min.js
@@ -0,0 +1,938 @@
+/*!
+* Note: While Microsoft is not the author of this file, Microsoft is
+* offering you a license subject to the terms of the Microsoft Software
+* License Terms for Microsoft ASP.NET Model View Controller 3.
+* Microsoft reserves all other rights. The notices below are provided
+* for informational purposes only and are not the license terms under
+* which Microsoft distributed this file.
+*
+* jQuery UI 1.8.11
+*
+* Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+*
+* http://docs.jquery.com/UI
+*/
+(function(c,j){function k(a){return!c(a).parents().andSelf().filter(function(){return c.curCSS(this,"visibility")==="hidden"||c.expr.filters.hidden(this)}).length}c.ui=c.ui||{};if(!c.ui.version){c.extend(c.ui,{version:"1.8.11",keyCode:{ALT:18,BACKSPACE:8,CAPS_LOCK:20,COMMA:188,COMMAND:91,COMMAND_LEFT:91,COMMAND_RIGHT:93,CONTROL:17,DELETE:46,DOWN:40,END:35,ENTER:13,ESCAPE:27,HOME:36,INSERT:45,LEFT:37,MENU:93,NUMPAD_ADD:107,NUMPAD_DECIMAL:110,NUMPAD_DIVIDE:111,NUMPAD_ENTER:108,NUMPAD_MULTIPLY:106,
+NUMPAD_SUBTRACT:109,PAGE_DOWN:34,PAGE_UP:33,PERIOD:190,RIGHT:39,SHIFT:16,SPACE:32,TAB:9,UP:38,WINDOWS:91}});c.fn.extend({_focus:c.fn.focus,focus:function(a,b){return typeof a==="number"?this.each(function(){var d=this;setTimeout(function(){c(d).focus();b&&b.call(d)},a)}):this._focus.apply(this,arguments)},scrollParent:function(){var a;a=c.browser.msie&&/(static|relative)/.test(this.css("position"))||/absolute/.test(this.css("position"))?this.parents().filter(function(){return/(relative|absolute|fixed)/.test(c.curCSS(this,
+"position",1))&&/(auto|scroll)/.test(c.curCSS(this,"overflow",1)+c.curCSS(this,"overflow-y",1)+c.curCSS(this,"overflow-x",1))}).eq(0):this.parents().filter(function(){return/(auto|scroll)/.test(c.curCSS(this,"overflow",1)+c.curCSS(this,"overflow-y",1)+c.curCSS(this,"overflow-x",1))}).eq(0);return/fixed/.test(this.css("position"))||!a.length?c(document):a},zIndex:function(a){if(a!==j)return this.css("zIndex",a);if(this.length){a=c(this[0]);for(var b;a.length&&a[0]!==document;){b=a.css("position");
+if(b==="absolute"||b==="relative"||b==="fixed"){b=parseInt(a.css("zIndex"),10);if(!isNaN(b)&&b!==0)return b}a=a.parent()}}return 0},disableSelection:function(){return this.bind((c.support.selectstart?"selectstart":"mousedown")+".ui-disableSelection",function(a){a.preventDefault()})},enableSelection:function(){return this.unbind(".ui-disableSelection")}});c.each(["Width","Height"],function(a,b){function d(f,g,l,m){c.each(e,function(){g-=parseFloat(c.curCSS(f,"padding"+this,true))||0;if(l)g-=parseFloat(c.curCSS(f,
+"border"+this+"Width",true))||0;if(m)g-=parseFloat(c.curCSS(f,"margin"+this,true))||0});return g}var e=b==="Width"?["Left","Right"]:["Top","Bottom"],h=b.toLowerCase(),i={innerWidth:c.fn.innerWidth,innerHeight:c.fn.innerHeight,outerWidth:c.fn.outerWidth,outerHeight:c.fn.outerHeight};c.fn["inner"+b]=function(f){if(f===j)return i["inner"+b].call(this);return this.each(function(){c(this).css(h,d(this,f)+"px")})};c.fn["outer"+b]=function(f,g){if(typeof f!=="number")return i["outer"+b].call(this,f);return this.each(function(){c(this).css(h,
+d(this,f,true,g)+"px")})}});c.extend(c.expr[":"],{data:function(a,b,d){return!!c.data(a,d[3])},focusable:function(a){var b=a.nodeName.toLowerCase(),d=c.attr(a,"tabindex");if("area"===b){b=a.parentNode;d=b.name;if(!a.href||!d||b.nodeName.toLowerCase()!=="map")return false;a=c("img[usemap=#"+d+"]")[0];return!!a&&k(a)}return(/input|select|textarea|button|object/.test(b)?!a.disabled:"a"==b?a.href||!isNaN(d):!isNaN(d))&&k(a)},tabbable:function(a){var b=c.attr(a,"tabindex");return(isNaN(b)||b>=0)&&c(a).is(":focusable")}});
+c(function(){var a=document.body,b=a.appendChild(b=document.createElement("div"));c.extend(b.style,{minHeight:"100px",height:"auto",padding:0,borderWidth:0});c.support.minHeight=b.offsetHeight===100;c.support.selectstart="onselectstart"in b;a.removeChild(b).style.display="none"});c.extend(c.ui,{plugin:{add:function(a,b,d){a=c.ui[a].prototype;for(var e in d){a.plugins[e]=a.plugins[e]||[];a.plugins[e].push([b,d[e]])}},call:function(a,b,d){if((b=a.plugins[b])&&a.element[0].parentNode)for(var e=0;e0)return true;a[b]=1;d=a[b]>0;a[b]=0;return d},isOverAxis:function(a,b,d){return a>b&&a=9)&&!a.button)return this._mouseUp(a);if(this._mouseStarted){this._mouseDrag(a);return a.preventDefault()}if(this._mouseDistanceMet(a)&&this._mouseDelayMet(a))(this._mouseStarted=this._mouseStart(this._mouseDownEvent,a)!==false)?this._mouseDrag(a):this._mouseUp(a);return!this._mouseStarted},_mouseUp:function(a){b(document).unbind("mousemove."+this.widgetName,this._mouseMoveDelegate).unbind("mouseup."+this.widgetName,this._mouseUpDelegate);
+if(this._mouseStarted){this._mouseStarted=false;a.target==this._mouseDownEvent.target&&b.data(a.target,this.widgetName+".preventClickEvent",true);this._mouseStop(a)}return false},_mouseDistanceMet:function(a){return Math.max(Math.abs(this._mouseDownEvent.pageX-a.pageX),Math.abs(this._mouseDownEvent.pageY-a.pageY))>=this.options.distance},_mouseDelayMet:function(){return this.mouseDelayMet},_mouseStart:function(){},_mouseDrag:function(){},_mouseStop:function(){},_mouseCapture:function(){return true}})})(jQuery);
+;/*
+ * Note: While Microsoft is not the author of this file, Microsoft is
+ * offering you a license subject to the terms of the Microsoft Software
+ * License Terms for Microsoft ASP.NET Model View Controller 3.
+ * Microsoft reserves all other rights. The notices below are provided
+ * for informational purposes only and are not the license terms under
+ * which Microsoft distributed this file.
+ *
+ * jQuery UI Position 1.8.11
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ *
+ * http://docs.jquery.com/UI/Position
+ */
+(function(c){c.ui=c.ui||{};var n=/left|center|right/,o=/top|center|bottom/,t=c.fn.position,u=c.fn.offset;c.fn.position=function(b){if(!b||!b.of)return t.apply(this,arguments);b=c.extend({},b);var a=c(b.of),d=a[0],g=(b.collision||"flip").split(" "),e=b.offset?b.offset.split(" "):[0,0],h,k,j;if(d.nodeType===9){h=a.width();k=a.height();j={top:0,left:0}}else if(d.setTimeout){h=a.width();k=a.height();j={top:a.scrollTop(),left:a.scrollLeft()}}else if(d.preventDefault){b.at="left top";h=k=0;j={top:b.of.pageY,
+left:b.of.pageX}}else{h=a.outerWidth();k=a.outerHeight();j=a.offset()}c.each(["my","at"],function(){var f=(b[this]||"").split(" ");if(f.length===1)f=n.test(f[0])?f.concat(["center"]):o.test(f[0])?["center"].concat(f):["center","center"];f[0]=n.test(f[0])?f[0]:"center";f[1]=o.test(f[1])?f[1]:"center";b[this]=f});if(g.length===1)g[1]=g[0];e[0]=parseInt(e[0],10)||0;if(e.length===1)e[1]=e[0];e[1]=parseInt(e[1],10)||0;if(b.at[0]==="right")j.left+=h;else if(b.at[0]==="center")j.left+=h/2;if(b.at[1]==="bottom")j.top+=
+k;else if(b.at[1]==="center")j.top+=k/2;j.left+=e[0];j.top+=e[1];return this.each(function(){var f=c(this),l=f.outerWidth(),m=f.outerHeight(),p=parseInt(c.curCSS(this,"marginLeft",true))||0,q=parseInt(c.curCSS(this,"marginTop",true))||0,v=l+p+(parseInt(c.curCSS(this,"marginRight",true))||0),w=m+q+(parseInt(c.curCSS(this,"marginBottom",true))||0),i=c.extend({},j),r;if(b.my[0]==="right")i.left-=l;else if(b.my[0]==="center")i.left-=l/2;if(b.my[1]==="bottom")i.top-=m;else if(b.my[1]==="center")i.top-=
+m/2;i.left=Math.round(i.left);i.top=Math.round(i.top);r={left:i.left-p,top:i.top-q};c.each(["left","top"],function(s,x){c.ui.position[g[s]]&&c.ui.position[g[s]][x](i,{targetWidth:h,targetHeight:k,elemWidth:l,elemHeight:m,collisionPosition:r,collisionWidth:v,collisionHeight:w,offset:e,my:b.my,at:b.at})});c.fn.bgiframe&&f.bgiframe();f.offset(c.extend(i,{using:b.using}))})};c.ui.position={fit:{left:function(b,a){var d=c(window);d=a.collisionPosition.left+a.collisionWidth-d.width()-d.scrollLeft();b.left=
+d>0?b.left-d:Math.max(b.left-a.collisionPosition.left,b.left)},top:function(b,a){var d=c(window);d=a.collisionPosition.top+a.collisionHeight-d.height()-d.scrollTop();b.top=d>0?b.top-d:Math.max(b.top-a.collisionPosition.top,b.top)}},flip:{left:function(b,a){if(a.at[0]!=="center"){var d=c(window);d=a.collisionPosition.left+a.collisionWidth-d.width()-d.scrollLeft();var g=a.my[0]==="left"?-a.elemWidth:a.my[0]==="right"?a.elemWidth:0,e=a.at[0]==="left"?a.targetWidth:-a.targetWidth,h=-2*a.offset[0];b.left+=
+a.collisionPosition.left<0?g+e+h:d>0?g+e+h:0}},top:function(b,a){if(a.at[1]!=="center"){var d=c(window);d=a.collisionPosition.top+a.collisionHeight-d.height()-d.scrollTop();var g=a.my[1]==="top"?-a.elemHeight:a.my[1]==="bottom"?a.elemHeight:0,e=a.at[1]==="top"?a.targetHeight:-a.targetHeight,h=-2*a.offset[1];b.top+=a.collisionPosition.top<0?g+e+h:d>0?g+e+h:0}}}};if(!c.offset.setOffset){c.offset.setOffset=function(b,a){if(/static/.test(c.curCSS(b,"position")))b.style.position="relative";var d=c(b),
+g=d.offset(),e=parseInt(c.curCSS(b,"top",true),10)||0,h=parseInt(c.curCSS(b,"left",true),10)||0;g={top:a.top-g.top+e,left:a.left-g.left+h};"using"in a?a.using.call(b,g):d.css(g)};c.fn.offset=function(b){var a=this[0];if(!a||!a.ownerDocument)return null;if(b)return this.each(function(){c.offset.setOffset(this,b)});return u.call(this)}}})(jQuery);
+;/*
+ * Note: While Microsoft is not the author of this file, Microsoft is
+ * offering you a license subject to the terms of the Microsoft Software
+ * License Terms for Microsoft ASP.NET Model View Controller 3.
+ * Microsoft reserves all other rights. The notices below are provided
+ * for informational purposes only and are not the license terms under
+ * which Microsoft distributed this file.
+ *
+ * jQuery UI Draggable 1.8.11
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ *
+ * http://docs.jquery.com/UI/Draggables
+ *
+ * Depends:
+ * jquery.ui.core.js
+ * jquery.ui.mouse.js
+ * jquery.ui.widget.js
+ */
+(function(d){d.widget("ui.draggable",d.ui.mouse,{widgetEventPrefix:"drag",options:{addClasses:true,appendTo:"parent",axis:false,connectToSortable:false,containment:false,cursor:"auto",cursorAt:false,grid:false,handle:false,helper:"original",iframeFix:false,opacity:false,refreshPositions:false,revert:false,revertDuration:500,scope:"default",scroll:true,scrollSensitivity:20,scrollSpeed:20,snap:false,snapMode:"both",snapTolerance:20,stack:false,zIndex:false},_create:function(){if(this.options.helper==
+"original"&&!/^(?:r|a|f)/.test(this.element.css("position")))this.element[0].style.position="relative";this.options.addClasses&&this.element.addClass("ui-draggable");this.options.disabled&&this.element.addClass("ui-draggable-disabled");this._mouseInit()},destroy:function(){if(this.element.data("draggable")){this.element.removeData("draggable").unbind(".draggable").removeClass("ui-draggable ui-draggable-dragging ui-draggable-disabled");this._mouseDestroy();return this}},_mouseCapture:function(a){var b=
+this.options;if(this.helper||b.disabled||d(a.target).is(".ui-resizable-handle"))return false;this.handle=this._getHandle(a);if(!this.handle)return false;return true},_mouseStart:function(a){var b=this.options;this.helper=this._createHelper(a);this._cacheHelperProportions();if(d.ui.ddmanager)d.ui.ddmanager.current=this;this._cacheMargins();this.cssPosition=this.helper.css("position");this.scrollParent=this.helper.scrollParent();this.offset=this.positionAbs=this.element.offset();this.offset={top:this.offset.top-
+this.margins.top,left:this.offset.left-this.margins.left};d.extend(this.offset,{click:{left:a.pageX-this.offset.left,top:a.pageY-this.offset.top},parent:this._getParentOffset(),relative:this._getRelativeOffset()});this.originalPosition=this.position=this._generatePosition(a);this.originalPageX=a.pageX;this.originalPageY=a.pageY;b.cursorAt&&this._adjustOffsetFromHelper(b.cursorAt);b.containment&&this._setContainment();if(this._trigger("start",a)===false){this._clear();return false}this._cacheHelperProportions();
+d.ui.ddmanager&&!b.dropBehaviour&&d.ui.ddmanager.prepareOffsets(this,a);this.helper.addClass("ui-draggable-dragging");this._mouseDrag(a,true);return true},_mouseDrag:function(a,b){this.position=this._generatePosition(a);this.positionAbs=this._convertPositionTo("absolute");if(!b){b=this._uiHash();if(this._trigger("drag",a,b)===false){this._mouseUp({});return false}this.position=b.position}if(!this.options.axis||this.options.axis!="y")this.helper[0].style.left=this.position.left+"px";if(!this.options.axis||
+this.options.axis!="x")this.helper[0].style.top=this.position.top+"px";d.ui.ddmanager&&d.ui.ddmanager.drag(this,a);return false},_mouseStop:function(a){var b=false;if(d.ui.ddmanager&&!this.options.dropBehaviour)b=d.ui.ddmanager.drop(this,a);if(this.dropped){b=this.dropped;this.dropped=false}if((!this.element[0]||!this.element[0].parentNode)&&this.options.helper=="original")return false;if(this.options.revert=="invalid"&&!b||this.options.revert=="valid"&&b||this.options.revert===true||d.isFunction(this.options.revert)&&
+this.options.revert.call(this.element,b)){var c=this;d(this.helper).animate(this.originalPosition,parseInt(this.options.revertDuration,10),function(){c._trigger("stop",a)!==false&&c._clear()})}else this._trigger("stop",a)!==false&&this._clear();return false},cancel:function(){this.helper.is(".ui-draggable-dragging")?this._mouseUp({}):this._clear();return this},_getHandle:function(a){var b=!this.options.handle||!d(this.options.handle,this.element).length?true:false;d(this.options.handle,this.element).find("*").andSelf().each(function(){if(this==
+a.target)b=true});return b},_createHelper:function(a){var b=this.options;a=d.isFunction(b.helper)?d(b.helper.apply(this.element[0],[a])):b.helper=="clone"?this.element.clone():this.element;a.parents("body").length||a.appendTo(b.appendTo=="parent"?this.element[0].parentNode:b.appendTo);a[0]!=this.element[0]&&!/(fixed|absolute)/.test(a.css("position"))&&a.css("position","absolute");return a},_adjustOffsetFromHelper:function(a){if(typeof a=="string")a=a.split(" ");if(d.isArray(a))a={left:+a[0],top:+a[1]||
+0};if("left"in a)this.offset.click.left=a.left+this.margins.left;if("right"in a)this.offset.click.left=this.helperProportions.width-a.right+this.margins.left;if("top"in a)this.offset.click.top=a.top+this.margins.top;if("bottom"in a)this.offset.click.top=this.helperProportions.height-a.bottom+this.margins.top},_getParentOffset:function(){this.offsetParent=this.helper.offsetParent();var a=this.offsetParent.offset();if(this.cssPosition=="absolute"&&this.scrollParent[0]!=document&&d.ui.contains(this.scrollParent[0],
+this.offsetParent[0])){a.left+=this.scrollParent.scrollLeft();a.top+=this.scrollParent.scrollTop()}if(this.offsetParent[0]==document.body||this.offsetParent[0].tagName&&this.offsetParent[0].tagName.toLowerCase()=="html"&&d.browser.msie)a={top:0,left:0};return{top:a.top+(parseInt(this.offsetParent.css("borderTopWidth"),10)||0),left:a.left+(parseInt(this.offsetParent.css("borderLeftWidth"),10)||0)}},_getRelativeOffset:function(){if(this.cssPosition=="relative"){var a=this.element.position();return{top:a.top-
+(parseInt(this.helper.css("top"),10)||0)+this.scrollParent.scrollTop(),left:a.left-(parseInt(this.helper.css("left"),10)||0)+this.scrollParent.scrollLeft()}}else return{top:0,left:0}},_cacheMargins:function(){this.margins={left:parseInt(this.element.css("marginLeft"),10)||0,top:parseInt(this.element.css("marginTop"),10)||0,right:parseInt(this.element.css("marginRight"),10)||0,bottom:parseInt(this.element.css("marginBottom"),10)||0}},_cacheHelperProportions:function(){this.helperProportions={width:this.helper.outerWidth(),
+height:this.helper.outerHeight()}},_setContainment:function(){var a=this.options;if(a.containment=="parent")a.containment=this.helper[0].parentNode;if(a.containment=="document"||a.containment=="window")this.containment=[(a.containment=="document"?0:d(window).scrollLeft())-this.offset.relative.left-this.offset.parent.left,(a.containment=="document"?0:d(window).scrollTop())-this.offset.relative.top-this.offset.parent.top,(a.containment=="document"?0:d(window).scrollLeft())+d(a.containment=="document"?
+document:window).width()-this.helperProportions.width-this.margins.left,(a.containment=="document"?0:d(window).scrollTop())+(d(a.containment=="document"?document:window).height()||document.body.parentNode.scrollHeight)-this.helperProportions.height-this.margins.top];if(!/^(document|window|parent)$/.test(a.containment)&&a.containment.constructor!=Array){var b=d(a.containment)[0];if(b){a=d(a.containment).offset();var c=d(b).css("overflow")!="hidden";this.containment=[a.left+(parseInt(d(b).css("borderLeftWidth"),
+10)||0)+(parseInt(d(b).css("paddingLeft"),10)||0),a.top+(parseInt(d(b).css("borderTopWidth"),10)||0)+(parseInt(d(b).css("paddingTop"),10)||0),a.left+(c?Math.max(b.scrollWidth,b.offsetWidth):b.offsetWidth)-(parseInt(d(b).css("borderLeftWidth"),10)||0)-(parseInt(d(b).css("paddingRight"),10)||0)-this.helperProportions.width-this.margins.left-this.margins.right,a.top+(c?Math.max(b.scrollHeight,b.offsetHeight):b.offsetHeight)-(parseInt(d(b).css("borderTopWidth"),10)||0)-(parseInt(d(b).css("paddingBottom"),
+10)||0)-this.helperProportions.height-this.margins.top-this.margins.bottom]}}else if(a.containment.constructor==Array)this.containment=a.containment},_convertPositionTo:function(a,b){if(!b)b=this.position;a=a=="absolute"?1:-1;var c=this.cssPosition=="absolute"&&!(this.scrollParent[0]!=document&&d.ui.contains(this.scrollParent[0],this.offsetParent[0]))?this.offsetParent:this.scrollParent,f=/(html|body)/i.test(c[0].tagName);return{top:b.top+this.offset.relative.top*a+this.offset.parent.top*a-(d.browser.safari&&
+d.browser.version<526&&this.cssPosition=="fixed"?0:(this.cssPosition=="fixed"?-this.scrollParent.scrollTop():f?0:c.scrollTop())*a),left:b.left+this.offset.relative.left*a+this.offset.parent.left*a-(d.browser.safari&&d.browser.version<526&&this.cssPosition=="fixed"?0:(this.cssPosition=="fixed"?-this.scrollParent.scrollLeft():f?0:c.scrollLeft())*a)}},_generatePosition:function(a){var b=this.options,c=this.cssPosition=="absolute"&&!(this.scrollParent[0]!=document&&d.ui.contains(this.scrollParent[0],
+this.offsetParent[0]))?this.offsetParent:this.scrollParent,f=/(html|body)/i.test(c[0].tagName),e=a.pageX,g=a.pageY;if(this.originalPosition){if(this.containment){if(a.pageX-this.offset.click.leftthis.containment[2])e=this.containment[2]+this.offset.click.left;if(a.pageY-this.offset.click.top>this.containment[3])g=
+this.containment[3]+this.offset.click.top}if(b.grid){g=this.originalPageY+Math.round((g-this.originalPageY)/b.grid[1])*b.grid[1];g=this.containment?!(g-this.offset.click.topthis.containment[3])?g:!(g-this.offset.click.topthis.containment[2])?
+e:!(e-this.offset.click.left').css({width:this.offsetWidth+
+"px",height:this.offsetHeight+"px",position:"absolute",opacity:"0.001",zIndex:1E3}).css(d(this).offset()).appendTo("body")})},stop:function(){d("div.ui-draggable-iframeFix").each(function(){this.parentNode.removeChild(this)})}});d.ui.plugin.add("draggable","opacity",{start:function(a,b){a=d(b.helper);b=d(this).data("draggable").options;if(a.css("opacity"))b._opacity=a.css("opacity");a.css("opacity",b.opacity)},stop:function(a,b){a=d(this).data("draggable").options;a._opacity&&d(b.helper).css("opacity",
+a._opacity)}});d.ui.plugin.add("draggable","scroll",{start:function(){var a=d(this).data("draggable");if(a.scrollParent[0]!=document&&a.scrollParent[0].tagName!="HTML")a.overflowOffset=a.scrollParent.offset()},drag:function(a){var b=d(this).data("draggable"),c=b.options,f=false;if(b.scrollParent[0]!=document&&b.scrollParent[0].tagName!="HTML"){if(!c.axis||c.axis!="x")if(b.overflowOffset.top+b.scrollParent[0].offsetHeight-a.pageY=0;h--){var i=c.snapElements[h].left,k=i+c.snapElements[h].width,j=c.snapElements[h].top,l=j+c.snapElements[h].height;if(i-e=j&&f<=l||h>=j&&h<=l||fl)&&(e>=
+i&&e<=k||g>=i&&g<=k||ek);default:return false}};d.ui.ddmanager={current:null,droppables:{"default":[]},prepareOffsets:function(a,b){var c=d.ui.ddmanager.droppables[a.options.scope]||[],e=b?b.type:null,g=(a.currentItem||a.element).find(":data(droppable)").andSelf(),f=0;a:for(;f').css({position:this.element.css("position"),width:this.element.outerWidth(),height:this.element.outerHeight(),
+top:this.element.css("top"),left:this.element.css("left")}));this.element=this.element.parent().data("resizable",this.element.data("resizable"));this.elementIsWrapper=true;this.element.css({marginLeft:this.originalElement.css("marginLeft"),marginTop:this.originalElement.css("marginTop"),marginRight:this.originalElement.css("marginRight"),marginBottom:this.originalElement.css("marginBottom")});this.originalElement.css({marginLeft:0,marginTop:0,marginRight:0,marginBottom:0});this.originalResizeStyle=
+this.originalElement.css("resize");this.originalElement.css("resize","none");this._proportionallyResizeElements.push(this.originalElement.css({position:"static",zoom:1,display:"block"}));this.originalElement.css({margin:this.originalElement.css("margin")});this._proportionallyResize()}this.handles=a.handles||(!e(".ui-resizable-handle",this.element).length?"e,s,se":{n:".ui-resizable-n",e:".ui-resizable-e",s:".ui-resizable-s",w:".ui-resizable-w",se:".ui-resizable-se",sw:".ui-resizable-sw",ne:".ui-resizable-ne",
+nw:".ui-resizable-nw"});if(this.handles.constructor==String){if(this.handles=="all")this.handles="n,e,s,w,se,sw,ne,nw";var c=this.handles.split(",");this.handles={};for(var d=0;d');/sw|se|ne|nw/.test(f)&&g.css({zIndex:++a.zIndex});"se"==f&&g.addClass("ui-icon ui-icon-gripsmall-diagonal-se");this.handles[f]=".ui-resizable-"+f;this.element.append(g)}}this._renderAxis=function(h){h=h||this.element;for(var i in this.handles){if(this.handles[i].constructor==
+String)this.handles[i]=e(this.handles[i],this.element).show();if(this.elementIsWrapper&&this.originalElement[0].nodeName.match(/textarea|input|select|button/i)){var j=e(this.handles[i],this.element),k=0;k=/sw|ne|nw|se|n|s/.test(i)?j.outerHeight():j.outerWidth();j=["padding",/ne|nw|n/.test(i)?"Top":/se|sw|s/.test(i)?"Bottom":/^e$/.test(i)?"Right":"Left"].join("");h.css(j,k);this._proportionallyResize()}e(this.handles[i])}};this._renderAxis(this.element);this._handles=e(".ui-resizable-handle",this.element).disableSelection();
+this._handles.mouseover(function(){if(!b.resizing){if(this.className)var h=this.className.match(/ui-resizable-(se|sw|ne|nw|n|e|s|w)/i);b.axis=h&&h[1]?h[1]:"se"}});if(a.autoHide){this._handles.hide();e(this.element).addClass("ui-resizable-autohide").hover(function(){e(this).removeClass("ui-resizable-autohide");b._handles.show()},function(){if(!b.resizing){e(this).addClass("ui-resizable-autohide");b._handles.hide()}})}this._mouseInit()},destroy:function(){this._mouseDestroy();var b=function(c){e(c).removeClass("ui-resizable ui-resizable-disabled ui-resizable-resizing").removeData("resizable").unbind(".resizable").find(".ui-resizable-handle").remove()};
+if(this.elementIsWrapper){b(this.element);var a=this.element;a.after(this.originalElement.css({position:a.css("position"),width:a.outerWidth(),height:a.outerHeight(),top:a.css("top"),left:a.css("left")})).remove()}this.originalElement.css("resize",this.originalResizeStyle);b(this.originalElement);return this},_mouseCapture:function(b){var a=false;for(var c in this.handles)if(e(this.handles[c])[0]==b.target)a=true;return!this.options.disabled&&a},_mouseStart:function(b){var a=this.options,c=this.element.position(),
+d=this.element;this.resizing=true;this.documentScroll={top:e(document).scrollTop(),left:e(document).scrollLeft()};if(d.is(".ui-draggable")||/absolute/.test(d.css("position")))d.css({position:"absolute",top:c.top,left:c.left});e.browser.opera&&/relative/.test(d.css("position"))&&d.css({position:"relative",top:"auto",left:"auto"});this._renderProxy();c=m(this.helper.css("left"));var f=m(this.helper.css("top"));if(a.containment){c+=e(a.containment).scrollLeft()||0;f+=e(a.containment).scrollTop()||0}this.offset=
+this.helper.offset();this.position={left:c,top:f};this.size=this._helper?{width:d.outerWidth(),height:d.outerHeight()}:{width:d.width(),height:d.height()};this.originalSize=this._helper?{width:d.outerWidth(),height:d.outerHeight()}:{width:d.width(),height:d.height()};this.originalPosition={left:c,top:f};this.sizeDiff={width:d.outerWidth()-d.width(),height:d.outerHeight()-d.height()};this.originalMousePosition={left:b.pageX,top:b.pageY};this.aspectRatio=typeof a.aspectRatio=="number"?a.aspectRatio:
+this.originalSize.width/this.originalSize.height||1;a=e(".ui-resizable-"+this.axis).css("cursor");e("body").css("cursor",a=="auto"?this.axis+"-resize":a);d.addClass("ui-resizable-resizing");this._propagate("start",b);return true},_mouseDrag:function(b){var a=this.helper,c=this.originalMousePosition,d=this._change[this.axis];if(!d)return false;c=d.apply(this,[b,b.pageX-c.left||0,b.pageY-c.top||0]);if(this._aspectRatio||b.shiftKey)c=this._updateRatio(c,b);c=this._respectSize(c,b);this._propagate("resize",
+b);a.css({top:this.position.top+"px",left:this.position.left+"px",width:this.size.width+"px",height:this.size.height+"px"});!this._helper&&this._proportionallyResizeElements.length&&this._proportionallyResize();this._updateCache(c);this._trigger("resize",b,this.ui());return false},_mouseStop:function(b){this.resizing=false;var a=this.options,c=this;if(this._helper){var d=this._proportionallyResizeElements,f=d.length&&/textarea/i.test(d[0].nodeName);d=f&&e.ui.hasScroll(d[0],"left")?0:c.sizeDiff.height;
+f=f?0:c.sizeDiff.width;f={width:c.helper.width()-f,height:c.helper.height()-d};d=parseInt(c.element.css("left"),10)+(c.position.left-c.originalPosition.left)||null;var g=parseInt(c.element.css("top"),10)+(c.position.top-c.originalPosition.top)||null;a.animate||this.element.css(e.extend(f,{top:g,left:d}));c.helper.height(c.size.height);c.helper.width(c.size.width);this._helper&&!a.animate&&this._proportionallyResize()}e("body").css("cursor","auto");this.element.removeClass("ui-resizable-resizing");
+this._propagate("stop",b);this._helper&&this.helper.remove();return false},_updateCache:function(b){this.offset=this.helper.offset();if(l(b.left))this.position.left=b.left;if(l(b.top))this.position.top=b.top;if(l(b.height))this.size.height=b.height;if(l(b.width))this.size.width=b.width},_updateRatio:function(b){var a=this.position,c=this.size,d=this.axis;if(b.height)b.width=c.height*this.aspectRatio;else if(b.width)b.height=c.width/this.aspectRatio;if(d=="sw"){b.left=a.left+(c.width-b.width);b.top=
+null}if(d=="nw"){b.top=a.top+(c.height-b.height);b.left=a.left+(c.width-b.width)}return b},_respectSize:function(b){var a=this.options,c=this.axis,d=l(b.width)&&a.maxWidth&&a.maxWidthb.width,h=l(b.height)&&a.minHeight&&a.minHeight>b.height;if(g)b.width=a.minWidth;if(h)b.height=a.minHeight;if(d)b.width=a.maxWidth;if(f)b.height=a.maxHeight;var i=this.originalPosition.left+this.originalSize.width,j=this.position.top+
+this.size.height,k=/sw|nw|w/.test(c);c=/nw|ne|n/.test(c);if(g&&k)b.left=i-a.minWidth;if(d&&k)b.left=i-a.maxWidth;if(h&&c)b.top=j-a.minHeight;if(f&&c)b.top=j-a.maxHeight;if((a=!b.width&&!b.height)&&!b.left&&b.top)b.top=null;else if(a&&!b.top&&b.left)b.left=null;return b},_proportionallyResize:function(){if(this._proportionallyResizeElements.length)for(var b=this.helper||this.element,a=0;a');var a=e.browser.msie&&e.browser.version<7,c=a?1:0;a=a?2:-1;this.helper.addClass(this._helper).css({width:this.element.outerWidth()+a,height:this.element.outerHeight()+a,position:"absolute",left:this.elementOffset.left-c+"px",top:this.elementOffset.top-c+"px",zIndex:++b.zIndex});this.helper.appendTo("body").disableSelection()}else this.helper=this.element},_change:{e:function(b,
+a){return{width:this.originalSize.width+a}},w:function(b,a){return{left:this.originalPosition.left+a,width:this.originalSize.width-a}},n:function(b,a,c){return{top:this.originalPosition.top+c,height:this.originalSize.height-c}},s:function(b,a,c){return{height:this.originalSize.height+c}},se:function(b,a,c){return e.extend(this._change.s.apply(this,arguments),this._change.e.apply(this,[b,a,c]))},sw:function(b,a,c){return e.extend(this._change.s.apply(this,arguments),this._change.w.apply(this,[b,a,
+c]))},ne:function(b,a,c){return e.extend(this._change.n.apply(this,arguments),this._change.e.apply(this,[b,a,c]))},nw:function(b,a,c){return e.extend(this._change.n.apply(this,arguments),this._change.w.apply(this,[b,a,c]))}},_propagate:function(b,a){e.ui.plugin.call(this,b,[a,this.ui()]);b!="resize"&&this._trigger(b,a,this.ui())},plugins:{},ui:function(){return{originalElement:this.originalElement,element:this.element,helper:this.helper,position:this.position,size:this.size,originalSize:this.originalSize,
+originalPosition:this.originalPosition}}});e.extend(e.ui.resizable,{version:"1.8.11"});e.ui.plugin.add("resizable","alsoResize",{start:function(){var b=e(this).data("resizable").options,a=function(c){e(c).each(function(){var d=e(this);d.data("resizable-alsoresize",{width:parseInt(d.width(),10),height:parseInt(d.height(),10),left:parseInt(d.css("left"),10),top:parseInt(d.css("top"),10),position:d.css("position")})})};if(typeof b.alsoResize=="object"&&!b.alsoResize.parentNode)if(b.alsoResize.length){b.alsoResize=
+b.alsoResize[0];a(b.alsoResize)}else e.each(b.alsoResize,function(c){a(c)});else a(b.alsoResize)},resize:function(b,a){var c=e(this).data("resizable");b=c.options;var d=c.originalSize,f=c.originalPosition,g={height:c.size.height-d.height||0,width:c.size.width-d.width||0,top:c.position.top-f.top||0,left:c.position.left-f.left||0},h=function(i,j){e(i).each(function(){var k=e(this),q=e(this).data("resizable-alsoresize"),p={},r=j&&j.length?j:k.parents(a.originalElement[0]).length?["width","height"]:["width",
+"height","top","left"];e.each(r,function(n,o){if((n=(q[o]||0)+(g[o]||0))&&n>=0)p[o]=n||null});if(e.browser.opera&&/relative/.test(k.css("position"))){c._revertToRelativePosition=true;k.css({position:"absolute",top:"auto",left:"auto"})}k.css(p)})};typeof b.alsoResize=="object"&&!b.alsoResize.nodeType?e.each(b.alsoResize,function(i,j){h(i,j)}):h(b.alsoResize)},stop:function(){var b=e(this).data("resizable"),a=b.options,c=function(d){e(d).each(function(){var f=e(this);f.css({position:f.data("resizable-alsoresize").position})})};
+if(b._revertToRelativePosition){b._revertToRelativePosition=false;typeof a.alsoResize=="object"&&!a.alsoResize.nodeType?e.each(a.alsoResize,function(d){c(d)}):c(a.alsoResize)}e(this).removeData("resizable-alsoresize")}});e.ui.plugin.add("resizable","animate",{stop:function(b){var a=e(this).data("resizable"),c=a.options,d=a._proportionallyResizeElements,f=d.length&&/textarea/i.test(d[0].nodeName),g=f&&e.ui.hasScroll(d[0],"left")?0:a.sizeDiff.height;f={width:a.size.width-(f?0:a.sizeDiff.width),height:a.size.height-
+g};g=parseInt(a.element.css("left"),10)+(a.position.left-a.originalPosition.left)||null;var h=parseInt(a.element.css("top"),10)+(a.position.top-a.originalPosition.top)||null;a.element.animate(e.extend(f,h&&g?{top:h,left:g}:{}),{duration:c.animateDuration,easing:c.animateEasing,step:function(){var i={width:parseInt(a.element.css("width"),10),height:parseInt(a.element.css("height"),10),top:parseInt(a.element.css("top"),10),left:parseInt(a.element.css("left"),10)};d&&d.length&&e(d[0]).css({width:i.width,
+height:i.height});a._updateCache(i);a._propagate("resize",b)}})}});e.ui.plugin.add("resizable","containment",{start:function(){var b=e(this).data("resizable"),a=b.element,c=b.options.containment;if(a=c instanceof e?c.get(0):/parent/.test(c)?a.parent().get(0):c){b.containerElement=e(a);if(/document/.test(c)||c==document){b.containerOffset={left:0,top:0};b.containerPosition={left:0,top:0};b.parentData={element:e(document),left:0,top:0,width:e(document).width(),height:e(document).height()||document.body.parentNode.scrollHeight}}else{var d=
+e(a),f=[];e(["Top","Right","Left","Bottom"]).each(function(i,j){f[i]=m(d.css("padding"+j))});b.containerOffset=d.offset();b.containerPosition=d.position();b.containerSize={height:d.innerHeight()-f[3],width:d.innerWidth()-f[1]};c=b.containerOffset;var g=b.containerSize.height,h=b.containerSize.width;h=e.ui.hasScroll(a,"left")?a.scrollWidth:h;g=e.ui.hasScroll(a)?a.scrollHeight:g;b.parentData={element:a,left:c.left,top:c.top,width:h,height:g}}}},resize:function(b){var a=e(this).data("resizable"),c=a.options,
+d=a.containerOffset,f=a.position;b=a._aspectRatio||b.shiftKey;var g={top:0,left:0},h=a.containerElement;if(h[0]!=document&&/static/.test(h.css("position")))g=d;if(f.left<(a._helper?d.left:0)){a.size.width+=a._helper?a.position.left-d.left:a.position.left-g.left;if(b)a.size.height=a.size.width/c.aspectRatio;a.position.left=c.helper?d.left:0}if(f.top<(a._helper?d.top:0)){a.size.height+=a._helper?a.position.top-d.top:a.position.top;if(b)a.size.width=a.size.height*c.aspectRatio;a.position.top=a._helper?
+d.top:0}a.offset.left=a.parentData.left+a.position.left;a.offset.top=a.parentData.top+a.position.top;c=Math.abs((a._helper?a.offset.left-g.left:a.offset.left-g.left)+a.sizeDiff.width);d=Math.abs((a._helper?a.offset.top-g.top:a.offset.top-d.top)+a.sizeDiff.height);f=a.containerElement.get(0)==a.element.parent().get(0);g=/relative|absolute/.test(a.containerElement.css("position"));if(f&&g)c-=a.parentData.left;if(c+a.size.width>=a.parentData.width){a.size.width=a.parentData.width-c;if(b)a.size.height=
+a.size.width/a.aspectRatio}if(d+a.size.height>=a.parentData.height){a.size.height=a.parentData.height-d;if(b)a.size.width=a.size.height*a.aspectRatio}},stop:function(){var b=e(this).data("resizable"),a=b.options,c=b.containerOffset,d=b.containerPosition,f=b.containerElement,g=e(b.helper),h=g.offset(),i=g.outerWidth()-b.sizeDiff.width;g=g.outerHeight()-b.sizeDiff.height;b._helper&&!a.animate&&/relative/.test(f.css("position"))&&e(this).css({left:h.left-d.left-c.left,width:i,height:g});b._helper&&!a.animate&&
+/static/.test(f.css("position"))&&e(this).css({left:h.left-d.left-c.left,width:i,height:g})}});e.ui.plugin.add("resizable","ghost",{start:function(){var b=e(this).data("resizable"),a=b.options,c=b.size;b.ghost=b.originalElement.clone();b.ghost.css({opacity:0.25,display:"block",position:"relative",height:c.height,width:c.width,margin:0,left:0,top:0}).addClass("ui-resizable-ghost").addClass(typeof a.ghost=="string"?a.ghost:"");b.ghost.appendTo(b.helper)},resize:function(){var b=e(this).data("resizable");
+b.ghost&&b.ghost.css({position:"relative",height:b.size.height,width:b.size.width})},stop:function(){var b=e(this).data("resizable");b.ghost&&b.helper&&b.helper.get(0).removeChild(b.ghost.get(0))}});e.ui.plugin.add("resizable","grid",{resize:function(){var b=e(this).data("resizable"),a=b.options,c=b.size,d=b.originalSize,f=b.originalPosition,g=b.axis;a.grid=typeof a.grid=="number"?[a.grid,a.grid]:a.grid;var h=Math.round((c.width-d.width)/(a.grid[0]||1))*(a.grid[0]||1);a=Math.round((c.height-d.height)/
+(a.grid[1]||1))*(a.grid[1]||1);if(/^(se|s|e)$/.test(g)){b.size.width=d.width+h;b.size.height=d.height+a}else if(/^(ne)$/.test(g)){b.size.width=d.width+h;b.size.height=d.height+a;b.position.top=f.top-a}else{if(/^(sw)$/.test(g)){b.size.width=d.width+h;b.size.height=d.height+a}else{b.size.width=d.width+h;b.size.height=d.height+a;b.position.top=f.top-a}b.position.left=f.left-h}}});var m=function(b){return parseInt(b,10)||0},l=function(b){return!isNaN(parseInt(b,10))}})(jQuery);
+;/*
+ * Note: While Microsoft is not the author of this file, Microsoft is
+ * offering you a license subject to the terms of the Microsoft Software
+ * License Terms for Microsoft ASP.NET Model View Controller 3.
+ * Microsoft reserves all other rights. The notices below are provided
+ * for informational purposes only and are not the license terms under
+ * which Microsoft distributed this file.
+ *
+ * jQuery UI Selectable 1.8.11
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ *
+ * http://docs.jquery.com/UI/Selectables
+ *
+ * Depends:
+ * jquery.ui.core.js
+ * jquery.ui.mouse.js
+ * jquery.ui.widget.js
+ */
+(function(e){e.widget("ui.selectable",e.ui.mouse,{options:{appendTo:"body",autoRefresh:true,distance:0,filter:"*",tolerance:"touch"},_create:function(){var c=this;this.element.addClass("ui-selectable");this.dragged=false;var f;this.refresh=function(){f=e(c.options.filter,c.element[0]);f.each(function(){var d=e(this),b=d.offset();e.data(this,"selectable-item",{element:this,$element:d,left:b.left,top:b.top,right:b.left+d.outerWidth(),bottom:b.top+d.outerHeight(),startselected:false,selected:d.hasClass("ui-selected"),
+selecting:d.hasClass("ui-selecting"),unselecting:d.hasClass("ui-unselecting")})})};this.refresh();this.selectees=f.addClass("ui-selectee");this._mouseInit();this.helper=e("
")},destroy:function(){this.selectees.removeClass("ui-selectee").removeData("selectable-item");this.element.removeClass("ui-selectable ui-selectable-disabled").removeData("selectable").unbind(".selectable");this._mouseDestroy();return this},_mouseStart:function(c){var f=this;this.opos=[c.pageX,
+c.pageY];if(!this.options.disabled){var d=this.options;this.selectees=e(d.filter,this.element[0]);this._trigger("start",c);e(d.appendTo).append(this.helper);this.helper.css({left:c.clientX,top:c.clientY,width:0,height:0});d.autoRefresh&&this.refresh();this.selectees.filter(".ui-selected").each(function(){var b=e.data(this,"selectable-item");b.startselected=true;if(!c.metaKey){b.$element.removeClass("ui-selected");b.selected=false;b.$element.addClass("ui-unselecting");b.unselecting=true;f._trigger("unselecting",
+c,{unselecting:b.element})}});e(c.target).parents().andSelf().each(function(){var b=e.data(this,"selectable-item");if(b){var g=!c.metaKey||!b.$element.hasClass("ui-selected");b.$element.removeClass(g?"ui-unselecting":"ui-selected").addClass(g?"ui-selecting":"ui-unselecting");b.unselecting=!g;b.selecting=g;(b.selected=g)?f._trigger("selecting",c,{selecting:b.element}):f._trigger("unselecting",c,{unselecting:b.element});return false}})}},_mouseDrag:function(c){var f=this;this.dragged=true;if(!this.options.disabled){var d=
+this.options,b=this.opos[0],g=this.opos[1],h=c.pageX,i=c.pageY;if(b>h){var j=h;h=b;b=j}if(g>i){j=i;i=g;g=j}this.helper.css({left:b,top:g,width:h-b,height:i-g});this.selectees.each(function(){var a=e.data(this,"selectable-item");if(!(!a||a.element==f.element[0])){var k=false;if(d.tolerance=="touch")k=!(a.left>h||a.righti||a.bottomb&&a.rightg&&a.bottom *",opacity:false,placeholder:false,revert:false,scroll:true,scrollSensitivity:20,scrollSpeed:20,scope:"default",tolerance:"intersect",zIndex:1E3},_create:function(){this.containerCache={};this.element.addClass("ui-sortable");
+this.refresh();this.floating=this.items.length?/left|right/.test(this.items[0].item.css("float"))||/inline|table-cell/.test(this.items[0].item.css("display")):false;this.offset=this.element.offset();this._mouseInit()},destroy:function(){this.element.removeClass("ui-sortable ui-sortable-disabled").removeData("sortable").unbind(".sortable");this._mouseDestroy();for(var a=this.items.length-1;a>=0;a--)this.items[a].item.removeData("sortable-item");return this},_setOption:function(a,b){if(a==="disabled"){this.options[a]=
+b;this.widget()[b?"addClass":"removeClass"]("ui-sortable-disabled")}else d.Widget.prototype._setOption.apply(this,arguments)},_mouseCapture:function(a,b){if(this.reverting)return false;if(this.options.disabled||this.options.type=="static")return false;this._refreshItems(a);var c=null,e=this;d(a.target).parents().each(function(){if(d.data(this,"sortable-item")==e){c=d(this);return false}});if(d.data(a.target,"sortable-item")==e)c=d(a.target);if(!c)return false;if(this.options.handle&&!b){var f=false;
+d(this.options.handle,c).find("*").andSelf().each(function(){if(this==a.target)f=true});if(!f)return false}this.currentItem=c;this._removeCurrentsFromItems();return true},_mouseStart:function(a,b,c){b=this.options;var e=this;this.currentContainer=this;this.refreshPositions();this.helper=this._createHelper(a);this._cacheHelperProportions();this._cacheMargins();this.scrollParent=this.helper.scrollParent();this.offset=this.currentItem.offset();this.offset={top:this.offset.top-this.margins.top,left:this.offset.left-
+this.margins.left};this.helper.css("position","absolute");this.cssPosition=this.helper.css("position");d.extend(this.offset,{click:{left:a.pageX-this.offset.left,top:a.pageY-this.offset.top},parent:this._getParentOffset(),relative:this._getRelativeOffset()});this.originalPosition=this._generatePosition(a);this.originalPageX=a.pageX;this.originalPageY=a.pageY;b.cursorAt&&this._adjustOffsetFromHelper(b.cursorAt);this.domPosition={prev:this.currentItem.prev()[0],parent:this.currentItem.parent()[0]};
+this.helper[0]!=this.currentItem[0]&&this.currentItem.hide();this._createPlaceholder();b.containment&&this._setContainment();if(b.cursor){if(d("body").css("cursor"))this._storedCursor=d("body").css("cursor");d("body").css("cursor",b.cursor)}if(b.opacity){if(this.helper.css("opacity"))this._storedOpacity=this.helper.css("opacity");this.helper.css("opacity",b.opacity)}if(b.zIndex){if(this.helper.css("zIndex"))this._storedZIndex=this.helper.css("zIndex");this.helper.css("zIndex",b.zIndex)}if(this.scrollParent[0]!=
+document&&this.scrollParent[0].tagName!="HTML")this.overflowOffset=this.scrollParent.offset();this._trigger("start",a,this._uiHash());this._preserveHelperProportions||this._cacheHelperProportions();if(!c)for(c=this.containers.length-1;c>=0;c--)this.containers[c]._trigger("activate",a,e._uiHash(this));if(d.ui.ddmanager)d.ui.ddmanager.current=this;d.ui.ddmanager&&!b.dropBehaviour&&d.ui.ddmanager.prepareOffsets(this,a);this.dragging=true;this.helper.addClass("ui-sortable-helper");this._mouseDrag(a);
+return true},_mouseDrag:function(a){this.position=this._generatePosition(a);this.positionAbs=this._convertPositionTo("absolute");if(!this.lastPositionAbs)this.lastPositionAbs=this.positionAbs;if(this.options.scroll){var b=this.options,c=false;if(this.scrollParent[0]!=document&&this.scrollParent[0].tagName!="HTML"){if(this.overflowOffset.top+this.scrollParent[0].offsetHeight-a.pageY=0;b--){c=this.items[b];var e=c.item[0],f=this._intersectsWithPointer(c);if(f)if(e!=this.currentItem[0]&&this.placeholder[f==1?"next":"prev"]()[0]!=e&&!d.ui.contains(this.placeholder[0],e)&&(this.options.type=="semi-dynamic"?!d.ui.contains(this.element[0],
+e):true)){this.direction=f==1?"down":"up";if(this.options.tolerance=="pointer"||this._intersectsWithSides(c))this._rearrange(a,c);else break;this._trigger("change",a,this._uiHash());break}}this._contactContainers(a);d.ui.ddmanager&&d.ui.ddmanager.drag(this,a);this._trigger("sort",a,this._uiHash());this.lastPositionAbs=this.positionAbs;return false},_mouseStop:function(a,b){if(a){d.ui.ddmanager&&!this.options.dropBehaviour&&d.ui.ddmanager.drop(this,a);if(this.options.revert){var c=this;b=c.placeholder.offset();
+c.reverting=true;d(this.helper).animate({left:b.left-this.offset.parent.left-c.margins.left+(this.offsetParent[0]==document.body?0:this.offsetParent[0].scrollLeft),top:b.top-this.offset.parent.top-c.margins.top+(this.offsetParent[0]==document.body?0:this.offsetParent[0].scrollTop)},parseInt(this.options.revert,10)||500,function(){c._clear(a)})}else this._clear(a,b);return false}},cancel:function(){var a=this;if(this.dragging){this._mouseUp({target:null});this.options.helper=="original"?this.currentItem.css(this._storedCSS).removeClass("ui-sortable-helper"):
+this.currentItem.show();for(var b=this.containers.length-1;b>=0;b--){this.containers[b]._trigger("deactivate",null,a._uiHash(this));if(this.containers[b].containerCache.over){this.containers[b]._trigger("out",null,a._uiHash(this));this.containers[b].containerCache.over=0}}}if(this.placeholder){this.placeholder[0].parentNode&&this.placeholder[0].parentNode.removeChild(this.placeholder[0]);this.options.helper!="original"&&this.helper&&this.helper[0].parentNode&&this.helper.remove();d.extend(this,{helper:null,
+dragging:false,reverting:false,_noFinalSort:null});this.domPosition.prev?d(this.domPosition.prev).after(this.currentItem):d(this.domPosition.parent).prepend(this.currentItem)}return this},serialize:function(a){var b=this._getItemsAsjQuery(a&&a.connected),c=[];a=a||{};d(b).each(function(){var e=(d(a.item||this).attr(a.attribute||"id")||"").match(a.expression||/(.+)[-=_](.+)/);if(e)c.push((a.key||e[1]+"[]")+"="+(a.key&&a.expression?e[1]:e[2]))});!c.length&&a.key&&c.push(a.key+"=");return c.join("&")},
+toArray:function(a){var b=this._getItemsAsjQuery(a&&a.connected),c=[];a=a||{};b.each(function(){c.push(d(a.item||this).attr(a.attribute||"id")||"")});return c},_intersectsWith:function(a){var b=this.positionAbs.left,c=b+this.helperProportions.width,e=this.positionAbs.top,f=e+this.helperProportions.height,g=a.left,h=g+a.width,i=a.top,k=i+a.height,j=this.offset.click.top,l=this.offset.click.left;j=e+j>i&&e+jg&&b+la[this.floating?"width":"height"]?j:g0?"down":"up")},_getDragHorizontalDirection:function(){var a=this.positionAbs.left-this.lastPositionAbs.left;return a!=0&&(a>0?"right":"left")},refresh:function(a){this._refreshItems(a);this.refreshPositions();return this},_connectWith:function(){var a=this.options;return a.connectWith.constructor==String?[a.connectWith]:a.connectWith},_getItemsAsjQuery:function(a){var b=[],c=[],e=this._connectWith();
+if(e&&a)for(a=e.length-1;a>=0;a--)for(var f=d(e[a]),g=f.length-1;g>=0;g--){var h=d.data(f[g],"sortable");if(h&&h!=this&&!h.options.disabled)c.push([d.isFunction(h.options.items)?h.options.items.call(h.element):d(h.options.items,h.element).not(".ui-sortable-helper").not(".ui-sortable-placeholder"),h])}c.push([d.isFunction(this.options.items)?this.options.items.call(this.element,null,{options:this.options,item:this.currentItem}):d(this.options.items,this.element).not(".ui-sortable-helper").not(".ui-sortable-placeholder"),
+this]);for(a=c.length-1;a>=0;a--)c[a][0].each(function(){b.push(this)});return d(b)},_removeCurrentsFromItems:function(){for(var a=this.currentItem.find(":data(sortable-item)"),b=0;b=0;f--)for(var g=d(e[f]),h=g.length-1;h>=0;h--){var i=d.data(g[h],"sortable");if(i&&i!=this&&!i.options.disabled){c.push([d.isFunction(i.options.items)?i.options.items.call(i.element[0],a,{item:this.currentItem}):d(i.options.items,i.element),i]);this.containers.push(i)}}for(f=c.length-1;f>=0;f--){a=c[f][1];e=c[f][0];h=0;for(g=e.length;h=0;b--){var c=this.items[b],e=this.options.toleranceElement?d(this.options.toleranceElement,c.item):c.item;if(!a){c.width=e.outerWidth();c.height=e.outerHeight()}e=e.offset();c.left=e.left;c.top=e.top}if(this.options.custom&&this.options.custom.refreshContainers)this.options.custom.refreshContainers.call(this);else for(b=this.containers.length-1;b>=0;b--){e=this.containers[b].element.offset();this.containers[b].containerCache.left=
+e.left;this.containers[b].containerCache.top=e.top;this.containers[b].containerCache.width=this.containers[b].element.outerWidth();this.containers[b].containerCache.height=this.containers[b].element.outerHeight()}return this},_createPlaceholder:function(a){var b=a||this,c=b.options;if(!c.placeholder||c.placeholder.constructor==String){var e=c.placeholder;c.placeholder={element:function(){var f=d(document.createElement(b.currentItem[0].nodeName)).addClass(e||b.currentItem[0].className+" ui-sortable-placeholder").removeClass("ui-sortable-helper")[0];
+if(!e)f.style.visibility="hidden";return f},update:function(f,g){if(!(e&&!c.forcePlaceholderSize)){g.height()||g.height(b.currentItem.innerHeight()-parseInt(b.currentItem.css("paddingTop")||0,10)-parseInt(b.currentItem.css("paddingBottom")||0,10));g.width()||g.width(b.currentItem.innerWidth()-parseInt(b.currentItem.css("paddingLeft")||0,10)-parseInt(b.currentItem.css("paddingRight")||0,10))}}}}b.placeholder=d(c.placeholder.element.call(b.element,b.currentItem));b.currentItem.after(b.placeholder);
+c.placeholder.update(b,b.placeholder)},_contactContainers:function(a){for(var b=null,c=null,e=this.containers.length-1;e>=0;e--)if(!d.ui.contains(this.currentItem[0],this.containers[e].element[0]))if(this._intersectsWith(this.containers[e].containerCache)){if(!(b&&d.ui.contains(this.containers[e].element[0],b.element[0]))){b=this.containers[e];c=e}}else if(this.containers[e].containerCache.over){this.containers[e]._trigger("out",a,this._uiHash(this));this.containers[e].containerCache.over=0}if(b)if(this.containers.length===
+1){this.containers[c]._trigger("over",a,this._uiHash(this));this.containers[c].containerCache.over=1}else if(this.currentContainer!=this.containers[c]){b=1E4;e=null;for(var f=this.positionAbs[this.containers[c].floating?"left":"top"],g=this.items.length-1;g>=0;g--)if(d.ui.contains(this.containers[c].element[0],this.items[g].item[0])){var h=this.items[g][this.containers[c].floating?"left":"top"];if(Math.abs(h-f)this.containment[2])f=this.containment[2]+this.offset.click.left;if(a.pageY-this.offset.click.top>this.containment[3])g=this.containment[3]+this.offset.click.top}if(b.grid){g=this.originalPageY+Math.round((g-this.originalPageY)/b.grid[1])*b.grid[1];g=this.containment?!(g-this.offset.click.top<
+this.containment[1]||g-this.offset.click.top>this.containment[3])?g:!(g-this.offset.click.topthis.containment[2])?f:!(f-this.offset.click.left=0;e--)if(d.ui.contains(this.containers[e].element[0],
+this.currentItem[0])&&!b){c.push(function(f){return function(g){f._trigger("receive",g,this._uiHash(this))}}.call(this,this.containers[e]));c.push(function(f){return function(g){f._trigger("update",g,this._uiHash(this))}}.call(this,this.containers[e]))}}for(e=this.containers.length-1;e>=0;e--){b||c.push(function(f){return function(g){f._trigger("deactivate",g,this._uiHash(this))}}.call(this,this.containers[e]));if(this.containers[e].containerCache.over){c.push(function(f){return function(g){f._trigger("out",
+g,this._uiHash(this))}}.call(this,this.containers[e]));this.containers[e].containerCache.over=0}}this._storedCursor&&d("body").css("cursor",this._storedCursor);this._storedOpacity&&this.helper.css("opacity",this._storedOpacity);if(this._storedZIndex)this.helper.css("zIndex",this._storedZIndex=="auto"?"":this._storedZIndex);this.dragging=false;if(this.cancelHelperRemoval){if(!b){this._trigger("beforeStop",a,this._uiHash());for(e=0;e li > :first-child,> :not(li):even",icons:{header:"ui-icon-triangle-1-e",headerSelected:"ui-icon-triangle-1-s"},navigation:false,navigationFilter:function(){return this.href.toLowerCase()===location.href.toLowerCase()}},_create:function(){var a=this,b=a.options;a.running=0;a.element.addClass("ui-accordion ui-widget ui-helper-reset").children("li").addClass("ui-accordion-li-fix");
+a.headers=a.element.find(b.header).addClass("ui-accordion-header ui-helper-reset ui-state-default ui-corner-all").bind("mouseenter.accordion",function(){b.disabled||c(this).addClass("ui-state-hover")}).bind("mouseleave.accordion",function(){b.disabled||c(this).removeClass("ui-state-hover")}).bind("focus.accordion",function(){b.disabled||c(this).addClass("ui-state-focus")}).bind("blur.accordion",function(){b.disabled||c(this).removeClass("ui-state-focus")});a.headers.next().addClass("ui-accordion-content ui-helper-reset ui-widget-content ui-corner-bottom");
+if(b.navigation){var d=a.element.find("a").filter(b.navigationFilter).eq(0);if(d.length){var h=d.closest(".ui-accordion-header");a.active=h.length?h:d.closest(".ui-accordion-content").prev()}}a.active=a._findActive(a.active||b.active).addClass("ui-state-default ui-state-active").toggleClass("ui-corner-all").toggleClass("ui-corner-top");a.active.next().addClass("ui-accordion-content-active");a._createIcons();a.resize();a.element.attr("role","tablist");a.headers.attr("role","tab").bind("keydown.accordion",
+function(f){return a._keydown(f)}).next().attr("role","tabpanel");a.headers.not(a.active||"").attr({"aria-expanded":"false","aria-selected":"false",tabIndex:-1}).next().hide();a.active.length?a.active.attr({"aria-expanded":"true","aria-selected":"true",tabIndex:0}):a.headers.eq(0).attr("tabIndex",0);c.browser.safari||a.headers.find("a").attr("tabIndex",-1);b.event&&a.headers.bind(b.event.split(" ").join(".accordion ")+".accordion",function(f){a._clickHandler.call(a,f,this);f.preventDefault()})},_createIcons:function(){var a=
+this.options;if(a.icons){c("").data("item.autocomplete",b).append(d("").addClass("ui-button-text").html(this.options.label).appendTo(b.empty()).text(),d=this.options.icons,f=d.primary&&d.secondary,e=[];if(d.primary||d.secondary){if(this.options.text)e.push("ui-button-text-icon"+(f?"s":d.primary?"-primary":"-secondary"));d.primary&&b.prepend("
")).appendTo(document.body).hide().addClass("ui-dialog ui-widget ui-widget-content ui-corner-all "+b.dialogClass).css({zIndex:b.zIndex}).attr("tabIndex",
+-1).css("outline",0).keydown(function(i){if(b.closeOnEscape&&i.keyCode&&i.keyCode===c.ui.keyCode.ESCAPE){a.close(i);i.preventDefault()}}).attr({role:"dialog","aria-labelledby":e}).mousedown(function(i){a.moveToTop(false,i)});a.element.show().removeAttr("title").addClass("ui-dialog-content ui-widget-content").appendTo(g);var f=(a.uiDialogTitlebar=c("
")).addClass("ui-dialog-titlebar ui-widget-header ui-corner-all ui-helper-clearfix").prependTo(g),h=c('
").addClass("ui-dialog-buttonpane ui-widget-content ui-helper-clearfix"),g=c("
").addClass("ui-dialog-buttonset").appendTo(e);b.uiDialog.find(".ui-dialog-buttonpane").remove();typeof a==="object"&&a!==null&&c.each(a,function(){return!(d=true)});if(d){c.each(a,function(f,
+h){h=c.isFunction(h)?{click:h,text:f}:h;f=c('").addClass("ui-widget-overlay")).appendTo(document.body).css({width:this.width(),
+height:this.height()});c.fn.bgiframe&&b.bgiframe();this.instances.push(b);return b},destroy:function(a){var b=c.inArray(a,this.instances);b!=-1&&this.oldInstances.push(this.instances.splice(b,1)[0]);this.instances.length===0&&c([document,window]).unbind(".dialog-overlay");a.remove();var d=0;c.each(this.instances,function(){d=Math.max(d,this.css("z-index"))});this.maxZ=d},height:function(){var a,b;if(c.browser.msie&&c.browser.version<7){a=Math.max(document.documentElement.scrollHeight,document.body.scrollHeight);
+b=Math.max(document.documentElement.offsetHeight,document.body.offsetHeight);return a");if(!a.values)a.values=[this._valueMin(),this._valueMin()];if(a.values.length&&a.values.length!==2)a.values=[a.values[0],a.values[0]]}else this.range=d("
");this.range.appendTo(this.element).addClass("ui-slider-range");if(a.range==="min"||a.range==="max")this.range.addClass("ui-slider-range-"+a.range);this.range.addClass("ui-widget-header")}d(".ui-slider-handle",this.element).length===0&&d("").appendTo(this.element).addClass("ui-slider-handle");this.handles=d(".ui-slider-handle",this.element).addClass("ui-state-default ui-corner-all");this.handle=this.handles.eq(0);this.handles.add(this.range).filter("a").click(function(c){c.preventDefault()}).hover(function(){a.disabled||d(this).addClass("ui-state-hover")},function(){d(this).removeClass("ui-state-hover")}).focus(function(){if(a.disabled)d(this).blur();
+else{d(".ui-slider .ui-state-focus").removeClass("ui-state-focus");d(this).addClass("ui-state-focus")}}).blur(function(){d(this).removeClass("ui-state-focus")});this.handles.each(function(c){d(this).data("index.ui-slider-handle",c)});this.handles.keydown(function(c){var e=true,f=d(this).data("index.ui-slider-handle"),h,g,i;if(!b.options.disabled){switch(c.keyCode){case d.ui.keyCode.HOME:case d.ui.keyCode.END:case d.ui.keyCode.PAGE_UP:case d.ui.keyCode.PAGE_DOWN:case d.ui.keyCode.UP:case d.ui.keyCode.RIGHT:case d.ui.keyCode.DOWN:case d.ui.keyCode.LEFT:e=
+false;if(!b._keySliding){b._keySliding=true;d(this).addClass("ui-state-active");h=b._start(c,f);if(h===false)return}break}i=b.options.step;h=b.options.values&&b.options.values.length?(g=b.values(f)):(g=b.value());switch(c.keyCode){case d.ui.keyCode.HOME:g=b._valueMin();break;case d.ui.keyCode.END:g=b._valueMax();break;case d.ui.keyCode.PAGE_UP:g=b._trimAlignValue(h+(b._valueMax()-b._valueMin())/5);break;case d.ui.keyCode.PAGE_DOWN:g=b._trimAlignValue(h-(b._valueMax()-b._valueMin())/5);break;case d.ui.keyCode.UP:case d.ui.keyCode.RIGHT:if(h===
+b._valueMax())return;g=b._trimAlignValue(h+i);break;case d.ui.keyCode.DOWN:case d.ui.keyCode.LEFT:if(h===b._valueMin())return;g=b._trimAlignValue(h-i);break}b._slide(c,f,g);return e}}).keyup(function(c){var e=d(this).data("index.ui-slider-handle");if(b._keySliding){b._keySliding=false;b._stop(c,e);b._change(c,e);d(this).removeClass("ui-state-active")}});this._refreshValue();this._animateOff=false},destroy:function(){this.handles.remove();this.range.remove();this.element.removeClass("ui-slider ui-slider-horizontal ui-slider-vertical ui-slider-disabled ui-widget ui-widget-content ui-corner-all").removeData("slider").unbind(".slider");
+this._mouseDestroy();return this},_mouseCapture:function(b){var a=this.options,c,e,f,h,g;if(a.disabled)return false;this.elementSize={width:this.element.outerWidth(),height:this.element.outerHeight()};this.elementOffset=this.element.offset();c=this._normValueFromMouse({x:b.pageX,y:b.pageY});e=this._valueMax()-this._valueMin()+1;h=this;this.handles.each(function(i){var j=Math.abs(c-h.values(i));if(e>j){e=j;f=d(this);g=i}});if(a.range===true&&this.values(1)===a.min){g+=1;f=d(this.handles[g])}if(this._start(b,
+g)===false)return false;this._mouseSliding=true;h._handleIndex=g;f.addClass("ui-state-active").focus();a=f.offset();this._clickOffset=!d(b.target).parents().andSelf().is(".ui-slider-handle")?{left:0,top:0}:{left:b.pageX-a.left-f.width()/2,top:b.pageY-a.top-f.height()/2-(parseInt(f.css("borderTopWidth"),10)||0)-(parseInt(f.css("borderBottomWidth"),10)||0)+(parseInt(f.css("marginTop"),10)||0)};this.handles.hasClass("ui-state-hover")||this._slide(b,g,c);return this._animateOff=true},_mouseStart:function(){return true},
+_mouseDrag:function(b){var a=this._normValueFromMouse({x:b.pageX,y:b.pageY});this._slide(b,this._handleIndex,a);return false},_mouseStop:function(b){this.handles.removeClass("ui-state-active");this._mouseSliding=false;this._stop(b,this._handleIndex);this._change(b,this._handleIndex);this._clickOffset=this._handleIndex=null;return this._animateOff=false},_detectOrientation:function(){this.orientation=this.options.orientation==="vertical"?"vertical":"horizontal"},_normValueFromMouse:function(b){var a;
+if(this.orientation==="horizontal"){a=this.elementSize.width;b=b.x-this.elementOffset.left-(this._clickOffset?this._clickOffset.left:0)}else{a=this.elementSize.height;b=b.y-this.elementOffset.top-(this._clickOffset?this._clickOffset.top:0)}a=b/a;if(a>1)a=1;if(a<0)a=0;if(this.orientation==="vertical")a=1-a;b=this._valueMax()-this._valueMin();return this._trimAlignValue(this._valueMin()+a*b)},_start:function(b,a){var c={handle:this.handles[a],value:this.value()};if(this.options.values&&this.options.values.length){c.value=
+this.values(a);c.values=this.values()}return this._trigger("start",b,c)},_slide:function(b,a,c){var e;if(this.options.values&&this.options.values.length){e=this.values(a?0:1);if(this.options.values.length===2&&this.options.range===true&&(a===0&&c>e||a===1&&c1){this.options.values[b]=this._trimAlignValue(a);this._refreshValue();this._change(null,b)}if(arguments.length)if(d.isArray(arguments[0])){c=this.options.values;e=arguments[0];for(f=0;f=this._valueMax())return this._valueMax();var a=this.options.step>0?this.options.step:1,c=(b-this._valueMin())%a;alignValue=b-c;if(Math.abs(c)*2>=a)alignValue+=c>0?a:-a;return parseFloat(alignValue.toFixed(5))},_valueMin:function(){return this.options.min},_valueMax:function(){return this.options.max},
+_refreshValue:function(){var b=this.options.range,a=this.options,c=this,e=!this._animateOff?a.animate:false,f,h={},g,i,j,l;if(this.options.values&&this.options.values.length)this.handles.each(function(k){f=(c.values(k)-c._valueMin())/(c._valueMax()-c._valueMin())*100;h[c.orientation==="horizontal"?"left":"bottom"]=f+"%";d(this).stop(1,1)[e?"animate":"css"](h,a.animate);if(c.options.range===true)if(c.orientation==="horizontal"){if(k===0)c.range.stop(1,1)[e?"animate":"css"]({left:f+"%"},a.animate);
+if(k===1)c.range[e?"animate":"css"]({width:f-g+"%"},{queue:false,duration:a.animate})}else{if(k===0)c.range.stop(1,1)[e?"animate":"css"]({bottom:f+"%"},a.animate);if(k===1)c.range[e?"animate":"css"]({height:f-g+"%"},{queue:false,duration:a.animate})}g=f});else{i=this.value();j=this._valueMin();l=this._valueMax();f=l!==j?(i-j)/(l-j)*100:0;h[c.orientation==="horizontal"?"left":"bottom"]=f+"%";this.handle.stop(1,1)[e?"animate":"css"](h,a.animate);if(b==="min"&&this.orientation==="horizontal")this.range.stop(1,
+1)[e?"animate":"css"]({width:f+"%"},a.animate);if(b==="max"&&this.orientation==="horizontal")this.range[e?"animate":"css"]({width:100-f+"%"},{queue:false,duration:a.animate});if(b==="min"&&this.orientation==="vertical")this.range.stop(1,1)[e?"animate":"css"]({height:f+"%"},a.animate);if(b==="max"&&this.orientation==="vertical")this.range[e?"animate":"css"]({height:100-f+"%"},{queue:false,duration:a.animate})}}});d.extend(d.ui.slider,{version:"1.8.11"})})(jQuery);
+;/*
+ * Note: While Microsoft is not the author of this file, Microsoft is
+ * offering you a license subject to the terms of the Microsoft Software
+ * License Terms for Microsoft ASP.NET Model View Controller 3.
+ * Microsoft reserves all other rights. The notices below are provided
+ * for informational purposes only and are not the license terms under
+ * which Microsoft distributed this file.
+ *
+ * jQuery UI Tabs 1.8.11
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ *
+ * http://docs.jquery.com/UI/Tabs
+ *
+ * Depends:
+ * jquery.ui.core.js
+ * jquery.ui.widget.js
+ */
+(function(d,p){function u(){return++v}function w(){return++x}var v=0,x=0;d.widget("ui.tabs",{options:{add:null,ajaxOptions:null,cache:false,cookie:null,collapsible:false,disable:null,disabled:[],enable:null,event:"click",fx:null,idPrefix:"ui-tabs-",load:null,panelTemplate:"
",remove:null,select:null,show:null,spinner:"Loading… ",tabTemplate:"#{label} =b?--h:h});this._tabify();this._trigger("remove",null,this._ui(a.find("a")[0],c[0]));return this},enable:function(b){b=this._getIndex(b);var e=this.options;if(d.inArray(b,e.disabled)!=-1){this.lis.eq(b).removeClass("ui-state-disabled");e.disabled=d.grep(e.disabled,function(a){return a!=b});this._trigger("enable",null,
+this._ui(this.anchors[b],this.panels[b]));return this}},disable:function(b){b=this._getIndex(b);var e=this.options;if(b!=e.selected){this.lis.eq(b).addClass("ui-state-disabled");e.disabled.push(b);e.disabled.sort();this._trigger("disable",null,this._ui(this.anchors[b],this.panels[b]))}return this},select:function(b){b=this._getIndex(b);if(b==-1)if(this.options.collapsible&&this.options.selected!=-1)b=this.options.selected;else return this;this.anchors.eq(b).trigger(this.options.event+".tabs");return this},
+load:function(b){b=this._getIndex(b);var e=this,a=this.options,c=this.anchors.eq(b)[0],h=d.data(c,"load.tabs");this.abort();if(!h||this.element.queue("tabs").length!==0&&d.data(c,"cache.tabs"))this.element.dequeue("tabs");else{this.lis.eq(b).addClass("ui-state-processing");if(a.spinner){var j=d("span",c);j.data("label.tabs",j.html()).html(a.spinner)}this.xhr=d.ajax(d.extend({},a.ajaxOptions,{url:h,success:function(k,n){e.element.find(e._sanitizeSelector(c.hash)).html(k);e._cleanup();a.cache&&d.data(c,
+"cache.tabs",true);e._trigger("load",null,e._ui(e.anchors[b],e.panels[b]));try{a.ajaxOptions.success(k,n)}catch(m){}},error:function(k,n){e._cleanup();e._trigger("load",null,e._ui(e.anchors[b],e.panels[b]));try{a.ajaxOptions.error(k,n,b,c)}catch(m){}}}));e.element.dequeue("tabs");return this}},abort:function(){this.element.queue([]);this.panels.stop(false,true);this.element.queue("tabs",this.element.queue("tabs").splice(-2,2));if(this.xhr){this.xhr.abort();delete this.xhr}this._cleanup();return this},
+url:function(b,e){this.anchors.eq(b).removeData("cache.tabs").data("load.tabs",e);return this},length:function(){return this.anchors.length}});d.extend(d.ui.tabs,{version:"1.8.11"});d.extend(d.ui.tabs.prototype,{rotation:null,rotate:function(b,e){var a=this,c=this.options,h=a._rotate||(a._rotate=function(j){clearTimeout(a.rotation);a.rotation=setTimeout(function(){var k=c.selected;a.select(++k')}function F(a,b){d.extend(a,b);for(var c in b)if(b[c]==
+null||b[c]==A)a[c]=b[c];return a}d.extend(d.ui,{datepicker:{version:"1.8.11"}});var y=(new Date).getTime();d.extend(K.prototype,{markerClassName:"hasDatepicker",log:function(){this.debug&&console.log.apply("",arguments)},_widgetDatepicker:function(){return this.dpDiv},setDefaults:function(a){F(this._defaults,a||{});return this},_attachDatepicker:function(a,b){var c=null;for(var e in this._defaults){var f=a.getAttribute("date:"+e);if(f){c=c||{};try{c[e]=eval(f)}catch(h){c[e]=f}}}e=a.nodeName.toLowerCase();
+f=e=="div"||e=="span";if(!a.id){this.uuid+=1;a.id="dp"+this.uuid}var i=this._newInst(d(a),f);i.settings=d.extend({},b||{},c||{});if(e=="input")this._connectDatepicker(a,i);else f&&this._inlineDatepicker(a,i)},_newInst:function(a,b){return{id:a[0].id.replace(/([^A-Za-z0-9_-])/g,"\\\\$1"),input:a,selectedDay:0,selectedMonth:0,selectedYear:0,drawMonth:0,drawYear:0,inline:b,dpDiv:!b?this.dpDiv:d('
')}},
+_connectDatepicker:function(a,b){var c=d(a);b.append=d([]);b.trigger=d([]);if(!c.hasClass(this.markerClassName)){this._attachments(c,b);c.addClass(this.markerClassName).keydown(this._doKeyDown).keypress(this._doKeyPress).keyup(this._doKeyUp).bind("setData.datepicker",function(e,f,h){b.settings[f]=h}).bind("getData.datepicker",function(e,f){return this._get(b,f)});this._autoSize(b);d.data(a,"datepicker",b)}},_attachments:function(a,b){var c=this._get(b,"appendText"),e=this._get(b,"isRTL");b.append&&
+b.append.remove();if(c){b.append=d(''+c+" ");a[e?"before":"after"](b.append)}a.unbind("focus",this._showDatepicker);b.trigger&&b.trigger.remove();c=this._get(b,"showOn");if(c=="focus"||c=="both")a.focus(this._showDatepicker);if(c=="button"||c=="both"){c=this._get(b,"buttonText");var f=this._get(b,"buttonImage");b.trigger=d(this._get(b,"buttonImageOnly")?d("h){h=f[g].length;i=g}return i};b.setMonth(e(this._get(a,
+c.match(/MM/)?"monthNames":"monthNamesShort")));b.setDate(e(this._get(a,c.match(/DD/)?"dayNames":"dayNamesShort"))+20-b.getDay())}a.input.attr("size",this._formatDate(a,b).length)}},_inlineDatepicker:function(a,b){var c=d(a);if(!c.hasClass(this.markerClassName)){c.addClass(this.markerClassName).append(b.dpDiv).bind("setData.datepicker",function(e,f,h){b.settings[f]=h}).bind("getData.datepicker",function(e,f){return this._get(b,f)});d.data(a,"datepicker",b);this._setDate(b,this._getDefaultDate(b),
+true);this._updateDatepicker(b);this._updateAlternate(b);b.dpDiv.show()}},_dialogDatepicker:function(a,b,c,e,f){a=this._dialogInst;if(!a){this.uuid+=1;this._dialogInput=d('-1}},_doKeyUp:function(a){a=d.datepicker._getInst(a.target);
+if(a.input.val()!=a.lastVal)try{if(d.datepicker.parseDate(d.datepicker._get(a,"dateFormat"),a.input?a.input.val():null,d.datepicker._getFormatConfig(a))){d.datepicker._setDateFromField(a);d.datepicker._updateAlternate(a);d.datepicker._updateDatepicker(a)}}catch(b){d.datepicker.log(b)}return true},_showDatepicker:function(a){a=a.target||a;if(a.nodeName.toLowerCase()!="input")a=d("input",a.parentNode)[0];if(!(d.datepicker._isDisabledDatepicker(a)||d.datepicker._lastInput==a)){var b=d.datepicker._getInst(a);
+d.datepicker._curInst&&d.datepicker._curInst!=b&&d.datepicker._curInst.dpDiv.stop(true,true);var c=d.datepicker._get(b,"beforeShow");F(b.settings,c?c.apply(a,[a,b]):{});b.lastVal=null;d.datepicker._lastInput=a;d.datepicker._setDateFromField(b);if(d.datepicker._inDialog)a.value="";if(!d.datepicker._pos){d.datepicker._pos=d.datepicker._findPos(a);d.datepicker._pos[1]+=a.offsetHeight}var e=false;d(a).parents().each(function(){e|=d(this).css("position")=="fixed";return!e});if(e&&d.browser.opera){d.datepicker._pos[0]-=
+document.documentElement.scrollLeft;d.datepicker._pos[1]-=document.documentElement.scrollTop}c={left:d.datepicker._pos[0],top:d.datepicker._pos[1]};d.datepicker._pos=null;b.dpDiv.empty();b.dpDiv.css({position:"absolute",display:"block",top:"-1000px"});d.datepicker._updateDatepicker(b);c=d.datepicker._checkOffset(b,c,e);b.dpDiv.css({position:d.datepicker._inDialog&&d.blockUI?"static":e?"fixed":"absolute",display:"none",left:c.left+"px",top:c.top+"px"});if(!b.inline){c=d.datepicker._get(b,"showAnim");
+var f=d.datepicker._get(b,"duration"),h=function(){d.datepicker._datepickerShowing=true;var i=b.dpDiv.find("iframe.ui-datepicker-cover");if(i.length){var g=d.datepicker._getBorders(b.dpDiv);i.css({left:-g[0],top:-g[1],width:b.dpDiv.outerWidth(),height:b.dpDiv.outerHeight()})}};b.dpDiv.zIndex(d(a).zIndex()+1);d.effects&&d.effects[c]?b.dpDiv.show(c,d.datepicker._get(b,"showOptions"),f,h):b.dpDiv[c||"show"](c?f:null,h);if(!c||!f)h();b.input.is(":visible")&&!b.input.is(":disabled")&&b.input.focus();d.datepicker._curInst=
+b}}},_updateDatepicker:function(a){var b=this,c=d.datepicker._getBorders(a.dpDiv);a.dpDiv.empty().append(this._generateHTML(a));var e=a.dpDiv.find("iframe.ui-datepicker-cover");e.length&&e.css({left:-c[0],top:-c[1],width:a.dpDiv.outerWidth(),height:a.dpDiv.outerHeight()});a.dpDiv.find("button, .ui-datepicker-prev, .ui-datepicker-next, .ui-datepicker-calendar td a").bind("mouseout",function(){d(this).removeClass("ui-state-hover");this.className.indexOf("ui-datepicker-prev")!=-1&&d(this).removeClass("ui-datepicker-prev-hover");
+this.className.indexOf("ui-datepicker-next")!=-1&&d(this).removeClass("ui-datepicker-next-hover")}).bind("mouseover",function(){if(!b._isDisabledDatepicker(a.inline?a.dpDiv.parent()[0]:a.input[0])){d(this).parents(".ui-datepicker-calendar").find("a").removeClass("ui-state-hover");d(this).addClass("ui-state-hover");this.className.indexOf("ui-datepicker-prev")!=-1&&d(this).addClass("ui-datepicker-prev-hover");this.className.indexOf("ui-datepicker-next")!=-1&&d(this).addClass("ui-datepicker-next-hover")}}).end().find("."+
+this._dayOverClass+" a").trigger("mouseover").end();c=this._getNumberOfMonths(a);e=c[1];e>1?a.dpDiv.addClass("ui-datepicker-multi-"+e).css("width",17*e+"em"):a.dpDiv.removeClass("ui-datepicker-multi-2 ui-datepicker-multi-3 ui-datepicker-multi-4").width("");a.dpDiv[(c[0]!=1||c[1]!=1?"add":"remove")+"Class"]("ui-datepicker-multi");a.dpDiv[(this._get(a,"isRTL")?"add":"remove")+"Class"]("ui-datepicker-rtl");a==d.datepicker._curInst&&d.datepicker._datepickerShowing&&a.input&&a.input.is(":visible")&&!a.input.is(":disabled")&&
+a.input[0]!=document.activeElement&&a.input.focus();if(a.yearshtml){var f=a.yearshtml;setTimeout(function(){f===a.yearshtml&&a.dpDiv.find("select.ui-datepicker-year:first").replaceWith(a.yearshtml);f=a.yearshtml=null},0)}},_getBorders:function(a){var b=function(c){return{thin:1,medium:2,thick:3}[c]||c};return[parseFloat(b(a.css("border-left-width"))),parseFloat(b(a.css("border-top-width")))]},_checkOffset:function(a,b,c){var e=a.dpDiv.outerWidth(),f=a.dpDiv.outerHeight(),h=a.input?a.input.outerWidth():
+0,i=a.input?a.input.outerHeight():0,g=document.documentElement.clientWidth+d(document).scrollLeft(),j=document.documentElement.clientHeight+d(document).scrollTop();b.left-=this._get(a,"isRTL")?e-h:0;b.left-=c&&b.left==a.input.offset().left?d(document).scrollLeft():0;b.top-=c&&b.top==a.input.offset().top+i?d(document).scrollTop():0;b.left-=Math.min(b.left,b.left+e>g&&g>e?Math.abs(b.left+e-g):0);b.top-=Math.min(b.top,b.top+f>j&&j>f?Math.abs(f+i):0);return b},_findPos:function(a){for(var b=this._get(this._getInst(a),
+"isRTL");a&&(a.type=="hidden"||a.nodeType!=1||d.expr.filters.hidden(a));)a=a[b?"previousSibling":"nextSibling"];a=d(a).offset();return[a.left,a.top]},_hideDatepicker:function(a){var b=this._curInst;if(!(!b||a&&b!=d.data(a,"datepicker")))if(this._datepickerShowing){a=this._get(b,"showAnim");var c=this._get(b,"duration"),e=function(){d.datepicker._tidyDialog(b);this._curInst=null};d.effects&&d.effects[a]?b.dpDiv.hide(a,d.datepicker._get(b,"showOptions"),c,e):b.dpDiv[a=="slideDown"?"slideUp":a=="fadeIn"?
+"fadeOut":"hide"](a?c:null,e);a||e();if(a=this._get(b,"onClose"))a.apply(b.input?b.input[0]:null,[b.input?b.input.val():"",b]);this._datepickerShowing=false;this._lastInput=null;if(this._inDialog){this._dialogInput.css({position:"absolute",left:"0",top:"-100px"});if(d.blockUI){d.unblockUI();d("body").append(this.dpDiv)}}this._inDialog=false}},_tidyDialog:function(a){a.dpDiv.removeClass(this._dialogClass).unbind(".ui-datepicker-calendar")},_checkExternalClick:function(a){if(d.datepicker._curInst){a=
+d(a.target);a[0].id!=d.datepicker._mainDivId&&a.parents("#"+d.datepicker._mainDivId).length==0&&!a.hasClass(d.datepicker.markerClassName)&&!a.hasClass(d.datepicker._triggerClass)&&d.datepicker._datepickerShowing&&!(d.datepicker._inDialog&&d.blockUI)&&d.datepicker._hideDatepicker()}},_adjustDate:function(a,b,c){a=d(a);var e=this._getInst(a[0]);if(!this._isDisabledDatepicker(a[0])){this._adjustInstDate(e,b+(c=="M"?this._get(e,"showCurrentAtPos"):0),c);this._updateDatepicker(e)}},_gotoToday:function(a){a=
+d(a);var b=this._getInst(a[0]);if(this._get(b,"gotoCurrent")&&b.currentDay){b.selectedDay=b.currentDay;b.drawMonth=b.selectedMonth=b.currentMonth;b.drawYear=b.selectedYear=b.currentYear}else{var c=new Date;b.selectedDay=c.getDate();b.drawMonth=b.selectedMonth=c.getMonth();b.drawYear=b.selectedYear=c.getFullYear()}this._notifyChange(b);this._adjustDate(a)},_selectMonthYear:function(a,b,c){a=d(a);var e=this._getInst(a[0]);e._selectingMonthYear=false;e["selected"+(c=="M"?"Month":"Year")]=e["draw"+(c==
+"M"?"Month":"Year")]=parseInt(b.options[b.selectedIndex].value,10);this._notifyChange(e);this._adjustDate(a)},_clickMonthYear:function(a){var b=this._getInst(d(a)[0]);b.input&&b._selectingMonthYear&&setTimeout(function(){b.input.focus()},0);b._selectingMonthYear=!b._selectingMonthYear},_selectDay:function(a,b,c,e){var f=d(a);if(!(d(e).hasClass(this._unselectableClass)||this._isDisabledDatepicker(f[0]))){f=this._getInst(f[0]);f.selectedDay=f.currentDay=d("a",e).html();f.selectedMonth=f.currentMonth=
+b;f.selectedYear=f.currentYear=c;this._selectDate(a,this._formatDate(f,f.currentDay,f.currentMonth,f.currentYear))}},_clearDate:function(a){a=d(a);this._getInst(a[0]);this._selectDate(a,"")},_selectDate:function(a,b){a=this._getInst(d(a)[0]);b=b!=null?b:this._formatDate(a);a.input&&a.input.val(b);this._updateAlternate(a);var c=this._get(a,"onSelect");if(c)c.apply(a.input?a.input[0]:null,[b,a]);else a.input&&a.input.trigger("change");if(a.inline)this._updateDatepicker(a);else{this._hideDatepicker();
+this._lastInput=a.input[0];typeof a.input[0]!="object"&&a.input.focus();this._lastInput=null}},_updateAlternate:function(a){var b=this._get(a,"altField");if(b){var c=this._get(a,"altFormat")||this._get(a,"dateFormat"),e=this._getDate(a),f=this.formatDate(c,e,this._getFormatConfig(a));d(b).each(function(){d(this).val(f)})}},noWeekends:function(a){a=a.getDay();return[a>0&&a<6,""]},iso8601Week:function(a){a=new Date(a.getTime());a.setDate(a.getDate()+4-(a.getDay()||7));var b=a.getTime();a.setMonth(0);
+a.setDate(1);return Math.floor(Math.round((b-a)/864E5)/7)+1},parseDate:function(a,b,c){if(a==null||b==null)throw"Invalid arguments";b=typeof b=="object"?b.toString():b+"";if(b=="")return null;var e=(c?c.shortYearCutoff:null)||this._defaults.shortYearCutoff;e=typeof e!="string"?e:(new Date).getFullYear()%100+parseInt(e,10);for(var f=(c?c.dayNamesShort:null)||this._defaults.dayNamesShort,h=(c?c.dayNames:null)||this._defaults.dayNames,i=(c?c.monthNamesShort:null)||this._defaults.monthNamesShort,g=(c?
+c.monthNames:null)||this._defaults.monthNames,j=c=-1,l=-1,u=-1,k=false,o=function(p){(p=z+1-1){j=1;l=u;do{e=this._getDaysInMonth(c,j-1);if(l<=e)break;j++;l-=e}while(1)}w=this._daylightSavingAdjust(new Date(c,j-1,l));if(w.getFullYear()!=c||w.getMonth()+1!=j||w.getDate()!=l)throw"Invalid date";return w},ATOM:"yy-mm-dd",COOKIE:"D, dd M yy",ISO_8601:"yy-mm-dd",RFC_822:"D, d M y",RFC_850:"DD, dd-M-y",
+RFC_1036:"D, d M y",RFC_1123:"D, d M yy",RFC_2822:"D, d M yy",RSS:"D, d M y",TICKS:"!",TIMESTAMP:"@",W3C:"yy-mm-dd",_ticksTo1970:(718685+Math.floor(492.5)-Math.floor(19.7)+Math.floor(4.925))*24*60*60*1E7,formatDate:function(a,b,c){if(!b)return"";var e=(c?c.dayNamesShort:null)||this._defaults.dayNamesShort,f=(c?c.dayNames:null)||this._defaults.dayNames,h=(c?c.monthNamesShort:null)||this._defaults.monthNamesShort;c=(c?c.monthNames:null)||this._defaults.monthNames;var i=function(o){(o=k+112?a.getHours()+2:0);return a},_setDate:function(a,b,c){var e=!b,f=a.selectedMonth,h=a.selectedYear;b=this._restrictMinMax(a,this._determineDate(a,b,new Date));a.selectedDay=
+a.currentDay=b.getDate();a.drawMonth=a.selectedMonth=a.currentMonth=b.getMonth();a.drawYear=a.selectedYear=a.currentYear=b.getFullYear();if((f!=a.selectedMonth||h!=a.selectedYear)&&!c)this._notifyChange(a);this._adjustInstDate(a);if(a.input)a.input.val(e?"":this._formatDate(a))},_getDate:function(a){return!a.currentYear||a.input&&a.input.val()==""?null:this._daylightSavingAdjust(new Date(a.currentYear,a.currentMonth,a.currentDay))},_generateHTML:function(a){var b=new Date;b=this._daylightSavingAdjust(new Date(b.getFullYear(),
+b.getMonth(),b.getDate()));var c=this._get(a,"isRTL"),e=this._get(a,"showButtonPanel"),f=this._get(a,"hideIfNoPrevNext"),h=this._get(a,"navigationAsDateFormat"),i=this._getNumberOfMonths(a),g=this._get(a,"showCurrentAtPos"),j=this._get(a,"stepMonths"),l=i[0]!=1||i[1]!=1,u=this._daylightSavingAdjust(!a.currentDay?new Date(9999,9,9):new Date(a.currentYear,a.currentMonth,a.currentDay)),k=this._getMinMaxDate(a,"min"),o=this._getMinMaxDate(a,"max");g=a.drawMonth-g;var m=a.drawYear;if(g<0){g+=12;m--}if(o){var n=
+this._daylightSavingAdjust(new Date(o.getFullYear(),o.getMonth()-i[0]*i[1]+1,o.getDate()));for(n=k&&nn;){g--;if(g<0){g=11;m--}}}a.drawMonth=g;a.drawYear=m;n=this._get(a,"prevText");n=!h?n:this.formatDate(n,this._daylightSavingAdjust(new Date(m,g-j,1)),this._getFormatConfig(a));n=this._canAdjustMonth(a,-1,m,g)?''+n+" '+n+" '+r+" '+r+" '+this._get(a,
+"closeText")+" ":"";e=e?''+(c?h:"")+(this._isInRange(a,r)?'"+j+" ":"")+(c?"":h)+"
":"";h=parseInt(this._get(a,"firstDay"),10);h=isNaN(h)?0:h;j=this._get(a,"showWeek");r=this._get(a,"dayNames");this._get(a,"dayNamesShort");var s=this._get(a,"dayNamesMin"),z=
+this._get(a,"monthNames"),w=this._get(a,"monthNamesShort"),p=this._get(a,"beforeShowDay"),v=this._get(a,"showOtherMonths"),H=this._get(a,"selectOtherMonths");this._get(a,"calculateWeek");for(var L=this._getDefaultDate(a),I="",D=0;D1)switch(E){case 0:x+=" ui-datepicker-group-first";t=" ui-corner-"+(c?"right":"left");break;case i[1]-
+1:x+=" ui-datepicker-group-last";t=" ui-corner-"+(c?"left":"right");break;default:x+=" ui-datepicker-group-middle";t="";break}x+='">'}x+='';var B=j?''+this._get(a,"weekHeader")+" ":"";for(t=0;t<7;t++){var q=
+(t+h)%7;B+="=5?' class="ui-datepicker-week-end"':"")+'>'+s[q]+" "}x+=B+" ";B=this._getDaysInMonth(m,g);if(m==a.selectedYear&&g==a.selectedMonth)a.selectedDay=Math.min(a.selectedDay,B);t=(this._getFirstDayOfMonth(m,g)-h+7)%7;B=l?6:Math.ceil((t+B)/7);q=this._daylightSavingAdjust(new Date(m,g,1-t));for(var O=0;O";var P=!j?"":''+this._get(a,"calculateWeek")(q)+" ";for(t=0;t<7;t++){var G=
+p?p.apply(a.input?a.input[0]:null,[q]):[true,""],C=q.getMonth()!=g,J=C&&!H||!G[0]||k&&qo;P+='"+(C&&!v?" ":J?''+q.getDate()+" ":''+q.getDate()+" ")+" ";q.setDate(q.getDate()+1);q=this._daylightSavingAdjust(q)}x+=
+P+""}g++;if(g>11){g=0;m++}x+="
"+(l?""+(i[0]>0&&E==i[1]-1?'
':""):"");M+=x}I+=M}I+=e+(d.browser.msie&&parseInt(d.browser.version,10)<7&&!a.inline?'':"");a._keyEvent=false;return I},_generateMonthYearHeader:function(a,b,c,e,f,h,i,g){var j=this._get(a,"changeMonth"),l=this._get(a,"changeYear"),u=this._get(a,"showMonthAfterYear"),k='',
+o="";if(h||!j)o+=''+i[b]+" ";else{i=e&&e.getFullYear()==c;var m=f&&f.getFullYear()==c;o+='";for(var n=0;n<12;n++)if((!i||n>=e.getMonth())&&(!m||n<=f.getMonth()))o+='"+g[n]+" ";o+=" "}u||(k+=o+(h||!(j&&
+l)?" ":""));a.yearshtml="";if(h||!l)k+=''+c+" ";else{g=this._get(a,"yearRange").split(":");var r=(new Date).getFullYear();i=function(s){s=s.match(/c[+-].*/)?c+parseInt(s.substring(1),10):s.match(/[+-].*/)?r+parseInt(s,10):parseInt(s,10);return isNaN(s)?r:s};b=i(g[0]);g=Math.max(b,i(g[1]||""));b=e?Math.max(b,e.getFullYear()):b;g=f?Math.min(g,f.getFullYear()):g;for(a.yearshtml+='";b<=g;b++)a.yearshtml+='"+b+" ";a.yearshtml+=" ";if(d.browser.mozilla)k+=''+c+"
";return k},_adjustInstDate:function(a,b,c){var e=
+a.drawYear+(c=="Y"?b:0),f=a.drawMonth+(c=="M"?b:0);b=Math.min(a.selectedDay,this._getDaysInMonth(e,f))+(c=="D"?b:0);e=this._restrictMinMax(a,this._daylightSavingAdjust(new Date(e,f,b)));a.selectedDay=e.getDate();a.drawMonth=a.selectedMonth=e.getMonth();a.drawYear=a.selectedYear=e.getFullYear();if(c=="M"||c=="Y")this._notifyChange(a)},_restrictMinMax:function(a,b){var c=this._getMinMaxDate(a,"min");a=this._getMinMaxDate(a,"max");b=c&&ba?a:b},_notifyChange:function(a){var b=this._get(a,
+"onChangeMonthYear");if(b)b.apply(a.input?a.input[0]:null,[a.selectedYear,a.selectedMonth+1,a])},_getNumberOfMonths:function(a){a=this._get(a,"numberOfMonths");return a==null?[1,1]:typeof a=="number"?[1,a]:a},_getMinMaxDate:function(a,b){return this._determineDate(a,this._get(a,b+"Date"),null)},_getDaysInMonth:function(a,b){return 32-this._daylightSavingAdjust(new Date(a,b,32)).getDate()},_getFirstDayOfMonth:function(a,b){return(new Date(a,b,1)).getDay()},_canAdjustMonth:function(a,b,c,e){var f=this._getNumberOfMonths(a);
+c=this._daylightSavingAdjust(new Date(c,e+(b<0?b:f[0]*f[1]),1));b<0&&c.setDate(this._getDaysInMonth(c.getFullYear(),c.getMonth()));return this._isInRange(a,c)},_isInRange:function(a,b){var c=this._getMinMaxDate(a,"min");a=this._getMinMaxDate(a,"max");return(!c||b.getTime()>=c.getTime())&&(!a||b.getTime()<=a.getTime())},_getFormatConfig:function(a){var b=this._get(a,"shortYearCutoff");b=typeof b!="string"?b:(new Date).getFullYear()%100+parseInt(b,10);return{shortYearCutoff:b,dayNamesShort:this._get(a,
+"dayNamesShort"),dayNames:this._get(a,"dayNames"),monthNamesShort:this._get(a,"monthNamesShort"),monthNames:this._get(a,"monthNames")}},_formatDate:function(a,b,c,e){if(!b){a.currentDay=a.selectedDay;a.currentMonth=a.selectedMonth;a.currentYear=a.selectedYear}b=b?typeof b=="object"?b:this._daylightSavingAdjust(new Date(e,c,b)):this._daylightSavingAdjust(new Date(a.currentYear,a.currentMonth,a.currentDay));return this.formatDate(this._get(a,"dateFormat"),b,this._getFormatConfig(a))}});d.fn.datepicker=
+function(a){if(!this.length)return this;if(!d.datepicker.initialized){d(document).mousedown(d.datepicker._checkExternalClick).find("body").append(d.datepicker.dpDiv);d.datepicker.initialized=true}var b=Array.prototype.slice.call(arguments,1);if(typeof a=="string"&&(a=="isDisabled"||a=="getDate"||a=="widget"))return d.datepicker["_"+a+"Datepicker"].apply(d.datepicker,[this[0]].concat(b));if(a=="option"&&arguments.length==2&&typeof arguments[1]=="string")return d.datepicker["_"+a+"Datepicker"].apply(d.datepicker,
+[this[0]].concat(b));return this.each(function(){typeof a=="string"?d.datepicker["_"+a+"Datepicker"].apply(d.datepicker,[this].concat(b)):d.datepicker._attachDatepicker(this,a)})};d.datepicker=new K;d.datepicker.initialized=false;d.datepicker.uuid=(new Date).getTime();d.datepicker.version="1.8.11";window["DP_jQuery_"+y]=d})(jQuery);
+;/*
+ * Note: While Microsoft is not the author of this file, Microsoft is
+ * offering you a license subject to the terms of the Microsoft Software
+ * License Terms for Microsoft ASP.NET Model View Controller 3.
+ * Microsoft reserves all other rights. The notices below are provided
+ * for informational purposes only and are not the license terms under
+ * which Microsoft distributed this file.
+ *
+ * jQuery UI Progressbar 1.8.11
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ *
+ * http://docs.jquery.com/UI/Progressbar
+ *
+ * Depends:
+ * jquery.ui.core.js
+ * jquery.ui.widget.js
+ */
+(function(b,d){b.widget("ui.progressbar",{options:{value:0,max:100},min:0,_create:function(){this.element.addClass("ui-progressbar ui-widget ui-widget-content ui-corner-all").attr({role:"progressbar","aria-valuemin":this.min,"aria-valuemax":this.options.max,"aria-valuenow":this._value()});this.valueDiv=b("").appendTo(this.element);this.oldValue=this._value();this._refreshValue()},destroy:function(){this.element.removeClass("ui-progressbar ui-widget ui-widget-content ui-corner-all").removeAttr("role").removeAttr("aria-valuemin").removeAttr("aria-valuemax").removeAttr("aria-valuenow");
+this.valueDiv.remove();b.Widget.prototype.destroy.apply(this,arguments)},value:function(a){if(a===d)return this._value();this._setOption("value",a);return this},_setOption:function(a,c){if(a==="value"){this.options.value=c;this._refreshValue();this._value()===this.options.max&&this._trigger("complete")}b.Widget.prototype._setOption.apply(this,arguments)},_value:function(){var a=this.options.value;if(typeof a!=="number")a=0;return Math.min(this.options.max,Math.max(this.min,a))},_percentage:function(){return 100*
+this._value()/this.options.max},_refreshValue:function(){var a=this.value(),c=this._percentage();if(this.oldValue!==a){this.oldValue=a;this._trigger("change")}this.valueDiv.toggleClass("ui-corner-right",a===this.options.max).width(c.toFixed(0)+"%");this.element.attr("aria-valuenow",a)}});b.extend(b.ui.progressbar,{version:"1.8.11"})})(jQuery);
+;/*
+ * Note: While Microsoft is not the author of this file, Microsoft is
+ * offering you a license subject to the terms of the Microsoft Software
+ * License Terms for Microsoft ASP.NET Model View Controller 3.
+ * Microsoft reserves all other rights. The notices below are provided
+ * for informational purposes only and are not the license terms under
+ * which Microsoft distributed this file.
+ *
+ * jQuery UI Effects 1.8.11
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ *
+ * http://docs.jquery.com/UI/Effects/
+ */
+jQuery.effects||function(f,j){function n(c){var a;if(c&&c.constructor==Array&&c.length==3)return c;if(a=/rgb\(\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*\)/.exec(c))return[parseInt(a[1],10),parseInt(a[2],10),parseInt(a[3],10)];if(a=/rgb\(\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*\)/.exec(c))return[parseFloat(a[1])*2.55,parseFloat(a[2])*2.55,parseFloat(a[3])*2.55];if(a=/#([a-fA-F0-9]{2})([a-fA-F0-9]{2})([a-fA-F0-9]{2})/.exec(c))return[parseInt(a[1],
+16),parseInt(a[2],16),parseInt(a[3],16)];if(a=/#([a-fA-F0-9])([a-fA-F0-9])([a-fA-F0-9])/.exec(c))return[parseInt(a[1]+a[1],16),parseInt(a[2]+a[2],16),parseInt(a[3]+a[3],16)];if(/rgba\(0, 0, 0, 0\)/.exec(c))return o.transparent;return o[f.trim(c).toLowerCase()]}function s(c,a){var b;do{b=f.curCSS(c,a);if(b!=""&&b!="transparent"||f.nodeName(c,"body"))break;a="backgroundColor"}while(c=c.parentNode);return n(b)}function p(){var c=document.defaultView?document.defaultView.getComputedStyle(this,null):this.currentStyle,
+a={},b,d;if(c&&c.length&&c[0]&&c[c[0]])for(var e=c.length;e--;){b=c[e];if(typeof c[b]=="string"){d=b.replace(/\-(\w)/g,function(g,h){return h.toUpperCase()});a[d]=c[b]}}else for(b in c)if(typeof c[b]==="string")a[b]=c[b];return a}function q(c){var a,b;for(a in c){b=c[a];if(b==null||f.isFunction(b)||a in t||/scrollbar/.test(a)||!/color/i.test(a)&&isNaN(parseFloat(b)))delete c[a]}return c}function u(c,a){var b={_:0},d;for(d in a)if(c[d]!=a[d])b[d]=a[d];return b}function k(c,a,b,d){if(typeof c=="object"){d=
+a;b=null;a=c;c=a.effect}if(f.isFunction(a)){d=a;b=null;a={}}if(typeof a=="number"||f.fx.speeds[a]){d=b;b=a;a={}}if(f.isFunction(b)){d=b;b=null}a=a||{};b=b||a.duration;b=f.fx.off?0:typeof b=="number"?b:b in f.fx.speeds?f.fx.speeds[b]:f.fx.speeds._default;d=d||a.complete;return[c,a,b,d]}function m(c){if(!c||typeof c==="number"||f.fx.speeds[c])return true;if(typeof c==="string"&&!f.effects[c])return true;return false}f.effects={};f.each(["backgroundColor","borderBottomColor","borderLeftColor","borderRightColor",
+"borderTopColor","borderColor","color","outlineColor"],function(c,a){f.fx.step[a]=function(b){if(!b.colorInit){b.start=s(b.elem,a);b.end=n(b.end);b.colorInit=true}b.elem.style[a]="rgb("+Math.max(Math.min(parseInt(b.pos*(b.end[0]-b.start[0])+b.start[0],10),255),0)+","+Math.max(Math.min(parseInt(b.pos*(b.end[1]-b.start[1])+b.start[1],10),255),0)+","+Math.max(Math.min(parseInt(b.pos*(b.end[2]-b.start[2])+b.start[2],10),255),0)+")"}});var o={aqua:[0,255,255],azure:[240,255,255],beige:[245,245,220],black:[0,
+0,0],blue:[0,0,255],brown:[165,42,42],cyan:[0,255,255],darkblue:[0,0,139],darkcyan:[0,139,139],darkgrey:[169,169,169],darkgreen:[0,100,0],darkkhaki:[189,183,107],darkmagenta:[139,0,139],darkolivegreen:[85,107,47],darkorange:[255,140,0],darkorchid:[153,50,204],darkred:[139,0,0],darksalmon:[233,150,122],darkviolet:[148,0,211],fuchsia:[255,0,255],gold:[255,215,0],green:[0,128,0],indigo:[75,0,130],khaki:[240,230,140],lightblue:[173,216,230],lightcyan:[224,255,255],lightgreen:[144,238,144],lightgrey:[211,
+211,211],lightpink:[255,182,193],lightyellow:[255,255,224],lime:[0,255,0],magenta:[255,0,255],maroon:[128,0,0],navy:[0,0,128],olive:[128,128,0],orange:[255,165,0],pink:[255,192,203],purple:[128,0,128],violet:[128,0,128],red:[255,0,0],silver:[192,192,192],white:[255,255,255],yellow:[255,255,0],transparent:[255,255,255]},r=["add","remove","toggle"],t={border:1,borderBottom:1,borderColor:1,borderLeft:1,borderRight:1,borderTop:1,borderWidth:1,margin:1,padding:1};f.effects.animateClass=function(c,a,b,
+d){if(f.isFunction(b)){d=b;b=null}return this.queue("fx",function(){var e=f(this),g=e.attr("style")||" ",h=q(p.call(this)),l,v=e.attr("className");f.each(r,function(w,i){c[i]&&e[i+"Class"](c[i])});l=q(p.call(this));e.attr("className",v);e.animate(u(h,l),a,b,function(){f.each(r,function(w,i){c[i]&&e[i+"Class"](c[i])});if(typeof e.attr("style")=="object"){e.attr("style").cssText="";e.attr("style").cssText=g}else e.attr("style",g);d&&d.apply(this,arguments)});h=f.queue(this);l=h.splice(h.length-1,1)[0];
+h.splice(1,0,l);f.dequeue(this)})};f.fn.extend({_addClass:f.fn.addClass,addClass:function(c,a,b,d){return a?f.effects.animateClass.apply(this,[{add:c},a,b,d]):this._addClass(c)},_removeClass:f.fn.removeClass,removeClass:function(c,a,b,d){return a?f.effects.animateClass.apply(this,[{remove:c},a,b,d]):this._removeClass(c)},_toggleClass:f.fn.toggleClass,toggleClass:function(c,a,b,d,e){return typeof a=="boolean"||a===j?b?f.effects.animateClass.apply(this,[a?{add:c}:{remove:c},b,d,e]):this._toggleClass(c,
+a):f.effects.animateClass.apply(this,[{toggle:c},a,b,d])},switchClass:function(c,a,b,d,e){return f.effects.animateClass.apply(this,[{add:a,remove:c},b,d,e])}});f.extend(f.effects,{version:"1.8.11",save:function(c,a){for(var b=0;b").addClass("ui-effects-wrapper").css({fontSize:"100%",background:"transparent",
+border:"none",margin:0,padding:0});c.wrap(b);b=c.parent();if(c.css("position")=="static"){b.css({position:"relative"});c.css({position:"relative"})}else{f.extend(a,{position:c.css("position"),zIndex:c.css("z-index")});f.each(["top","left","bottom","right"],function(d,e){a[e]=c.css(e);if(isNaN(parseInt(a[e],10)))a[e]="auto"});c.css({position:"relative",top:0,left:0,right:"auto",bottom:"auto"})}return b.css(a).show()},removeWrapper:function(c){if(c.parent().is(".ui-effects-wrapper"))return c.parent().replaceWith(c);
+return c},setTransition:function(c,a,b,d){d=d||{};f.each(a,function(e,g){unit=c.cssUnit(g);if(unit[0]>0)d[g]=unit[0]*b+unit[1]});return d}});f.fn.extend({effect:function(c){var a=k.apply(this,arguments),b={options:a[1],duration:a[2],callback:a[3]};a=b.options.mode;var d=f.effects[c];if(f.fx.off||!d)return a?this[a](b.duration,b.callback):this.each(function(){b.callback&&b.callback.call(this)});return d.call(this,b)},_show:f.fn.show,show:function(c){if(m(c))return this._show.apply(this,arguments);
+else{var a=k.apply(this,arguments);a[1].mode="show";return this.effect.apply(this,a)}},_hide:f.fn.hide,hide:function(c){if(m(c))return this._hide.apply(this,arguments);else{var a=k.apply(this,arguments);a[1].mode="hide";return this.effect.apply(this,a)}},__toggle:f.fn.toggle,toggle:function(c){if(m(c)||typeof c==="boolean"||f.isFunction(c))return this.__toggle.apply(this,arguments);else{var a=k.apply(this,arguments);a[1].mode="toggle";return this.effect.apply(this,a)}},cssUnit:function(c){var a=this.css(c),
+b=[];f.each(["em","px","%","pt"],function(d,e){if(a.indexOf(e)>0)b=[parseFloat(a),e]});return b}});f.easing.jswing=f.easing.swing;f.extend(f.easing,{def:"easeOutQuad",swing:function(c,a,b,d,e){return f.easing[f.easing.def](c,a,b,d,e)},easeInQuad:function(c,a,b,d,e){return d*(a/=e)*a+b},easeOutQuad:function(c,a,b,d,e){return-d*(a/=e)*(a-2)+b},easeInOutQuad:function(c,a,b,d,e){if((a/=e/2)<1)return d/2*a*a+b;return-d/2*(--a*(a-2)-1)+b},easeInCubic:function(c,a,b,d,e){return d*(a/=e)*a*a+b},easeOutCubic:function(c,
+a,b,d,e){return d*((a=a/e-1)*a*a+1)+b},easeInOutCubic:function(c,a,b,d,e){if((a/=e/2)<1)return d/2*a*a*a+b;return d/2*((a-=2)*a*a+2)+b},easeInQuart:function(c,a,b,d,e){return d*(a/=e)*a*a*a+b},easeOutQuart:function(c,a,b,d,e){return-d*((a=a/e-1)*a*a*a-1)+b},easeInOutQuart:function(c,a,b,d,e){if((a/=e/2)<1)return d/2*a*a*a*a+b;return-d/2*((a-=2)*a*a*a-2)+b},easeInQuint:function(c,a,b,d,e){return d*(a/=e)*a*a*a*a+b},easeOutQuint:function(c,a,b,d,e){return d*((a=a/e-1)*a*a*a*a+1)+b},easeInOutQuint:function(c,
+a,b,d,e){if((a/=e/2)<1)return d/2*a*a*a*a*a+b;return d/2*((a-=2)*a*a*a*a+2)+b},easeInSine:function(c,a,b,d,e){return-d*Math.cos(a/e*(Math.PI/2))+d+b},easeOutSine:function(c,a,b,d,e){return d*Math.sin(a/e*(Math.PI/2))+b},easeInOutSine:function(c,a,b,d,e){return-d/2*(Math.cos(Math.PI*a/e)-1)+b},easeInExpo:function(c,a,b,d,e){return a==0?b:d*Math.pow(2,10*(a/e-1))+b},easeOutExpo:function(c,a,b,d,e){return a==e?b+d:d*(-Math.pow(2,-10*a/e)+1)+b},easeInOutExpo:function(c,a,b,d,e){if(a==0)return b;if(a==
+e)return b+d;if((a/=e/2)<1)return d/2*Math.pow(2,10*(a-1))+b;return d/2*(-Math.pow(2,-10*--a)+2)+b},easeInCirc:function(c,a,b,d,e){return-d*(Math.sqrt(1-(a/=e)*a)-1)+b},easeOutCirc:function(c,a,b,d,e){return d*Math.sqrt(1-(a=a/e-1)*a)+b},easeInOutCirc:function(c,a,b,d,e){if((a/=e/2)<1)return-d/2*(Math.sqrt(1-a*a)-1)+b;return d/2*(Math.sqrt(1-(a-=2)*a)+1)+b},easeInElastic:function(c,a,b,d,e){c=1.70158;var g=0,h=d;if(a==0)return b;if((a/=e)==1)return b+d;g||(g=e*0.3);if(h").css({position:"absolute",visibility:"visible",left:-f*(h/d),top:-e*(i/c)}).parent().addClass("ui-effects-explode").css({position:"absolute",overflow:"hidden",width:h/d,height:i/c,left:g.left+f*(h/d)+(a.options.mode=="show"?(f-Math.floor(d/2))*(h/d):0),top:g.top+e*(i/c)+(a.options.mode=="show"?(e-Math.floor(c/2))*(i/c):0),opacity:a.options.mode=="show"?0:1}).animate({left:g.left+f*(h/d)+(a.options.mode=="show"?0:(f-Math.floor(d/2))*(h/d)),top:g.top+
+e*(i/c)+(a.options.mode=="show"?0:(e-Math.floor(c/2))*(i/c)),opacity:a.options.mode=="show"?1:0},a.duration||500);setTimeout(function(){a.options.mode=="show"?b.css({visibility:"visible"}):b.css({visibility:"visible"}).hide();a.callback&&a.callback.apply(b[0]);b.dequeue();j("div.ui-effects-explode").remove()},a.duration||500)})}})(jQuery);
+;/*
+ * Note: While Microsoft is not the author of this file, Microsoft is
+ * offering you a license subject to the terms of the Microsoft Software
+ * License Terms for Microsoft ASP.NET Model View Controller 3.
+ * Microsoft reserves all other rights. The notices below are provided
+ * for informational purposes only and are not the license terms under
+ * which Microsoft distributed this file.
+ *
+ * jQuery UI Effects Fade 1.8.11
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ *
+ * http://docs.jquery.com/UI/Effects/Fade
+ *
+ * Depends:
+ * jquery.effects.core.js
+ */
+(function(b){b.effects.fade=function(a){return this.queue(function(){var c=b(this),d=b.effects.setMode(c,a.options.mode||"hide");c.animate({opacity:d},{queue:false,duration:a.duration,easing:a.options.easing,complete:function(){a.callback&&a.callback.apply(this,arguments);c.dequeue()}})})}})(jQuery);
+;/*
+ * Note: While Microsoft is not the author of this file, Microsoft is
+ * offering you a license subject to the terms of the Microsoft Software
+ * License Terms for Microsoft ASP.NET Model View Controller 3.
+ * Microsoft reserves all other rights. The notices below are provided
+ * for informational purposes only and are not the license terms under
+ * which Microsoft distributed this file.
+ *
+ * jQuery UI Effects Fold 1.8.11
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ *
+ * http://docs.jquery.com/UI/Effects/Fold
+ *
+ * Depends:
+ * jquery.effects.core.js
+ */
+(function(c){c.effects.fold=function(a){return this.queue(function(){var b=c(this),j=["position","top","bottom","left","right"],d=c.effects.setMode(b,a.options.mode||"hide"),g=a.options.size||15,h=!!a.options.horizFirst,k=a.duration?a.duration/2:c.fx.speeds._default/2;c.effects.save(b,j);b.show();var e=c.effects.createWrapper(b).css({overflow:"hidden"}),f=d=="show"!=h,l=f?["width","height"]:["height","width"];f=f?[e.width(),e.height()]:[e.height(),e.width()];var i=/([0-9]+)%/.exec(g);if(i)g=parseInt(i[1],
+10)/100*f[d=="hide"?0:1];if(d=="show")e.css(h?{height:0,width:g}:{height:g,width:0});h={};i={};h[l[0]]=d=="show"?f[0]:g;i[l[1]]=d=="show"?f[1]:0;e.animate(h,k,a.options.easing).animate(i,k,a.options.easing,function(){d=="hide"&&b.hide();c.effects.restore(b,j);c.effects.removeWrapper(b);a.callback&&a.callback.apply(b[0],arguments);b.dequeue()})})}})(jQuery);
+;/*
+ * Note: While Microsoft is not the author of this file, Microsoft is
+ * offering you a license subject to the terms of the Microsoft Software
+ * License Terms for Microsoft ASP.NET Model View Controller 3.
+ * Microsoft reserves all other rights. The notices below are provided
+ * for informational purposes only and are not the license terms under
+ * which Microsoft distributed this file.
+ *
+ * jQuery UI Effects Highlight 1.8.11
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ *
+ * http://docs.jquery.com/UI/Effects/Highlight
+ *
+ * Depends:
+ * jquery.effects.core.js
+ */
+(function(b){b.effects.highlight=function(c){return this.queue(function(){var a=b(this),e=["backgroundImage","backgroundColor","opacity"],d=b.effects.setMode(a,c.options.mode||"show"),f={backgroundColor:a.css("backgroundColor")};if(d=="hide")f.opacity=0;b.effects.save(a,e);a.show().css({backgroundImage:"none",backgroundColor:c.options.color||"#ffff99"}).animate(f,{queue:false,duration:c.duration,easing:c.options.easing,complete:function(){d=="hide"&&a.hide();b.effects.restore(a,e);d=="show"&&!b.support.opacity&&
+this.style.removeAttribute("filter");c.callback&&c.callback.apply(this,arguments);a.dequeue()}})})}})(jQuery);
+;/*
+ * Note: While Microsoft is not the author of this file, Microsoft is
+ * offering you a license subject to the terms of the Microsoft Software
+ * License Terms for Microsoft ASP.NET Model View Controller 3.
+ * Microsoft reserves all other rights. The notices below are provided
+ * for informational purposes only and are not the license terms under
+ * which Microsoft distributed this file.
+ *
+ * jQuery UI Effects Pulsate 1.8.11
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ *
+ * http://docs.jquery.com/UI/Effects/Pulsate
+ *
+ * Depends:
+ * jquery.effects.core.js
+ */
+(function(d){d.effects.pulsate=function(a){return this.queue(function(){var b=d(this),c=d.effects.setMode(b,a.options.mode||"show");times=(a.options.times||5)*2-1;duration=a.duration?a.duration/2:d.fx.speeds._default/2;isVisible=b.is(":visible");animateTo=0;if(!isVisible){b.css("opacity",0).show();animateTo=1}if(c=="hide"&&isVisible||c=="show"&&!isVisible)times--;for(c=0;c').appendTo(document.body).addClass(a.options.className).css({top:d.top,left:d.left,height:b.innerHeight(),width:b.innerWidth(),position:"absolute"}).animate(c,a.duration,a.options.easing,function(){f.remove();a.callback&&a.callback.apply(b[0],arguments);
+b.dequeue()})})}})(jQuery);
+;
\ No newline at end of file
diff --git a/src/Umbraco.Web.UI/Umbraco/plugins/umbracoContour/scripts/jquery.datatables.js b/src/Umbraco.Web.UI/Umbraco/plugins/umbracoContour/scripts/jquery.datatables.js
new file mode 100644
index 0000000000..8575de9bc5
--- /dev/null
+++ b/src/Umbraco.Web.UI/Umbraco/plugins/umbracoContour/scripts/jquery.datatables.js
@@ -0,0 +1,11265 @@
+/**
+* @summary DataTables
+* @description Paginate, search and sort HTML tables
+* @version 1.9.3
+* @file jquery.dataTables.js
+* @author Allan Jardine (www.sprymedia.co.uk)
+* @contact www.sprymedia.co.uk/contact
+*
+* @copyright Copyright 2008-2012 Allan Jardine, all rights reserved.
+*
+* This source file is free software, under either the GPL v2 license or a
+* BSD style license, available at:
+* http://datatables.net/license_gpl2
+* http://datatables.net/license_bsd
+*
+* This source file is distributed in the hope that it will be useful, but
+* WITHOUT ANY WARRANTY; without even the implied warranty of MERCHANTABILITY
+* or FITNESS FOR A PARTICULAR PURPOSE. See the license files for details.
+*
+* For details please refer to: http://www.datatables.net
+*/
+
+/*jslint evil: true, undef: true, browser: true */
+/*globals $, jQuery,_fnExternApiFunc,_fnInitialise,_fnInitComplete,_fnLanguageCompat,_fnAddColumn,_fnColumnOptions,_fnAddData,_fnCreateTr,_fnGatherData,_fnBuildHead,_fnDrawHead,_fnDraw,_fnReDraw,_fnAjaxUpdate,_fnAjaxParameters,_fnAjaxUpdateDraw,_fnServerParams,_fnAddOptionsHtml,_fnFeatureHtmlTable,_fnScrollDraw,_fnAdjustColumnSizing,_fnFeatureHtmlFilter,_fnFilterComplete,_fnFilterCustom,_fnFilterColumn,_fnFilter,_fnBuildSearchArray,_fnBuildSearchRow,_fnFilterCreateSearch,_fnDataToSearch,_fnSort,_fnSortAttachListener,_fnSortingClasses,_fnFeatureHtmlPaginate,_fnPageChange,_fnFeatureHtmlInfo,_fnUpdateInfo,_fnFeatureHtmlLength,_fnFeatureHtmlProcessing,_fnProcessingDisplay,_fnVisibleToColumnIndex,_fnColumnIndexToVisible,_fnNodeToDataIndex,_fnVisbleColumns,_fnCalculateEnd,_fnConvertToWidth,_fnCalculateColumnWidths,_fnScrollingWidthAdjust,_fnGetWidestNode,_fnGetMaxLenString,_fnStringToCss,_fnDetectType,_fnSettingsFromNode,_fnGetDataMaster,_fnGetTrNodes,_fnGetTdNodes,_fnEscapeRegex,_fnDeleteIndex,_fnReOrderIndex,_fnColumnOrdering,_fnLog,_fnClearTable,_fnSaveState,_fnLoadState,_fnCreateCookie,_fnReadCookie,_fnDetectHeader,_fnGetUniqueThs,_fnScrollBarWidth,_fnApplyToChildren,_fnMap,_fnGetRowData,_fnGetCellData,_fnSetCellData,_fnGetObjectDataFn,_fnSetObjectDataFn,_fnApplyColumnDefs,_fnBindAction,_fnCallbackReg,_fnCallbackFire,_fnJsonString,_fnRender,_fnNodeToColumnIndex,_fnInfoMacros,_fnBrowserDetect,_fnGetColumns*/
+
+(/** @lends */function ($, window, document, undefined) {
+ /**
+ * DataTables is a plug-in for the jQuery Javascript library. It is a
+ * highly flexible tool, based upon the foundations of progressive
+ * enhancement, which will add advanced interaction controls to any
+ * HTML table. For a full list of features please refer to
+ * DataTables.net .
+ *
+ * Note that the DataTable object is not a global variable but is
+ * aliased to jQuery.fn.DataTable and jQuery.fn.dataTable through which
+ * it may be accessed.
+ *
+ * @class
+ * @param {object} [oInit={}] Configuration object for DataTables. Options
+ * are defined by {@link DataTable.defaults}
+ * @requires jQuery 1.3+
+ *
+ * @example
+ * // Basic initialisation
+ * $(document).ready( function {
+ * $('#example').dataTable();
+ * } );
+ *
+ * @example
+ * // Initialisation with configuration options - in this case, disable
+ * // pagination and sorting.
+ * $(document).ready( function {
+ * $('#example').dataTable( {
+ * "bPaginate": false,
+ * "bSort": false
+ * } );
+ * } );
+ */
+ var DataTable = function (oInit) {
+
+
+ /**
+ * Add a column to the list used for the table with default values
+ * @param {object} oSettings dataTables settings object
+ * @param {node} nTh The th element for this column
+ * @memberof DataTable#oApi
+ */
+ function _fnAddColumn(oSettings, nTh) {
+ var oDefaults = DataTable.defaults.columns;
+ var iCol = oSettings.aoColumns.length;
+ var oCol = $.extend({}, DataTable.models.oColumn, oDefaults, {
+ "sSortingClass": oSettings.oClasses.sSortable,
+ "sSortingClassJUI": oSettings.oClasses.sSortJUI,
+ "nTh": nTh ? nTh : document.createElement('th'),
+ "sTitle": oDefaults.sTitle ? oDefaults.sTitle : nTh ? nTh.innerHTML : '',
+ "aDataSort": oDefaults.aDataSort ? oDefaults.aDataSort : [iCol],
+ "mData": oDefaults.mData ? oDefaults.oDefaults : iCol
+ });
+ oSettings.aoColumns.push(oCol);
+
+ /* Add a column specific filter */
+ if (oSettings.aoPreSearchCols[iCol] === undefined || oSettings.aoPreSearchCols[iCol] === null) {
+ oSettings.aoPreSearchCols[iCol] = $.extend({}, DataTable.models.oSearch);
+ }
+ else {
+ var oPre = oSettings.aoPreSearchCols[iCol];
+
+ /* Don't require that the user must specify bRegex, bSmart or bCaseInsensitive */
+ if (oPre.bRegex === undefined) {
+ oPre.bRegex = true;
+ }
+
+ if (oPre.bSmart === undefined) {
+ oPre.bSmart = true;
+ }
+
+ if (oPre.bCaseInsensitive === undefined) {
+ oPre.bCaseInsensitive = true;
+ }
+ }
+
+ /* Use the column options function to initialise classes etc */
+ _fnColumnOptions(oSettings, iCol, null);
+ }
+
+
+ /**
+ * Apply options for a column
+ * @param {object} oSettings dataTables settings object
+ * @param {int} iCol column index to consider
+ * @param {object} oOptions object with sType, bVisible and bSearchable etc
+ * @memberof DataTable#oApi
+ */
+ function _fnColumnOptions(oSettings, iCol, oOptions) {
+ var oCol = oSettings.aoColumns[iCol];
+
+ /* User specified column options */
+ if (oOptions !== undefined && oOptions !== null) {
+ /* Backwards compatibility for mDataProp */
+ if (oOptions.mDataProp && !oOptions.mData) {
+ oOptions.mData = oOptions.mDataProp;
+ }
+
+ if (oOptions.sType !== undefined) {
+ oCol.sType = oOptions.sType;
+ oCol._bAutoType = false;
+ }
+
+ $.extend(oCol, oOptions);
+ _fnMap(oCol, oOptions, "sWidth", "sWidthOrig");
+
+ /* iDataSort to be applied (backwards compatibility), but aDataSort will take
+ * priority if defined
+ */
+ if (oOptions.iDataSort !== undefined) {
+ oCol.aDataSort = [oOptions.iDataSort];
+ }
+ _fnMap(oCol, oOptions, "aDataSort");
+ }
+
+ /* Cache the data get and set functions for speed */
+ var mRender = oCol.mRender ? _fnGetObjectDataFn(oCol.mRender) : null;
+ var mData = _fnGetObjectDataFn(oCol.mData);
+
+ oCol.fnGetData = function (oData, sSpecific) {
+ var innerData = mData(oData, sSpecific);
+
+ if (oCol.mRender && (sSpecific && sSpecific !== '')) {
+ return mRender(innerData, sSpecific, oData);
+ }
+ return innerData;
+ };
+ oCol.fnSetData = _fnSetObjectDataFn(oCol.mData);
+
+ /* Feature sorting overrides column specific when off */
+ if (!oSettings.oFeatures.bSort) {
+ oCol.bSortable = false;
+ }
+
+ /* Check that the class assignment is correct for sorting */
+ if (!oCol.bSortable ||
+ ($.inArray('asc', oCol.asSorting) == -1 && $.inArray('desc', oCol.asSorting) == -1)) {
+ oCol.sSortingClass = oSettings.oClasses.sSortableNone;
+ oCol.sSortingClassJUI = "";
+ }
+ else if (oCol.bSortable ||
+ ($.inArray('asc', oCol.asSorting) == -1 && $.inArray('desc', oCol.asSorting) == -1)) {
+ oCol.sSortingClass = oSettings.oClasses.sSortable;
+ oCol.sSortingClassJUI = oSettings.oClasses.sSortJUI;
+ }
+ else if ($.inArray('asc', oCol.asSorting) != -1 && $.inArray('desc', oCol.asSorting) == -1) {
+ oCol.sSortingClass = oSettings.oClasses.sSortableAsc;
+ oCol.sSortingClassJUI = oSettings.oClasses.sSortJUIAscAllowed;
+ }
+ else if ($.inArray('asc', oCol.asSorting) == -1 && $.inArray('desc', oCol.asSorting) != -1) {
+ oCol.sSortingClass = oSettings.oClasses.sSortableDesc;
+ oCol.sSortingClassJUI = oSettings.oClasses.sSortJUIDescAllowed;
+ }
+ }
+
+
+ /**
+ * Adjust the table column widths for new data. Note: you would probably want to
+ * do a redraw after calling this function!
+ * @param {object} oSettings dataTables settings object
+ * @memberof DataTable#oApi
+ */
+ function _fnAdjustColumnSizing(oSettings) {
+ /* Not interested in doing column width calculation if auto-width is disabled */
+ if (oSettings.oFeatures.bAutoWidth === false) {
+ return false;
+ }
+
+ _fnCalculateColumnWidths(oSettings);
+ for (var i = 0, iLen = oSettings.aoColumns.length; i < iLen; i++) {
+ oSettings.aoColumns[i].nTh.style.width = oSettings.aoColumns[i].sWidth;
+ }
+ }
+
+
+ /**
+ * Covert the index of a visible column to the index in the data array (take account
+ * of hidden columns)
+ * @param {object} oSettings dataTables settings object
+ * @param {int} iMatch Visible column index to lookup
+ * @returns {int} i the data index
+ * @memberof DataTable#oApi
+ */
+ function _fnVisibleToColumnIndex(oSettings, iMatch) {
+ var aiVis = _fnGetColumns(oSettings, 'bVisible');
+
+ return typeof aiVis[iMatch] === 'number' ?
+ aiVis[iMatch] :
+ null;
+ }
+
+
+ /**
+ * Covert the index of an index in the data array and convert it to the visible
+ * column index (take account of hidden columns)
+ * @param {int} iMatch Column index to lookup
+ * @param {object} oSettings dataTables settings object
+ * @returns {int} i the data index
+ * @memberof DataTable#oApi
+ */
+ function _fnColumnIndexToVisible(oSettings, iMatch) {
+ var aiVis = _fnGetColumns(oSettings, 'bVisible');
+ var iPos = $.inArray(iMatch, aiVis);
+
+ return iPos !== -1 ? iPos : null;
+ }
+
+
+ /**
+ * Get the number of visible columns
+ * @param {object} oSettings dataTables settings object
+ * @returns {int} i the number of visible columns
+ * @memberof DataTable#oApi
+ */
+ function _fnVisbleColumns(oSettings) {
+ return _fnGetColumns(oSettings, 'bVisible').length;
+ }
+
+
+ /**
+ * Get an array of column indexes that match a given property
+ * @param {object} oSettings dataTables settings object
+ * @param {string} sParam Parameter in aoColumns to look for - typically
+ * bVisible or bSearchable
+ * @returns {array} Array of indexes with matched properties
+ * @memberof DataTable#oApi
+ */
+ function _fnGetColumns(oSettings, sParam) {
+ var a = [];
+
+ $.map(oSettings.aoColumns, function (val, i) {
+ if (val[sParam]) {
+ a.push(i);
+ }
+ });
+
+ return a;
+ }
+
+
+ /**
+ * Get the sort type based on an input string
+ * @param {string} sData data we wish to know the type of
+ * @returns {string} type (defaults to 'string' if no type can be detected)
+ * @memberof DataTable#oApi
+ */
+ function _fnDetectType(sData) {
+ var aTypes = DataTable.ext.aTypes;
+ var iLen = aTypes.length;
+
+ for (var i = 0; i < iLen; i++) {
+ var sType = aTypes[i](sData);
+ if (sType !== null) {
+ return sType;
+ }
+ }
+
+ return 'string';
+ }
+
+
+ /**
+ * Figure out how to reorder a display list
+ * @param {object} oSettings dataTables settings object
+ * @returns array {int} aiReturn index list for reordering
+ * @memberof DataTable#oApi
+ */
+ function _fnReOrderIndex(oSettings, sColumns) {
+ var aColumns = sColumns.split(',');
+ var aiReturn = [];
+
+ for (var i = 0, iLen = oSettings.aoColumns.length; i < iLen; i++) {
+ for (var j = 0; j < iLen; j++) {
+ if (oSettings.aoColumns[i].sName == aColumns[j]) {
+ aiReturn.push(j);
+ break;
+ }
+ }
+ }
+
+ return aiReturn;
+ }
+
+
+ /**
+ * Get the column ordering that DataTables expects
+ * @param {object} oSettings dataTables settings object
+ * @returns {string} comma separated list of names
+ * @memberof DataTable#oApi
+ */
+ function _fnColumnOrdering(oSettings) {
+ var sNames = '';
+ for (var i = 0, iLen = oSettings.aoColumns.length; i < iLen; i++) {
+ sNames += oSettings.aoColumns[i].sName + ',';
+ }
+ if (sNames.length == iLen) {
+ return "";
+ }
+ return sNames.slice(0, -1);
+ }
+
+
+ /**
+ * Take the column definitions and static columns arrays and calculate how
+ * they relate to column indexes. The callback function will then apply the
+ * definition found for a column to a suitable configuration object.
+ * @param {object} oSettings dataTables settings object
+ * @param {array} aoColDefs The aoColumnDefs array that is to be applied
+ * @param {array} aoCols The aoColumns array that defines columns individually
+ * @param {function} fn Callback function - takes two parameters, the calculated
+ * column index and the definition for that column.
+ * @memberof DataTable#oApi
+ */
+ function _fnApplyColumnDefs(oSettings, aoColDefs, aoCols, fn) {
+ var i, iLen, j, jLen, k, kLen;
+
+ // Column definitions with aTargets
+ if (aoColDefs) {
+ /* Loop over the definitions array - loop in reverse so first instance has priority */
+ for (i = aoColDefs.length - 1; i >= 0; i--) {
+ /* Each definition can target multiple columns, as it is an array */
+ var aTargets = aoColDefs[i].aTargets;
+ if (!$.isArray(aTargets)) {
+ _fnLog(oSettings, 1, 'aTargets must be an array of targets, not a ' + (typeof aTargets));
+ }
+
+ for (j = 0, jLen = aTargets.length; j < jLen; j++) {
+ if (typeof aTargets[j] === 'number' && aTargets[j] >= 0) {
+ /* Add columns that we don't yet know about */
+ while (oSettings.aoColumns.length <= aTargets[j]) {
+ _fnAddColumn(oSettings);
+ }
+
+ /* Integer, basic index */
+ fn(aTargets[j], aoColDefs[i]);
+ }
+ else if (typeof aTargets[j] === 'number' && aTargets[j] < 0) {
+ /* Negative integer, right to left column counting */
+ fn(oSettings.aoColumns.length + aTargets[j], aoColDefs[i]);
+ }
+ else if (typeof aTargets[j] === 'string') {
+ /* Class name matching on TH element */
+ for (k = 0, kLen = oSettings.aoColumns.length; k < kLen; k++) {
+ if (aTargets[j] == "_all" ||
+ $(oSettings.aoColumns[k].nTh).hasClass(aTargets[j])) {
+ fn(k, aoColDefs[i]);
+ }
+ }
+ }
+ }
+ }
+ }
+
+ // Statically defined columns array
+ if (aoCols) {
+ for (i = 0, iLen = aoCols.length; i < iLen; i++) {
+ fn(i, aoCols[i]);
+ }
+ }
+ }
+
+
+
+ /**
+ * Add a data array to the table, creating DOM node etc. This is the parallel to
+ * _fnGatherData, but for adding rows from a Javascript source, rather than a
+ * DOM source.
+ * @param {object} oSettings dataTables settings object
+ * @param {array} aData data array to be added
+ * @returns {int} >=0 if successful (index of new aoData entry), -1 if failed
+ * @memberof DataTable#oApi
+ */
+ function _fnAddData(oSettings, aDataSupplied) {
+ var oCol;
+
+ /* Take an independent copy of the data source so we can bash it about as we wish */
+ var aDataIn = ($.isArray(aDataSupplied)) ?
+ aDataSupplied.slice() :
+ $.extend(true, {}, aDataSupplied);
+
+ /* Create the object for storing information about this new row */
+ var iRow = oSettings.aoData.length;
+ var oData = $.extend(true, {}, DataTable.models.oRow);
+ oData._aData = aDataIn;
+ oSettings.aoData.push(oData);
+
+ /* Create the cells */
+ var nTd, sThisType;
+ for (var i = 0, iLen = oSettings.aoColumns.length; i < iLen; i++) {
+ oCol = oSettings.aoColumns[i];
+
+ /* Use rendered data for filtering / sorting */
+ if (typeof oCol.fnRender === 'function' && oCol.bUseRendered && oCol.mData !== null) {
+ _fnSetCellData(oSettings, iRow, i, _fnRender(oSettings, iRow, i));
+ }
+ else {
+ _fnSetCellData(oSettings, iRow, i, _fnGetCellData(oSettings, iRow, i));
+ }
+
+ /* See if we should auto-detect the column type */
+ if (oCol._bAutoType && oCol.sType != 'string') {
+ /* Attempt to auto detect the type - same as _fnGatherData() */
+ var sVarType = _fnGetCellData(oSettings, iRow, i, 'type');
+ if (sVarType !== null && sVarType !== '') {
+ sThisType = _fnDetectType(sVarType);
+ if (oCol.sType === null) {
+ oCol.sType = sThisType;
+ }
+ else if (oCol.sType != sThisType && oCol.sType != "html") {
+ /* String is always the 'fallback' option */
+ oCol.sType = 'string';
+ }
+ }
+ }
+ }
+
+ /* Add to the display array */
+ oSettings.aiDisplayMaster.push(iRow);
+
+ /* Create the DOM imformation */
+ if (!oSettings.oFeatures.bDeferRender) {
+ _fnCreateTr(oSettings, iRow);
+ }
+
+ return iRow;
+ }
+
+
+ /**
+ * Read in the data from the target table from the DOM
+ * @param {object} oSettings dataTables settings object
+ * @memberof DataTable#oApi
+ */
+ function _fnGatherData(oSettings) {
+ var iLoop, i, iLen, j, jLen, jInner,
+ nTds, nTrs, nTd, aLocalData, iThisIndex,
+ iRow, iRows, iColumn, iColumns, sNodeName,
+ oCol, oData;
+
+ /*
+ * Process by row first
+ * Add the data object for the whole table - storing the tr node. Note - no point in getting
+ * DOM based data if we are going to go and replace it with Ajax source data.
+ */
+ if (oSettings.bDeferLoading || oSettings.sAjaxSource === null) {
+ nTrs = oSettings.nTBody.childNodes;
+ for (i = 0, iLen = nTrs.length; i < iLen; i++) {
+ if (nTrs[i].nodeName.toUpperCase() == "TR") {
+ iThisIndex = oSettings.aoData.length;
+ nTrs[i]._DT_RowIndex = iThisIndex;
+ oSettings.aoData.push($.extend(true, {}, DataTable.models.oRow, {
+ "nTr": nTrs[i]
+ }));
+
+ oSettings.aiDisplayMaster.push(iThisIndex);
+ nTds = nTrs[i].childNodes;
+ jInner = 0;
+
+ for (j = 0, jLen = nTds.length; j < jLen; j++) {
+ sNodeName = nTds[j].nodeName.toUpperCase();
+ if (sNodeName == "TD" || sNodeName == "TH") {
+ _fnSetCellData(oSettings, iThisIndex, jInner, $.trim(nTds[j].innerHTML));
+ jInner++;
+ }
+ }
+ }
+ }
+ }
+
+ /* Gather in the TD elements of the Table - note that this is basically the same as
+ * fnGetTdNodes, but that function takes account of hidden columns, which we haven't yet
+ * setup!
+ */
+ nTrs = _fnGetTrNodes(oSettings);
+ nTds = [];
+ for (i = 0, iLen = nTrs.length; i < iLen; i++) {
+ for (j = 0, jLen = nTrs[i].childNodes.length; j < jLen; j++) {
+ nTd = nTrs[i].childNodes[j];
+ sNodeName = nTd.nodeName.toUpperCase();
+ if (sNodeName == "TD" || sNodeName == "TH") {
+ nTds.push(nTd);
+ }
+ }
+ }
+
+ /* Now process by column */
+ for (iColumn = 0, iColumns = oSettings.aoColumns.length; iColumn < iColumns; iColumn++) {
+ oCol = oSettings.aoColumns[iColumn];
+
+ /* Get the title of the column - unless there is a user set one */
+ if (oCol.sTitle === null) {
+ oCol.sTitle = oCol.nTh.innerHTML;
+ }
+
+ var
+ bAutoType = oCol._bAutoType,
+ bRender = typeof oCol.fnRender === 'function',
+ bClass = oCol.sClass !== null,
+ bVisible = oCol.bVisible,
+ nCell, sThisType, sRendered, sValType;
+
+ /* A single loop to rule them all (and be more efficient) */
+ if (bAutoType || bRender || bClass || !bVisible) {
+ for (iRow = 0, iRows = oSettings.aoData.length; iRow < iRows; iRow++) {
+ oData = oSettings.aoData[iRow];
+ nCell = nTds[(iRow * iColumns) + iColumn];
+
+ /* Type detection */
+ if (bAutoType && oCol.sType != 'string') {
+ sValType = _fnGetCellData(oSettings, iRow, iColumn, 'type');
+ if (sValType !== '') {
+ sThisType = _fnDetectType(sValType);
+ if (oCol.sType === null) {
+ oCol.sType = sThisType;
+ }
+ else if (oCol.sType != sThisType &&
+ oCol.sType != "html") {
+ /* String is always the 'fallback' option */
+ oCol.sType = 'string';
+ }
+ }
+ }
+
+ if (typeof oCol.mData === 'function') {
+ nCell.innerHTML = _fnGetCellData(oSettings, iRow, iColumn, 'display');
+ }
+
+ /* Rendering */
+ if (bRender) {
+ sRendered = _fnRender(oSettings, iRow, iColumn);
+ nCell.innerHTML = sRendered;
+ if (oCol.bUseRendered) {
+ /* Use the rendered data for filtering / sorting */
+ _fnSetCellData(oSettings, iRow, iColumn, sRendered);
+ }
+ }
+
+ /* Classes */
+ if (bClass) {
+ nCell.className += ' ' + oCol.sClass;
+ }
+
+ /* Column visibility */
+ if (!bVisible) {
+ oData._anHidden[iColumn] = nCell;
+ nCell.parentNode.removeChild(nCell);
+ }
+ else {
+ oData._anHidden[iColumn] = null;
+ }
+
+ if (oCol.fnCreatedCell) {
+ oCol.fnCreatedCell.call(oSettings.oInstance,
+ nCell, _fnGetCellData(oSettings, iRow, iColumn, 'display'), oData._aData, iRow, iColumn
+ );
+ }
+ }
+ }
+ }
+
+ /* Row created callbacks */
+ if (oSettings.aoRowCreatedCallback.length !== 0) {
+ for (i = 0, iLen = oSettings.aoData.length; i < iLen; i++) {
+ oData = oSettings.aoData[i];
+ _fnCallbackFire(oSettings, 'aoRowCreatedCallback', null, [oData.nTr, oData._aData, i]);
+ }
+ }
+ }
+
+
+ /**
+ * Take a TR element and convert it to an index in aoData
+ * @param {object} oSettings dataTables settings object
+ * @param {node} n the TR element to find
+ * @returns {int} index if the node is found, null if not
+ * @memberof DataTable#oApi
+ */
+ function _fnNodeToDataIndex(oSettings, n) {
+ return (n._DT_RowIndex !== undefined) ? n._DT_RowIndex : null;
+ }
+
+
+ /**
+ * Take a TD element and convert it into a column data index (not the visible index)
+ * @param {object} oSettings dataTables settings object
+ * @param {int} iRow The row number the TD/TH can be found in
+ * @param {node} n The TD/TH element to find
+ * @returns {int} index if the node is found, -1 if not
+ * @memberof DataTable#oApi
+ */
+ function _fnNodeToColumnIndex(oSettings, iRow, n) {
+ var anCells = _fnGetTdNodes(oSettings, iRow);
+
+ for (var i = 0, iLen = oSettings.aoColumns.length; i < iLen; i++) {
+ if (anCells[i] === n) {
+ return i;
+ }
+ }
+ return -1;
+ }
+
+
+ /**
+ * Get an array of data for a given row from the internal data cache
+ * @param {object} oSettings dataTables settings object
+ * @param {int} iRow aoData row id
+ * @param {string} sSpecific data get type ('type' 'filter' 'sort')
+ * @param {array} aiColumns Array of column indexes to get data from
+ * @returns {array} Data array
+ * @memberof DataTable#oApi
+ */
+ function _fnGetRowData(oSettings, iRow, sSpecific, aiColumns) {
+ var out = [];
+ for (var i = 0, iLen = aiColumns.length; i < iLen; i++) {
+ out.push(_fnGetCellData(oSettings, iRow, aiColumns[i], sSpecific));
+ }
+ return out;
+ }
+
+
+ /**
+ * Get the data for a given cell from the internal cache, taking into account data mapping
+ * @param {object} oSettings dataTables settings object
+ * @param {int} iRow aoData row id
+ * @param {int} iCol Column index
+ * @param {string} sSpecific data get type ('display', 'type' 'filter' 'sort')
+ * @returns {*} Cell data
+ * @memberof DataTable#oApi
+ */
+ function _fnGetCellData(oSettings, iRow, iCol, sSpecific) {
+ var sData;
+ var oCol = oSettings.aoColumns[iCol];
+ var oData = oSettings.aoData[iRow]._aData;
+
+ if ((sData = oCol.fnGetData(oData, sSpecific)) === undefined) {
+ if (oSettings.iDrawError != oSettings.iDraw && oCol.sDefaultContent === null) {
+ _fnLog(oSettings, 0, "Requested unknown parameter " +
+ (typeof oCol.mData == 'function' ? '{mData function}' : "'" + oCol.mData + "'") +
+ " from the data source for row " + iRow);
+ oSettings.iDrawError = oSettings.iDraw;
+ }
+ return oCol.sDefaultContent;
+ }
+
+ /* When the data source is null, we can use default column data */
+ if (sData === null && oCol.sDefaultContent !== null) {
+ sData = oCol.sDefaultContent;
+ }
+ else if (typeof sData === 'function') {
+ /* If the data source is a function, then we run it and use the return */
+ return sData();
+ }
+
+ if (sSpecific == 'display' && sData === null) {
+ return '';
+ }
+ return sData;
+ }
+
+
+ /**
+ * Set the value for a specific cell, into the internal data cache
+ * @param {object} oSettings dataTables settings object
+ * @param {int} iRow aoData row id
+ * @param {int} iCol Column index
+ * @param {*} val Value to set
+ * @memberof DataTable#oApi
+ */
+ function _fnSetCellData(oSettings, iRow, iCol, val) {
+ var oCol = oSettings.aoColumns[iCol];
+ var oData = oSettings.aoData[iRow]._aData;
+
+ oCol.fnSetData(oData, val);
+ }
+
+
+ // Private variable that is used to match array syntax in the data property object
+ var __reArray = /\[.*?\]$/;
+
+ /**
+ * Return a function that can be used to get data from a source object, taking
+ * into account the ability to use nested objects as a source
+ * @param {string|int|function} mSource The data source for the object
+ * @returns {function} Data get function
+ * @memberof DataTable#oApi
+ */
+ function _fnGetObjectDataFn(mSource) {
+ if (mSource === null) {
+ /* Give an empty string for rendering / sorting etc */
+ return function (data, type) {
+ return null;
+ };
+ }
+ else if (typeof mSource === 'function') {
+ return function (data, type, extra) {
+ return mSource(data, type, extra);
+ };
+ }
+ else if (typeof mSource === 'string' && (mSource.indexOf('.') !== -1 || mSource.indexOf('[') !== -1)) {
+ /* If there is a . in the source string then the data source is in a
+ * nested object so we loop over the data for each level to get the next
+ * level down. On each loop we test for undefined, and if found immediately
+ * return. This allows entire objects to be missing and sDefaultContent to
+ * be used if defined, rather than throwing an error
+ */
+ var fetchData = function (data, type, src) {
+ var a = src.split('.');
+ var arrayNotation, out, innerSrc;
+
+ if (src !== "") {
+ for (var i = 0, iLen = a.length; i < iLen; i++) {
+ // Check if we are dealing with an array notation request
+ arrayNotation = a[i].match(__reArray);
+
+ if (arrayNotation) {
+ a[i] = a[i].replace(__reArray, '');
+
+ // Condition allows simply [] to be passed in
+ if (a[i] !== "") {
+ data = data[a[i]];
+ }
+ out = [];
+
+ // Get the remainder of the nested object to get
+ a.splice(0, i + 1);
+ innerSrc = a.join('.');
+
+ // Traverse each entry in the array getting the properties requested
+ for (var j = 0, jLen = data.length; j < jLen; j++) {
+ out.push(fetchData(data[j], type, innerSrc));
+ }
+
+ // If a string is given in between the array notation indicators, that
+ // is used to join the strings together, otherwise an array is returned
+ var join = arrayNotation[0].substring(1, arrayNotation[0].length - 1);
+ data = (join === "") ? out : out.join(join);
+
+ // The inner call to fetchData has already traversed through the remainder
+ // of the source requested, so we exit from the loop
+ break;
+ }
+
+ if (data === null || data[a[i]] === undefined) {
+ return undefined;
+ }
+ data = data[a[i]];
+ }
+ }
+
+ return data;
+ };
+
+ return function (data, type) {
+ return fetchData(data, type, mSource);
+ };
+ }
+ else {
+ /* Array or flat object mapping */
+ return function (data, type) {
+ return data[mSource];
+ };
+ }
+ }
+
+
+ /**
+ * Return a function that can be used to set data from a source object, taking
+ * into account the ability to use nested objects as a source
+ * @param {string|int|function} mSource The data source for the object
+ * @returns {function} Data set function
+ * @memberof DataTable#oApi
+ */
+ function _fnSetObjectDataFn(mSource) {
+ if (mSource === null) {
+ /* Nothing to do when the data source is null */
+ return function (data, val) { };
+ }
+ else if (typeof mSource === 'function') {
+ return function (data, val) {
+ mSource(data, 'set', val);
+ };
+ }
+ else if (typeof mSource === 'string' && (mSource.indexOf('.') !== -1 || mSource.indexOf('[') !== -1)) {
+ /* Like the get, we need to get data from a nested object */
+ var setData = function (data, val, src) {
+ var a = src.split('.'), b;
+ var arrayNotation, o, innerSrc;
+
+ for (var i = 0, iLen = a.length - 1; i < iLen; i++) {
+ // Check if we are dealing with an array notation request
+ arrayNotation = a[i].match(__reArray);
+
+ if (arrayNotation) {
+ a[i] = a[i].replace(__reArray, '');
+ data[a[i]] = [];
+
+ // Get the remainder of the nested object to set so we can recurse
+ b = a.slice();
+ b.splice(0, i + 1);
+ innerSrc = b.join('.');
+
+ // Traverse each entry in the array setting the properties requested
+ for (var j = 0, jLen = val.length; j < jLen; j++) {
+ o = {};
+ setData(o, val[j], innerSrc);
+ data[a[i]].push(o);
+ }
+
+ // The inner call to setData has already traversed through the remainder
+ // of the source and has set the data, thus we can exit here
+ return;
+ }
+
+ // If the nested object doesn't currently exist - since we are
+ // trying to set the value - create it
+ if (data[a[i]] === null || data[a[i]] === undefined) {
+ data[a[i]] = {};
+ }
+ data = data[a[i]];
+ }
+
+ // If array notation is used, we just want to strip it and use the property name
+ // and assign the value. If it isn't used, then we get the result we want anyway
+ data[a[a.length - 1].replace(__reArray, '')] = val;
+ };
+
+ return function (data, val) {
+ return setData(data, val, mSource);
+ };
+ }
+ else {
+ /* Array or flat object mapping */
+ return function (data, val) {
+ data[mSource] = val;
+ };
+ }
+ }
+
+
+ /**
+ * Return an array with the full table data
+ * @param {object} oSettings dataTables settings object
+ * @returns array {array} aData Master data array
+ * @memberof DataTable#oApi
+ */
+ function _fnGetDataMaster(oSettings) {
+ var aData = [];
+ var iLen = oSettings.aoData.length;
+ for (var i = 0; i < iLen; i++) {
+ aData.push(oSettings.aoData[i]._aData);
+ }
+ return aData;
+ }
+
+
+ /**
+ * Nuke the table
+ * @param {object} oSettings dataTables settings object
+ * @memberof DataTable#oApi
+ */
+ function _fnClearTable(oSettings) {
+ oSettings.aoData.splice(0, oSettings.aoData.length);
+ oSettings.aiDisplayMaster.splice(0, oSettings.aiDisplayMaster.length);
+ oSettings.aiDisplay.splice(0, oSettings.aiDisplay.length);
+ _fnCalculateEnd(oSettings);
+ }
+
+
+ /**
+ * Take an array of integers (index array) and remove a target integer (value - not
+ * the key!)
+ * @param {array} a Index array to target
+ * @param {int} iTarget value to find
+ * @memberof DataTable#oApi
+ */
+ function _fnDeleteIndex(a, iTarget) {
+ var iTargetIndex = -1;
+
+ for (var i = 0, iLen = a.length; i < iLen; i++) {
+ if (a[i] == iTarget) {
+ iTargetIndex = i;
+ }
+ else if (a[i] > iTarget) {
+ a[i]--;
+ }
+ }
+
+ if (iTargetIndex != -1) {
+ a.splice(iTargetIndex, 1);
+ }
+ }
+
+
+ /**
+ * Call the developer defined fnRender function for a given cell (row/column) with
+ * the required parameters and return the result.
+ * @param {object} oSettings dataTables settings object
+ * @param {int} iRow aoData index for the row
+ * @param {int} iCol aoColumns index for the column
+ * @returns {*} Return of the developer's fnRender function
+ * @memberof DataTable#oApi
+ */
+ function _fnRender(oSettings, iRow, iCol) {
+ var oCol = oSettings.aoColumns[iCol];
+
+ return oCol.fnRender({
+ "iDataRow": iRow,
+ "iDataColumn": iCol,
+ "oSettings": oSettings,
+ "aData": oSettings.aoData[iRow]._aData,
+ "mDataProp": oCol.mData
+ }, _fnGetCellData(oSettings, iRow, iCol, 'display'));
+ }
+
+ /**
+ * Create a new TR element (and it's TD children) for a row
+ * @param {object} oSettings dataTables settings object
+ * @param {int} iRow Row to consider
+ * @memberof DataTable#oApi
+ */
+ function _fnCreateTr(oSettings, iRow) {
+ var oData = oSettings.aoData[iRow];
+ var nTd;
+
+ if (oData.nTr === null) {
+ oData.nTr = document.createElement('tr');
+
+ /* Use a private property on the node to allow reserve mapping from the node
+ * to the aoData array for fast look up
+ */
+ oData.nTr._DT_RowIndex = iRow;
+
+ /* Special parameters can be given by the data source to be used on the row */
+ if (oData._aData.DT_RowId) {
+ oData.nTr.id = oData._aData.DT_RowId;
+ }
+
+ if (oData._aData.DT_RowClass) {
+ $(oData.nTr).addClass(oData._aData.DT_RowClass);
+ }
+
+ /* Process each column */
+ for (var i = 0, iLen = oSettings.aoColumns.length; i < iLen; i++) {
+ var oCol = oSettings.aoColumns[i];
+ nTd = document.createElement(oCol.sCellType);
+
+ /* Render if needed - if bUseRendered is true then we already have the rendered
+ * value in the data source - so can just use that
+ */
+ nTd.innerHTML = (typeof oCol.fnRender === 'function' && (!oCol.bUseRendered || oCol.mData === null)) ?
+ _fnRender(oSettings, iRow, i) :
+ _fnGetCellData(oSettings, iRow, i, 'display');
+
+ /* Add user defined class */
+ if (oCol.sClass !== null) {
+ nTd.className = oCol.sClass;
+ }
+
+ if (oCol.bVisible) {
+ oData.nTr.appendChild(nTd);
+ oData._anHidden[i] = null;
+ }
+ else {
+ oData._anHidden[i] = nTd;
+ }
+
+ if (oCol.fnCreatedCell) {
+ oCol.fnCreatedCell.call(oSettings.oInstance,
+ nTd, _fnGetCellData(oSettings, iRow, i, 'display'), oData._aData, iRow, i
+ );
+ }
+ }
+
+ _fnCallbackFire(oSettings, 'aoRowCreatedCallback', null, [oData.nTr, oData._aData, iRow]);
+ }
+ }
+
+
+ /**
+ * Create the HTML header for the table
+ * @param {object} oSettings dataTables settings object
+ * @memberof DataTable#oApi
+ */
+ function _fnBuildHead(oSettings) {
+ var i, nTh, iLen, j, jLen;
+ var iThs = oSettings.nTHead.getElementsByTagName('th').length;
+ var iCorrector = 0;
+ var jqChildren;
+
+ /* If there is a header in place - then use it - otherwise it's going to get nuked... */
+ if (iThs !== 0) {
+ /* We've got a thead from the DOM, so remove hidden columns and apply width to vis cols */
+ for (i = 0, iLen = oSettings.aoColumns.length; i < iLen; i++) {
+ nTh = oSettings.aoColumns[i].nTh;
+ nTh.setAttribute('role', 'columnheader');
+ if (oSettings.aoColumns[i].bSortable) {
+ nTh.setAttribute('tabindex', oSettings.iTabIndex);
+ nTh.setAttribute('aria-controls', oSettings.sTableId);
+ }
+
+ if (oSettings.aoColumns[i].sClass !== null) {
+ $(nTh).addClass(oSettings.aoColumns[i].sClass);
+ }
+
+ /* Set the title of the column if it is user defined (not what was auto detected) */
+ if (oSettings.aoColumns[i].sTitle != nTh.innerHTML) {
+ nTh.innerHTML = oSettings.aoColumns[i].sTitle;
+ }
+ }
+ }
+ else {
+ /* We don't have a header in the DOM - so we are going to have to create one */
+ var nTr = document.createElement("tr");
+
+ for (i = 0, iLen = oSettings.aoColumns.length; i < iLen; i++) {
+ nTh = oSettings.aoColumns[i].nTh;
+ nTh.innerHTML = oSettings.aoColumns[i].sTitle;
+ nTh.setAttribute('tabindex', '0');
+
+ if (oSettings.aoColumns[i].sClass !== null) {
+ $(nTh).addClass(oSettings.aoColumns[i].sClass);
+ }
+
+ nTr.appendChild(nTh);
+ }
+ $(oSettings.nTHead).html('')[0].appendChild(nTr);
+ _fnDetectHeader(oSettings.aoHeader, oSettings.nTHead);
+ }
+
+ /* ARIA role for the rows */
+ $(oSettings.nTHead).children('tr').attr('role', 'row');
+
+ /* Add the extra markup needed by jQuery UI's themes */
+ if (oSettings.bJUI) {
+ for (i = 0, iLen = oSettings.aoColumns.length; i < iLen; i++) {
+ nTh = oSettings.aoColumns[i].nTh;
+
+ var nDiv = document.createElement('div');
+ nDiv.className = oSettings.oClasses.sSortJUIWrapper;
+ $(nTh).contents().appendTo(nDiv);
+
+ var nSpan = document.createElement('span');
+ nSpan.className = oSettings.oClasses.sSortIcon;
+ nDiv.appendChild(nSpan);
+ nTh.appendChild(nDiv);
+ }
+ }
+
+ if (oSettings.oFeatures.bSort) {
+ for (i = 0; i < oSettings.aoColumns.length; i++) {
+ if (oSettings.aoColumns[i].bSortable !== false) {
+ _fnSortAttachListener(oSettings, oSettings.aoColumns[i].nTh, i);
+ }
+ else {
+ $(oSettings.aoColumns[i].nTh).addClass(oSettings.oClasses.sSortableNone);
+ }
+ }
+ }
+
+ /* Deal with the footer - add classes if required */
+ if (oSettings.oClasses.sFooterTH !== "") {
+ $(oSettings.nTFoot).children('tr').children('th').addClass(oSettings.oClasses.sFooterTH);
+ }
+
+ /* Cache the footer elements */
+ if (oSettings.nTFoot !== null) {
+ var anCells = _fnGetUniqueThs(oSettings, null, oSettings.aoFooter);
+ for (i = 0, iLen = oSettings.aoColumns.length; i < iLen; i++) {
+ if (anCells[i]) {
+ oSettings.aoColumns[i].nTf = anCells[i];
+ if (oSettings.aoColumns[i].sClass) {
+ $(anCells[i]).addClass(oSettings.aoColumns[i].sClass);
+ }
+ }
+ }
+ }
+ }
+
+
+ /**
+ * Draw the header (or footer) element based on the column visibility states. The
+ * methodology here is to use the layout array from _fnDetectHeader, modified for
+ * the instantaneous column visibility, to construct the new layout. The grid is
+ * traversed over cell at a time in a rows x columns grid fashion, although each
+ * cell insert can cover multiple elements in the grid - which is tracks using the
+ * aApplied array. Cell inserts in the grid will only occur where there isn't
+ * already a cell in that position.
+ * @param {object} oSettings dataTables settings object
+ * @param array {objects} aoSource Layout array from _fnDetectHeader
+ * @param {boolean} [bIncludeHidden=false] If true then include the hidden columns in the calc,
+ * @memberof DataTable#oApi
+ */
+ function _fnDrawHead(oSettings, aoSource, bIncludeHidden) {
+ var i, iLen, j, jLen, k, kLen, n, nLocalTr;
+ var aoLocal = [];
+ var aApplied = [];
+ var iColumns = oSettings.aoColumns.length;
+ var iRowspan, iColspan;
+
+ if (bIncludeHidden === undefined) {
+ bIncludeHidden = false;
+ }
+
+ /* Make a copy of the master layout array, but without the visible columns in it */
+ for (i = 0, iLen = aoSource.length; i < iLen; i++) {
+ aoLocal[i] = aoSource[i].slice();
+ aoLocal[i].nTr = aoSource[i].nTr;
+
+ /* Remove any columns which are currently hidden */
+ for (j = iColumns - 1; j >= 0; j--) {
+ if (!oSettings.aoColumns[j].bVisible && !bIncludeHidden) {
+ aoLocal[i].splice(j, 1);
+ }
+ }
+
+ /* Prep the applied array - it needs an element for each row */
+ aApplied.push([]);
+ }
+
+ for (i = 0, iLen = aoLocal.length; i < iLen; i++) {
+ nLocalTr = aoLocal[i].nTr;
+
+ /* All cells are going to be replaced, so empty out the row */
+ if (nLocalTr) {
+ while ((n = nLocalTr.firstChild)) {
+ nLocalTr.removeChild(n);
+ }
+ }
+
+ for (j = 0, jLen = aoLocal[i].length; j < jLen; j++) {
+ iRowspan = 1;
+ iColspan = 1;
+
+ /* Check to see if there is already a cell (row/colspan) covering our target
+ * insert point. If there is, then there is nothing to do.
+ */
+ if (aApplied[i][j] === undefined) {
+ nLocalTr.appendChild(aoLocal[i][j].cell);
+ aApplied[i][j] = 1;
+
+ /* Expand the cell to cover as many rows as needed */
+ while (aoLocal[i + iRowspan] !== undefined &&
+ aoLocal[i][j].cell == aoLocal[i + iRowspan][j].cell) {
+ aApplied[i + iRowspan][j] = 1;
+ iRowspan++;
+ }
+
+ /* Expand the cell to cover as many columns as needed */
+ while (aoLocal[i][j + iColspan] !== undefined &&
+ aoLocal[i][j].cell == aoLocal[i][j + iColspan].cell) {
+ /* Must update the applied array over the rows for the columns */
+ for (k = 0; k < iRowspan; k++) {
+ aApplied[i + k][j + iColspan] = 1;
+ }
+ iColspan++;
+ }
+
+ /* Do the actual expansion in the DOM */
+ aoLocal[i][j].cell.rowSpan = iRowspan;
+ aoLocal[i][j].cell.colSpan = iColspan;
+ }
+ }
+ }
+ }
+
+
+ /**
+ * Insert the required TR nodes into the table for display
+ * @param {object} oSettings dataTables settings object
+ * @memberof DataTable#oApi
+ */
+ function _fnDraw(oSettings) {
+ /* Provide a pre-callback function which can be used to cancel the draw is false is returned */
+ var aPreDraw = _fnCallbackFire(oSettings, 'aoPreDrawCallback', 'preDraw', [oSettings]);
+ if ($.inArray(false, aPreDraw) !== -1) {
+ _fnProcessingDisplay(oSettings, false);
+ return;
+ }
+
+ var i, iLen, n;
+ var anRows = [];
+ var iRowCount = 0;
+ var iStripes = oSettings.asStripeClasses.length;
+ var iOpenRows = oSettings.aoOpenRows.length;
+
+ oSettings.bDrawing = true;
+
+ /* Check and see if we have an initial draw position from state saving */
+ if (oSettings.iInitDisplayStart !== undefined && oSettings.iInitDisplayStart != -1) {
+ if (oSettings.oFeatures.bServerSide) {
+ oSettings._iDisplayStart = oSettings.iInitDisplayStart;
+ }
+ else {
+ oSettings._iDisplayStart = (oSettings.iInitDisplayStart >= oSettings.fnRecordsDisplay()) ?
+ 0 : oSettings.iInitDisplayStart;
+ }
+ oSettings.iInitDisplayStart = -1;
+ _fnCalculateEnd(oSettings);
+ }
+
+ /* Server-side processing draw intercept */
+ if (oSettings.bDeferLoading) {
+ oSettings.bDeferLoading = false;
+ oSettings.iDraw++;
+ }
+ else if (!oSettings.oFeatures.bServerSide) {
+ oSettings.iDraw++;
+ }
+ else if (!oSettings.bDestroying && !_fnAjaxUpdate(oSettings)) {
+ return;
+ }
+
+ if (oSettings.aiDisplay.length !== 0) {
+ var iStart = oSettings._iDisplayStart;
+ var iEnd = oSettings._iDisplayEnd;
+
+ if (oSettings.oFeatures.bServerSide) {
+ iStart = 0;
+ iEnd = oSettings.aoData.length;
+ }
+
+ for (var j = iStart; j < iEnd; j++) {
+ var aoData = oSettings.aoData[oSettings.aiDisplay[j]];
+ if (aoData.nTr === null) {
+ _fnCreateTr(oSettings, oSettings.aiDisplay[j]);
+ }
+
+ var nRow = aoData.nTr;
+
+ /* Remove the old striping classes and then add the new one */
+ if (iStripes !== 0) {
+ var sStripe = oSettings.asStripeClasses[iRowCount % iStripes];
+ if (aoData._sRowStripe != sStripe) {
+ $(nRow).removeClass(aoData._sRowStripe).addClass(sStripe);
+ aoData._sRowStripe = sStripe;
+ }
+ }
+
+ /* Row callback functions - might want to manipulate the row */
+ _fnCallbackFire(oSettings, 'aoRowCallback', null,
+ [nRow, oSettings.aoData[oSettings.aiDisplay[j]]._aData, iRowCount, j]);
+
+ anRows.push(nRow);
+ iRowCount++;
+
+ /* If there is an open row - and it is attached to this parent - attach it on redraw */
+ if (iOpenRows !== 0) {
+ for (var k = 0; k < iOpenRows; k++) {
+ if (nRow == oSettings.aoOpenRows[k].nParent) {
+ anRows.push(oSettings.aoOpenRows[k].nTr);
+ break;
+ }
+ }
+ }
+ }
+ }
+ else {
+ /* Table is empty - create a row with an empty message in it */
+ anRows[0] = document.createElement('tr');
+
+ if (oSettings.asStripeClasses[0]) {
+ anRows[0].className = oSettings.asStripeClasses[0];
+ }
+
+ var oLang = oSettings.oLanguage;
+ var sZero = oLang.sZeroRecords;
+ if (oSettings.iDraw == 1 && oSettings.sAjaxSource !== null && !oSettings.oFeatures.bServerSide) {
+ sZero = oLang.sLoadingRecords;
+ }
+ else if (oLang.sEmptyTable && oSettings.fnRecordsTotal() === 0) {
+ sZero = oLang.sEmptyTable;
+ }
+
+ var nTd = document.createElement('td');
+ nTd.setAttribute('valign', "top");
+ nTd.colSpan = _fnVisbleColumns(oSettings);
+ nTd.className = oSettings.oClasses.sRowEmpty;
+ nTd.innerHTML = _fnInfoMacros(oSettings, sZero);
+
+ anRows[iRowCount].appendChild(nTd);
+ }
+
+ /* Header and footer callbacks */
+ _fnCallbackFire(oSettings, 'aoHeaderCallback', 'header', [$(oSettings.nTHead).children('tr')[0],
+ _fnGetDataMaster(oSettings), oSettings._iDisplayStart, oSettings.fnDisplayEnd(), oSettings.aiDisplay]);
+
+ _fnCallbackFire(oSettings, 'aoFooterCallback', 'footer', [$(oSettings.nTFoot).children('tr')[0],
+ _fnGetDataMaster(oSettings), oSettings._iDisplayStart, oSettings.fnDisplayEnd(), oSettings.aiDisplay]);
+
+ /*
+ * Need to remove any old row from the display - note we can't just empty the tbody using
+ * $().html('') since this will unbind the jQuery event handlers (even although the node
+ * still exists!) - equally we can't use innerHTML, since IE throws an exception.
+ */
+ var
+ nAddFrag = document.createDocumentFragment(),
+ nRemoveFrag = document.createDocumentFragment(),
+ nBodyPar, nTrs;
+
+ if (oSettings.nTBody) {
+ nBodyPar = oSettings.nTBody.parentNode;
+ nRemoveFrag.appendChild(oSettings.nTBody);
+
+ /* When doing infinite scrolling, only remove child rows when sorting, filtering or start
+ * up. When not infinite scroll, always do it.
+ */
+ if (!oSettings.oScroll.bInfinite || !oSettings._bInitComplete ||
+ oSettings.bSorted || oSettings.bFiltered) {
+ while ((n = oSettings.nTBody.firstChild)) {
+ oSettings.nTBody.removeChild(n);
+ }
+ }
+
+ /* Put the draw table into the dom */
+ for (i = 0, iLen = anRows.length; i < iLen; i++) {
+ nAddFrag.appendChild(anRows[i]);
+ }
+
+ oSettings.nTBody.appendChild(nAddFrag);
+ if (nBodyPar !== null) {
+ nBodyPar.appendChild(oSettings.nTBody);
+ }
+ }
+
+ /* Call all required callback functions for the end of a draw */
+ _fnCallbackFire(oSettings, 'aoDrawCallback', 'draw', [oSettings]);
+
+ /* Draw is complete, sorting and filtering must be as well */
+ oSettings.bSorted = false;
+ oSettings.bFiltered = false;
+ oSettings.bDrawing = false;
+
+ if (oSettings.oFeatures.bServerSide) {
+ _fnProcessingDisplay(oSettings, false);
+ if (!oSettings._bInitComplete) {
+ _fnInitComplete(oSettings);
+ }
+ }
+ }
+
+
+ /**
+ * Redraw the table - taking account of the various features which are enabled
+ * @param {object} oSettings dataTables settings object
+ * @memberof DataTable#oApi
+ */
+ function _fnReDraw(oSettings) {
+ if (oSettings.oFeatures.bSort) {
+ /* Sorting will refilter and draw for us */
+ _fnSort(oSettings, oSettings.oPreviousSearch);
+ }
+ else if (oSettings.oFeatures.bFilter) {
+ /* Filtering will redraw for us */
+ _fnFilterComplete(oSettings, oSettings.oPreviousSearch);
+ }
+ else {
+ _fnCalculateEnd(oSettings);
+ _fnDraw(oSettings);
+ }
+ }
+
+
+ /**
+ * Add the options to the page HTML for the table
+ * @param {object} oSettings dataTables settings object
+ * @memberof DataTable#oApi
+ */
+ function _fnAddOptionsHtml(oSettings) {
+ /*
+ * Create a temporary, empty, div which we can later on replace with what we have generated
+ * we do it this way to rendering the 'options' html offline - speed :-)
+ */
+ var nHolding = $('
')[0];
+ oSettings.nTable.parentNode.insertBefore(nHolding, oSettings.nTable);
+
+ /*
+ * All DataTables are wrapped in a div
+ */
+ oSettings.nTableWrapper = $('
')[0];
+ oSettings.nTableReinsertBefore = oSettings.nTable.nextSibling;
+
+ /* Track where we want to insert the option */
+ var nInsertNode = oSettings.nTableWrapper;
+
+ /* Loop over the user set positioning and place the elements as needed */
+ var aDom = oSettings.sDom.split('');
+ var nTmp, iPushFeature, cOption, nNewNode, cNext, sAttr, j;
+ for (var i = 0; i < aDom.length; i++) {
+ iPushFeature = 0;
+ cOption = aDom[i];
+
+ if (cOption == '<') {
+ /* New container div */
+ nNewNode = $('
')[0];
+
+ /* Check to see if we should append an id and/or a class name to the container */
+ cNext = aDom[i + 1];
+ if (cNext == "'" || cNext == '"') {
+ sAttr = "";
+ j = 2;
+ while (aDom[i + j] != cNext) {
+ sAttr += aDom[i + j];
+ j++;
+ }
+
+ /* Replace jQuery UI constants */
+ if (sAttr == "H") {
+ sAttr = oSettings.oClasses.sJUIHeader;
+ }
+ else if (sAttr == "F") {
+ sAttr = oSettings.oClasses.sJUIFooter;
+ }
+
+ /* The attribute can be in the format of "#id.class", "#id" or "class" This logic
+ * breaks the string into parts and applies them as needed
+ */
+ if (sAttr.indexOf('.') != -1) {
+ var aSplit = sAttr.split('.');
+ nNewNode.id = aSplit[0].substr(1, aSplit[0].length - 1);
+ nNewNode.className = aSplit[1];
+ }
+ else if (sAttr.charAt(0) == "#") {
+ nNewNode.id = sAttr.substr(1, sAttr.length - 1);
+ }
+ else {
+ nNewNode.className = sAttr;
+ }
+
+ i += j; /* Move along the position array */
+ }
+
+ nInsertNode.appendChild(nNewNode);
+ nInsertNode = nNewNode;
+ }
+ else if (cOption == '>') {
+ /* End container div */
+ nInsertNode = nInsertNode.parentNode;
+ }
+ else if (cOption == 'l' && oSettings.oFeatures.bPaginate && oSettings.oFeatures.bLengthChange) {
+ /* Length */
+ nTmp = _fnFeatureHtmlLength(oSettings);
+ iPushFeature = 1;
+ }
+ else if (cOption == 'f' && oSettings.oFeatures.bFilter) {
+ /* Filter */
+ nTmp = _fnFeatureHtmlFilter(oSettings);
+ iPushFeature = 1;
+ }
+ else if (cOption == 'r' && oSettings.oFeatures.bProcessing) {
+ /* pRocessing */
+ nTmp = _fnFeatureHtmlProcessing(oSettings);
+ iPushFeature = 1;
+ }
+ else if (cOption == 't') {
+ /* Table */
+ nTmp = _fnFeatureHtmlTable(oSettings);
+ iPushFeature = 1;
+ }
+ else if (cOption == 'i' && oSettings.oFeatures.bInfo) {
+ /* Info */
+ nTmp = _fnFeatureHtmlInfo(oSettings);
+ iPushFeature = 1;
+ }
+ else if (cOption == 'p' && oSettings.oFeatures.bPaginate) {
+ /* Pagination */
+ nTmp = _fnFeatureHtmlPaginate(oSettings);
+ iPushFeature = 1;
+ }
+ else if (DataTable.ext.aoFeatures.length !== 0) {
+ /* Plug-in features */
+ var aoFeatures = DataTable.ext.aoFeatures;
+ for (var k = 0, kLen = aoFeatures.length; k < kLen; k++) {
+ if (cOption == aoFeatures[k].cFeature) {
+ nTmp = aoFeatures[k].fnInit(oSettings);
+ if (nTmp) {
+ iPushFeature = 1;
+ }
+ break;
+ }
+ }
+ }
+
+ /* Add to the 2D features array */
+ if (iPushFeature == 1 && nTmp !== null) {
+ if (typeof oSettings.aanFeatures[cOption] !== 'object') {
+ oSettings.aanFeatures[cOption] = [];
+ }
+ oSettings.aanFeatures[cOption].push(nTmp);
+ nInsertNode.appendChild(nTmp);
+ }
+ }
+
+ /* Built our DOM structure - replace the holding div with what we want */
+ nHolding.parentNode.replaceChild(oSettings.nTableWrapper, nHolding);
+ }
+
+
+ /**
+ * Use the DOM source to create up an array of header cells. The idea here is to
+ * create a layout grid (array) of rows x columns, which contains a reference
+ * to the cell that that point in the grid (regardless of col/rowspan), such that
+ * any column / row could be removed and the new grid constructed
+ * @param array {object} aLayout Array to store the calculated layout in
+ * @param {node} nThead The header/footer element for the table
+ * @memberof DataTable#oApi
+ */
+ function _fnDetectHeader(aLayout, nThead) {
+ var nTrs = $(nThead).children('tr');
+ var nCell;
+ var i, j, k, l, iLen, jLen, iColShifted;
+ var fnShiftCol = function (a, i, j) {
+ while (a[i][j]) {
+ j++;
+ }
+ return j;
+ };
+
+ aLayout.splice(0, aLayout.length);
+
+ /* We know how many rows there are in the layout - so prep it */
+ for (i = 0, iLen = nTrs.length; i < iLen; i++) {
+ aLayout.push([]);
+ }
+
+ /* Calculate a layout array */
+ for (i = 0, iLen = nTrs.length; i < iLen; i++) {
+ var iColumn = 0;
+
+ /* For every cell in the row... */
+ for (j = 0, jLen = nTrs[i].childNodes.length; j < jLen; j++) {
+ nCell = nTrs[i].childNodes[j];
+
+ if (nCell.nodeName.toUpperCase() == "TD" ||
+ nCell.nodeName.toUpperCase() == "TH") {
+ /* Get the col and rowspan attributes from the DOM and sanitise them */
+ var iColspan = nCell.getAttribute('colspan') * 1;
+ var iRowspan = nCell.getAttribute('rowspan') * 1;
+ iColspan = (!iColspan || iColspan === 0 || iColspan === 1) ? 1 : iColspan;
+ iRowspan = (!iRowspan || iRowspan === 0 || iRowspan === 1) ? 1 : iRowspan;
+
+ /* There might be colspan cells already in this row, so shift our target
+ * accordingly
+ */
+ iColShifted = fnShiftCol(aLayout, i, iColumn);
+
+ /* If there is col / rowspan, copy the information into the layout grid */
+ for (l = 0; l < iColspan; l++) {
+ for (k = 0; k < iRowspan; k++) {
+ aLayout[i + k][iColShifted + l] = {
+ "cell": nCell,
+ "unique": iColspan == 1 ? true : false
+ };
+ aLayout[i + k].nTr = nTrs[i];
+ }
+ }
+ }
+ }
+ }
+ }
+
+
+ /**
+ * Get an array of unique th elements, one for each column
+ * @param {object} oSettings dataTables settings object
+ * @param {node} nHeader automatically detect the layout from this node - optional
+ * @param {array} aLayout thead/tfoot layout from _fnDetectHeader - optional
+ * @returns array {node} aReturn list of unique th's
+ * @memberof DataTable#oApi
+ */
+ function _fnGetUniqueThs(oSettings, nHeader, aLayout) {
+ var aReturn = [];
+ if (!aLayout) {
+ aLayout = oSettings.aoHeader;
+ if (nHeader) {
+ aLayout = [];
+ _fnDetectHeader(aLayout, nHeader);
+ }
+ }
+
+ for (var i = 0, iLen = aLayout.length; i < iLen; i++) {
+ for (var j = 0, jLen = aLayout[i].length; j < jLen; j++) {
+ if (aLayout[i][j].unique &&
+ (!aReturn[j] || !oSettings.bSortCellsTop)) {
+ aReturn[j] = aLayout[i][j].cell;
+ }
+ }
+ }
+
+ return aReturn;
+ }
+
+
+
+ /**
+ * Update the table using an Ajax call
+ * @param {object} oSettings dataTables settings object
+ * @returns {boolean} Block the table drawing or not
+ * @memberof DataTable#oApi
+ */
+ function _fnAjaxUpdate(oSettings) {
+ if (oSettings.bAjaxDataGet) {
+ oSettings.iDraw++;
+ _fnProcessingDisplay(oSettings, true);
+ var iColumns = oSettings.aoColumns.length;
+ var aoData = _fnAjaxParameters(oSettings);
+ _fnServerParams(oSettings, aoData);
+
+ oSettings.fnServerData.call(oSettings.oInstance, oSettings.sAjaxSource, aoData,
+ function (json) {
+ _fnAjaxUpdateDraw(oSettings, json);
+ }, oSettings);
+ return false;
+ }
+ else {
+ return true;
+ }
+ }
+
+
+ /**
+ * Build up the parameters in an object needed for a server-side processing request
+ * @param {object} oSettings dataTables settings object
+ * @returns {bool} block the table drawing or not
+ * @memberof DataTable#oApi
+ */
+ function _fnAjaxParameters(oSettings) {
+ var iColumns = oSettings.aoColumns.length;
+ var aoData = [], mDataProp, aaSort, aDataSort;
+ var i, j;
+
+ aoData.push({ "name": "sEcho", "value": oSettings.iDraw });
+ aoData.push({ "name": "iColumns", "value": iColumns });
+ aoData.push({ "name": "sColumns", "value": _fnColumnOrdering(oSettings) });
+ aoData.push({ "name": "iDisplayStart", "value": oSettings._iDisplayStart });
+ aoData.push({ "name": "iDisplayLength", "value": oSettings.oFeatures.bPaginate !== false ?
+ oSettings._iDisplayLength : -1
+ });
+
+ for (i = 0; i < iColumns; i++) {
+ mDataProp = oSettings.aoColumns[i].mData;
+ aoData.push({ "name": "mDataProp_" + i, "value": typeof (mDataProp) === "function" ? 'function' : mDataProp });
+ }
+
+ /* Filtering */
+ if (oSettings.oFeatures.bFilter !== false) {
+ aoData.push({ "name": "sSearch", "value": oSettings.oPreviousSearch.sSearch });
+ aoData.push({ "name": "bRegex", "value": oSettings.oPreviousSearch.bRegex });
+ for (i = 0; i < iColumns; i++) {
+ aoData.push({ "name": "sSearch_" + i, "value": oSettings.aoPreSearchCols[i].sSearch });
+ aoData.push({ "name": "bRegex_" + i, "value": oSettings.aoPreSearchCols[i].bRegex });
+ aoData.push({ "name": "bSearchable_" + i, "value": oSettings.aoColumns[i].bSearchable });
+ }
+ }
+
+ /* Sorting */
+ if (oSettings.oFeatures.bSort !== false) {
+ var iCounter = 0;
+
+ aaSort = (oSettings.aaSortingFixed !== null) ?
+ oSettings.aaSortingFixed.concat(oSettings.aaSorting) :
+ oSettings.aaSorting.slice();
+
+ for (i = 0; i < aaSort.length; i++) {
+ aDataSort = oSettings.aoColumns[aaSort[i][0]].aDataSort;
+
+ for (j = 0; j < aDataSort.length; j++) {
+ aoData.push({ "name": "iSortCol_" + iCounter, "value": aDataSort[j] });
+ aoData.push({ "name": "sSortDir_" + iCounter, "value": aaSort[i][1] });
+ iCounter++;
+ }
+ }
+ aoData.push({ "name": "iSortingCols", "value": iCounter });
+
+ for (i = 0; i < iColumns; i++) {
+ aoData.push({ "name": "bSortable_" + i, "value": oSettings.aoColumns[i].bSortable });
+ }
+ }
+
+ return aoData;
+ }
+
+
+ /**
+ * Add Ajax parameters from plug-ins
+ * @param {object} oSettings dataTables settings object
+ * @param array {objects} aoData name/value pairs to send to the server
+ * @memberof DataTable#oApi
+ */
+ function _fnServerParams(oSettings, aoData) {
+ _fnCallbackFire(oSettings, 'aoServerParams', 'serverParams', [aoData]);
+ }
+
+
+ /**
+ * Data the data from the server (nuking the old) and redraw the table
+ * @param {object} oSettings dataTables settings object
+ * @param {object} json json data return from the server.
+ * @param {string} json.sEcho Tracking flag for DataTables to match requests
+ * @param {int} json.iTotalRecords Number of records in the data set, not accounting for filtering
+ * @param {int} json.iTotalDisplayRecords Number of records in the data set, accounting for filtering
+ * @param {array} json.aaData The data to display on this page
+ * @param {string} [json.sColumns] Column ordering (sName, comma separated)
+ * @memberof DataTable#oApi
+ */
+ function _fnAjaxUpdateDraw(oSettings, json) {
+ if (json.sEcho !== undefined) {
+ /* Protect against old returns over-writing a new one. Possible when you get
+ * very fast interaction, and later queries are completed much faster
+ */
+ if (json.sEcho * 1 < oSettings.iDraw) {
+ return;
+ }
+ else {
+ oSettings.iDraw = json.sEcho * 1;
+ }
+ }
+
+ if (!oSettings.oScroll.bInfinite ||
+ (oSettings.oScroll.bInfinite && (oSettings.bSorted || oSettings.bFiltered))) {
+ _fnClearTable(oSettings);
+ }
+ oSettings._iRecordsTotal = parseInt(json.iTotalRecords, 10);
+ oSettings._iRecordsDisplay = parseInt(json.iTotalDisplayRecords, 10);
+
+ /* Determine if reordering is required */
+ var sOrdering = _fnColumnOrdering(oSettings);
+ var bReOrder = (json.sColumns !== undefined && sOrdering !== "" && json.sColumns != sOrdering);
+ var aiIndex;
+ if (bReOrder) {
+ aiIndex = _fnReOrderIndex(oSettings, json.sColumns);
+ }
+
+ var aData = _fnGetObjectDataFn(oSettings.sAjaxDataProp)(json);
+ for (var i = 0, iLen = aData.length; i < iLen; i++) {
+ if (bReOrder) {
+ /* If we need to re-order, then create a new array with the correct order and add it */
+ var aDataSorted = [];
+ for (var j = 0, jLen = oSettings.aoColumns.length; j < jLen; j++) {
+ aDataSorted.push(aData[i][aiIndex[j]]);
+ }
+ _fnAddData(oSettings, aDataSorted);
+ }
+ else {
+ /* No re-order required, sever got it "right" - just straight add */
+ _fnAddData(oSettings, aData[i]);
+ }
+ }
+ oSettings.aiDisplay = oSettings.aiDisplayMaster.slice();
+
+ oSettings.bAjaxDataGet = false;
+ _fnDraw(oSettings);
+ oSettings.bAjaxDataGet = true;
+ _fnProcessingDisplay(oSettings, false);
+ }
+
+
+
+ /**
+ * Generate the node required for filtering text
+ * @returns {node} Filter control element
+ * @param {object} oSettings dataTables settings object
+ * @memberof DataTable#oApi
+ */
+ function _fnFeatureHtmlFilter(oSettings) {
+ var oPreviousSearch = oSettings.oPreviousSearch;
+
+ var sSearchStr = oSettings.oLanguage.sSearch;
+ sSearchStr = (sSearchStr.indexOf('_INPUT_') !== -1) ?
+ sSearchStr.replace('_INPUT_', '' + sSearchStr + ' ';
+ if (!oSettings.aanFeatures.f) {
+ nFilter.id = oSettings.sTableId + '_filter';
+ }
+
+ var jqFilter = $('input[type="text"]', nFilter);
+
+ // Store a reference to the input element, so other input elements could be
+ // added to the filter wrapper if needed (submit button for example)
+ nFilter._DT_Input = jqFilter[0];
+
+ jqFilter.val(oPreviousSearch.sSearch.replace('"', '"'));
+ jqFilter.bind('keyup.DT', function (e) {
+ /* Update all other filter input elements for the new display */
+ var n = oSettings.aanFeatures.f;
+ var val = this.value === "" ? "" : this.value; // mental IE8 fix :-(
+
+ for (var i = 0, iLen = n.length; i < iLen; i++) {
+ if (n[i] != $(this).parents('div.dataTables_filter')[0]) {
+ $(n[i]._DT_Input).val(val);
+ }
+ }
+
+ /* Now do the filter */
+ if (val != oPreviousSearch.sSearch) {
+ _fnFilterComplete(oSettings, {
+ "sSearch": val,
+ "bRegex": oPreviousSearch.bRegex,
+ "bSmart": oPreviousSearch.bSmart,
+ "bCaseInsensitive": oPreviousSearch.bCaseInsensitive
+ });
+ }
+ });
+
+ jqFilter
+ .attr('aria-controls', oSettings.sTableId)
+ .bind('keypress.DT', function (e) {
+ /* Prevent form submission */
+ if (e.keyCode == 13) {
+ return false;
+ }
+ }
+ );
+
+ return nFilter;
+ }
+
+
+ /**
+ * Filter the table using both the global filter and column based filtering
+ * @param {object} oSettings dataTables settings object
+ * @param {object} oSearch search information
+ * @param {int} [iForce] force a research of the master array (1) or not (undefined or 0)
+ * @memberof DataTable#oApi
+ */
+ function _fnFilterComplete(oSettings, oInput, iForce) {
+ var oPrevSearch = oSettings.oPreviousSearch;
+ var aoPrevSearch = oSettings.aoPreSearchCols;
+ var fnSaveFilter = function (oFilter) {
+ /* Save the filtering values */
+ oPrevSearch.sSearch = oFilter.sSearch;
+ oPrevSearch.bRegex = oFilter.bRegex;
+ oPrevSearch.bSmart = oFilter.bSmart;
+ oPrevSearch.bCaseInsensitive = oFilter.bCaseInsensitive;
+ };
+
+ /* In server-side processing all filtering is done by the server, so no point hanging around here */
+ if (!oSettings.oFeatures.bServerSide) {
+ /* Global filter */
+ _fnFilter(oSettings, oInput.sSearch, iForce, oInput.bRegex, oInput.bSmart, oInput.bCaseInsensitive);
+ fnSaveFilter(oInput);
+
+ /* Now do the individual column filter */
+ for (var i = 0; i < oSettings.aoPreSearchCols.length; i++) {
+ _fnFilterColumn(oSettings, aoPrevSearch[i].sSearch, i, aoPrevSearch[i].bRegex,
+ aoPrevSearch[i].bSmart, aoPrevSearch[i].bCaseInsensitive);
+ }
+
+ /* Custom filtering */
+ _fnFilterCustom(oSettings);
+ }
+ else {
+ fnSaveFilter(oInput);
+ }
+
+ /* Tell the draw function we have been filtering */
+ oSettings.bFiltered = true;
+ $(oSettings.oInstance).trigger('filter', oSettings);
+
+ /* Redraw the table */
+ oSettings._iDisplayStart = 0;
+ _fnCalculateEnd(oSettings);
+ _fnDraw(oSettings);
+
+ /* Rebuild search array 'offline' */
+ _fnBuildSearchArray(oSettings, 0);
+ }
+
+
+ /**
+ * Apply custom filtering functions
+ * @param {object} oSettings dataTables settings object
+ * @memberof DataTable#oApi
+ */
+ function _fnFilterCustom(oSettings) {
+ var afnFilters = DataTable.ext.afnFiltering;
+ var aiFilterColumns = _fnGetColumns(oSettings, 'bSearchable');
+
+ for (var i = 0, iLen = afnFilters.length; i < iLen; i++) {
+ var iCorrector = 0;
+ for (var j = 0, jLen = oSettings.aiDisplay.length; j < jLen; j++) {
+ var iDisIndex = oSettings.aiDisplay[j - iCorrector];
+ var bTest = afnFilters[i](
+ oSettings,
+ _fnGetRowData(oSettings, iDisIndex, 'filter', aiFilterColumns),
+ iDisIndex
+ );
+
+ /* Check if we should use this row based on the filtering function */
+ if (!bTest) {
+ oSettings.aiDisplay.splice(j - iCorrector, 1);
+ iCorrector++;
+ }
+ }
+ }
+ }
+
+
+ /**
+ * Filter the table on a per-column basis
+ * @param {object} oSettings dataTables settings object
+ * @param {string} sInput string to filter on
+ * @param {int} iColumn column to filter
+ * @param {bool} bRegex treat search string as a regular expression or not
+ * @param {bool} bSmart use smart filtering or not
+ * @param {bool} bCaseInsensitive Do case insenstive matching or not
+ * @memberof DataTable#oApi
+ */
+ function _fnFilterColumn(oSettings, sInput, iColumn, bRegex, bSmart, bCaseInsensitive) {
+ if (sInput === "") {
+ return;
+ }
+
+ var iIndexCorrector = 0;
+ var rpSearch = _fnFilterCreateSearch(sInput, bRegex, bSmart, bCaseInsensitive);
+
+ for (var i = oSettings.aiDisplay.length - 1; i >= 0; i--) {
+ var sData = _fnDataToSearch(_fnGetCellData(oSettings, oSettings.aiDisplay[i], iColumn, 'filter'),
+ oSettings.aoColumns[iColumn].sType);
+ if (!rpSearch.test(sData)) {
+ oSettings.aiDisplay.splice(i, 1);
+ iIndexCorrector++;
+ }
+ }
+ }
+
+
+ /**
+ * Filter the data table based on user input and draw the table
+ * @param {object} oSettings dataTables settings object
+ * @param {string} sInput string to filter on
+ * @param {int} iForce optional - force a research of the master array (1) or not (undefined or 0)
+ * @param {bool} bRegex treat as a regular expression or not
+ * @param {bool} bSmart perform smart filtering or not
+ * @param {bool} bCaseInsensitive Do case insenstive matching or not
+ * @memberof DataTable#oApi
+ */
+ function _fnFilter(oSettings, sInput, iForce, bRegex, bSmart, bCaseInsensitive) {
+ var i;
+ var rpSearch = _fnFilterCreateSearch(sInput, bRegex, bSmart, bCaseInsensitive);
+ var oPrevSearch = oSettings.oPreviousSearch;
+
+ /* Check if we are forcing or not - optional parameter */
+ if (!iForce) {
+ iForce = 0;
+ }
+
+ /* Need to take account of custom filtering functions - always filter */
+ if (DataTable.ext.afnFiltering.length !== 0) {
+ iForce = 1;
+ }
+
+ /*
+ * If the input is blank - we want the full data set
+ */
+ if (sInput.length <= 0) {
+ oSettings.aiDisplay.splice(0, oSettings.aiDisplay.length);
+ oSettings.aiDisplay = oSettings.aiDisplayMaster.slice();
+ }
+ else {
+ /*
+ * We are starting a new search or the new search string is smaller
+ * then the old one (i.e. delete). Search from the master array
+ */
+ if (oSettings.aiDisplay.length == oSettings.aiDisplayMaster.length ||
+ oPrevSearch.sSearch.length > sInput.length || iForce == 1 ||
+ sInput.indexOf(oPrevSearch.sSearch) !== 0) {
+ /* Nuke the old display array - we are going to rebuild it */
+ oSettings.aiDisplay.splice(0, oSettings.aiDisplay.length);
+
+ /* Force a rebuild of the search array */
+ _fnBuildSearchArray(oSettings, 1);
+
+ /* Search through all records to populate the search array
+ * The the oSettings.aiDisplayMaster and asDataSearch arrays have 1 to 1
+ * mapping
+ */
+ for (i = 0; i < oSettings.aiDisplayMaster.length; i++) {
+ if (rpSearch.test(oSettings.asDataSearch[i])) {
+ oSettings.aiDisplay.push(oSettings.aiDisplayMaster[i]);
+ }
+ }
+ }
+ else {
+ /* Using old search array - refine it - do it this way for speed
+ * Don't have to search the whole master array again
+ */
+ var iIndexCorrector = 0;
+
+ /* Search the current results */
+ for (i = 0; i < oSettings.asDataSearch.length; i++) {
+ if (!rpSearch.test(oSettings.asDataSearch[i])) {
+ oSettings.aiDisplay.splice(i - iIndexCorrector, 1);
+ iIndexCorrector++;
+ }
+ }
+ }
+ }
+ }
+
+
+ /**
+ * Create an array which can be quickly search through
+ * @param {object} oSettings dataTables settings object
+ * @param {int} iMaster use the master data array - optional
+ * @memberof DataTable#oApi
+ */
+ function _fnBuildSearchArray(oSettings, iMaster) {
+ if (!oSettings.oFeatures.bServerSide) {
+ /* Clear out the old data */
+ oSettings.asDataSearch = [];
+
+ var aiFilterColumns = _fnGetColumns(oSettings, 'bSearchable');
+ var aiIndex = (iMaster === 1) ?
+ oSettings.aiDisplayMaster :
+ oSettings.aiDisplay;
+
+ for (var i = 0, iLen = aiIndex.length; i < iLen; i++) {
+ oSettings.asDataSearch[i] = _fnBuildSearchRow(
+ oSettings,
+ _fnGetRowData(oSettings, aiIndex[i], 'filter', aiFilterColumns)
+ );
+ }
+ }
+ }
+
+
+ /**
+ * Create a searchable string from a single data row
+ * @param {object} oSettings dataTables settings object
+ * @param {array} aData Row data array to use for the data to search
+ * @memberof DataTable#oApi
+ */
+ function _fnBuildSearchRow(oSettings, aData) {
+ var sSearch = aData.join(' ');
+
+ /* If it looks like there is an HTML entity in the string, attempt to decode it */
+ if (sSearch.indexOf('&') !== -1) {
+ sSearch = $('').html(sSearch).text();
+ }
+
+ // Strip newline characters
+ return sSearch.replace(/[\n\r]/g, " ");
+ }
+
+ /**
+ * Build a regular expression object suitable for searching a table
+ * @param {string} sSearch string to search for
+ * @param {bool} bRegex treat as a regular expression or not
+ * @param {bool} bSmart perform smart filtering or not
+ * @param {bool} bCaseInsensitive Do case insensitive matching or not
+ * @returns {RegExp} constructed object
+ * @memberof DataTable#oApi
+ */
+ function _fnFilterCreateSearch(sSearch, bRegex, bSmart, bCaseInsensitive) {
+ var asSearch, sRegExpString;
+
+ if (bSmart) {
+ /* Generate the regular expression to use. Something along the lines of:
+ * ^(?=.*?\bone\b)(?=.*?\btwo\b)(?=.*?\bthree\b).*$
+ */
+ asSearch = bRegex ? sSearch.split(' ') : _fnEscapeRegex(sSearch).split(' ');
+ sRegExpString = '^(?=.*?' + asSearch.join(')(?=.*?') + ').*$';
+ return new RegExp(sRegExpString, bCaseInsensitive ? "i" : "");
+ }
+ else {
+ sSearch = bRegex ? sSearch : _fnEscapeRegex(sSearch);
+ return new RegExp(sSearch, bCaseInsensitive ? "i" : "");
+ }
+ }
+
+
+ /**
+ * Convert raw data into something that the user can search on
+ * @param {string} sData data to be modified
+ * @param {string} sType data type
+ * @returns {string} search string
+ * @memberof DataTable#oApi
+ */
+ function _fnDataToSearch(sData, sType) {
+ if (typeof DataTable.ext.ofnSearch[sType] === "function") {
+ return DataTable.ext.ofnSearch[sType](sData);
+ }
+ else if (sData === null) {
+ return '';
+ }
+ else if (sType == "html") {
+ return sData.replace(/[\r\n]/g, " ").replace(/<.*?>/g, "");
+ }
+ else if (typeof sData === "string") {
+ return sData.replace(/[\r\n]/g, " ");
+ }
+ return sData;
+ }
+
+
+ /**
+ * scape a string such that it can be used in a regular expression
+ * @param {string} sVal string to escape
+ * @returns {string} escaped string
+ * @memberof DataTable#oApi
+ */
+ function _fnEscapeRegex(sVal) {
+ var acEscape = ['/', '.', '*', '+', '?', '|', '(', ')', '[', ']', '{', '}', '\\', '$', '^', '-'];
+ var reReplace = new RegExp('(\\' + acEscape.join('|\\') + ')', 'g');
+ return sVal.replace(reReplace, '\\$1');
+ }
+
+
+
+ /**
+ * Generate the node required for the info display
+ * @param {object} oSettings dataTables settings object
+ * @returns {node} Information element
+ * @memberof DataTable#oApi
+ */
+ function _fnFeatureHtmlInfo(oSettings) {
+ var nInfo = document.createElement('div');
+ nInfo.className = oSettings.oClasses.sInfo;
+
+ /* Actions that are to be taken once only for this feature */
+ if (!oSettings.aanFeatures.i) {
+ /* Add draw callback */
+ oSettings.aoDrawCallback.push({
+ "fn": _fnUpdateInfo,
+ "sName": "information"
+ });
+
+ /* Add id */
+ nInfo.id = oSettings.sTableId + '_info';
+ }
+ oSettings.nTable.setAttribute('aria-describedby', oSettings.sTableId + '_info');
+
+ return nInfo;
+ }
+
+
+ /**
+ * Update the information elements in the display
+ * @param {object} oSettings dataTables settings object
+ * @memberof DataTable#oApi
+ */
+ function _fnUpdateInfo(oSettings) {
+ /* Show information about the table */
+ if (!oSettings.oFeatures.bInfo || oSettings.aanFeatures.i.length === 0) {
+ return;
+ }
+
+ var
+ oLang = oSettings.oLanguage,
+ iStart = oSettings._iDisplayStart + 1,
+ iEnd = oSettings.fnDisplayEnd(),
+ iMax = oSettings.fnRecordsTotal(),
+ iTotal = oSettings.fnRecordsDisplay(),
+ sOut;
+
+ if (iTotal === 0 && iTotal == iMax) {
+ /* Empty record set */
+ sOut = oLang.sInfoEmpty;
+ }
+ else if (iTotal === 0) {
+ /* Empty record set after filtering */
+ sOut = oLang.sInfoEmpty + ' ' + oLang.sInfoFiltered;
+ }
+ else if (iTotal == iMax) {
+ /* Normal record set */
+ sOut = oLang.sInfo;
+ }
+ else {
+ /* Record set after filtering */
+ sOut = oLang.sInfo + ' ' + oLang.sInfoFiltered;
+ }
+
+ // Convert the macros
+ sOut += oLang.sInfoPostFix;
+ sOut = _fnInfoMacros(oSettings, sOut);
+
+ if (oLang.fnInfoCallback !== null) {
+ sOut = oLang.fnInfoCallback.call(oSettings.oInstance,
+ oSettings, iStart, iEnd, iMax, iTotal, sOut);
+ }
+
+ var n = oSettings.aanFeatures.i;
+ for (var i = 0, iLen = n.length; i < iLen; i++) {
+ $(n[i]).html(sOut);
+ }
+ }
+
+
+ function _fnInfoMacros(oSettings, str) {
+ var
+ iStart = oSettings._iDisplayStart + 1,
+ sStart = oSettings.fnFormatNumber(iStart),
+ iEnd = oSettings.fnDisplayEnd(),
+ sEnd = oSettings.fnFormatNumber(iEnd),
+ iTotal = oSettings.fnRecordsDisplay(),
+ sTotal = oSettings.fnFormatNumber(iTotal),
+ iMax = oSettings.fnRecordsTotal(),
+ sMax = oSettings.fnFormatNumber(iMax);
+
+ // When infinite scrolling, we are always starting at 1. _iDisplayStart is used only
+ // internally
+ if (oSettings.oScroll.bInfinite) {
+ sStart = oSettings.fnFormatNumber(1);
+ }
+
+ return str.
+ replace('_START_', sStart).
+ replace('_END_', sEnd).
+ replace('_TOTAL_', sTotal).
+ replace('_MAX_', sMax);
+ }
+
+
+
+ /**
+ * Draw the table for the first time, adding all required features
+ * @param {object} oSettings dataTables settings object
+ * @memberof DataTable#oApi
+ */
+ function _fnInitialise(oSettings) {
+ var i, iLen, iAjaxStart = oSettings.iInitDisplayStart;
+
+ /* Ensure that the table data is fully initialised */
+ if (oSettings.bInitialised === false) {
+ setTimeout(function () { _fnInitialise(oSettings); }, 200);
+ return;
+ }
+
+ /* Show the display HTML options */
+ _fnAddOptionsHtml(oSettings);
+
+ /* Build and draw the header / footer for the table */
+ _fnBuildHead(oSettings);
+ _fnDrawHead(oSettings, oSettings.aoHeader);
+ if (oSettings.nTFoot) {
+ _fnDrawHead(oSettings, oSettings.aoFooter);
+ }
+
+ /* Okay to show that something is going on now */
+ _fnProcessingDisplay(oSettings, true);
+
+ /* Calculate sizes for columns */
+ if (oSettings.oFeatures.bAutoWidth) {
+ _fnCalculateColumnWidths(oSettings);
+ }
+
+ for (i = 0, iLen = oSettings.aoColumns.length; i < iLen; i++) {
+ if (oSettings.aoColumns[i].sWidth !== null) {
+ oSettings.aoColumns[i].nTh.style.width = _fnStringToCss(oSettings.aoColumns[i].sWidth);
+ }
+ }
+
+ /* If there is default sorting required - let's do it. The sort function will do the
+ * drawing for us. Otherwise we draw the table regardless of the Ajax source - this allows
+ * the table to look initialised for Ajax sourcing data (show 'loading' message possibly)
+ */
+ if (oSettings.oFeatures.bSort) {
+ _fnSort(oSettings);
+ }
+ else if (oSettings.oFeatures.bFilter) {
+ _fnFilterComplete(oSettings, oSettings.oPreviousSearch);
+ }
+ else {
+ oSettings.aiDisplay = oSettings.aiDisplayMaster.slice();
+ _fnCalculateEnd(oSettings);
+ _fnDraw(oSettings);
+ }
+
+ /* if there is an ajax source load the data */
+ if (oSettings.sAjaxSource !== null && !oSettings.oFeatures.bServerSide) {
+ var aoData = [];
+ _fnServerParams(oSettings, aoData);
+ oSettings.fnServerData.call(oSettings.oInstance, oSettings.sAjaxSource, aoData, function (json) {
+ var aData = (oSettings.sAjaxDataProp !== "") ?
+ _fnGetObjectDataFn(oSettings.sAjaxDataProp)(json) : json;
+
+ /* Got the data - add it to the table */
+ for (i = 0; i < aData.length; i++) {
+ _fnAddData(oSettings, aData[i]);
+ }
+
+ /* Reset the init display for cookie saving. We've already done a filter, and
+ * therefore cleared it before. So we need to make it appear 'fresh'
+ */
+ oSettings.iInitDisplayStart = iAjaxStart;
+
+ if (oSettings.oFeatures.bSort) {
+ _fnSort(oSettings);
+ }
+ else {
+ oSettings.aiDisplay = oSettings.aiDisplayMaster.slice();
+ _fnCalculateEnd(oSettings);
+ _fnDraw(oSettings);
+ }
+
+ _fnProcessingDisplay(oSettings, false);
+ _fnInitComplete(oSettings, json);
+ }, oSettings);
+ return;
+ }
+
+ /* Server-side processing initialisation complete is done at the end of _fnDraw */
+ if (!oSettings.oFeatures.bServerSide) {
+ _fnProcessingDisplay(oSettings, false);
+ _fnInitComplete(oSettings);
+ }
+ }
+
+
+ /**
+ * Draw the table for the first time, adding all required features
+ * @param {object} oSettings dataTables settings object
+ * @param {object} [json] JSON from the server that completed the table, if using Ajax source
+ * with client-side processing (optional)
+ * @memberof DataTable#oApi
+ */
+ function _fnInitComplete(oSettings, json) {
+ oSettings._bInitComplete = true;
+ _fnCallbackFire(oSettings, 'aoInitComplete', 'init', [oSettings, json]);
+ }
+
+
+ /**
+ * Language compatibility - when certain options are given, and others aren't, we
+ * need to duplicate the values over, in order to provide backwards compatibility
+ * with older language files.
+ * @param {object} oSettings dataTables settings object
+ * @memberof DataTable#oApi
+ */
+ function _fnLanguageCompat(oLanguage) {
+ var oDefaults = DataTable.defaults.oLanguage;
+
+ /* Backwards compatibility - if there is no sEmptyTable given, then use the same as
+ * sZeroRecords - assuming that is given.
+ */
+ if (!oLanguage.sEmptyTable && oLanguage.sZeroRecords &&
+ oDefaults.sEmptyTable === "No data available in table") {
+ _fnMap(oLanguage, oLanguage, 'sZeroRecords', 'sEmptyTable');
+ }
+
+ /* Likewise with loading records */
+ if (!oLanguage.sLoadingRecords && oLanguage.sZeroRecords &&
+ oDefaults.sLoadingRecords === "Loading...") {
+ _fnMap(oLanguage, oLanguage, 'sZeroRecords', 'sLoadingRecords');
+ }
+ }
+
+
+
+ /**
+ * Generate the node required for user display length changing
+ * @param {object} oSettings dataTables settings object
+ * @returns {node} Display length feature node
+ * @memberof DataTable#oApi
+ */
+ function _fnFeatureHtmlLength(oSettings) {
+ if (oSettings.oScroll.bInfinite) {
+ return null;
+ }
+
+ /* This can be overruled by not using the _MENU_ var/macro in the language variable */
+ var sName = 'name="' + oSettings.sTableId + '_length"';
+ var sStdMenu = '
';
+ var i, iLen;
+ var aLengthMenu = oSettings.aLengthMenu;
+
+ if (aLengthMenu.length == 2 && typeof aLengthMenu[0] === 'object' &&
+ typeof aLengthMenu[1] === 'object') {
+ for (i = 0, iLen = aLengthMenu[0].length; i < iLen; i++) {
+ sStdMenu += '' + aLengthMenu[1][i] + ' ';
+ }
+ }
+ else {
+ for (i = 0, iLen = aLengthMenu.length; i < iLen; i++) {
+ sStdMenu += '' + aLengthMenu[i] + ' ';
+ }
+ }
+ sStdMenu += ' ';
+
+ var nLength = document.createElement('div');
+ if (!oSettings.aanFeatures.l) {
+ nLength.id = oSettings.sTableId + '_length';
+ }
+ nLength.className = oSettings.oClasses.sLength;
+ nLength.innerHTML = '
' + oSettings.oLanguage.sLengthMenu.replace('_MENU_', sStdMenu) + ' ';
+
+ /*
+ * Set the length to the current display length - thanks to Andrea Pavlovic for this fix,
+ * and Stefan Skopnik for fixing the fix!
+ */
+ $('select option[value="' + oSettings._iDisplayLength + '"]', nLength).attr("selected", true);
+
+ $('select', nLength).bind('change.DT', function (e) {
+ var iVal = $(this).val();
+
+ /* Update all other length options for the new display */
+ var n = oSettings.aanFeatures.l;
+ for (i = 0, iLen = n.length; i < iLen; i++) {
+ if (n[i] != this.parentNode) {
+ $('select', n[i]).val(iVal);
+ }
+ }
+
+ /* Redraw the table */
+ oSettings._iDisplayLength = parseInt(iVal, 10);
+ _fnCalculateEnd(oSettings);
+
+ /* If we have space to show extra rows (backing up from the end point - then do so */
+ if (oSettings.fnDisplayEnd() == oSettings.fnRecordsDisplay()) {
+ oSettings._iDisplayStart = oSettings.fnDisplayEnd() - oSettings._iDisplayLength;
+ if (oSettings._iDisplayStart < 0) {
+ oSettings._iDisplayStart = 0;
+ }
+ }
+
+ if (oSettings._iDisplayLength == -1) {
+ oSettings._iDisplayStart = 0;
+ }
+
+ _fnDraw(oSettings);
+ });
+
+
+ $('select', nLength).attr('aria-controls', oSettings.sTableId);
+
+ return nLength;
+ }
+
+
+ /**
+ * Recalculate the end point based on the start point
+ * @param {object} oSettings dataTables settings object
+ * @memberof DataTable#oApi
+ */
+ function _fnCalculateEnd(oSettings) {
+ if (oSettings.oFeatures.bPaginate === false) {
+ oSettings._iDisplayEnd = oSettings.aiDisplay.length;
+ }
+ else {
+ /* Set the end point of the display - based on how many elements there are
+ * still to display
+ */
+ if (oSettings._iDisplayStart + oSettings._iDisplayLength > oSettings.aiDisplay.length ||
+ oSettings._iDisplayLength == -1) {
+ oSettings._iDisplayEnd = oSettings.aiDisplay.length;
+ }
+ else {
+ oSettings._iDisplayEnd = oSettings._iDisplayStart + oSettings._iDisplayLength;
+ }
+ }
+ }
+
+
+
+ /* * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * *
+ * Note that most of the paging logic is done in
+ * DataTable.ext.oPagination
+ */
+
+ /**
+ * Generate the node required for default pagination
+ * @param {object} oSettings dataTables settings object
+ * @returns {node} Pagination feature node
+ * @memberof DataTable#oApi
+ */
+ function _fnFeatureHtmlPaginate(oSettings) {
+ if (oSettings.oScroll.bInfinite) {
+ return null;
+ }
+
+ var nPaginate = document.createElement('div');
+ nPaginate.className = oSettings.oClasses.sPaging + oSettings.sPaginationType;
+
+ DataTable.ext.oPagination[oSettings.sPaginationType].fnInit(oSettings, nPaginate,
+ function (oSettings) {
+ _fnCalculateEnd(oSettings);
+ _fnDraw(oSettings);
+ }
+ );
+
+ /* Add a draw callback for the pagination on first instance, to update the paging display */
+ if (!oSettings.aanFeatures.p) {
+ oSettings.aoDrawCallback.push({
+ "fn": function (oSettings) {
+ DataTable.ext.oPagination[oSettings.sPaginationType].fnUpdate(oSettings, function (oSettings) {
+ _fnCalculateEnd(oSettings);
+ _fnDraw(oSettings);
+ });
+ },
+ "sName": "pagination"
+ });
+ }
+ return nPaginate;
+ }
+
+
+ /**
+ * Alter the display settings to change the page
+ * @param {object} oSettings dataTables settings object
+ * @param {string|int} mAction Paging action to take: "first", "previous", "next" or "last"
+ * or page number to jump to (integer)
+ * @returns {bool} true page has changed, false - no change (no effect) eg 'first' on page 1
+ * @memberof DataTable#oApi
+ */
+ function _fnPageChange(oSettings, mAction) {
+ var iOldStart = oSettings._iDisplayStart;
+
+ if (typeof mAction === "number") {
+ oSettings._iDisplayStart = mAction * oSettings._iDisplayLength;
+ if (oSettings._iDisplayStart > oSettings.fnRecordsDisplay()) {
+ oSettings._iDisplayStart = 0;
+ }
+ }
+ else if (mAction == "first") {
+ oSettings._iDisplayStart = 0;
+ }
+ else if (mAction == "previous") {
+ oSettings._iDisplayStart = oSettings._iDisplayLength >= 0 ?
+ oSettings._iDisplayStart - oSettings._iDisplayLength :
+ 0;
+
+ /* Correct for under-run */
+ if (oSettings._iDisplayStart < 0) {
+ oSettings._iDisplayStart = 0;
+ }
+ }
+ else if (mAction == "next") {
+ if (oSettings._iDisplayLength >= 0) {
+ /* Make sure we are not over running the display array */
+ if (oSettings._iDisplayStart + oSettings._iDisplayLength < oSettings.fnRecordsDisplay()) {
+ oSettings._iDisplayStart += oSettings._iDisplayLength;
+ }
+ }
+ else {
+ oSettings._iDisplayStart = 0;
+ }
+ }
+ else if (mAction == "last") {
+ if (oSettings._iDisplayLength >= 0) {
+ var iPages = parseInt((oSettings.fnRecordsDisplay() - 1) / oSettings._iDisplayLength, 10) + 1;
+ oSettings._iDisplayStart = (iPages - 1) * oSettings._iDisplayLength;
+ }
+ else {
+ oSettings._iDisplayStart = 0;
+ }
+ }
+ else {
+ _fnLog(oSettings, 0, "Unknown paging action: " + mAction);
+ }
+ $(oSettings.oInstance).trigger('page', oSettings);
+
+ return iOldStart != oSettings._iDisplayStart;
+ }
+
+
+
+ /**
+ * Generate the node required for the processing node
+ * @param {object} oSettings dataTables settings object
+ * @returns {node} Processing element
+ * @memberof DataTable#oApi
+ */
+ function _fnFeatureHtmlProcessing(oSettings) {
+ var nProcessing = document.createElement('div');
+
+ if (!oSettings.aanFeatures.r) {
+ nProcessing.id = oSettings.sTableId + '_processing';
+ }
+ nProcessing.innerHTML = oSettings.oLanguage.sProcessing;
+ nProcessing.className = oSettings.oClasses.sProcessing;
+ oSettings.nTable.parentNode.insertBefore(nProcessing, oSettings.nTable);
+
+ return nProcessing;
+ }
+
+
+ /**
+ * Display or hide the processing indicator
+ * @param {object} oSettings dataTables settings object
+ * @param {bool} bShow Show the processing indicator (true) or not (false)
+ * @memberof DataTable#oApi
+ */
+ function _fnProcessingDisplay(oSettings, bShow) {
+ if (oSettings.oFeatures.bProcessing) {
+ var an = oSettings.aanFeatures.r;
+ for (var i = 0, iLen = an.length; i < iLen; i++) {
+ an[i].style.visibility = bShow ? "visible" : "hidden";
+ }
+ }
+
+ $(oSettings.oInstance).trigger('processing', [oSettings, bShow]);
+ }
+
+
+
+ /**
+ * Add any control elements for the table - specifically scrolling
+ * @param {object} oSettings dataTables settings object
+ * @returns {node} Node to add to the DOM
+ * @memberof DataTable#oApi
+ */
+ function _fnFeatureHtmlTable(oSettings) {
+ /* Check if scrolling is enabled or not - if not then leave the DOM unaltered */
+ if (oSettings.oScroll.sX === "" && oSettings.oScroll.sY === "") {
+ return oSettings.nTable;
+ }
+
+ /*
+ * The HTML structure that we want to generate in this function is:
+ * div - nScroller
+ * div - nScrollHead
+ * div - nScrollHeadInner
+ * table - nScrollHeadTable
+ * thead - nThead
+ * div - nScrollBody
+ * table - oSettings.nTable
+ * thead - nTheadSize
+ * tbody - nTbody
+ * div - nScrollFoot
+ * div - nScrollFootInner
+ * table - nScrollFootTable
+ * tfoot - nTfoot
+ */
+ var
+ nScroller = document.createElement('div'),
+ nScrollHead = document.createElement('div'),
+ nScrollHeadInner = document.createElement('div'),
+ nScrollBody = document.createElement('div'),
+ nScrollFoot = document.createElement('div'),
+ nScrollFootInner = document.createElement('div'),
+ nScrollHeadTable = oSettings.nTable.cloneNode(false),
+ nScrollFootTable = oSettings.nTable.cloneNode(false),
+ nThead = oSettings.nTable.getElementsByTagName('thead')[0],
+ nTfoot = oSettings.nTable.getElementsByTagName('tfoot').length === 0 ? null :
+ oSettings.nTable.getElementsByTagName('tfoot')[0],
+ oClasses = oSettings.oClasses;
+
+ nScrollHead.appendChild(nScrollHeadInner);
+ nScrollFoot.appendChild(nScrollFootInner);
+ nScrollBody.appendChild(oSettings.nTable);
+ nScroller.appendChild(nScrollHead);
+ nScroller.appendChild(nScrollBody);
+ nScrollHeadInner.appendChild(nScrollHeadTable);
+ nScrollHeadTable.appendChild(nThead);
+ if (nTfoot !== null) {
+ nScroller.appendChild(nScrollFoot);
+ nScrollFootInner.appendChild(nScrollFootTable);
+ nScrollFootTable.appendChild(nTfoot);
+ }
+
+ nScroller.className = oClasses.sScrollWrapper;
+ nScrollHead.className = oClasses.sScrollHead;
+ nScrollHeadInner.className = oClasses.sScrollHeadInner;
+ nScrollBody.className = oClasses.sScrollBody;
+ nScrollFoot.className = oClasses.sScrollFoot;
+ nScrollFootInner.className = oClasses.sScrollFootInner;
+
+ if (oSettings.oScroll.bAutoCss) {
+ nScrollHead.style.overflow = "hidden";
+ nScrollHead.style.position = "relative";
+ nScrollFoot.style.overflow = "hidden";
+ nScrollBody.style.overflow = "auto";
+ }
+
+ nScrollHead.style.border = "0";
+ nScrollHead.style.width = "100%";
+ nScrollFoot.style.border = "0";
+ nScrollHeadInner.style.width = oSettings.oScroll.sXInner !== "" ?
+ oSettings.oScroll.sXInner : "100%"; /* will be overwritten */
+
+ /* Modify attributes to respect the clones */
+ nScrollHeadTable.removeAttribute('id');
+ nScrollHeadTable.style.marginLeft = "0";
+ oSettings.nTable.style.marginLeft = "0";
+ if (nTfoot !== null) {
+ nScrollFootTable.removeAttribute('id');
+ nScrollFootTable.style.marginLeft = "0";
+ }
+
+ /* Move caption elements from the body to the header, footer or leave where it is
+ * depending on the configuration. Note that the DTD says there can be only one caption */
+ var nCaption = $(oSettings.nTable).children('caption');
+ if (nCaption.length > 0) {
+ nCaption = nCaption[0];
+ if (nCaption._captionSide === "top") {
+ nScrollHeadTable.appendChild(nCaption);
+ }
+ else if (nCaption._captionSide === "bottom" && nTfoot) {
+ nScrollFootTable.appendChild(nCaption);
+ }
+ }
+
+ /*
+ * Sizing
+ */
+ /* When x-scrolling add the width and a scroller to move the header with the body */
+ if (oSettings.oScroll.sX !== "") {
+ nScrollHead.style.width = _fnStringToCss(oSettings.oScroll.sX);
+ nScrollBody.style.width = _fnStringToCss(oSettings.oScroll.sX);
+
+ if (nTfoot !== null) {
+ nScrollFoot.style.width = _fnStringToCss(oSettings.oScroll.sX);
+ }
+
+ /* When the body is scrolled, then we also want to scroll the headers */
+ $(nScrollBody).scroll(function (e) {
+ nScrollHead.scrollLeft = this.scrollLeft;
+
+ if (nTfoot !== null) {
+ nScrollFoot.scrollLeft = this.scrollLeft;
+ }
+ });
+ }
+
+ /* When yscrolling, add the height */
+ if (oSettings.oScroll.sY !== "") {
+ nScrollBody.style.height = _fnStringToCss(oSettings.oScroll.sY);
+ }
+
+ /* Redraw - align columns across the tables */
+ oSettings.aoDrawCallback.push({
+ "fn": _fnScrollDraw,
+ "sName": "scrolling"
+ });
+
+ /* Infinite scrolling event handlers */
+ if (oSettings.oScroll.bInfinite) {
+ $(nScrollBody).scroll(function () {
+ /* Use a blocker to stop scrolling from loading more data while other data is still loading */
+ if (!oSettings.bDrawing && $(this).scrollTop() !== 0) {
+ /* Check if we should load the next data set */
+ if ($(this).scrollTop() + $(this).height() >
+ $(oSettings.nTable).height() - oSettings.oScroll.iLoadGap) {
+ /* Only do the redraw if we have to - we might be at the end of the data */
+ if (oSettings.fnDisplayEnd() < oSettings.fnRecordsDisplay()) {
+ _fnPageChange(oSettings, 'next');
+ _fnCalculateEnd(oSettings);
+ _fnDraw(oSettings);
+ }
+ }
+ }
+ });
+ }
+
+ oSettings.nScrollHead = nScrollHead;
+ oSettings.nScrollFoot = nScrollFoot;
+
+ return nScroller;
+ }
+
+
+ /**
+ * Update the various tables for resizing. It's a bit of a pig this function, but
+ * basically the idea to:
+ * 1. Re-create the table inside the scrolling div
+ * 2. Take live measurements from the DOM
+ * 3. Apply the measurements
+ * 4. Clean up
+ * @param {object} o dataTables settings object
+ * @returns {node} Node to add to the DOM
+ * @memberof DataTable#oApi
+ */
+ function _fnScrollDraw(o) {
+ var
+ nScrollHeadInner = o.nScrollHead.getElementsByTagName('div')[0],
+ nScrollHeadTable = nScrollHeadInner.getElementsByTagName('table')[0],
+ nScrollBody = o.nTable.parentNode,
+ i, iLen, j, jLen, anHeadToSize, anHeadSizers, anFootSizers, anFootToSize, oStyle, iVis,
+ nTheadSize, nTfootSize,
+ iWidth, aApplied = [], iSanityWidth,
+ nScrollFootInner = (o.nTFoot !== null) ? o.nScrollFoot.getElementsByTagName('div')[0] : null,
+ nScrollFootTable = (o.nTFoot !== null) ? nScrollFootInner.getElementsByTagName('table')[0] : null,
+ ie67 = o.oBrowser.bScrollOversize;
+
+ /*
+ * 1. Re-create the table inside the scrolling div
+ */
+
+ /* Remove the old minimised thead and tfoot elements in the inner table */
+ $(o.nTable).children('thead, tfoot').remove();
+
+ /* Clone the current header and footer elements and then place it into the inner table */
+ nTheadSize = $(o.nTHead).clone()[0];
+ o.nTable.insertBefore(nTheadSize, o.nTable.childNodes[0]);
+
+ if (o.nTFoot !== null) {
+ nTfootSize = $(o.nTFoot).clone()[0];
+ o.nTable.insertBefore(nTfootSize, o.nTable.childNodes[1]);
+ }
+
+ /*
+ * 2. Take live measurements from the DOM - do not alter the DOM itself!
+ */
+
+ /* Remove old sizing and apply the calculated column widths
+ * Get the unique column headers in the newly created (cloned) header. We want to apply the
+ * calculated sizes to this header
+ */
+ if (o.oScroll.sX === "") {
+ nScrollBody.style.width = '100%';
+ nScrollHeadInner.parentNode.style.width = '100%';
+ }
+
+ var nThs = _fnGetUniqueThs(o, nTheadSize);
+ for (i = 0, iLen = nThs.length; i < iLen; i++) {
+ iVis = _fnVisibleToColumnIndex(o, i);
+ nThs[i].style.width = o.aoColumns[iVis].sWidth;
+ }
+
+ if (o.nTFoot !== null) {
+ _fnApplyToChildren(function (n) {
+ n.style.width = "";
+ }, nTfootSize.getElementsByTagName('tr'));
+ }
+
+ // If scroll collapse is enabled, when we put the headers back into the body for sizing, we
+ // will end up forcing the scrollbar to appear, making our measurements wrong for when we
+ // then hide it (end of this function), so add the header height to the body scroller.
+ if (o.oScroll.bCollapse && o.oScroll.sY !== "") {
+ nScrollBody.style.height = (nScrollBody.offsetHeight + o.nTHead.offsetHeight) + "px";
+ }
+
+ /* Size the table as a whole */
+ iSanityWidth = $(o.nTable).outerWidth();
+ if (o.oScroll.sX === "") {
+ /* No x scrolling */
+ o.nTable.style.width = "100%";
+
+ /* I know this is rubbish - but IE7 will make the width of the table when 100% include
+ * the scrollbar - which is shouldn't. When there is a scrollbar we need to take this
+ * into account.
+ */
+ if (ie67 && ($('tbody', nScrollBody).height() > nScrollBody.offsetHeight ||
+ $(nScrollBody).css('overflow-y') == "scroll")) {
+ o.nTable.style.width = _fnStringToCss($(o.nTable).outerWidth() - o.oScroll.iBarWidth);
+ }
+ }
+ else {
+ if (o.oScroll.sXInner !== "") {
+ /* x scroll inner has been given - use it */
+ o.nTable.style.width = _fnStringToCss(o.oScroll.sXInner);
+ }
+ else if (iSanityWidth == $(nScrollBody).width() &&
+ $(nScrollBody).height() < $(o.nTable).height()) {
+ /* There is y-scrolling - try to take account of the y scroll bar */
+ o.nTable.style.width = _fnStringToCss(iSanityWidth - o.oScroll.iBarWidth);
+ if ($(o.nTable).outerWidth() > iSanityWidth - o.oScroll.iBarWidth) {
+ /* Not possible to take account of it */
+ o.nTable.style.width = _fnStringToCss(iSanityWidth);
+ }
+ }
+ else {
+ /* All else fails */
+ o.nTable.style.width = _fnStringToCss(iSanityWidth);
+ }
+ }
+
+ /* Recalculate the sanity width - now that we've applied the required width, before it was
+ * a temporary variable. This is required because the column width calculation is done
+ * before this table DOM is created.
+ */
+ iSanityWidth = $(o.nTable).outerWidth();
+
+ /* We want the hidden header to have zero height, so remove padding and borders. Then
+ * set the width based on the real headers
+ */
+ anHeadToSize = o.nTHead.getElementsByTagName('tr');
+ anHeadSizers = nTheadSize.getElementsByTagName('tr');
+
+ _fnApplyToChildren(function (nSizer, nToSize) {
+ oStyle = nSizer.style;
+ oStyle.paddingTop = "0";
+ oStyle.paddingBottom = "0";
+ oStyle.borderTopWidth = "0";
+ oStyle.borderBottomWidth = "0";
+ oStyle.height = 0;
+
+ iWidth = $(nSizer).width();
+ nToSize.style.width = _fnStringToCss(iWidth);
+ aApplied.push(iWidth);
+ }, anHeadSizers, anHeadToSize);
+ $(anHeadSizers).height(0);
+
+ if (o.nTFoot !== null) {
+ /* Clone the current footer and then place it into the body table as a "hidden header" */
+ anFootSizers = nTfootSize.getElementsByTagName('tr');
+ anFootToSize = o.nTFoot.getElementsByTagName('tr');
+
+ _fnApplyToChildren(function (nSizer, nToSize) {
+ oStyle = nSizer.style;
+ oStyle.paddingTop = "0";
+ oStyle.paddingBottom = "0";
+ oStyle.borderTopWidth = "0";
+ oStyle.borderBottomWidth = "0";
+ oStyle.height = 0;
+
+ iWidth = $(nSizer).width();
+ nToSize.style.width = _fnStringToCss(iWidth);
+ aApplied.push(iWidth);
+ }, anFootSizers, anFootToSize);
+ $(anFootSizers).height(0);
+ }
+
+ /*
+ * 3. Apply the measurements
+ */
+
+ /* "Hide" the header and footer that we used for the sizing. We want to also fix their width
+ * to what they currently are
+ */
+ _fnApplyToChildren(function (nSizer) {
+ nSizer.innerHTML = "";
+ nSizer.style.width = _fnStringToCss(aApplied.shift());
+ }, anHeadSizers);
+
+ if (o.nTFoot !== null) {
+ _fnApplyToChildren(function (nSizer) {
+ nSizer.innerHTML = "";
+ nSizer.style.width = _fnStringToCss(aApplied.shift());
+ }, anFootSizers);
+ }
+
+ /* Sanity check that the table is of a sensible width. If not then we are going to get
+ * misalignment - try to prevent this by not allowing the table to shrink below its min width
+ */
+ if ($(o.nTable).outerWidth() < iSanityWidth) {
+ /* The min width depends upon if we have a vertical scrollbar visible or not */
+ var iCorrection = ((nScrollBody.scrollHeight > nScrollBody.offsetHeight ||
+ $(nScrollBody).css('overflow-y') == "scroll")) ?
+ iSanityWidth + o.oScroll.iBarWidth : iSanityWidth;
+
+ /* IE6/7 are a law unto themselves... */
+ if (ie67 && (nScrollBody.scrollHeight >
+ nScrollBody.offsetHeight || $(nScrollBody).css('overflow-y') == "scroll")) {
+ o.nTable.style.width = _fnStringToCss(iCorrection - o.oScroll.iBarWidth);
+ }
+
+ /* Apply the calculated minimum width to the table wrappers */
+ nScrollBody.style.width = _fnStringToCss(iCorrection);
+ nScrollHeadInner.parentNode.style.width = _fnStringToCss(iCorrection);
+
+ if (o.nTFoot !== null) {
+ nScrollFootInner.parentNode.style.width = _fnStringToCss(iCorrection);
+ }
+
+ /* And give the user a warning that we've stopped the table getting too small */
+ if (o.oScroll.sX === "") {
+ _fnLog(o, 1, "The table cannot fit into the current element which will cause column" +
+ " misalignment. The table has been drawn at its minimum possible width.");
+ }
+ else if (o.oScroll.sXInner !== "") {
+ _fnLog(o, 1, "The table cannot fit into the current element which will cause column" +
+ " misalignment. Increase the sScrollXInner value or remove it to allow automatic" +
+ " calculation");
+ }
+ }
+ else {
+ nScrollBody.style.width = _fnStringToCss('100%');
+ nScrollHeadInner.parentNode.style.width = _fnStringToCss('100%');
+
+ if (o.nTFoot !== null) {
+ nScrollFootInner.parentNode.style.width = _fnStringToCss('100%');
+ }
+ }
+
+
+ /*
+ * 4. Clean up
+ */
+ if (o.oScroll.sY === "") {
+ /* IE7< puts a vertical scrollbar in place (when it shouldn't be) due to subtracting
+ * the scrollbar height from the visible display, rather than adding it on. We need to
+ * set the height in order to sort this. Don't want to do it in any other browsers.
+ */
+ if (ie67) {
+ nScrollBody.style.height = _fnStringToCss(o.nTable.offsetHeight + o.oScroll.iBarWidth);
+ }
+ }
+
+ if (o.oScroll.sY !== "" && o.oScroll.bCollapse) {
+ nScrollBody.style.height = _fnStringToCss(o.oScroll.sY);
+
+ var iExtra = (o.oScroll.sX !== "" && o.nTable.offsetWidth > nScrollBody.offsetWidth) ?
+ o.oScroll.iBarWidth : 0;
+ if (o.nTable.offsetHeight < nScrollBody.offsetHeight) {
+ nScrollBody.style.height = _fnStringToCss(o.nTable.offsetHeight + iExtra);
+ }
+ }
+
+ /* Finally set the width's of the header and footer tables */
+ var iOuterWidth = $(o.nTable).outerWidth();
+ nScrollHeadTable.style.width = _fnStringToCss(iOuterWidth);
+ nScrollHeadInner.style.width = _fnStringToCss(iOuterWidth);
+
+ // Figure out if there are scrollbar present - if so then we need a the header and footer to
+ // provide a bit more space to allow "overflow" scrolling (i.e. past the scrollbar)
+ var bScrolling = $(o.nTable).height() > nScrollBody.clientHeight || $(nScrollBody).css('overflow-y') == "scroll";
+ nScrollHeadInner.style.paddingRight = bScrolling ? o.oScroll.iBarWidth + "px" : "0px";
+
+ if (o.nTFoot !== null) {
+ nScrollFootTable.style.width = _fnStringToCss(iOuterWidth);
+ nScrollFootInner.style.width = _fnStringToCss(iOuterWidth);
+ nScrollFootInner.style.paddingRight = bScrolling ? o.oScroll.iBarWidth + "px" : "0px";
+ }
+
+ /* Adjust the position of the header in case we loose the y-scrollbar */
+ $(nScrollBody).scroll();
+
+ /* If sorting or filtering has occurred, jump the scrolling back to the top */
+ if (o.bSorted || o.bFiltered) {
+ nScrollBody.scrollTop = 0;
+ }
+ }
+
+
+ /**
+ * Apply a given function to the display child nodes of an element array (typically
+ * TD children of TR rows
+ * @param {function} fn Method to apply to the objects
+ * @param array {nodes} an1 List of elements to look through for display children
+ * @param array {nodes} an2 Another list (identical structure to the first) - optional
+ * @memberof DataTable#oApi
+ */
+ function _fnApplyToChildren(fn, an1, an2) {
+ for (var i = 0, iLen = an1.length; i < iLen; i++) {
+ for (var j = 0, jLen = an1[i].childNodes.length; j < jLen; j++) {
+ if (an1[i].childNodes[j].nodeType == 1) {
+ if (an2) {
+ fn(an1[i].childNodes[j], an2[i].childNodes[j]);
+ }
+ else {
+ fn(an1[i].childNodes[j]);
+ }
+ }
+ }
+ }
+ }
+
+
+
+ /**
+ * Convert a CSS unit width to pixels (e.g. 2em)
+ * @param {string} sWidth width to be converted
+ * @param {node} nParent parent to get the with for (required for relative widths) - optional
+ * @returns {int} iWidth width in pixels
+ * @memberof DataTable#oApi
+ */
+ function _fnConvertToWidth(sWidth, nParent) {
+ if (!sWidth || sWidth === null || sWidth === '') {
+ return 0;
+ }
+
+ if (!nParent) {
+ nParent = document.getElementsByTagName('body')[0];
+ }
+
+ var iWidth;
+ var nTmp = document.createElement("div");
+ nTmp.style.width = _fnStringToCss(sWidth);
+
+ nParent.appendChild(nTmp);
+ iWidth = nTmp.offsetWidth;
+ nParent.removeChild(nTmp);
+
+ return (iWidth);
+ }
+
+
+ /**
+ * Calculate the width of columns for the table
+ * @param {object} oSettings dataTables settings object
+ * @memberof DataTable#oApi
+ */
+ function _fnCalculateColumnWidths(oSettings) {
+ var iTableWidth = oSettings.nTable.offsetWidth;
+ var iUserInputs = 0;
+ var iTmpWidth;
+ var iVisibleColumns = 0;
+ var iColums = oSettings.aoColumns.length;
+ var i, iIndex, iCorrector, iWidth;
+ var oHeaders = $('th', oSettings.nTHead);
+ var widthAttr = oSettings.nTable.getAttribute('width');
+
+ /* Convert any user input sizes into pixel sizes */
+ for (i = 0; i < iColums; i++) {
+ if (oSettings.aoColumns[i].bVisible) {
+ iVisibleColumns++;
+
+ if (oSettings.aoColumns[i].sWidth !== null) {
+ iTmpWidth = _fnConvertToWidth(oSettings.aoColumns[i].sWidthOrig,
+ oSettings.nTable.parentNode);
+ if (iTmpWidth !== null) {
+ oSettings.aoColumns[i].sWidth = _fnStringToCss(iTmpWidth);
+ }
+
+ iUserInputs++;
+ }
+ }
+ }
+
+ /* If the number of columns in the DOM equals the number that we have to process in
+ * DataTables, then we can use the offsets that are created by the web-browser. No custom
+ * sizes can be set in order for this to happen, nor scrolling used
+ */
+ if (iColums == oHeaders.length && iUserInputs === 0 && iVisibleColumns == iColums &&
+ oSettings.oScroll.sX === "" && oSettings.oScroll.sY === "") {
+ for (i = 0; i < oSettings.aoColumns.length; i++) {
+ iTmpWidth = $(oHeaders[i]).width();
+ if (iTmpWidth !== null) {
+ oSettings.aoColumns[i].sWidth = _fnStringToCss(iTmpWidth);
+ }
+ }
+ }
+ else {
+ /* Otherwise we are going to have to do some calculations to get the width of each column.
+ * Construct a 1 row table with the widest node in the data, and any user defined widths,
+ * then insert it into the DOM and allow the browser to do all the hard work of
+ * calculating table widths.
+ */
+ var
+ nCalcTmp = oSettings.nTable.cloneNode(false),
+ nTheadClone = oSettings.nTHead.cloneNode(true),
+ nBody = document.createElement('tbody'),
+ nTr = document.createElement('tr'),
+ nDivSizing;
+
+ nCalcTmp.removeAttribute("id");
+ nCalcTmp.appendChild(nTheadClone);
+ if (oSettings.nTFoot !== null) {
+ nCalcTmp.appendChild(oSettings.nTFoot.cloneNode(true));
+ _fnApplyToChildren(function (n) {
+ n.style.width = "";
+ }, nCalcTmp.getElementsByTagName('tr'));
+ }
+
+ nCalcTmp.appendChild(nBody);
+ nBody.appendChild(nTr);
+
+ /* Remove any sizing that was previously applied by the styles */
+ var jqColSizing = $('thead th', nCalcTmp);
+ if (jqColSizing.length === 0) {
+ jqColSizing = $('tbody tr:eq(0)>td', nCalcTmp);
+ }
+
+ /* Apply custom sizing to the cloned header */
+ var nThs = _fnGetUniqueThs(oSettings, nTheadClone);
+ iCorrector = 0;
+ for (i = 0; i < iColums; i++) {
+ var oColumn = oSettings.aoColumns[i];
+ if (oColumn.bVisible && oColumn.sWidthOrig !== null && oColumn.sWidthOrig !== "") {
+ nThs[i - iCorrector].style.width = _fnStringToCss(oColumn.sWidthOrig);
+ }
+ else if (oColumn.bVisible) {
+ nThs[i - iCorrector].style.width = "";
+ }
+ else {
+ iCorrector++;
+ }
+ }
+
+ /* Find the biggest td for each column and put it into the table */
+ for (i = 0; i < iColums; i++) {
+ if (oSettings.aoColumns[i].bVisible) {
+ var nTd = _fnGetWidestNode(oSettings, i);
+ if (nTd !== null) {
+ nTd = nTd.cloneNode(true);
+ if (oSettings.aoColumns[i].sContentPadding !== "") {
+ nTd.innerHTML += oSettings.aoColumns[i].sContentPadding;
+ }
+ nTr.appendChild(nTd);
+ }
+ }
+ }
+
+ /* Build the table and 'display' it */
+ var nWrapper = oSettings.nTable.parentNode;
+ nWrapper.appendChild(nCalcTmp);
+
+ /* When scrolling (X or Y) we want to set the width of the table as appropriate. However,
+ * when not scrolling leave the table width as it is. This results in slightly different,
+ * but I think correct behaviour
+ */
+ if (oSettings.oScroll.sX !== "" && oSettings.oScroll.sXInner !== "") {
+ nCalcTmp.style.width = _fnStringToCss(oSettings.oScroll.sXInner);
+ }
+ else if (oSettings.oScroll.sX !== "") {
+ nCalcTmp.style.width = "";
+ if ($(nCalcTmp).width() < nWrapper.offsetWidth) {
+ nCalcTmp.style.width = _fnStringToCss(nWrapper.offsetWidth);
+ }
+ }
+ else if (oSettings.oScroll.sY !== "") {
+ nCalcTmp.style.width = _fnStringToCss(nWrapper.offsetWidth);
+ }
+ else if (widthAttr) {
+ nCalcTmp.style.width = _fnStringToCss(widthAttr);
+ }
+ nCalcTmp.style.visibility = "hidden";
+
+ /* Scrolling considerations */
+ _fnScrollingWidthAdjust(oSettings, nCalcTmp);
+
+ /* Read the width's calculated by the browser and store them for use by the caller. We
+ * first of all try to use the elements in the body, but it is possible that there are
+ * no elements there, under which circumstances we use the header elements
+ */
+ var oNodes = $("tbody tr:eq(0)", nCalcTmp).children();
+ if (oNodes.length === 0) {
+ oNodes = _fnGetUniqueThs(oSettings, $('thead', nCalcTmp)[0]);
+ }
+
+ /* Browsers need a bit of a hand when a width is assigned to any columns when
+ * x-scrolling as they tend to collapse the table to the min-width, even if
+ * we sent the column widths. So we need to keep track of what the table width
+ * should be by summing the user given values, and the automatic values
+ */
+ if (oSettings.oScroll.sX !== "") {
+ var iTotal = 0;
+ iCorrector = 0;
+ for (i = 0; i < oSettings.aoColumns.length; i++) {
+ if (oSettings.aoColumns[i].bVisible) {
+ if (oSettings.aoColumns[i].sWidthOrig === null) {
+ iTotal += $(oNodes[iCorrector]).outerWidth();
+ }
+ else {
+ iTotal += parseInt(oSettings.aoColumns[i].sWidth.replace('px', ''), 10) +
+ ($(oNodes[iCorrector]).outerWidth() - $(oNodes[iCorrector]).width());
+ }
+ iCorrector++;
+ }
+ }
+
+ nCalcTmp.style.width = _fnStringToCss(iTotal);
+ oSettings.nTable.style.width = _fnStringToCss(iTotal);
+ }
+
+ iCorrector = 0;
+ for (i = 0; i < oSettings.aoColumns.length; i++) {
+ if (oSettings.aoColumns[i].bVisible) {
+ iWidth = $(oNodes[iCorrector]).width();
+ if (iWidth !== null && iWidth > 0) {
+ oSettings.aoColumns[i].sWidth = _fnStringToCss(iWidth);
+ }
+ iCorrector++;
+ }
+ }
+
+ var cssWidth = $(nCalcTmp).css('width');
+ oSettings.nTable.style.width = (cssWidth.indexOf('%') !== -1) ?
+ cssWidth : _fnStringToCss($(nCalcTmp).outerWidth());
+ nCalcTmp.parentNode.removeChild(nCalcTmp);
+ }
+
+ if (widthAttr) {
+ oSettings.nTable.style.width = _fnStringToCss(widthAttr);
+ }
+ }
+
+
+ /**
+ * Adjust a table's width to take account of scrolling
+ * @param {object} oSettings dataTables settings object
+ * @param {node} n table node
+ * @memberof DataTable#oApi
+ */
+ function _fnScrollingWidthAdjust(oSettings, n) {
+ if (oSettings.oScroll.sX === "" && oSettings.oScroll.sY !== "") {
+ /* When y-scrolling only, we want to remove the width of the scroll bar so the table
+ * + scroll bar will fit into the area avaialble.
+ */
+ var iOrigWidth = $(n).width();
+ n.style.width = _fnStringToCss($(n).outerWidth() - oSettings.oScroll.iBarWidth);
+ }
+ else if (oSettings.oScroll.sX !== "") {
+ /* When x-scrolling both ways, fix the table at it's current size, without adjusting */
+ n.style.width = _fnStringToCss($(n).outerWidth());
+ }
+ }
+
+
+ /**
+ * Get the widest node
+ * @param {object} oSettings dataTables settings object
+ * @param {int} iCol column of interest
+ * @returns {string} max string length for each column
+ * @memberof DataTable#oApi
+ */
+ function _fnGetWidestNode(oSettings, iCol) {
+ var iMaxIndex = _fnGetMaxLenString(oSettings, iCol);
+ if (iMaxIndex < 0) {
+ return null;
+ }
+
+ if (oSettings.aoData[iMaxIndex].nTr === null) {
+ var n = document.createElement('td');
+ n.innerHTML = _fnGetCellData(oSettings, iMaxIndex, iCol, '');
+ return n;
+ }
+ return _fnGetTdNodes(oSettings, iMaxIndex)[iCol];
+ }
+
+
+ /**
+ * Get the maximum strlen for each data column
+ * @param {object} oSettings dataTables settings object
+ * @param {int} iCol column of interest
+ * @returns {string} max string length for each column
+ * @memberof DataTable#oApi
+ */
+ function _fnGetMaxLenString(oSettings, iCol) {
+ var iMax = -1;
+ var iMaxIndex = -1;
+
+ for (var i = 0; i < oSettings.aoData.length; i++) {
+ var s = _fnGetCellData(oSettings, i, iCol, 'display') + "";
+ s = s.replace(/<.*?>/g, "");
+ if (s.length > iMax) {
+ iMax = s.length;
+ iMaxIndex = i;
+ }
+ }
+
+ return iMaxIndex;
+ }
+
+
+ /**
+ * Append a CSS unit (only if required) to a string
+ * @param {array} aArray1 first array
+ * @param {array} aArray2 second array
+ * @returns {int} 0 if match, 1 if length is different, 2 if no match
+ * @memberof DataTable#oApi
+ */
+ function _fnStringToCss(s) {
+ if (s === null) {
+ return "0px";
+ }
+
+ if (typeof s == 'number') {
+ if (s < 0) {
+ return "0px";
+ }
+ return s + "px";
+ }
+
+ /* Check if the last character is not 0-9 */
+ var c = s.charCodeAt(s.length - 1);
+ if (c < 0x30 || c > 0x39) {
+ return s;
+ }
+ return s + "px";
+ }
+
+
+ /**
+ * Get the width of a scroll bar in this browser being used
+ * @returns {int} width in pixels
+ * @memberof DataTable#oApi
+ */
+ function _fnScrollBarWidth() {
+ var inner = document.createElement('p');
+ var style = inner.style;
+ style.width = "100%";
+ style.height = "200px";
+ style.padding = "0px";
+
+ var outer = document.createElement('div');
+ style = outer.style;
+ style.position = "absolute";
+ style.top = "0px";
+ style.left = "0px";
+ style.visibility = "hidden";
+ style.width = "200px";
+ style.height = "150px";
+ style.padding = "0px";
+ style.overflow = "hidden";
+ outer.appendChild(inner);
+
+ document.body.appendChild(outer);
+ var w1 = inner.offsetWidth;
+ outer.style.overflow = 'scroll';
+ var w2 = inner.offsetWidth;
+ if (w1 == w2) {
+ w2 = outer.clientWidth;
+ }
+
+ document.body.removeChild(outer);
+ return (w1 - w2);
+ }
+
+
+
+ /**
+ * Change the order of the table
+ * @param {object} oSettings dataTables settings object
+ * @param {bool} bApplyClasses optional - should we apply classes or not
+ * @memberof DataTable#oApi
+ */
+ function _fnSort(oSettings, bApplyClasses) {
+ var
+ i, iLen, j, jLen, k, kLen,
+ sDataType, nTh,
+ aaSort = [],
+ aiOrig = [],
+ oSort = DataTable.ext.oSort,
+ aoData = oSettings.aoData,
+ aoColumns = oSettings.aoColumns,
+ oAria = oSettings.oLanguage.oAria;
+
+ /* No sorting required if server-side or no sorting array */
+ if (!oSettings.oFeatures.bServerSide &&
+ (oSettings.aaSorting.length !== 0 || oSettings.aaSortingFixed !== null)) {
+ aaSort = (oSettings.aaSortingFixed !== null) ?
+ oSettings.aaSortingFixed.concat(oSettings.aaSorting) :
+ oSettings.aaSorting.slice();
+
+ /* If there is a sorting data type, and a function belonging to it, then we need to
+ * get the data from the developer's function and apply it for this column
+ */
+ for (i = 0; i < aaSort.length; i++) {
+ var iColumn = aaSort[i][0];
+ var iVisColumn = _fnColumnIndexToVisible(oSettings, iColumn);
+ sDataType = oSettings.aoColumns[iColumn].sSortDataType;
+ if (DataTable.ext.afnSortData[sDataType]) {
+ var aData = DataTable.ext.afnSortData[sDataType].call(
+ oSettings.oInstance, oSettings, iColumn, iVisColumn
+ );
+ if (aData.length === aoData.length) {
+ for (j = 0, jLen = aoData.length; j < jLen; j++) {
+ _fnSetCellData(oSettings, j, iColumn, aData[j]);
+ }
+ }
+ else {
+ _fnLog(oSettings, 0, "Returned data sort array (col " + iColumn + ") is the wrong length");
+ }
+ }
+ }
+
+ /* Create a value - key array of the current row positions such that we can use their
+ * current position during the sort, if values match, in order to perform stable sorting
+ */
+ for (i = 0, iLen = oSettings.aiDisplayMaster.length; i < iLen; i++) {
+ aiOrig[oSettings.aiDisplayMaster[i]] = i;
+ }
+
+ /* Build an internal data array which is specific to the sort, so we can get and prep
+ * the data to be sorted only once, rather than needing to do it every time the sorting
+ * function runs. This make the sorting function a very simple comparison
+ */
+ var iSortLen = aaSort.length;
+ var fnSortFormat, aDataSort;
+ for (i = 0, iLen = aoData.length; i < iLen; i++) {
+ for (j = 0; j < iSortLen; j++) {
+ aDataSort = aoColumns[aaSort[j][0]].aDataSort;
+
+ for (k = 0, kLen = aDataSort.length; k < kLen; k++) {
+ sDataType = aoColumns[aDataSort[k]].sType;
+ fnSortFormat = oSort[(sDataType ? sDataType : 'string') + "-pre"];
+
+ aoData[i]._aSortData[aDataSort[k]] = fnSortFormat ?
+ fnSortFormat(_fnGetCellData(oSettings, i, aDataSort[k], 'sort')) :
+ _fnGetCellData(oSettings, i, aDataSort[k], 'sort');
+ }
+ }
+ }
+
+ /* Do the sort - here we want multi-column sorting based on a given data source (column)
+ * and sorting function (from oSort) in a certain direction. It's reasonably complex to
+ * follow on it's own, but this is what we want (example two column sorting):
+ * fnLocalSorting = function(a,b){
+ * var iTest;
+ * iTest = oSort['string-asc']('data11', 'data12');
+ * if (iTest !== 0)
+ * return iTest;
+ * iTest = oSort['numeric-desc']('data21', 'data22');
+ * if (iTest !== 0)
+ * return iTest;
+ * return oSort['numeric-asc']( aiOrig[a], aiOrig[b] );
+ * }
+ * Basically we have a test for each sorting column, if the data in that column is equal,
+ * test the next column. If all columns match, then we use a numeric sort on the row
+ * positions in the original data array to provide a stable sort.
+ */
+ oSettings.aiDisplayMaster.sort(function (a, b) {
+ var k, l, lLen, iTest, aDataSort, sDataType;
+ for (k = 0; k < iSortLen; k++) {
+ aDataSort = aoColumns[aaSort[k][0]].aDataSort;
+
+ for (l = 0, lLen = aDataSort.length; l < lLen; l++) {
+ sDataType = aoColumns[aDataSort[l]].sType;
+
+ iTest = oSort[(sDataType ? sDataType : 'string') + "-" + aaSort[k][1]](
+ aoData[a]._aSortData[aDataSort[l]],
+ aoData[b]._aSortData[aDataSort[l]]
+ );
+
+ if (iTest !== 0) {
+ return iTest;
+ }
+ }
+ }
+
+ return oSort['numeric-asc'](aiOrig[a], aiOrig[b]);
+ });
+ }
+
+ /* Alter the sorting classes to take account of the changes */
+ if ((bApplyClasses === undefined || bApplyClasses) && !oSettings.oFeatures.bDeferRender) {
+ _fnSortingClasses(oSettings);
+ }
+
+ for (i = 0, iLen = oSettings.aoColumns.length; i < iLen; i++) {
+ var sTitle = aoColumns[i].sTitle.replace(/<.*?>/g, "");
+ nTh = aoColumns[i].nTh;
+ nTh.removeAttribute('aria-sort');
+ nTh.removeAttribute('aria-label');
+
+ /* In ARIA only the first sorting column can be marked as sorting - no multi-sort option */
+ if (aoColumns[i].bSortable) {
+ if (aaSort.length > 0 && aaSort[0][0] == i) {
+ nTh.setAttribute('aria-sort', aaSort[0][1] == "asc" ? "ascending" : "descending");
+
+ var nextSort = (aoColumns[i].asSorting[aaSort[0][2] + 1]) ?
+ aoColumns[i].asSorting[aaSort[0][2] + 1] : aoColumns[i].asSorting[0];
+ nTh.setAttribute('aria-label', sTitle +
+ (nextSort == "asc" ? oAria.sSortAscending : oAria.sSortDescending));
+ }
+ else {
+ nTh.setAttribute('aria-label', sTitle +
+ (aoColumns[i].asSorting[0] == "asc" ? oAria.sSortAscending : oAria.sSortDescending));
+ }
+ }
+ else {
+ nTh.setAttribute('aria-label', sTitle);
+ }
+ }
+
+ /* Tell the draw function that we have sorted the data */
+ oSettings.bSorted = true;
+ $(oSettings.oInstance).trigger('sort', oSettings);
+
+ /* Copy the master data into the draw array and re-draw */
+ if (oSettings.oFeatures.bFilter) {
+ /* _fnFilter() will redraw the table for us */
+ _fnFilterComplete(oSettings, oSettings.oPreviousSearch, 1);
+ }
+ else {
+ oSettings.aiDisplay = oSettings.aiDisplayMaster.slice();
+ oSettings._iDisplayStart = 0; /* reset display back to page 0 */
+ _fnCalculateEnd(oSettings);
+ _fnDraw(oSettings);
+ }
+ }
+
+
+ /**
+ * Attach a sort handler (click) to a node
+ * @param {object} oSettings dataTables settings object
+ * @param {node} nNode node to attach the handler to
+ * @param {int} iDataIndex column sorting index
+ * @param {function} [fnCallback] callback function
+ * @memberof DataTable#oApi
+ */
+ function _fnSortAttachListener(oSettings, nNode, iDataIndex, fnCallback) {
+ _fnBindAction(nNode, {}, function (e) {
+ /* If the column is not sortable - don't to anything */
+ if (oSettings.aoColumns[iDataIndex].bSortable === false) {
+ return;
+ }
+
+ /*
+ * This is a little bit odd I admit... I declare a temporary function inside the scope of
+ * _fnBuildHead and the click handler in order that the code presented here can be used
+ * twice - once for when bProcessing is enabled, and another time for when it is
+ * disabled, as we need to perform slightly different actions.
+ * Basically the issue here is that the Javascript engine in modern browsers don't
+ * appear to allow the rendering engine to update the display while it is still executing
+ * it's thread (well - it does but only after long intervals). This means that the
+ * 'processing' display doesn't appear for a table sort. To break the js thread up a bit
+ * I force an execution break by using setTimeout - but this breaks the expected
+ * thread continuation for the end-developer's point of view (their code would execute
+ * too early), so we only do it when we absolutely have to.
+ */
+ var fnInnerSorting = function () {
+ var iColumn, iNextSort;
+
+ /* If the shift key is pressed then we are multiple column sorting */
+ if (e.shiftKey) {
+ /* Are we already doing some kind of sort on this column? */
+ var bFound = false;
+ for (var i = 0; i < oSettings.aaSorting.length; i++) {
+ if (oSettings.aaSorting[i][0] == iDataIndex) {
+ bFound = true;
+ iColumn = oSettings.aaSorting[i][0];
+ iNextSort = oSettings.aaSorting[i][2] + 1;
+
+ if (!oSettings.aoColumns[iColumn].asSorting[iNextSort]) {
+ /* Reached the end of the sorting options, remove from multi-col sort */
+ oSettings.aaSorting.splice(i, 1);
+ }
+ else {
+ /* Move onto next sorting direction */
+ oSettings.aaSorting[i][1] = oSettings.aoColumns[iColumn].asSorting[iNextSort];
+ oSettings.aaSorting[i][2] = iNextSort;
+ }
+ break;
+ }
+ }
+
+ /* No sort yet - add it in */
+ if (bFound === false) {
+ oSettings.aaSorting.push([iDataIndex,
+ oSettings.aoColumns[iDataIndex].asSorting[0], 0]);
+ }
+ }
+ else {
+ /* If no shift key then single column sort */
+ if (oSettings.aaSorting.length == 1 && oSettings.aaSorting[0][0] == iDataIndex) {
+ iColumn = oSettings.aaSorting[0][0];
+ iNextSort = oSettings.aaSorting[0][2] + 1;
+ if (!oSettings.aoColumns[iColumn].asSorting[iNextSort]) {
+ iNextSort = 0;
+ }
+ oSettings.aaSorting[0][1] = oSettings.aoColumns[iColumn].asSorting[iNextSort];
+ oSettings.aaSorting[0][2] = iNextSort;
+ }
+ else {
+ oSettings.aaSorting.splice(0, oSettings.aaSorting.length);
+ oSettings.aaSorting.push([iDataIndex,
+ oSettings.aoColumns[iDataIndex].asSorting[0], 0]);
+ }
+ }
+
+ /* Run the sort */
+ _fnSort(oSettings);
+ }; /* /fnInnerSorting */
+
+ if (!oSettings.oFeatures.bProcessing) {
+ fnInnerSorting();
+ }
+ else {
+ _fnProcessingDisplay(oSettings, true);
+ setTimeout(function () {
+ fnInnerSorting();
+ if (!oSettings.oFeatures.bServerSide) {
+ _fnProcessingDisplay(oSettings, false);
+ }
+ }, 0);
+ }
+
+ /* Call the user specified callback function - used for async user interaction */
+ if (typeof fnCallback == 'function') {
+ fnCallback(oSettings);
+ }
+ });
+ }
+
+
+ /**
+ * Set the sorting classes on the header, Note: it is safe to call this function
+ * when bSort and bSortClasses are false
+ * @param {object} oSettings dataTables settings object
+ * @memberof DataTable#oApi
+ */
+ function _fnSortingClasses(oSettings) {
+ var i, iLen, j, jLen, iFound;
+ var aaSort, sClass;
+ var iColumns = oSettings.aoColumns.length;
+ var oClasses = oSettings.oClasses;
+
+ for (i = 0; i < iColumns; i++) {
+ if (oSettings.aoColumns[i].bSortable) {
+ $(oSettings.aoColumns[i].nTh).removeClass(oClasses.sSortAsc + " " + oClasses.sSortDesc +
+ " " + oSettings.aoColumns[i].sSortingClass);
+ }
+ }
+
+ if (oSettings.aaSortingFixed !== null) {
+ aaSort = oSettings.aaSortingFixed.concat(oSettings.aaSorting);
+ }
+ else {
+ aaSort = oSettings.aaSorting.slice();
+ }
+
+ /* Apply the required classes to the header */
+ for (i = 0; i < oSettings.aoColumns.length; i++) {
+ if (oSettings.aoColumns[i].bSortable) {
+ sClass = oSettings.aoColumns[i].sSortingClass;
+ iFound = -1;
+ for (j = 0; j < aaSort.length; j++) {
+ if (aaSort[j][0] == i) {
+ sClass = (aaSort[j][1] == "asc") ?
+ oClasses.sSortAsc : oClasses.sSortDesc;
+ iFound = j;
+ break;
+ }
+ }
+ $(oSettings.aoColumns[i].nTh).addClass(sClass);
+
+ if (oSettings.bJUI) {
+ /* jQuery UI uses extra markup */
+ var jqSpan = $("span." + oClasses.sSortIcon, oSettings.aoColumns[i].nTh);
+ jqSpan.removeClass(oClasses.sSortJUIAsc + " " + oClasses.sSortJUIDesc + " " +
+ oClasses.sSortJUI + " " + oClasses.sSortJUIAscAllowed + " " + oClasses.sSortJUIDescAllowed);
+
+ var sSpanClass;
+ if (iFound == -1) {
+ sSpanClass = oSettings.aoColumns[i].sSortingClassJUI;
+ }
+ else if (aaSort[iFound][1] == "asc") {
+ sSpanClass = oClasses.sSortJUIAsc;
+ }
+ else {
+ sSpanClass = oClasses.sSortJUIDesc;
+ }
+
+ jqSpan.addClass(sSpanClass);
+ }
+ }
+ else {
+ /* No sorting on this column, so add the base class. This will have been assigned by
+ * _fnAddColumn
+ */
+ $(oSettings.aoColumns[i].nTh).addClass(oSettings.aoColumns[i].sSortingClass);
+ }
+ }
+
+ /*
+ * Apply the required classes to the table body
+ * Note that this is given as a feature switch since it can significantly slow down a sort
+ * on large data sets (adding and removing of classes is always slow at the best of times..)
+ * Further to this, note that this code is admittedly fairly ugly. It could be made a lot
+ * simpler using jQuery selectors and add/removeClass, but that is significantly slower
+ * (on the order of 5 times slower) - hence the direct DOM manipulation here.
+ * Note that for deferred drawing we do use jQuery - the reason being that taking the first
+ * row found to see if the whole column needs processed can miss classes since the first
+ * column might be new.
+ */
+ sClass = oClasses.sSortColumn;
+
+ if (oSettings.oFeatures.bSort && oSettings.oFeatures.bSortClasses) {
+ var nTds = _fnGetTdNodes(oSettings);
+
+ /* Remove the old classes */
+ if (oSettings.oFeatures.bDeferRender) {
+ $(nTds).removeClass(sClass + '1 ' + sClass + '2 ' + sClass + '3');
+ }
+ else if (nTds.length >= iColumns) {
+ for (i = 0; i < iColumns; i++) {
+ if (nTds[i].className.indexOf(sClass + "1") != -1) {
+ for (j = 0, jLen = (nTds.length / iColumns); j < jLen; j++) {
+ nTds[(iColumns * j) + i].className =
+ $.trim(nTds[(iColumns * j) + i].className.replace(sClass + "1", ""));
+ }
+ }
+ else if (nTds[i].className.indexOf(sClass + "2") != -1) {
+ for (j = 0, jLen = (nTds.length / iColumns); j < jLen; j++) {
+ nTds[(iColumns * j) + i].className =
+ $.trim(nTds[(iColumns * j) + i].className.replace(sClass + "2", ""));
+ }
+ }
+ else if (nTds[i].className.indexOf(sClass + "3") != -1) {
+ for (j = 0, jLen = (nTds.length / iColumns); j < jLen; j++) {
+ nTds[(iColumns * j) + i].className =
+ $.trim(nTds[(iColumns * j) + i].className.replace(" " + sClass + "3", ""));
+ }
+ }
+ }
+ }
+
+ /* Add the new classes to the table */
+ var iClass = 1, iTargetCol;
+ for (i = 0; i < aaSort.length; i++) {
+ iTargetCol = parseInt(aaSort[i][0], 10);
+ for (j = 0, jLen = (nTds.length / iColumns); j < jLen; j++) {
+ nTds[(iColumns * j) + iTargetCol].className += " " + sClass + iClass;
+ }
+
+ if (iClass < 3) {
+ iClass++;
+ }
+ }
+ }
+ }
+
+
+
+ /**
+ * Save the state of a table in a cookie such that the page can be reloaded
+ * @param {object} oSettings dataTables settings object
+ * @memberof DataTable#oApi
+ */
+ function _fnSaveState(oSettings) {
+ if (!oSettings.oFeatures.bStateSave || oSettings.bDestroying) {
+ return;
+ }
+
+ /* Store the interesting variables */
+ var i, iLen, bInfinite = oSettings.oScroll.bInfinite;
+ var oState = {
+ "iCreate": new Date().getTime(),
+ "iStart": (bInfinite ? 0 : oSettings._iDisplayStart),
+ "iEnd": (bInfinite ? oSettings._iDisplayLength : oSettings._iDisplayEnd),
+ "iLength": oSettings._iDisplayLength,
+ "aaSorting": $.extend(true, [], oSettings.aaSorting),
+ "oSearch": $.extend(true, {}, oSettings.oPreviousSearch),
+ "aoSearchCols": $.extend(true, [], oSettings.aoPreSearchCols),
+ "abVisCols": []
+ };
+
+ for (i = 0, iLen = oSettings.aoColumns.length; i < iLen; i++) {
+ oState.abVisCols.push(oSettings.aoColumns[i].bVisible);
+ }
+
+ _fnCallbackFire(oSettings, "aoStateSaveParams", 'stateSaveParams', [oSettings, oState]);
+
+ oSettings.fnStateSave.call(oSettings.oInstance, oSettings, oState);
+ }
+
+
+ /**
+ * Attempt to load a saved table state from a cookie
+ * @param {object} oSettings dataTables settings object
+ * @param {object} oInit DataTables init object so we can override settings
+ * @memberof DataTable#oApi
+ */
+ function _fnLoadState(oSettings, oInit) {
+ if (!oSettings.oFeatures.bStateSave) {
+ return;
+ }
+
+ var oData = oSettings.fnStateLoad.call(oSettings.oInstance, oSettings);
+ if (!oData) {
+ return;
+ }
+
+ /* Allow custom and plug-in manipulation functions to alter the saved data set and
+ * cancelling of loading by returning false
+ */
+ var abStateLoad = _fnCallbackFire(oSettings, 'aoStateLoadParams', 'stateLoadParams', [oSettings, oData]);
+ if ($.inArray(false, abStateLoad) !== -1) {
+ return;
+ }
+
+ /* Store the saved state so it might be accessed at any time */
+ oSettings.oLoadedState = $.extend(true, {}, oData);
+
+ /* Restore key features */
+ oSettings._iDisplayStart = oData.iStart;
+ oSettings.iInitDisplayStart = oData.iStart;
+ oSettings._iDisplayEnd = oData.iEnd;
+ oSettings._iDisplayLength = oData.iLength;
+ oSettings.aaSorting = oData.aaSorting.slice();
+ oSettings.saved_aaSorting = oData.aaSorting.slice();
+
+ /* Search filtering */
+ $.extend(oSettings.oPreviousSearch, oData.oSearch);
+ $.extend(true, oSettings.aoPreSearchCols, oData.aoSearchCols);
+
+ /* Column visibility state
+ * Pass back visibility settings to the init handler, but to do not here override
+ * the init object that the user might have passed in
+ */
+ oInit.saved_aoColumns = [];
+ for (var i = 0; i < oData.abVisCols.length; i++) {
+ oInit.saved_aoColumns[i] = {};
+ oInit.saved_aoColumns[i].bVisible = oData.abVisCols[i];
+ }
+
+ _fnCallbackFire(oSettings, 'aoStateLoaded', 'stateLoaded', [oSettings, oData]);
+ }
+
+
+ /**
+ * Create a new cookie with a value to store the state of a table
+ * @param {string} sName name of the cookie to create
+ * @param {string} sValue the value the cookie should take
+ * @param {int} iSecs duration of the cookie
+ * @param {string} sBaseName sName is made up of the base + file name - this is the base
+ * @param {function} fnCallback User definable function to modify the cookie
+ * @memberof DataTable#oApi
+ */
+ function _fnCreateCookie(sName, sValue, iSecs, sBaseName, fnCallback) {
+ var date = new Date();
+ date.setTime(date.getTime() + (iSecs * 1000));
+
+ /*
+ * Shocking but true - it would appear IE has major issues with having the path not having
+ * a trailing slash on it. We need the cookie to be available based on the path, so we
+ * have to append the file name to the cookie name. Appalling. Thanks to vex for adding the
+ * patch to use at least some of the path
+ */
+ var aParts = window.location.pathname.split('/');
+ var sNameFile = sName + '_' + aParts.pop().replace(/[\/:]/g, "").toLowerCase();
+ var sFullCookie, oData;
+
+ if (fnCallback !== null) {
+ oData = (typeof $.parseJSON === 'function') ?
+ $.parseJSON(sValue) : eval('(' + sValue + ')');
+ sFullCookie = fnCallback(sNameFile, oData, date.toGMTString(),
+ aParts.join('/') + "/");
+ }
+ else {
+ sFullCookie = sNameFile + "=" + encodeURIComponent(sValue) +
+ "; expires=" + date.toGMTString() + "; path=" + aParts.join('/') + "/";
+ }
+
+ /* Are we going to go over the cookie limit of 4KiB? If so, try to delete a cookies
+ * belonging to DataTables. This is FAR from bullet proof
+ */
+ var sOldName = "", iOldTime = 9999999999999;
+ var iLength = _fnReadCookie(sNameFile) !== null ? document.cookie.length :
+ sFullCookie.length + document.cookie.length;
+
+ if (iLength + 10 > 4096) /* Magic 10 for padding */
+ {
+ var aCookies = document.cookie.split(';');
+ for (var i = 0, iLen = aCookies.length; i < iLen; i++) {
+ if (aCookies[i].indexOf(sBaseName) != -1) {
+ /* It's a DataTables cookie, so eval it and check the time stamp */
+ var aSplitCookie = aCookies[i].split('=');
+ try { oData = eval('(' + decodeURIComponent(aSplitCookie[1]) + ')'); }
+ catch (e) { continue; }
+
+ if (oData.iCreate && oData.iCreate < iOldTime) {
+ sOldName = aSplitCookie[0];
+ iOldTime = oData.iCreate;
+ }
+ }
+ }
+
+ if (sOldName !== "") {
+ document.cookie = sOldName + "=; expires=Thu, 01-Jan-1970 00:00:01 GMT; path=" +
+ aParts.join('/') + "/";
+ }
+ }
+
+ document.cookie = sFullCookie;
+ }
+
+
+ /**
+ * Read an old cookie to get a cookie with an old table state
+ * @param {string} sName name of the cookie to read
+ * @returns {string} contents of the cookie - or null if no cookie with that name found
+ * @memberof DataTable#oApi
+ */
+ function _fnReadCookie(sName) {
+ var
+ aParts = window.location.pathname.split('/'),
+ sNameEQ = sName + '_' + aParts[aParts.length - 1].replace(/[\/:]/g, "").toLowerCase() + '=',
+ sCookieContents = document.cookie.split(';');
+
+ for (var i = 0; i < sCookieContents.length; i++) {
+ var c = sCookieContents[i];
+
+ while (c.charAt(0) == ' ') {
+ c = c.substring(1, c.length);
+ }
+
+ if (c.indexOf(sNameEQ) === 0) {
+ return decodeURIComponent(c.substring(sNameEQ.length, c.length));
+ }
+ }
+ return null;
+ }
+
+
+
+ /**
+ * Return the settings object for a particular table
+ * @param {node} nTable table we are using as a dataTable
+ * @returns {object} Settings object - or null if not found
+ * @memberof DataTable#oApi
+ */
+ function _fnSettingsFromNode(nTable) {
+ for (var i = 0; i < DataTable.settings.length; i++) {
+ if (DataTable.settings[i].nTable === nTable) {
+ return DataTable.settings[i];
+ }
+ }
+
+ return null;
+ }
+
+
+ /**
+ * Return an array with the TR nodes for the table
+ * @param {object} oSettings dataTables settings object
+ * @returns {array} TR array
+ * @memberof DataTable#oApi
+ */
+ function _fnGetTrNodes(oSettings) {
+ var aNodes = [];
+ var aoData = oSettings.aoData;
+ for (var i = 0, iLen = aoData.length; i < iLen; i++) {
+ if (aoData[i].nTr !== null) {
+ aNodes.push(aoData[i].nTr);
+ }
+ }
+ return aNodes;
+ }
+
+
+ /**
+ * Return an flat array with all TD nodes for the table, or row
+ * @param {object} oSettings dataTables settings object
+ * @param {int} [iIndividualRow] aoData index to get the nodes for - optional
+ * if not given then the return array will contain all nodes for the table
+ * @returns {array} TD array
+ * @memberof DataTable#oApi
+ */
+ function _fnGetTdNodes(oSettings, iIndividualRow) {
+ var anReturn = [];
+ var iCorrector;
+ var anTds;
+ var iRow, iRows = oSettings.aoData.length,
+ iColumn, iColumns, oData, sNodeName, iStart = 0, iEnd = iRows;
+
+ /* Allow the collection to be limited to just one row */
+ if (iIndividualRow !== undefined) {
+ iStart = iIndividualRow;
+ iEnd = iIndividualRow + 1;
+ }
+
+ for (iRow = iStart; iRow < iEnd; iRow++) {
+ oData = oSettings.aoData[iRow];
+ if (oData.nTr !== null) {
+ /* get the TD child nodes - taking into account text etc nodes */
+ anTds = [];
+ for (iColumn = 0, iColumns = oData.nTr.childNodes.length; iColumn < iColumns; iColumn++) {
+ sNodeName = oData.nTr.childNodes[iColumn].nodeName.toLowerCase();
+ if (sNodeName == 'td' || sNodeName == 'th') {
+ anTds.push(oData.nTr.childNodes[iColumn]);
+ }
+ }
+
+ iCorrector = 0;
+ for (iColumn = 0, iColumns = oSettings.aoColumns.length; iColumn < iColumns; iColumn++) {
+ if (oSettings.aoColumns[iColumn].bVisible) {
+ anReturn.push(anTds[iColumn - iCorrector]);
+ }
+ else {
+ anReturn.push(oData._anHidden[iColumn]);
+ iCorrector++;
+ }
+ }
+ }
+ }
+
+ return anReturn;
+ }
+
+
+ /**
+ * Log an error message
+ * @param {object} oSettings dataTables settings object
+ * @param {int} iLevel log error messages, or display them to the user
+ * @param {string} sMesg error message
+ * @memberof DataTable#oApi
+ */
+ function _fnLog(oSettings, iLevel, sMesg) {
+ var sAlert = (oSettings === null) ?
+ "DataTables warning: " + sMesg :
+ "DataTables warning (table id = '" + oSettings.sTableId + "'): " + sMesg;
+
+ if (iLevel === 0) {
+ if (DataTable.ext.sErrMode == 'alert') {
+ alert(sAlert);
+ }
+ else {
+ throw new Error(sAlert);
+ }
+ return;
+ }
+ else if (window.console && console.log) {
+ console.log(sAlert);
+ }
+ }
+
+
+ /**
+ * See if a property is defined on one object, if so assign it to the other object
+ * @param {object} oRet target object
+ * @param {object} oSrc source object
+ * @param {string} sName property
+ * @param {string} [sMappedName] name to map too - optional, sName used if not given
+ * @memberof DataTable#oApi
+ */
+ function _fnMap(oRet, oSrc, sName, sMappedName) {
+ if (sMappedName === undefined) {
+ sMappedName = sName;
+ }
+ if (oSrc[sName] !== undefined) {
+ oRet[sMappedName] = oSrc[sName];
+ }
+ }
+
+
+ /**
+ * Extend objects - very similar to jQuery.extend, but deep copy objects, and shallow
+ * copy arrays. The reason we need to do this, is that we don't want to deep copy array
+ * init values (such as aaSorting) since the dev wouldn't be able to override them, but
+ * we do want to deep copy arrays.
+ * @param {object} oOut Object to extend
+ * @param {object} oExtender Object from which the properties will be applied to oOut
+ * @returns {object} oOut Reference, just for convenience - oOut === the return.
+ * @memberof DataTable#oApi
+ * @todo This doesn't take account of arrays inside the deep copied objects.
+ */
+ function _fnExtend(oOut, oExtender) {
+ var val;
+
+ for (var prop in oExtender) {
+ if (oExtender.hasOwnProperty(prop)) {
+ val = oExtender[prop];
+
+ if (typeof oInit[prop] === 'object' && val !== null && $.isArray(val) === false) {
+ $.extend(true, oOut[prop], val);
+ }
+ else {
+ oOut[prop] = val;
+ }
+ }
+ }
+
+ return oOut;
+ }
+
+
+ /**
+ * Bind an event handers to allow a click or return key to activate the callback.
+ * This is good for accessibility since a return on the keyboard will have the
+ * same effect as a click, if the element has focus.
+ * @param {element} n Element to bind the action to
+ * @param {object} oData Data object to pass to the triggered function
+ * @param {function} fn Callback function for when the event is triggered
+ * @memberof DataTable#oApi
+ */
+ function _fnBindAction(n, oData, fn) {
+ $(n)
+ .bind('click.DT', oData, function (e) {
+ n.blur(); // Remove focus outline for mouse users
+ fn(e);
+ })
+ .bind('keypress.DT', oData, function (e) {
+ if (e.which === 13) {
+ fn(e);
+ }
+ })
+ .bind('selectstart.DT', function () {
+ /* Take the brutal approach to cancelling text selection */
+ return false;
+ });
+ }
+
+
+ /**
+ * Register a callback function. Easily allows a callback function to be added to
+ * an array store of callback functions that can then all be called together.
+ * @param {object} oSettings dataTables settings object
+ * @param {string} sStore Name of the array storage for the callbacks in oSettings
+ * @param {function} fn Function to be called back
+ * @param {string} sName Identifying name for the callback (i.e. a label)
+ * @memberof DataTable#oApi
+ */
+ function _fnCallbackReg(oSettings, sStore, fn, sName) {
+ if (fn) {
+ oSettings[sStore].push({
+ "fn": fn,
+ "sName": sName
+ });
+ }
+ }
+
+
+ /**
+ * Fire callback functions and trigger events. Note that the loop over the callback
+ * array store is done backwards! Further note that you do not want to fire off triggers
+ * in time sensitive applications (for example cell creation) as its slow.
+ * @param {object} oSettings dataTables settings object
+ * @param {string} sStore Name of the array storage for the callbacks in oSettings
+ * @param {string} sTrigger Name of the jQuery custom event to trigger. If null no trigger
+ * is fired
+ * @param {array} aArgs Array of arguments to pass to the callback function / trigger
+ * @memberof DataTable#oApi
+ */
+ function _fnCallbackFire(oSettings, sStore, sTrigger, aArgs) {
+ var aoStore = oSettings[sStore];
+ var aRet = [];
+
+ for (var i = aoStore.length - 1; i >= 0; i--) {
+ aRet.push(aoStore[i].fn.apply(oSettings.oInstance, aArgs));
+ }
+
+ if (sTrigger !== null) {
+ $(oSettings.oInstance).trigger(sTrigger, aArgs);
+ }
+
+ return aRet;
+ }
+
+
+ /**
+ * JSON stringify. If JSON.stringify it provided by the browser, json2.js or any other
+ * library, then we use that as it is fast, safe and accurate. If the function isn't
+ * available then we need to built it ourselves - the inspiration for this function comes
+ * from Craig Buckler ( http://www.sitepoint.com/javascript-json-serialization/ ). It is
+ * not perfect and absolutely should not be used as a replacement to json2.js - but it does
+ * do what we need, without requiring a dependency for DataTables.
+ * @param {object} o JSON object to be converted
+ * @returns {string} JSON string
+ * @memberof DataTable#oApi
+ */
+ var _fnJsonString = (window.JSON) ? JSON.stringify : function (o) {
+ /* Not an object or array */
+ var sType = typeof o;
+ if (sType !== "object" || o === null) {
+ // simple data type
+ if (sType === "string") {
+ o = '"' + o + '"';
+ }
+ return o + "";
+ }
+
+ /* If object or array, need to recurse over it */
+ var
+ sProp, mValue,
+ json = [],
+ bArr = $.isArray(o);
+
+ for (sProp in o) {
+ mValue = o[sProp];
+ sType = typeof mValue;
+
+ if (sType === "string") {
+ mValue = '"' + mValue + '"';
+ }
+ else if (sType === "object" && mValue !== null) {
+ mValue = _fnJsonString(mValue);
+ }
+
+ json.push((bArr ? "" : '"' + sProp + '":') + mValue);
+ }
+
+ return (bArr ? "[" : "{") + json + (bArr ? "]" : "}");
+ };
+
+
+ /**
+ * From some browsers (specifically IE6/7) we need special handling to work around browser
+ * bugs - this function is used to detect when these workarounds are needed.
+ * @param {object} oSettings dataTables settings object
+ * @memberof DataTable#oApi
+ */
+ function _fnBrowserDetect(oSettings) {
+ /* IE6/7 will oversize a width 100% element inside a scrolling element, to include the
+ * width of the scrollbar, while other browsers ensure the inner element is contained
+ * without forcing scrolling
+ */
+ var n = $(
+ '
')[0];
+
+ document.body.appendChild(n);
+ oSettings.oBrowser.bScrollOversize = $('#DT_BrowserTest', n)[0].offsetWidth === 100 ? true : false;
+ document.body.removeChild(n);
+ }
+
+
+
+
+ /**
+ * Perform a jQuery selector action on the table's TR elements (from the tbody) and
+ * return the resulting jQuery object.
+ * @param {string|node|jQuery} sSelector jQuery selector or node collection to act on
+ * @param {object} [oOpts] Optional parameters for modifying the rows to be included
+ * @param {string} [oOpts.filter=none] Select TR elements that meet the current filter
+ * criterion ("applied") or all TR elements (i.e. no filter).
+ * @param {string} [oOpts.order=current] Order of the TR elements in the processed array.
+ * Can be either 'current', whereby the current sorting of the table is used, or
+ * 'original' whereby the original order the data was read into the table is used.
+ * @param {string} [oOpts.page=all] Limit the selection to the currently displayed page
+ * ("current") or not ("all"). If 'current' is given, then order is assumed to be
+ * 'current' and filter is 'applied', regardless of what they might be given as.
+ * @returns {object} jQuery object, filtered by the given selector.
+ * @dtopt API
+ *
+ * @example
+ * $(document).ready(function() {
+ * var oTable = $('#example').dataTable();
+ *
+ * // Highlight every second row
+ * oTable.$('tr:odd').css('backgroundColor', 'blue');
+ * } );
+ *
+ * @example
+ * $(document).ready(function() {
+ * var oTable = $('#example').dataTable();
+ *
+ * // Filter to rows with 'Webkit' in them, add a background colour and then
+ * // remove the filter, thus highlighting the 'Webkit' rows only.
+ * oTable.fnFilter('Webkit');
+ * oTable.$('tr', {"filter": "applied"}).css('backgroundColor', 'blue');
+ * oTable.fnFilter('');
+ * } );
+ */
+ this.$ = function (sSelector, oOpts) {
+ var i, iLen, a = [], tr;
+ var oSettings = _fnSettingsFromNode(this[DataTable.ext.iApiIndex]);
+ var aoData = oSettings.aoData;
+ var aiDisplay = oSettings.aiDisplay;
+ var aiDisplayMaster = oSettings.aiDisplayMaster;
+
+ if (!oOpts) {
+ oOpts = {};
+ }
+
+ oOpts = $.extend({}, {
+ "filter": "none", // applied
+ "order": "current", // "original"
+ "page": "all" // current
+ }, oOpts);
+
+ // Current page implies that order=current and fitler=applied, since it is fairly
+ // senseless otherwise
+ if (oOpts.page == 'current') {
+ for (i = oSettings._iDisplayStart, iLen = oSettings.fnDisplayEnd(); i < iLen; i++) {
+ tr = aoData[aiDisplay[i]].nTr;
+ if (tr) {
+ a.push(tr);
+ }
+ }
+ }
+ else if (oOpts.order == "current" && oOpts.filter == "none") {
+ for (i = 0, iLen = aiDisplayMaster.length; i < iLen; i++) {
+ tr = aoData[aiDisplayMaster[i]].nTr;
+ if (tr) {
+ a.push(tr);
+ }
+ }
+ }
+ else if (oOpts.order == "current" && oOpts.filter == "applied") {
+ for (i = 0, iLen = aiDisplay.length; i < iLen; i++) {
+ tr = aoData[aiDisplay[i]].nTr;
+ if (tr) {
+ a.push(tr);
+ }
+ }
+ }
+ else if (oOpts.order == "original" && oOpts.filter == "none") {
+ for (i = 0, iLen = aoData.length; i < iLen; i++) {
+ tr = aoData[i].nTr;
+ if (tr) {
+ a.push(tr);
+ }
+ }
+ }
+ else if (oOpts.order == "original" && oOpts.filter == "applied") {
+ for (i = 0, iLen = aoData.length; i < iLen; i++) {
+ tr = aoData[i].nTr;
+ if ($.inArray(i, aiDisplay) !== -1 && tr) {
+ a.push(tr);
+ }
+ }
+ }
+ else {
+ _fnLog(oSettings, 1, "Unknown selection options");
+ }
+
+ /* We need to filter on the TR elements and also 'find' in their descendants
+ * to make the selector act like it would in a full table - so we need
+ * to build both results and then combine them together
+ */
+ var jqA = $(a);
+ var jqTRs = jqA.filter(sSelector);
+ var jqDescendants = jqA.find(sSelector);
+
+ return $([].concat($.makeArray(jqTRs), $.makeArray(jqDescendants)));
+ };
+
+
+ /**
+ * Almost identical to $ in operation, but in this case returns the data for the matched
+ * rows - as such, the jQuery selector used should match TR row nodes or TD/TH cell nodes
+ * rather than any descendants, so the data can be obtained for the row/cell. If matching
+ * rows are found, the data returned is the original data array/object that was used to
+ * create the row (or a generated array if from a DOM source).
+ *
+ * This method is often useful in-combination with $ where both functions are given the
+ * same parameters and the array indexes will match identically.
+ * @param {string|node|jQuery} sSelector jQuery selector or node collection to act on
+ * @param {object} [oOpts] Optional parameters for modifying the rows to be included
+ * @param {string} [oOpts.filter=none] Select elements that meet the current filter
+ * criterion ("applied") or all elements (i.e. no filter).
+ * @param {string} [oOpts.order=current] Order of the data in the processed array.
+ * Can be either 'current', whereby the current sorting of the table is used, or
+ * 'original' whereby the original order the data was read into the table is used.
+ * @param {string} [oOpts.page=all] Limit the selection to the currently displayed page
+ * ("current") or not ("all"). If 'current' is given, then order is assumed to be
+ * 'current' and filter is 'applied', regardless of what they might be given as.
+ * @returns {array} Data for the matched elements. If any elements, as a result of the
+ * selector, were not TR, TD or TH elements in the DataTable, they will have a null
+ * entry in the array.
+ * @dtopt API
+ *
+ * @example
+ * $(document).ready(function() {
+ * var oTable = $('#example').dataTable();
+ *
+ * // Get the data from the first row in the table
+ * var data = oTable._('tr:first');
+ *
+ * // Do something useful with the data
+ * alert( "First cell is: "+data[0] );
+ * } );
+ *
+ * @example
+ * $(document).ready(function() {
+ * var oTable = $('#example').dataTable();
+ *
+ * // Filter to 'Webkit' and get all data for
+ * oTable.fnFilter('Webkit');
+ * var data = oTable._('tr', {"filter": "applied"});
+ *
+ * // Do something with the data
+ * alert( data.length+" rows matched the filter" );
+ * } );
+ */
+ this._ = function (sSelector, oOpts) {
+ var aOut = [];
+ var i, iLen, iIndex;
+ var aTrs = this.$(sSelector, oOpts);
+
+ for (i = 0, iLen = aTrs.length; i < iLen; i++) {
+ aOut.push(this.fnGetData(aTrs[i]));
+ }
+
+ return aOut;
+ };
+
+
+ /**
+ * Add a single new row or multiple rows of data to the table. Please note
+ * that this is suitable for client-side processing only - if you are using
+ * server-side processing (i.e. "bServerSide": true), then to add data, you
+ * must add it to the data source, i.e. the server-side, through an Ajax call.
+ * @param {array|object} mData The data to be added to the table. This can be:
+ *
+ * 1D array of data - add a single row with the data provided
+ * 2D array of arrays - add multiple rows in a single call
+ * object - data object when using mData
+ * array of objects - multiple data objects when using mData
+ *
+ * @param {bool} [bRedraw=true] redraw the table or not
+ * @returns {array} An array of integers, representing the list of indexes in
+ *
aoData ({@link DataTable.models.oSettings}) that have been added to
+ * the table.
+ * @dtopt API
+ *
+ * @example
+ * // Global var for counter
+ * var giCount = 2;
+ *
+ * $(document).ready(function() {
+ * $('#example').dataTable();
+ * } );
+ *
+ * function fnClickAddRow() {
+ * $('#example').dataTable().fnAddData( [
+ * giCount+".1",
+ * giCount+".2",
+ * giCount+".3",
+ * giCount+".4" ]
+ * );
+ *
+ * giCount++;
+ * }
+ */
+ this.fnAddData = function (mData, bRedraw) {
+ if (mData.length === 0) {
+ return [];
+ }
+
+ var aiReturn = [];
+ var iTest;
+
+ /* Find settings from table node */
+ var oSettings = _fnSettingsFromNode(this[DataTable.ext.iApiIndex]);
+
+ /* Check if we want to add multiple rows or not */
+ if (typeof mData[0] === "object" && mData[0] !== null) {
+ for (var i = 0; i < mData.length; i++) {
+ iTest = _fnAddData(oSettings, mData[i]);
+ if (iTest == -1) {
+ return aiReturn;
+ }
+ aiReturn.push(iTest);
+ }
+ }
+ else {
+ iTest = _fnAddData(oSettings, mData);
+ if (iTest == -1) {
+ return aiReturn;
+ }
+ aiReturn.push(iTest);
+ }
+
+ oSettings.aiDisplay = oSettings.aiDisplayMaster.slice();
+
+ if (bRedraw === undefined || bRedraw) {
+ _fnReDraw(oSettings);
+ }
+ return aiReturn;
+ };
+
+
+ /**
+ * This function will make DataTables recalculate the column sizes, based on the data
+ * contained in the table and the sizes applied to the columns (in the DOM, CSS or
+ * through the sWidth parameter). This can be useful when the width of the table's
+ * parent element changes (for example a window resize).
+ * @param {boolean} [bRedraw=true] Redraw the table or not, you will typically want to
+ * @dtopt API
+ *
+ * @example
+ * $(document).ready(function() {
+ * var oTable = $('#example').dataTable( {
+ * "sScrollY": "200px",
+ * "bPaginate": false
+ * } );
+ *
+ * $(window).bind('resize', function () {
+ * oTable.fnAdjustColumnSizing();
+ * } );
+ * } );
+ */
+ this.fnAdjustColumnSizing = function (bRedraw) {
+ var oSettings = _fnSettingsFromNode(this[DataTable.ext.iApiIndex]);
+ _fnAdjustColumnSizing(oSettings);
+
+ if (bRedraw === undefined || bRedraw) {
+ this.fnDraw(false);
+ }
+ else if (oSettings.oScroll.sX !== "" || oSettings.oScroll.sY !== "") {
+ /* If not redrawing, but scrolling, we want to apply the new column sizes anyway */
+ this.oApi._fnScrollDraw(oSettings);
+ }
+ };
+
+
+ /**
+ * Quickly and simply clear a table
+ * @param {bool} [bRedraw=true] redraw the table or not
+ * @dtopt API
+ *
+ * @example
+ * $(document).ready(function() {
+ * var oTable = $('#example').dataTable();
+ *
+ * // Immediately 'nuke' the current rows (perhaps waiting for an Ajax callback...)
+ * oTable.fnClearTable();
+ * } );
+ */
+ this.fnClearTable = function (bRedraw) {
+ /* Find settings from table node */
+ var oSettings = _fnSettingsFromNode(this[DataTable.ext.iApiIndex]);
+ _fnClearTable(oSettings);
+
+ if (bRedraw === undefined || bRedraw) {
+ _fnDraw(oSettings);
+ }
+ };
+
+
+ /**
+ * The exact opposite of 'opening' a row, this function will close any rows which
+ * are currently 'open'.
+ * @param {node} nTr the table row to 'close'
+ * @returns {int} 0 on success, or 1 if failed (can't find the row)
+ * @dtopt API
+ *
+ * @example
+ * $(document).ready(function() {
+ * var oTable;
+ *
+ * // 'open' an information row when a row is clicked on
+ * $('#example tbody tr').click( function () {
+ * if ( oTable.fnIsOpen(this) ) {
+ * oTable.fnClose( this );
+ * } else {
+ * oTable.fnOpen( this, "Temporary row opened", "info_row" );
+ * }
+ * } );
+ *
+ * oTable = $('#example').dataTable();
+ * } );
+ */
+ this.fnClose = function (nTr) {
+ /* Find settings from table node */
+ var oSettings = _fnSettingsFromNode(this[DataTable.ext.iApiIndex]);
+
+ for (var i = 0; i < oSettings.aoOpenRows.length; i++) {
+ if (oSettings.aoOpenRows[i].nParent == nTr) {
+ var nTrParent = oSettings.aoOpenRows[i].nTr.parentNode;
+ if (nTrParent) {
+ /* Remove it if it is currently on display */
+ nTrParent.removeChild(oSettings.aoOpenRows[i].nTr);
+ }
+ oSettings.aoOpenRows.splice(i, 1);
+ return 0;
+ }
+ }
+ return 1;
+ };
+
+
+ /**
+ * Remove a row for the table
+ * @param {mixed} mTarget The index of the row from aoData to be deleted, or
+ * the TR element you want to delete
+ * @param {function|null} [fnCallBack] Callback function
+ * @param {bool} [bRedraw=true] Redraw the table or not
+ * @returns {array} The row that was deleted
+ * @dtopt API
+ *
+ * @example
+ * $(document).ready(function() {
+ * var oTable = $('#example').dataTable();
+ *
+ * // Immediately remove the first row
+ * oTable.fnDeleteRow( 0 );
+ * } );
+ */
+ this.fnDeleteRow = function (mTarget, fnCallBack, bRedraw) {
+ /* Find settings from table node */
+ var oSettings = _fnSettingsFromNode(this[DataTable.ext.iApiIndex]);
+ var i, iLen, iAODataIndex;
+
+ iAODataIndex = (typeof mTarget === 'object') ?
+ _fnNodeToDataIndex(oSettings, mTarget) : mTarget;
+
+ /* Return the data array from this row */
+ var oData = oSettings.aoData.splice(iAODataIndex, 1);
+
+ /* Update the _DT_RowIndex parameter */
+ for (i = 0, iLen = oSettings.aoData.length; i < iLen; i++) {
+ if (oSettings.aoData[i].nTr !== null) {
+ oSettings.aoData[i].nTr._DT_RowIndex = i;
+ }
+ }
+
+ /* Remove the target row from the search array */
+ var iDisplayIndex = $.inArray(iAODataIndex, oSettings.aiDisplay);
+ oSettings.asDataSearch.splice(iDisplayIndex, 1);
+
+ /* Delete from the display arrays */
+ _fnDeleteIndex(oSettings.aiDisplayMaster, iAODataIndex);
+ _fnDeleteIndex(oSettings.aiDisplay, iAODataIndex);
+
+ /* If there is a user callback function - call it */
+ if (typeof fnCallBack === "function") {
+ fnCallBack.call(this, oSettings, oData);
+ }
+
+ /* Check for an 'overflow' they case for displaying the table */
+ if (oSettings._iDisplayStart >= oSettings.fnRecordsDisplay()) {
+ oSettings._iDisplayStart -= oSettings._iDisplayLength;
+ if (oSettings._iDisplayStart < 0) {
+ oSettings._iDisplayStart = 0;
+ }
+ }
+
+ if (bRedraw === undefined || bRedraw) {
+ _fnCalculateEnd(oSettings);
+ _fnDraw(oSettings);
+ }
+
+ return oData;
+ };
+
+
+ /**
+ * Restore the table to it's original state in the DOM by removing all of DataTables
+ * enhancements, alterations to the DOM structure of the table and event listeners.
+ * @param {boolean} [bRemove=false] Completely remove the table from the DOM
+ * @dtopt API
+ *
+ * @example
+ * $(document).ready(function() {
+ * // This example is fairly pointless in reality, but shows how fnDestroy can be used
+ * var oTable = $('#example').dataTable();
+ * oTable.fnDestroy();
+ * } );
+ */
+ this.fnDestroy = function (bRemove) {
+ var oSettings = _fnSettingsFromNode(this[DataTable.ext.iApiIndex]);
+ var nOrig = oSettings.nTableWrapper.parentNode;
+ var nBody = oSettings.nTBody;
+ var i, iLen;
+
+ bRemove = (bRemove === undefined) ? false : true;
+
+ /* Flag to note that the table is currently being destroyed - no action should be taken */
+ oSettings.bDestroying = true;
+
+ /* Fire off the destroy callbacks for plug-ins etc */
+ _fnCallbackFire(oSettings, "aoDestroyCallback", "destroy", [oSettings]);
+
+ /* Restore hidden columns */
+ for (i = 0, iLen = oSettings.aoColumns.length; i < iLen; i++) {
+ if (oSettings.aoColumns[i].bVisible === false) {
+ this.fnSetColumnVis(i, true);
+ }
+ }
+
+ /* Blitz all DT events */
+ $(oSettings.nTableWrapper).find('*').andSelf().unbind('.DT');
+
+ /* If there is an 'empty' indicator row, remove it */
+ $('tbody>tr>td.' + oSettings.oClasses.sRowEmpty, oSettings.nTable).parent().remove();
+
+ /* When scrolling we had to break the table up - restore it */
+ if (oSettings.nTable != oSettings.nTHead.parentNode) {
+ $(oSettings.nTable).children('thead').remove();
+ oSettings.nTable.appendChild(oSettings.nTHead);
+ }
+
+ if (oSettings.nTFoot && oSettings.nTable != oSettings.nTFoot.parentNode) {
+ $(oSettings.nTable).children('tfoot').remove();
+ oSettings.nTable.appendChild(oSettings.nTFoot);
+ }
+
+ /* Remove the DataTables generated nodes, events and classes */
+ oSettings.nTable.parentNode.removeChild(oSettings.nTable);
+ $(oSettings.nTableWrapper).remove();
+
+ oSettings.aaSorting = [];
+ oSettings.aaSortingFixed = [];
+ _fnSortingClasses(oSettings);
+
+ $(_fnGetTrNodes(oSettings)).removeClass(oSettings.asStripeClasses.join(' '));
+
+ $('th, td', oSettings.nTHead).removeClass([
+ oSettings.oClasses.sSortable,
+ oSettings.oClasses.sSortableAsc,
+ oSettings.oClasses.sSortableDesc,
+ oSettings.oClasses.sSortableNone].join(' ')
+ );
+ if (oSettings.bJUI) {
+ $('th span.' + oSettings.oClasses.sSortIcon
+ + ', td span.' + oSettings.oClasses.sSortIcon, oSettings.nTHead).remove();
+
+ $('th, td', oSettings.nTHead).each(function () {
+ var jqWrapper = $('div.' + oSettings.oClasses.sSortJUIWrapper, this);
+ var kids = jqWrapper.contents();
+ $(this).append(kids);
+ jqWrapper.remove();
+ });
+ }
+
+ /* Add the TR elements back into the table in their original order */
+ if (!bRemove && oSettings.nTableReinsertBefore) {
+ nOrig.insertBefore(oSettings.nTable, oSettings.nTableReinsertBefore);
+ }
+ else if (!bRemove) {
+ nOrig.appendChild(oSettings.nTable);
+ }
+
+ for (i = 0, iLen = oSettings.aoData.length; i < iLen; i++) {
+ if (oSettings.aoData[i].nTr !== null) {
+ nBody.appendChild(oSettings.aoData[i].nTr);
+ }
+ }
+
+ /* Restore the width of the original table */
+ if (oSettings.oFeatures.bAutoWidth === true) {
+ oSettings.nTable.style.width = _fnStringToCss(oSettings.sDestroyWidth);
+ }
+
+ /* If the were originally odd/even type classes - then we add them back here. Note
+ * this is not fool proof (for example if not all rows as odd/even classes - but
+ * it's a good effort without getting carried away
+ */
+ $(nBody).children('tr:even').addClass(oSettings.asDestroyStripes[0]);
+ $(nBody).children('tr:odd').addClass(oSettings.asDestroyStripes[1]);
+
+ /* Remove the settings object from the settings array */
+ for (i = 0, iLen = DataTable.settings.length; i < iLen; i++) {
+ if (DataTable.settings[i] == oSettings) {
+ DataTable.settings.splice(i, 1);
+ }
+ }
+
+ /* End it all */
+ oSettings = null;
+ };
+
+
+ /**
+ * Redraw the table
+ * @param {bool} [bComplete=true] Re-filter and resort (if enabled) the table before the draw.
+ * @dtopt API
+ *
+ * @example
+ * $(document).ready(function() {
+ * var oTable = $('#example').dataTable();
+ *
+ * // Re-draw the table - you wouldn't want to do it here, but it's an example :-)
+ * oTable.fnDraw();
+ * } );
+ */
+ this.fnDraw = function (bComplete) {
+ var oSettings = _fnSettingsFromNode(this[DataTable.ext.iApiIndex]);
+ if (bComplete === false) {
+ _fnCalculateEnd(oSettings);
+ _fnDraw(oSettings);
+ }
+ else {
+ _fnReDraw(oSettings);
+ }
+ };
+
+
+ /**
+ * Filter the input based on data
+ * @param {string} sInput String to filter the table on
+ * @param {int|null} [iColumn] Column to limit filtering to
+ * @param {bool} [bRegex=false] Treat as regular expression or not
+ * @param {bool} [bSmart=true] Perform smart filtering or not
+ * @param {bool} [bShowGlobal=true] Show the input global filter in it's input box(es)
+ * @param {bool} [bCaseInsensitive=true] Do case-insensitive matching (true) or not (false)
+ * @dtopt API
+ *
+ * @example
+ * $(document).ready(function() {
+ * var oTable = $('#example').dataTable();
+ *
+ * // Sometime later - filter...
+ * oTable.fnFilter( 'test string' );
+ * } );
+ */
+ this.fnFilter = function (sInput, iColumn, bRegex, bSmart, bShowGlobal, bCaseInsensitive) {
+ var oSettings = _fnSettingsFromNode(this[DataTable.ext.iApiIndex]);
+
+ if (!oSettings.oFeatures.bFilter) {
+ return;
+ }
+
+ if (bRegex === undefined || bRegex === null) {
+ bRegex = false;
+ }
+
+ if (bSmart === undefined || bSmart === null) {
+ bSmart = true;
+ }
+
+ if (bShowGlobal === undefined || bShowGlobal === null) {
+ bShowGlobal = true;
+ }
+
+ if (bCaseInsensitive === undefined || bCaseInsensitive === null) {
+ bCaseInsensitive = true;
+ }
+
+ if (iColumn === undefined || iColumn === null) {
+ /* Global filter */
+ _fnFilterComplete(oSettings, {
+ "sSearch": sInput + "",
+ "bRegex": bRegex,
+ "bSmart": bSmart,
+ "bCaseInsensitive": bCaseInsensitive
+ }, 1);
+
+ if (bShowGlobal && oSettings.aanFeatures.f) {
+ var n = oSettings.aanFeatures.f;
+ for (var i = 0, iLen = n.length; i < iLen; i++) {
+ $(n[i]._DT_Input).val(sInput);
+ }
+ }
+ }
+ else {
+ /* Single column filter */
+ $.extend(oSettings.aoPreSearchCols[iColumn], {
+ "sSearch": sInput + "",
+ "bRegex": bRegex,
+ "bSmart": bSmart,
+ "bCaseInsensitive": bCaseInsensitive
+ });
+ _fnFilterComplete(oSettings, oSettings.oPreviousSearch, 1);
+ }
+ };
+
+
+ /**
+ * Get the data for the whole table, an individual row or an individual cell based on the
+ * provided parameters.
+ * @param {int|node} [mRow] A TR row node, TD/TH cell node or an integer. If given as
+ * a TR node then the data source for the whole row will be returned. If given as a
+ * TD/TH cell node then iCol will be automatically calculated and the data for the
+ * cell returned. If given as an integer, then this is treated as the aoData internal
+ * data index for the row (see fnGetPosition) and the data for that row used.
+ * @param {int} [iCol] Optional column index that you want the data of.
+ * @returns {array|object|string} If mRow is undefined, then the data for all rows is
+ * returned. If mRow is defined, just data for that row, and is iCol is
+ * defined, only data for the designated cell is returned.
+ * @dtopt API
+ *
+ * @example
+ * // Row data
+ * $(document).ready(function() {
+ * oTable = $('#example').dataTable();
+ *
+ * oTable.$('tr').click( function () {
+ * var data = oTable.fnGetData( this );
+ * // ... do something with the array / object of data for the row
+ * } );
+ * } );
+ *
+ * @example
+ * // Individual cell data
+ * $(document).ready(function() {
+ * oTable = $('#example').dataTable();
+ *
+ * oTable.$('td').click( function () {
+ * var sData = oTable.fnGetData( this );
+ * alert( 'The cell clicked on had the value of '+sData );
+ * } );
+ * } );
+ */
+ this.fnGetData = function (mRow, iCol) {
+ var oSettings = _fnSettingsFromNode(this[DataTable.ext.iApiIndex]);
+
+ if (mRow !== undefined) {
+ var iRow = mRow;
+ if (typeof mRow === 'object') {
+ var sNode = mRow.nodeName.toLowerCase();
+ if (sNode === "tr") {
+ iRow = _fnNodeToDataIndex(oSettings, mRow);
+ }
+ else if (sNode === "td") {
+ iRow = _fnNodeToDataIndex(oSettings, mRow.parentNode);
+ iCol = _fnNodeToColumnIndex(oSettings, iRow, mRow);
+ }
+ }
+
+ if (iCol !== undefined) {
+ return _fnGetCellData(oSettings, iRow, iCol, '');
+ }
+ return (oSettings.aoData[iRow] !== undefined) ?
+ oSettings.aoData[iRow]._aData : null;
+ }
+ return _fnGetDataMaster(oSettings);
+ };
+
+
+ /**
+ * Get an array of the TR nodes that are used in the table's body. Note that you will
+ * typically want to use the '$' API method in preference to this as it is more
+ * flexible.
+ * @param {int} [iRow] Optional row index for the TR element you want
+ * @returns {array|node} If iRow is undefined, returns an array of all TR elements
+ * in the table's body, or iRow is defined, just the TR element requested.
+ * @dtopt API
+ *
+ * @example
+ * $(document).ready(function() {
+ * var oTable = $('#example').dataTable();
+ *
+ * // Get the nodes from the table
+ * var nNodes = oTable.fnGetNodes( );
+ * } );
+ */
+ this.fnGetNodes = function (iRow) {
+ var oSettings = _fnSettingsFromNode(this[DataTable.ext.iApiIndex]);
+
+ if (iRow !== undefined) {
+ return (oSettings.aoData[iRow] !== undefined) ?
+ oSettings.aoData[iRow].nTr : null;
+ }
+ return _fnGetTrNodes(oSettings);
+ };
+
+
+ /**
+ * Get the array indexes of a particular cell from it's DOM element
+ * and column index including hidden columns
+ * @param {node} nNode this can either be a TR, TD or TH in the table's body
+ * @returns {int} If nNode is given as a TR, then a single index is returned, or
+ * if given as a cell, an array of [row index, column index (visible)] is given.
+ * @dtopt API
+ *
+ * @example
+ * $(document).ready(function() {
+ * $('#example tbody td').click( function () {
+ * // Get the position of the current data from the node
+ * var aPos = oTable.fnGetPosition( this );
+ *
+ * // Get the data array for this row
+ * var aData = oTable.fnGetData( aPos[0] );
+ *
+ * // Update the data array and return the value
+ * aData[ aPos[1] ] = 'clicked';
+ * this.innerHTML = 'clicked';
+ * } );
+ *
+ * // Init DataTables
+ * oTable = $('#example').dataTable();
+ * } );
+ */
+ this.fnGetPosition = function (nNode) {
+ var oSettings = _fnSettingsFromNode(this[DataTable.ext.iApiIndex]);
+ var sNodeName = nNode.nodeName.toUpperCase();
+
+ if (sNodeName == "TR") {
+ return _fnNodeToDataIndex(oSettings, nNode);
+ }
+ else if (sNodeName == "TD" || sNodeName == "TH") {
+ var iDataIndex = _fnNodeToDataIndex(oSettings, nNode.parentNode);
+ var iColumnIndex = _fnNodeToColumnIndex(oSettings, iDataIndex, nNode);
+ return [iDataIndex, _fnColumnIndexToVisible(oSettings, iColumnIndex), iColumnIndex];
+ }
+ return null;
+ };
+
+
+ /**
+ * Check to see if a row is 'open' or not.
+ * @param {node} nTr the table row to check
+ * @returns {boolean} true if the row is currently open, false otherwise
+ * @dtopt API
+ *
+ * @example
+ * $(document).ready(function() {
+ * var oTable;
+ *
+ * // 'open' an information row when a row is clicked on
+ * $('#example tbody tr').click( function () {
+ * if ( oTable.fnIsOpen(this) ) {
+ * oTable.fnClose( this );
+ * } else {
+ * oTable.fnOpen( this, "Temporary row opened", "info_row" );
+ * }
+ * } );
+ *
+ * oTable = $('#example').dataTable();
+ * } );
+ */
+ this.fnIsOpen = function (nTr) {
+ var oSettings = _fnSettingsFromNode(this[DataTable.ext.iApiIndex]);
+ var aoOpenRows = oSettings.aoOpenRows;
+
+ for (var i = 0; i < oSettings.aoOpenRows.length; i++) {
+ if (oSettings.aoOpenRows[i].nParent == nTr) {
+ return true;
+ }
+ }
+ return false;
+ };
+
+
+ /**
+ * This function will place a new row directly after a row which is currently
+ * on display on the page, with the HTML contents that is passed into the
+ * function. This can be used, for example, to ask for confirmation that a
+ * particular record should be deleted.
+ * @param {node} nTr The table row to 'open'
+ * @param {string|node|jQuery} mHtml The HTML to put into the row
+ * @param {string} sClass Class to give the new TD cell
+ * @returns {node} The row opened. Note that if the table row passed in as the
+ * first parameter, is not found in the table, this method will silently
+ * return.
+ * @dtopt API
+ *
+ * @example
+ * $(document).ready(function() {
+ * var oTable;
+ *
+ * // 'open' an information row when a row is clicked on
+ * $('#example tbody tr').click( function () {
+ * if ( oTable.fnIsOpen(this) ) {
+ * oTable.fnClose( this );
+ * } else {
+ * oTable.fnOpen( this, "Temporary row opened", "info_row" );
+ * }
+ * } );
+ *
+ * oTable = $('#example').dataTable();
+ * } );
+ */
+ this.fnOpen = function (nTr, mHtml, sClass) {
+ /* Find settings from table node */
+ var oSettings = _fnSettingsFromNode(this[DataTable.ext.iApiIndex]);
+
+ /* Check that the row given is in the table */
+ var nTableRows = _fnGetTrNodes(oSettings);
+ if ($.inArray(nTr, nTableRows) === -1) {
+ return;
+ }
+
+ /* the old open one if there is one */
+ this.fnClose(nTr);
+
+ var nNewRow = document.createElement("tr");
+ var nNewCell = document.createElement("td");
+ nNewRow.appendChild(nNewCell);
+ nNewCell.className = sClass;
+ nNewCell.colSpan = _fnVisbleColumns(oSettings);
+
+ if (typeof mHtml === "string") {
+ nNewCell.innerHTML = mHtml;
+ }
+ else {
+ $(nNewCell).html(mHtml);
+ }
+
+ /* If the nTr isn't on the page at the moment - then we don't insert at the moment */
+ var nTrs = $('tr', oSettings.nTBody);
+ if ($.inArray(nTr, nTrs) != -1) {
+ $(nNewRow).insertAfter(nTr);
+ }
+
+ oSettings.aoOpenRows.push({
+ "nTr": nNewRow,
+ "nParent": nTr
+ });
+
+ return nNewRow;
+ };
+
+
+ /**
+ * Change the pagination - provides the internal logic for pagination in a simple API
+ * function. With this function you can have a DataTables table go to the next,
+ * previous, first or last pages.
+ * @param {string|int} mAction Paging action to take: "first", "previous", "next" or "last"
+ * or page number to jump to (integer), note that page 0 is the first page.
+ * @param {bool} [bRedraw=true] Redraw the table or not
+ * @dtopt API
+ *
+ * @example
+ * $(document).ready(function() {
+ * var oTable = $('#example').dataTable();
+ * oTable.fnPageChange( 'next' );
+ * } );
+ */
+ this.fnPageChange = function (mAction, bRedraw) {
+ var oSettings = _fnSettingsFromNode(this[DataTable.ext.iApiIndex]);
+ _fnPageChange(oSettings, mAction);
+ _fnCalculateEnd(oSettings);
+
+ if (bRedraw === undefined || bRedraw) {
+ _fnDraw(oSettings);
+ }
+ };
+
+
+ /**
+ * Show a particular column
+ * @param {int} iCol The column whose display should be changed
+ * @param {bool} bShow Show (true) or hide (false) the column
+ * @param {bool} [bRedraw=true] Redraw the table or not
+ * @dtopt API
+ *
+ * @example
+ * $(document).ready(function() {
+ * var oTable = $('#example').dataTable();
+ *
+ * // Hide the second column after initialisation
+ * oTable.fnSetColumnVis( 1, false );
+ * } );
+ */
+ this.fnSetColumnVis = function (iCol, bShow, bRedraw) {
+ var oSettings = _fnSettingsFromNode(this[DataTable.ext.iApiIndex]);
+ var i, iLen;
+ var aoColumns = oSettings.aoColumns;
+ var aoData = oSettings.aoData;
+ var nTd, bAppend, iBefore;
+
+ /* No point in doing anything if we are requesting what is already true */
+ if (aoColumns[iCol].bVisible == bShow) {
+ return;
+ }
+
+ /* Show the column */
+ if (bShow) {
+ var iInsert = 0;
+ for (i = 0; i < iCol; i++) {
+ if (aoColumns[i].bVisible) {
+ iInsert++;
+ }
+ }
+
+ /* Need to decide if we should use appendChild or insertBefore */
+ bAppend = (iInsert >= _fnVisbleColumns(oSettings));
+
+ /* Which coloumn should we be inserting before? */
+ if (!bAppend) {
+ for (i = iCol; i < aoColumns.length; i++) {
+ if (aoColumns[i].bVisible) {
+ iBefore = i;
+ break;
+ }
+ }
+ }
+
+ for (i = 0, iLen = aoData.length; i < iLen; i++) {
+ if (aoData[i].nTr !== null) {
+ if (bAppend) {
+ aoData[i].nTr.appendChild(
+ aoData[i]._anHidden[iCol]
+ );
+ }
+ else {
+ aoData[i].nTr.insertBefore(
+ aoData[i]._anHidden[iCol],
+ _fnGetTdNodes(oSettings, i)[iBefore]);
+ }
+ }
+ }
+ }
+ else {
+ /* Remove a column from display */
+ for (i = 0, iLen = aoData.length; i < iLen; i++) {
+ if (aoData[i].nTr !== null) {
+ nTd = _fnGetTdNodes(oSettings, i)[iCol];
+ aoData[i]._anHidden[iCol] = nTd;
+ nTd.parentNode.removeChild(nTd);
+ }
+ }
+ }
+
+ /* Clear to set the visible flag */
+ aoColumns[iCol].bVisible = bShow;
+
+ /* Redraw the header and footer based on the new column visibility */
+ _fnDrawHead(oSettings, oSettings.aoHeader);
+ if (oSettings.nTFoot) {
+ _fnDrawHead(oSettings, oSettings.aoFooter);
+ }
+
+ /* If there are any 'open' rows, then we need to alter the colspan for this col change */
+ for (i = 0, iLen = oSettings.aoOpenRows.length; i < iLen; i++) {
+ oSettings.aoOpenRows[i].nTr.colSpan = _fnVisbleColumns(oSettings);
+ }
+
+ /* Do a redraw incase anything depending on the table columns needs it
+ * (built-in: scrolling)
+ */
+ if (bRedraw === undefined || bRedraw) {
+ _fnAdjustColumnSizing(oSettings);
+ _fnDraw(oSettings);
+ }
+
+ _fnSaveState(oSettings);
+ };
+
+
+ /**
+ * Get the settings for a particular table for external manipulation
+ * @returns {object} DataTables settings object. See
+ * {@link DataTable.models.oSettings}
+ * @dtopt API
+ *
+ * @example
+ * $(document).ready(function() {
+ * var oTable = $('#example').dataTable();
+ * var oSettings = oTable.fnSettings();
+ *
+ * // Show an example parameter from the settings
+ * alert( oSettings._iDisplayStart );
+ * } );
+ */
+ this.fnSettings = function () {
+ return _fnSettingsFromNode(this[DataTable.ext.iApiIndex]);
+ };
+
+
+ /**
+ * Sort the table by a particular column
+ * @param {int} iCol the data index to sort on. Note that this will not match the
+ * 'display index' if you have hidden data entries
+ * @dtopt API
+ *
+ * @example
+ * $(document).ready(function() {
+ * var oTable = $('#example').dataTable();
+ *
+ * // Sort immediately with columns 0 and 1
+ * oTable.fnSort( [ [0,'asc'], [1,'asc'] ] );
+ * } );
+ */
+ this.fnSort = function (aaSort) {
+ var oSettings = _fnSettingsFromNode(this[DataTable.ext.iApiIndex]);
+ oSettings.aaSorting = aaSort;
+ _fnSort(oSettings);
+ };
+
+
+ /**
+ * Attach a sort listener to an element for a given column
+ * @param {node} nNode the element to attach the sort listener to
+ * @param {int} iColumn the column that a click on this node will sort on
+ * @param {function} [fnCallback] callback function when sort is run
+ * @dtopt API
+ *
+ * @example
+ * $(document).ready(function() {
+ * var oTable = $('#example').dataTable();
+ *
+ * // Sort on column 1, when 'sorter' is clicked on
+ * oTable.fnSortListener( document.getElementById('sorter'), 1 );
+ * } );
+ */
+ this.fnSortListener = function (nNode, iColumn, fnCallback) {
+ _fnSortAttachListener(_fnSettingsFromNode(this[DataTable.ext.iApiIndex]), nNode, iColumn,
+ fnCallback);
+ };
+
+
+ /**
+ * Update a table cell or row - this method will accept either a single value to
+ * update the cell with, an array of values with one element for each column or
+ * an object in the same format as the original data source. The function is
+ * self-referencing in order to make the multi column updates easier.
+ * @param {object|array|string} mData Data to update the cell/row with
+ * @param {node|int} mRow TR element you want to update or the aoData index
+ * @param {int} [iColumn] The column to update (not used of mData is an array or object)
+ * @param {bool} [bRedraw=true] Redraw the table or not
+ * @param {bool} [bAction=true] Perform pre-draw actions or not
+ * @returns {int} 0 on success, 1 on error
+ * @dtopt API
+ *
+ * @example
+ * $(document).ready(function() {
+ * var oTable = $('#example').dataTable();
+ * oTable.fnUpdate( 'Example update', 0, 0 ); // Single cell
+ * oTable.fnUpdate( ['a', 'b', 'c', 'd', 'e'], 1, 0 ); // Row
+ * } );
+ */
+ this.fnUpdate = function (mData, mRow, iColumn, bRedraw, bAction) {
+ var oSettings = _fnSettingsFromNode(this[DataTable.ext.iApiIndex]);
+ var i, iLen, sDisplay;
+ var iRow = (typeof mRow === 'object') ?
+ _fnNodeToDataIndex(oSettings, mRow) : mRow;
+
+ if ($.isArray(mData) && iColumn === undefined) {
+ /* Array update - update the whole row */
+ oSettings.aoData[iRow]._aData = mData.slice();
+
+ /* Flag to the function that we are recursing */
+ for (i = 0; i < oSettings.aoColumns.length; i++) {
+ this.fnUpdate(_fnGetCellData(oSettings, iRow, i), iRow, i, false, false);
+ }
+ }
+ else if ($.isPlainObject(mData) && iColumn === undefined) {
+ /* Object update - update the whole row - assume the developer gets the object right */
+ oSettings.aoData[iRow]._aData = $.extend(true, {}, mData);
+
+ for (i = 0; i < oSettings.aoColumns.length; i++) {
+ this.fnUpdate(_fnGetCellData(oSettings, iRow, i), iRow, i, false, false);
+ }
+ }
+ else {
+ /* Individual cell update */
+ _fnSetCellData(oSettings, iRow, iColumn, mData);
+ sDisplay = _fnGetCellData(oSettings, iRow, iColumn, 'display');
+
+ var oCol = oSettings.aoColumns[iColumn];
+ if (oCol.fnRender !== null) {
+ sDisplay = _fnRender(oSettings, iRow, iColumn);
+ if (oCol.bUseRendered) {
+ _fnSetCellData(oSettings, iRow, iColumn, sDisplay);
+ }
+ }
+
+ if (oSettings.aoData[iRow].nTr !== null) {
+ /* Do the actual HTML update */
+ _fnGetTdNodes(oSettings, iRow)[iColumn].innerHTML = sDisplay;
+ }
+ }
+
+ /* Modify the search index for this row (strictly this is likely not needed, since fnReDraw
+ * will rebuild the search array - however, the redraw might be disabled by the user)
+ */
+ var iDisplayIndex = $.inArray(iRow, oSettings.aiDisplay);
+ oSettings.asDataSearch[iDisplayIndex] = _fnBuildSearchRow(
+ oSettings,
+ _fnGetRowData(oSettings, iRow, 'filter', _fnGetColumns(oSettings, 'bSearchable'))
+ );
+
+ /* Perform pre-draw actions */
+ if (bAction === undefined || bAction) {
+ _fnAdjustColumnSizing(oSettings);
+ }
+
+ /* Redraw the table */
+ if (bRedraw === undefined || bRedraw) {
+ _fnReDraw(oSettings);
+ }
+ return 0;
+ };
+
+
+ /**
+ * Provide a common method for plug-ins to check the version of DataTables being used, in order
+ * to ensure compatibility.
+ * @param {string} sVersion Version string to check for, in the format "X.Y.Z". Note that the
+ * formats "X" and "X.Y" are also acceptable.
+ * @returns {boolean} true if this version of DataTables is greater or equal to the required
+ * version, or false if this version of DataTales is not suitable
+ * @method
+ * @dtopt API
+ *
+ * @example
+ * $(document).ready(function() {
+ * var oTable = $('#example').dataTable();
+ * alert( oTable.fnVersionCheck( '1.9.0' ) );
+ * } );
+ */
+ this.fnVersionCheck = DataTable.ext.fnVersionCheck;
+
+
+ /*
+ * This is really a good bit rubbish this method of exposing the internal methods
+ * publicly... - To be fixed in 2.0 using methods on the prototype
+ */
+
+
+ /**
+ * Create a wrapper function for exporting an internal functions to an external API.
+ * @param {string} sFunc API function name
+ * @returns {function} wrapped function
+ * @memberof DataTable#oApi
+ */
+ function _fnExternApiFunc(sFunc) {
+ return function () {
+ var aArgs = [_fnSettingsFromNode(this[DataTable.ext.iApiIndex])].concat(
+ Array.prototype.slice.call(arguments));
+ return DataTable.ext.oApi[sFunc].apply(this, aArgs);
+ };
+ }
+
+
+ /**
+ * Reference to internal functions for use by plug-in developers. Note that these
+ * methods are references to internal functions and are considered to be private.
+ * If you use these methods, be aware that they are liable to change between versions
+ * (check the upgrade notes).
+ * @namespace
+ */
+ this.oApi = {
+ "_fnExternApiFunc": _fnExternApiFunc,
+ "_fnInitialise": _fnInitialise,
+ "_fnInitComplete": _fnInitComplete,
+ "_fnLanguageCompat": _fnLanguageCompat,
+ "_fnAddColumn": _fnAddColumn,
+ "_fnColumnOptions": _fnColumnOptions,
+ "_fnAddData": _fnAddData,
+ "_fnCreateTr": _fnCreateTr,
+ "_fnGatherData": _fnGatherData,
+ "_fnBuildHead": _fnBuildHead,
+ "_fnDrawHead": _fnDrawHead,
+ "_fnDraw": _fnDraw,
+ "_fnReDraw": _fnReDraw,
+ "_fnAjaxUpdate": _fnAjaxUpdate,
+ "_fnAjaxParameters": _fnAjaxParameters,
+ "_fnAjaxUpdateDraw": _fnAjaxUpdateDraw,
+ "_fnServerParams": _fnServerParams,
+ "_fnAddOptionsHtml": _fnAddOptionsHtml,
+ "_fnFeatureHtmlTable": _fnFeatureHtmlTable,
+ "_fnScrollDraw": _fnScrollDraw,
+ "_fnAdjustColumnSizing": _fnAdjustColumnSizing,
+ "_fnFeatureHtmlFilter": _fnFeatureHtmlFilter,
+ "_fnFilterComplete": _fnFilterComplete,
+ "_fnFilterCustom": _fnFilterCustom,
+ "_fnFilterColumn": _fnFilterColumn,
+ "_fnFilter": _fnFilter,
+ "_fnBuildSearchArray": _fnBuildSearchArray,
+ "_fnBuildSearchRow": _fnBuildSearchRow,
+ "_fnFilterCreateSearch": _fnFilterCreateSearch,
+ "_fnDataToSearch": _fnDataToSearch,
+ "_fnSort": _fnSort,
+ "_fnSortAttachListener": _fnSortAttachListener,
+ "_fnSortingClasses": _fnSortingClasses,
+ "_fnFeatureHtmlPaginate": _fnFeatureHtmlPaginate,
+ "_fnPageChange": _fnPageChange,
+ "_fnFeatureHtmlInfo": _fnFeatureHtmlInfo,
+ "_fnUpdateInfo": _fnUpdateInfo,
+ "_fnFeatureHtmlLength": _fnFeatureHtmlLength,
+ "_fnFeatureHtmlProcessing": _fnFeatureHtmlProcessing,
+ "_fnProcessingDisplay": _fnProcessingDisplay,
+ "_fnVisibleToColumnIndex": _fnVisibleToColumnIndex,
+ "_fnColumnIndexToVisible": _fnColumnIndexToVisible,
+ "_fnNodeToDataIndex": _fnNodeToDataIndex,
+ "_fnVisbleColumns": _fnVisbleColumns,
+ "_fnCalculateEnd": _fnCalculateEnd,
+ "_fnConvertToWidth": _fnConvertToWidth,
+ "_fnCalculateColumnWidths": _fnCalculateColumnWidths,
+ "_fnScrollingWidthAdjust": _fnScrollingWidthAdjust,
+ "_fnGetWidestNode": _fnGetWidestNode,
+ "_fnGetMaxLenString": _fnGetMaxLenString,
+ "_fnStringToCss": _fnStringToCss,
+ "_fnDetectType": _fnDetectType,
+ "_fnSettingsFromNode": _fnSettingsFromNode,
+ "_fnGetDataMaster": _fnGetDataMaster,
+ "_fnGetTrNodes": _fnGetTrNodes,
+ "_fnGetTdNodes": _fnGetTdNodes,
+ "_fnEscapeRegex": _fnEscapeRegex,
+ "_fnDeleteIndex": _fnDeleteIndex,
+ "_fnReOrderIndex": _fnReOrderIndex,
+ "_fnColumnOrdering": _fnColumnOrdering,
+ "_fnLog": _fnLog,
+ "_fnClearTable": _fnClearTable,
+ "_fnSaveState": _fnSaveState,
+ "_fnLoadState": _fnLoadState,
+ "_fnCreateCookie": _fnCreateCookie,
+ "_fnReadCookie": _fnReadCookie,
+ "_fnDetectHeader": _fnDetectHeader,
+ "_fnGetUniqueThs": _fnGetUniqueThs,
+ "_fnScrollBarWidth": _fnScrollBarWidth,
+ "_fnApplyToChildren": _fnApplyToChildren,
+ "_fnMap": _fnMap,
+ "_fnGetRowData": _fnGetRowData,
+ "_fnGetCellData": _fnGetCellData,
+ "_fnSetCellData": _fnSetCellData,
+ "_fnGetObjectDataFn": _fnGetObjectDataFn,
+ "_fnSetObjectDataFn": _fnSetObjectDataFn,
+ "_fnApplyColumnDefs": _fnApplyColumnDefs,
+ "_fnBindAction": _fnBindAction,
+ "_fnExtend": _fnExtend,
+ "_fnCallbackReg": _fnCallbackReg,
+ "_fnCallbackFire": _fnCallbackFire,
+ "_fnJsonString": _fnJsonString,
+ "_fnRender": _fnRender,
+ "_fnNodeToColumnIndex": _fnNodeToColumnIndex,
+ "_fnInfoMacros": _fnInfoMacros,
+ "_fnBrowserDetect": _fnBrowserDetect,
+ "_fnGetColumns": _fnGetColumns
+ };
+
+ $.extend(DataTable.ext.oApi, this.oApi);
+
+ for (var sFunc in DataTable.ext.oApi) {
+ if (sFunc) {
+ this[sFunc] = _fnExternApiFunc(sFunc);
+ }
+ }
+
+
+ var _that = this;
+ return this.each(function () {
+
+ var i = 0, iLen, j, jLen, k, kLen;
+ var sId = this.getAttribute('id');
+ var bInitHandedOff = false;
+ var bUsePassedData = false;
+
+
+ /* Sanity check */
+ if (this.nodeName.toLowerCase() != 'table') {
+ _fnLog(null, 0, "Attempted to initialise DataTables on a node which is not a " +
+ "table: " + this.nodeName);
+ return;
+ }
+
+ /* Check to see if we are re-initialising a table */
+ for (i = 0, iLen = DataTable.settings.length; i < iLen; i++) {
+ /* Base check on table node */
+ if (DataTable.settings[i].nTable == this) {
+ if (oInit === undefined || oInit.bRetrieve) {
+ return DataTable.settings[i].oInstance;
+ }
+ else if (oInit.bDestroy) {
+ DataTable.settings[i].oInstance.fnDestroy();
+ break;
+ }
+ else {
+ _fnLog(DataTable.settings[i], 0, "Cannot reinitialise DataTable.\n\n" +
+ "To retrieve the DataTables object for this table, pass no arguments or see " +
+ "the docs for bRetrieve and bDestroy");
+ return;
+ }
+ }
+
+ /* If the element we are initialising has the same ID as a table which was previously
+ * initialised, but the table nodes don't match (from before) then we destroy the old
+ * instance by simply deleting it. This is under the assumption that the table has been
+ * destroyed by other methods. Anyone using non-id selectors will need to do this manually
+ */
+ if (DataTable.settings[i].sTableId == this.id) {
+ DataTable.settings.splice(i, 1);
+ break;
+ }
+ }
+
+ /* Ensure the table has an ID - required for accessibility */
+ if (sId === null || sId === "") {
+ sId = "DataTables_Table_" + (DataTable.ext._oExternConfig.iNextUnique++);
+ this.id = sId;
+ }
+
+ /* Create the settings object for this table and set some of the default parameters */
+ var oSettings = $.extend(true, {}, DataTable.models.oSettings, {
+ "nTable": this,
+ "oApi": _that.oApi,
+ "oInit": oInit,
+ "sDestroyWidth": $(this).width(),
+ "sInstance": sId,
+ "sTableId": sId
+ });
+ DataTable.settings.push(oSettings);
+
+ // Need to add the instance after the instance after the settings object has been added
+ // to the settings array, so we can self reference the table instance if more than one
+ oSettings.oInstance = (_that.length === 1) ? _that : $(this).dataTable();
+
+ /* Setting up the initialisation object */
+ if (!oInit) {
+ oInit = {};
+ }
+
+ // Backwards compatibility, before we apply all the defaults
+ if (oInit.oLanguage) {
+ _fnLanguageCompat(oInit.oLanguage);
+ }
+
+ oInit = _fnExtend($.extend(true, {}, DataTable.defaults), oInit);
+
+ // Map the initialisation options onto the settings object
+ _fnMap(oSettings.oFeatures, oInit, "bPaginate");
+ _fnMap(oSettings.oFeatures, oInit, "bLengthChange");
+ _fnMap(oSettings.oFeatures, oInit, "bFilter");
+ _fnMap(oSettings.oFeatures, oInit, "bSort");
+ _fnMap(oSettings.oFeatures, oInit, "bInfo");
+ _fnMap(oSettings.oFeatures, oInit, "bProcessing");
+ _fnMap(oSettings.oFeatures, oInit, "bAutoWidth");
+ _fnMap(oSettings.oFeatures, oInit, "bSortClasses");
+ _fnMap(oSettings.oFeatures, oInit, "bServerSide");
+ _fnMap(oSettings.oFeatures, oInit, "bDeferRender");
+ _fnMap(oSettings.oScroll, oInit, "sScrollX", "sX");
+ _fnMap(oSettings.oScroll, oInit, "sScrollXInner", "sXInner");
+ _fnMap(oSettings.oScroll, oInit, "sScrollY", "sY");
+ _fnMap(oSettings.oScroll, oInit, "bScrollCollapse", "bCollapse");
+ _fnMap(oSettings.oScroll, oInit, "bScrollInfinite", "bInfinite");
+ _fnMap(oSettings.oScroll, oInit, "iScrollLoadGap", "iLoadGap");
+ _fnMap(oSettings.oScroll, oInit, "bScrollAutoCss", "bAutoCss");
+ _fnMap(oSettings, oInit, "asStripeClasses");
+ _fnMap(oSettings, oInit, "asStripClasses", "asStripeClasses"); // legacy
+ _fnMap(oSettings, oInit, "fnServerData");
+ _fnMap(oSettings, oInit, "fnFormatNumber");
+ _fnMap(oSettings, oInit, "sServerMethod");
+ _fnMap(oSettings, oInit, "aaSorting");
+ _fnMap(oSettings, oInit, "aaSortingFixed");
+ _fnMap(oSettings, oInit, "aLengthMenu");
+ _fnMap(oSettings, oInit, "sPaginationType");
+ _fnMap(oSettings, oInit, "sAjaxSource");
+ _fnMap(oSettings, oInit, "sAjaxDataProp");
+ _fnMap(oSettings, oInit, "iCookieDuration");
+ _fnMap(oSettings, oInit, "sCookiePrefix");
+ _fnMap(oSettings, oInit, "sDom");
+ _fnMap(oSettings, oInit, "bSortCellsTop");
+ _fnMap(oSettings, oInit, "iTabIndex");
+ _fnMap(oSettings, oInit, "oSearch", "oPreviousSearch");
+ _fnMap(oSettings, oInit, "aoSearchCols", "aoPreSearchCols");
+ _fnMap(oSettings, oInit, "iDisplayLength", "_iDisplayLength");
+ _fnMap(oSettings, oInit, "bJQueryUI", "bJUI");
+ _fnMap(oSettings, oInit, "fnCookieCallback");
+ _fnMap(oSettings, oInit, "fnStateLoad");
+ _fnMap(oSettings, oInit, "fnStateSave");
+ _fnMap(oSettings.oLanguage, oInit, "fnInfoCallback");
+
+ /* Callback functions which are array driven */
+ _fnCallbackReg(oSettings, 'aoDrawCallback', oInit.fnDrawCallback, 'user');
+ _fnCallbackReg(oSettings, 'aoServerParams', oInit.fnServerParams, 'user');
+ _fnCallbackReg(oSettings, 'aoStateSaveParams', oInit.fnStateSaveParams, 'user');
+ _fnCallbackReg(oSettings, 'aoStateLoadParams', oInit.fnStateLoadParams, 'user');
+ _fnCallbackReg(oSettings, 'aoStateLoaded', oInit.fnStateLoaded, 'user');
+ _fnCallbackReg(oSettings, 'aoRowCallback', oInit.fnRowCallback, 'user');
+ _fnCallbackReg(oSettings, 'aoRowCreatedCallback', oInit.fnCreatedRow, 'user');
+ _fnCallbackReg(oSettings, 'aoHeaderCallback', oInit.fnHeaderCallback, 'user');
+ _fnCallbackReg(oSettings, 'aoFooterCallback', oInit.fnFooterCallback, 'user');
+ _fnCallbackReg(oSettings, 'aoInitComplete', oInit.fnInitComplete, 'user');
+ _fnCallbackReg(oSettings, 'aoPreDrawCallback', oInit.fnPreDrawCallback, 'user');
+
+ if (oSettings.oFeatures.bServerSide && oSettings.oFeatures.bSort &&
+ oSettings.oFeatures.bSortClasses) {
+ /* Enable sort classes for server-side processing. Safe to do it here, since server-side
+ * processing must be enabled by the developer
+ */
+ _fnCallbackReg(oSettings, 'aoDrawCallback', _fnSortingClasses, 'server_side_sort_classes');
+ }
+ else if (oSettings.oFeatures.bDeferRender) {
+ _fnCallbackReg(oSettings, 'aoDrawCallback', _fnSortingClasses, 'defer_sort_classes');
+ }
+
+ if (oInit.bJQueryUI) {
+ /* Use the JUI classes object for display. You could clone the oStdClasses object if
+ * you want to have multiple tables with multiple independent classes
+ */
+ $.extend(oSettings.oClasses, DataTable.ext.oJUIClasses);
+
+ if (oInit.sDom === DataTable.defaults.sDom && DataTable.defaults.sDom === "lfrtip") {
+ /* Set the DOM to use a layout suitable for jQuery UI's theming */
+ oSettings.sDom = '<"H"lfr>t<"F"ip>';
+ }
+ }
+ else {
+ $.extend(oSettings.oClasses, DataTable.ext.oStdClasses);
+ }
+ $(this).addClass(oSettings.oClasses.sTable);
+
+ /* Calculate the scroll bar width and cache it for use later on */
+ if (oSettings.oScroll.sX !== "" || oSettings.oScroll.sY !== "") {
+ oSettings.oScroll.iBarWidth = _fnScrollBarWidth();
+ }
+
+ if (oSettings.iInitDisplayStart === undefined) {
+ /* Display start point, taking into account the save saving */
+ oSettings.iInitDisplayStart = oInit.iDisplayStart;
+ oSettings._iDisplayStart = oInit.iDisplayStart;
+ }
+
+ /* Must be done after everything which can be overridden by a cookie! */
+ if (oInit.bStateSave) {
+ oSettings.oFeatures.bStateSave = true;
+ _fnLoadState(oSettings, oInit);
+ _fnCallbackReg(oSettings, 'aoDrawCallback', _fnSaveState, 'state_save');
+ }
+
+ if (oInit.iDeferLoading !== null) {
+ oSettings.bDeferLoading = true;
+ var tmp = $.isArray(oInit.iDeferLoading);
+ oSettings._iRecordsDisplay = tmp ? oInit.iDeferLoading[0] : oInit.iDeferLoading;
+ oSettings._iRecordsTotal = tmp ? oInit.iDeferLoading[1] : oInit.iDeferLoading;
+ }
+
+ if (oInit.aaData !== null) {
+ bUsePassedData = true;
+ }
+
+ /* Language definitions */
+ if (oInit.oLanguage.sUrl !== "") {
+ /* Get the language definitions from a file - because this Ajax call makes the language
+ * get async to the remainder of this function we use bInitHandedOff to indicate that
+ * _fnInitialise will be fired by the returned Ajax handler, rather than the constructor
+ */
+ oSettings.oLanguage.sUrl = oInit.oLanguage.sUrl;
+ $.getJSON(oSettings.oLanguage.sUrl, null, function (json) {
+ _fnLanguageCompat(json);
+ $.extend(true, oSettings.oLanguage, oInit.oLanguage, json);
+ _fnInitialise(oSettings);
+ });
+ bInitHandedOff = true;
+ }
+ else {
+ $.extend(true, oSettings.oLanguage, oInit.oLanguage);
+ }
+
+
+ /*
+ * Stripes
+ */
+ if (oInit.asStripeClasses === null) {
+ oSettings.asStripeClasses = [
+ oSettings.oClasses.sStripeOdd,
+ oSettings.oClasses.sStripeEven
+ ];
+ }
+
+ /* Remove row stripe classes if they are already on the table row */
+ var bStripeRemove = false;
+ var anRows = $(this).children('tbody').children('tr');
+ for (i = 0, iLen = oSettings.asStripeClasses.length; i < iLen; i++) {
+ if (anRows.filter(":lt(2)").hasClass(oSettings.asStripeClasses[i])) {
+ bStripeRemove = true;
+ break;
+ }
+ }
+
+ if (bStripeRemove) {
+ /* Store the classes which we are about to remove so they can be re-added on destroy */
+ oSettings.asDestroyStripes = ['', ''];
+ if ($(anRows[0]).hasClass(oSettings.oClasses.sStripeOdd)) {
+ oSettings.asDestroyStripes[0] += oSettings.oClasses.sStripeOdd + " ";
+ }
+ if ($(anRows[0]).hasClass(oSettings.oClasses.sStripeEven)) {
+ oSettings.asDestroyStripes[0] += oSettings.oClasses.sStripeEven;
+ }
+ if ($(anRows[1]).hasClass(oSettings.oClasses.sStripeOdd)) {
+ oSettings.asDestroyStripes[1] += oSettings.oClasses.sStripeOdd + " ";
+ }
+ if ($(anRows[1]).hasClass(oSettings.oClasses.sStripeEven)) {
+ oSettings.asDestroyStripes[1] += oSettings.oClasses.sStripeEven;
+ }
+
+ anRows.removeClass(oSettings.asStripeClasses.join(' '));
+ }
+
+
+ /*
+ * Columns
+ * See if we should load columns automatically or use defined ones
+ */
+ var anThs = [];
+ var aoColumnsInit;
+ var nThead = this.getElementsByTagName('thead');
+ if (nThead.length !== 0) {
+ _fnDetectHeader(oSettings.aoHeader, nThead[0]);
+ anThs = _fnGetUniqueThs(oSettings);
+ }
+
+ /* If not given a column array, generate one with nulls */
+ if (oInit.aoColumns === null) {
+ aoColumnsInit = [];
+ for (i = 0, iLen = anThs.length; i < iLen; i++) {
+ aoColumnsInit.push(null);
+ }
+ }
+ else {
+ aoColumnsInit = oInit.aoColumns;
+ }
+
+ /* Add the columns */
+ for (i = 0, iLen = aoColumnsInit.length; i < iLen; i++) {
+ /* Short cut - use the loop to check if we have column visibility state to restore */
+ if (oInit.saved_aoColumns !== undefined && oInit.saved_aoColumns.length == iLen) {
+ if (aoColumnsInit[i] === null) {
+ aoColumnsInit[i] = {};
+ }
+ aoColumnsInit[i].bVisible = oInit.saved_aoColumns[i].bVisible;
+ }
+
+ _fnAddColumn(oSettings, anThs ? anThs[i] : null);
+ }
+
+ /* Apply the column definitions */
+ _fnApplyColumnDefs(oSettings, oInit.aoColumnDefs, aoColumnsInit, function (iCol, oDef) {
+ _fnColumnOptions(oSettings, iCol, oDef);
+ });
+
+
+ /*
+ * Sorting
+ * Check the aaSorting array
+ */
+ for (i = 0, iLen = oSettings.aaSorting.length; i < iLen; i++) {
+ if (oSettings.aaSorting[i][0] >= oSettings.aoColumns.length) {
+ oSettings.aaSorting[i][0] = 0;
+ }
+ var oColumn = oSettings.aoColumns[oSettings.aaSorting[i][0]];
+
+ /* Add a default sorting index */
+ if (oSettings.aaSorting[i][2] === undefined) {
+ oSettings.aaSorting[i][2] = 0;
+ }
+
+ /* If aaSorting is not defined, then we use the first indicator in asSorting */
+ if (oInit.aaSorting === undefined && oSettings.saved_aaSorting === undefined) {
+ oSettings.aaSorting[i][1] = oColumn.asSorting[0];
+ }
+
+ /* Set the current sorting index based on aoColumns.asSorting */
+ for (j = 0, jLen = oColumn.asSorting.length; j < jLen; j++) {
+ if (oSettings.aaSorting[i][1] == oColumn.asSorting[j]) {
+ oSettings.aaSorting[i][2] = j;
+ break;
+ }
+ }
+ }
+
+ /* Do a first pass on the sorting classes (allows any size changes to be taken into
+ * account, and also will apply sorting disabled classes if disabled
+ */
+ _fnSortingClasses(oSettings);
+
+
+ /*
+ * Final init
+ * Cache the header, body and footer as required, creating them if needed
+ */
+
+ /* Browser support detection */
+ _fnBrowserDetect(oSettings);
+
+ // Work around for Webkit bug 83867 - store the caption-side before removing from doc
+ var captions = $(this).children('caption').each(function () {
+ this._captionSide = $(this).css('caption-side');
+ });
+
+ var thead = $(this).children('thead');
+ if (thead.length === 0) {
+ thead = [document.createElement('thead')];
+ this.appendChild(thead[0]);
+ }
+ oSettings.nTHead = thead[0];
+
+ var tbody = $(this).children('tbody');
+ if (tbody.length === 0) {
+ tbody = [document.createElement('tbody')];
+ this.appendChild(tbody[0]);
+ }
+ oSettings.nTBody = tbody[0];
+ oSettings.nTBody.setAttribute("role", "alert");
+ oSettings.nTBody.setAttribute("aria-live", "polite");
+ oSettings.nTBody.setAttribute("aria-relevant", "all");
+
+ var tfoot = $(this).children('tfoot');
+ if (tfoot.length === 0 && captions.length > 0 && (oSettings.oScroll.sX !== "" || oSettings.oScroll.sY !== "")) {
+ // If we are a scrolling table, and no footer has been given, then we need to create
+ // a tfoot element for the caption element to be appended to
+ tfoot = [document.createElement('tfoot')];
+ this.appendChild(tfoot[0]);
+ }
+
+ if (tfoot.length > 0) {
+ oSettings.nTFoot = tfoot[0];
+ _fnDetectHeader(oSettings.aoFooter, oSettings.nTFoot);
+ }
+
+ /* Check if there is data passing into the constructor */
+ if (bUsePassedData) {
+ for (i = 0; i < oInit.aaData.length; i++) {
+ _fnAddData(oSettings, oInit.aaData[i]);
+ }
+ }
+ else {
+ /* Grab the data from the page */
+ _fnGatherData(oSettings);
+ }
+
+ /* Copy the data index array */
+ oSettings.aiDisplay = oSettings.aiDisplayMaster.slice();
+
+ /* Initialisation complete - table can be drawn */
+ oSettings.bInitialised = true;
+
+ /* Check if we need to initialise the table (it might not have been handed off to the
+ * language processor)
+ */
+ if (bInitHandedOff === false) {
+ _fnInitialise(oSettings);
+ }
+ });
+ };
+
+
+
+ /**
+ * Provide a common method for plug-ins to check the version of DataTables being used, in order
+ * to ensure compatibility.
+ * @param {string} sVersion Version string to check for, in the format "X.Y.Z". Note that the
+ * formats "X" and "X.Y" are also acceptable.
+ * @returns {boolean} true if this version of DataTables is greater or equal to the required
+ * version, or false if this version of DataTales is not suitable
+ * @static
+ * @dtopt API-Static
+ *
+ * @example
+ * alert( $.fn.dataTable.fnVersionCheck( '1.9.0' ) );
+ */
+ DataTable.fnVersionCheck = function (sVersion) {
+ /* This is cheap, but effective */
+ var fnZPad = function (Zpad, count) {
+ while (Zpad.length < count) {
+ Zpad += '0';
+ }
+ return Zpad;
+ };
+ var aThis = DataTable.ext.sVersion.split('.');
+ var aThat = sVersion.split('.');
+ var sThis = '', sThat = '';
+
+ for (var i = 0, iLen = aThat.length; i < iLen; i++) {
+ sThis += fnZPad(aThis[i], 3);
+ sThat += fnZPad(aThat[i], 3);
+ }
+
+ return parseInt(sThis, 10) >= parseInt(sThat, 10);
+ };
+
+
+ /**
+ * Check if a TABLE node is a DataTable table already or not.
+ * @param {node} nTable The TABLE node to check if it is a DataTable or not (note that other
+ * node types can be passed in, but will always return false).
+ * @returns {boolean} true the table given is a DataTable, or false otherwise
+ * @static
+ * @dtopt API-Static
+ *
+ * @example
+ * var ex = document.getElementById('example');
+ * if ( ! $.fn.DataTable.fnIsDataTable( ex ) ) {
+ * $(ex).dataTable();
+ * }
+ */
+ DataTable.fnIsDataTable = function (nTable) {
+ var o = DataTable.settings;
+
+ for (var i = 0; i < o.length; i++) {
+ if (o[i].nTable === nTable || o[i].nScrollHead === nTable || o[i].nScrollFoot === nTable) {
+ return true;
+ }
+ }
+
+ return false;
+ };
+
+
+ /**
+ * Get all DataTable tables that have been initialised - optionally you can select to
+ * get only currently visible tables.
+ * @param {boolean} [bVisible=false] Flag to indicate if you want all (default) or
+ * visible tables only.
+ * @returns {array} Array of TABLE nodes (not DataTable instances) which are DataTables
+ * @static
+ * @dtopt API-Static
+ *
+ * @example
+ * var table = $.fn.dataTable.fnTables(true);
+ * if ( table.length > 0 ) {
+ * $(table).dataTable().fnAdjustColumnSizing();
+ * }
+ */
+ DataTable.fnTables = function (bVisible) {
+ var out = [];
+
+ jQuery.each(DataTable.settings, function (i, o) {
+ if (!bVisible || (bVisible === true && $(o.nTable).is(':visible'))) {
+ out.push(o.nTable);
+ }
+ });
+
+ return out;
+ };
+
+
+ /**
+ * Version string for plug-ins to check compatibility. Allowed format is
+ * a.b.c.d.e where: a:int, b:int, c:int, d:string(dev|beta), e:int. d and
+ * e are optional
+ * @member
+ * @type string
+ * @default Version number
+ */
+ DataTable.version = "1.9.3";
+
+ /**
+ * Private data store, containing all of the settings objects that are created for the
+ * tables on a given page.
+ *
+ * Note that the
DataTable.settings object is aliased to
jQuery.fn.dataTableExt
+ * through which it may be accessed and manipulated, or
jQuery.fn.dataTable.settings .
+ * @member
+ * @type array
+ * @default []
+ * @private
+ */
+ DataTable.settings = [];
+
+ /**
+ * Object models container, for the various models that DataTables has available
+ * to it. These models define the objects that are used to hold the active state
+ * and configuration of the table.
+ * @namespace
+ */
+ DataTable.models = {};
+
+
+ /**
+ * DataTables extension options and plug-ins. This namespace acts as a collection "area"
+ * for plug-ins that can be used to extend the default DataTables behaviour - indeed many
+ * of the build in methods use this method to provide their own capabilities (sorting methods
+ * for example).
+ *
+ * Note that this namespace is aliased to jQuery.fn.dataTableExt so it can be readily accessed
+ * and modified by plug-ins.
+ * @namespace
+ */
+ DataTable.models.ext = {
+ /**
+ * Plug-in filtering functions - this method of filtering is complimentary to the default
+ * type based filtering, and a lot more comprehensive as it allows you complete control
+ * over the filtering logic. Each element in this array is a function (parameters
+ * described below) that is called for every row in the table, and your logic decides if
+ * it should be included in the filtered data set or not.
+ *
+ *
+ * Function input parameters:
+ *
+ * {object} DataTables settings object: see {@link DataTable.models.oSettings}.
+ * {array|object} Data for the row to be processed (same as the original format
+ * that was passed in as the data source, or an array from a DOM data source
+ * {int} Row index in aoData ({@link DataTable.models.oSettings.aoData}), which can
+ * be useful to retrieve the TR element if you need DOM interaction.
+ *
+ *
+ *
+ * Function return:
+ *
+ * {boolean} Include the row in the filtered result set (true) or not (false)
+ *
+ *
+ *
+ * @type array
+ * @default []
+ *
+ * @example
+ * // The following example shows custom filtering being applied to the fourth column (i.e.
+ * // the aData[3] index) based on two input values from the end-user, matching the data in
+ * // a certain range.
+ * $.fn.dataTableExt.afnFiltering.push(
+ * function( oSettings, aData, iDataIndex ) {
+ * var iMin = document.getElementById('min').value * 1;
+ * var iMax = document.getElementById('max').value * 1;
+ * var iVersion = aData[3] == "-" ? 0 : aData[3]*1;
+ * if ( iMin == "" && iMax == "" ) {
+ * return true;
+ * }
+ * else if ( iMin == "" && iVersion < iMax ) {
+ * return true;
+ * }
+ * else if ( iMin < iVersion && "" == iMax ) {
+ * return true;
+ * }
+ * else if ( iMin < iVersion && iVersion < iMax ) {
+ * return true;
+ * }
+ * return false;
+ * }
+ * );
+ */
+ "afnFiltering": [],
+
+
+ /**
+ * Plug-in sorting functions - this method of sorting is complimentary to the default type
+ * based sorting that DataTables does automatically, allowing much greater control over the
+ * the data that is being used to sort a column. This is useful if you want to do sorting
+ * based on live data (for example the contents of an 'input' element) rather than just the
+ * static string that DataTables knows of. The way these plug-ins work is that you create
+ * an array of the values you wish to be sorted for the column in question and then return
+ * that array. Which pre-sorting function is run here depends on the sSortDataType parameter
+ * that is used for the column (if any). This is the corollary of
ofnSearch for sort
+ * data.
+ *
+ *
+ * Function input parameters:
+ *
+ * {object} DataTables settings object: see {@link DataTable.models.oSettings}.
+ * {int} Target column index
+ *
+ *
+ *
+ * Function return:
+ *
+ * {array} Data for the column to be sorted upon
+ *
+ *
+ *
+ *
+ * Note that as of v1.9, it is typically preferable to use
mData to prepare data for
+ * the different uses that DataTables can put the data to. Specifically
mData when
+ * used as a function will give you a 'type' (sorting, filtering etc) that you can use to
+ * prepare the data as required for the different types. As such, this method is deprecated.
+ * @type array
+ * @default []
+ * @deprecated
+ *
+ * @example
+ * // Updating the cached sorting information with user entered values in HTML input elements
+ * jQuery.fn.dataTableExt.afnSortData['dom-text'] = function ( oSettings, iColumn )
+ * {
+ * var aData = [];
+ * $( 'td:eq('+iColumn+') input', oSettings.oApi._fnGetTrNodes(oSettings) ).each( function () {
+ * aData.push( this.value );
+ * } );
+ * return aData;
+ * }
+ */
+ "afnSortData": [],
+
+
+ /**
+ * Feature plug-ins - This is an array of objects which describe the feature plug-ins that are
+ * available to DataTables. These feature plug-ins are accessible through the sDom initialisation
+ * option. As such, each feature plug-in must describe a function that is used to initialise
+ * itself (fnInit), a character so the feature can be enabled by sDom (cFeature) and the name
+ * of the feature (sFeature). Thus the objects attached to this method must provide:
+ *
+ * {function} fnInit Initialisation of the plug-in
+ *
+ *
+ * Function input parameters:
+ *
+ * {object} DataTables settings object: see {@link DataTable.models.oSettings}.
+ *
+ *
+ *
+ * Function return:
+ *
+ * {node|null} The element which contains your feature. Note that the return
+ * may also be void if your plug-in does not require to inject any DOM elements
+ * into DataTables control (sDom) - for example this might be useful when
+ * developing a plug-in which allows table control via keyboard entry.
+ *
+ *
+ *
+ *
+ * {character} cFeature Character that will be matched in sDom - case sensitive
+ * {string} sFeature Feature name
+ *
+ * @type array
+ * @default []
+ *
+ * @example
+ * // How TableTools initialises itself.
+ * $.fn.dataTableExt.aoFeatures.push( {
+ * "fnInit": function( oSettings ) {
+ * return new TableTools( { "oDTSettings": oSettings } );
+ * },
+ * "cFeature": "T",
+ * "sFeature": "TableTools"
+ * } );
+ */
+ "aoFeatures": [],
+
+
+ /**
+ * Type detection plug-in functions - DataTables utilises types to define how sorting and
+ * filtering behave, and types can be either be defined by the developer (sType for the
+ * column) or they can be automatically detected by the methods in this array. The functions
+ * defined in the array are quite simple, taking a single parameter (the data to analyse)
+ * and returning the type if it is a known type, or null otherwise.
+ *
+ *
+ * Function input parameters:
+ *
+ * {*} Data from the column cell to be analysed
+ *
+ *
+ *
+ * Function return:
+ *
+ * {string|null} Data type detected, or null if unknown (and thus pass it
+ * on to the other type detection functions.
+ *
+ *
+ *
+ * @type array
+ * @default []
+ *
+ * @example
+ * // Currency type detection plug-in:
+ * jQuery.fn.dataTableExt.aTypes.push(
+ * function ( sData ) {
+ * var sValidChars = "0123456789.-";
+ * var Char;
+ *
+ * // Check the numeric part
+ * for ( i=1 ; i
afnSortData for filtering data.
+ *
+ *
+ * Function input parameters:
+ *
+ * {*} Data from the column cell to be prepared for filtering
+ *
+ *
+ *
+ * Function return:
+ *
+ * {string|null} Formatted string that will be used for the filtering.
+ *
+ *
+ *
+ *
+ * Note that as of v1.9, it is typically preferable to use mData to prepare data for
+ * the different uses that DataTables can put the data to. Specifically mData when
+ * used as a function will give you a 'type' (sorting, filtering etc) that you can use to
+ * prepare the data as required for the different types. As such, this method is deprecated.
+ * @type object
+ * @default {}
+ * @deprecated
+ *
+ * @example
+ * $.fn.dataTableExt.ofnSearch['title-numeric'] = function ( sData ) {
+ * return sData.replace(/\n/g," ").replace( /<.*?>/g, "" );
+ * }
+ */
+ "ofnSearch": {},
+
+
+ /**
+ * Container for all private functions in DataTables so they can be exposed externally
+ * @type object
+ * @default {}
+ */
+ "oApi": {},
+
+
+ /**
+ * Storage for the various classes that DataTables uses
+ * @type object
+ * @default {}
+ */
+ "oStdClasses": {},
+
+
+ /**
+ * Storage for the various classes that DataTables uses - jQuery UI suitable
+ * @type object
+ * @default {}
+ */
+ "oJUIClasses": {},
+
+
+ /**
+ * Pagination plug-in methods - The style and controls of the pagination can significantly
+ * impact on how the end user interacts with the data in your table, and DataTables allows
+ * the addition of pagination controls by extending this object, which can then be enabled
+ * through the sPaginationType initialisation parameter. Each pagination type that
+ * is added is an object (the property name of which is what sPaginationType refers
+ * to) that has two properties, both methods that are used by DataTables to update the
+ * control's state.
+ *
+ *
+ * fnInit - Initialisation of the paging controls. Called only during initialisation
+ * of the table. It is expected that this function will add the required DOM elements
+ * to the page for the paging controls to work. The element pointer
+ * 'oSettings.aanFeatures.p' array is provided by DataTables to contain the paging
+ * controls (note that this is a 2D array to allow for multiple instances of each
+ * DataTables DOM element). It is suggested that you add the controls to this element
+ * as children
+ *
+ *
+ * Function input parameters:
+ *
+ * {object} DataTables settings object: see {@link DataTable.models.oSettings}.
+ * {node} Container into which the pagination controls must be inserted
+ * {function} Draw callback function - whenever the controls cause a page
+ * change, this method must be called to redraw the table.
+ *
+ *
+ *
+ * Function return:
+ *
+ * No return required
+ *
+ *
+ *
+ *
+ *
+ * fnInit - This function is called whenever the paging status of the table changes and is
+ * typically used to update classes and/or text of the paging controls to reflex the new
+ * status.
+ *
+ *
+ * Function input parameters:
+ *
+ * {object} DataTables settings object: see {@link DataTable.models.oSettings}.
+ * {function} Draw callback function - in case you need to redraw the table again
+ * or attach new event listeners
+ *
+ *
+ *
+ * Function return:
+ *
+ * No return required
+ *
+ *
+ *
+ *
+ *
+ * @type object
+ * @default {}
+ *
+ * @example
+ * $.fn.dataTableExt.oPagination.four_button = {
+ * "fnInit": function ( oSettings, nPaging, fnCallbackDraw ) {
+ * nFirst = document.createElement( 'span' );
+ * nPrevious = document.createElement( 'span' );
+ * nNext = document.createElement( 'span' );
+ * nLast = document.createElement( 'span' );
+ *
+ * nFirst.appendChild( document.createTextNode( oSettings.oLanguage.oPaginate.sFirst ) );
+ * nPrevious.appendChild( document.createTextNode( oSettings.oLanguage.oPaginate.sPrevious ) );
+ * nNext.appendChild( document.createTextNode( oSettings.oLanguage.oPaginate.sNext ) );
+ * nLast.appendChild( document.createTextNode( oSettings.oLanguage.oPaginate.sLast ) );
+ *
+ * nFirst.className = "paginate_button first";
+ * nPrevious.className = "paginate_button previous";
+ * nNext.className="paginate_button next";
+ * nLast.className = "paginate_button last";
+ *
+ * nPaging.appendChild( nFirst );
+ * nPaging.appendChild( nPrevious );
+ * nPaging.appendChild( nNext );
+ * nPaging.appendChild( nLast );
+ *
+ * $(nFirst).click( function () {
+ * oSettings.oApi._fnPageChange( oSettings, "first" );
+ * fnCallbackDraw( oSettings );
+ * } );
+ *
+ * $(nPrevious).click( function() {
+ * oSettings.oApi._fnPageChange( oSettings, "previous" );
+ * fnCallbackDraw( oSettings );
+ * } );
+ *
+ * $(nNext).click( function() {
+ * oSettings.oApi._fnPageChange( oSettings, "next" );
+ * fnCallbackDraw( oSettings );
+ * } );
+ *
+ * $(nLast).click( function() {
+ * oSettings.oApi._fnPageChange( oSettings, "last" );
+ * fnCallbackDraw( oSettings );
+ * } );
+ *
+ * $(nFirst).bind( 'selectstart', function () { return false; } );
+ * $(nPrevious).bind( 'selectstart', function () { return false; } );
+ * $(nNext).bind( 'selectstart', function () { return false; } );
+ * $(nLast).bind( 'selectstart', function () { return false; } );
+ * },
+ *
+ * "fnUpdate": function ( oSettings, fnCallbackDraw ) {
+ * if ( !oSettings.aanFeatures.p ) {
+ * return;
+ * }
+ *
+ * // Loop over each instance of the pager
+ * var an = oSettings.aanFeatures.p;
+ * for ( var i=0, iLen=an.length ; i
+ *
+ * Function input parameters:
+ *
+ * {*} Data to compare to the second parameter
+ * {*} Data to compare to the first parameter
+ *
+ *
+ *
+ * Function return:
+ *
+ * {int} Sorting match: <0 if first parameter should be sorted lower than
+ * the second parameter, ===0 if the two parameters are equal and >0 if
+ * the first parameter should be sorted height than the second parameter.
+ *
+ *
+ *
+ * @type object
+ * @default {}
+ *
+ * @example
+ * // Case-sensitive string sorting, with no pre-formatting method
+ * $.extend( $.fn.dataTableExt.oSort, {
+ * "string-case-asc": function(x,y) {
+ * return ((x < y) ? -1 : ((x > y) ? 1 : 0));
+ * },
+ * "string-case-desc": function(x,y) {
+ * return ((x < y) ? 1 : ((x > y) ? -1 : 0));
+ * }
+ * } );
+ *
+ * @example
+ * // Case-insensitive string sorting, with pre-formatting
+ * $.extend( $.fn.dataTableExt.oSort, {
+ * "string-pre": function(x) {
+ * return x.toLowerCase();
+ * },
+ * "string-asc": function(x,y) {
+ * return ((x < y) ? -1 : ((x > y) ? 1 : 0));
+ * },
+ * "string-desc": function(x,y) {
+ * return ((x < y) ? 1 : ((x > y) ? -1 : 0));
+ * }
+ * } );
+ */
+ "oSort": {},
+
+
+ /**
+ * Version string for plug-ins to check compatibility. Allowed format is
+ * a.b.c.d.e where: a:int, b:int, c:int, d:string(dev|beta), e:int. d and
+ * e are optional
+ * @type string
+ * @default Version number
+ */
+ "sVersion": DataTable.version,
+
+
+ /**
+ * How should DataTables report an error. Can take the value 'alert' or 'throw'
+ * @type string
+ * @default alert
+ */
+ "sErrMode": "alert",
+
+
+ /**
+ * Store information for DataTables to access globally about other instances
+ * @namespace
+ * @private
+ */
+ "_oExternConfig": {
+ /* int:iNextUnique - next unique number for an instance */
+ "iNextUnique": 0
+ }
+ };
+
+
+
+
+ /**
+ * Template object for the way in which DataTables holds information about
+ * search information for the global filter and individual column filters.
+ * @namespace
+ */
+ DataTable.models.oSearch = {
+ /**
+ * Flag to indicate if the filtering should be case insensitive or not
+ * @type boolean
+ * @default true
+ */
+ "bCaseInsensitive": true,
+
+ /**
+ * Applied search term
+ * @type string
+ * @default Empty string
+ */
+ "sSearch": "",
+
+ /**
+ * Flag to indicate if the search term should be interpreted as a
+ * regular expression (true) or not (false) and therefore and special
+ * regex characters escaped.
+ * @type boolean
+ * @default false
+ */
+ "bRegex": false,
+
+ /**
+ * Flag to indicate if DataTables is to use its smart filtering or not.
+ * @type boolean
+ * @default true
+ */
+ "bSmart": true
+ };
+
+
+
+
+ /**
+ * Template object for the way in which DataTables holds information about
+ * each individual row. This is the object format used for the settings
+ * aoData array.
+ * @namespace
+ */
+ DataTable.models.oRow = {
+ /**
+ * TR element for the row
+ * @type node
+ * @default null
+ */
+ "nTr": null,
+
+ /**
+ * Data object from the original data source for the row. This is either
+ * an array if using the traditional form of DataTables, or an object if
+ * using mData options. The exact type will depend on the passed in
+ * data from the data source, or will be an array if using DOM a data
+ * source.
+ * @type array|object
+ * @default []
+ */
+ "_aData": [],
+
+ /**
+ * Sorting data cache - this array is ostensibly the same length as the
+ * number of columns (although each index is generated only as it is
+ * needed), and holds the data that is used for sorting each column in the
+ * row. We do this cache generation at the start of the sort in order that
+ * the formatting of the sort data need be done only once for each cell
+ * per sort. This array should not be read from or written to by anything
+ * other than the master sorting methods.
+ * @type array
+ * @default []
+ * @private
+ */
+ "_aSortData": [],
+
+ /**
+ * Array of TD elements that are cached for hidden rows, so they can be
+ * reinserted into the table if a column is made visible again (or to act
+ * as a store if a column is made hidden). Only hidden columns have a
+ * reference in the array. For non-hidden columns the value is either
+ * undefined or null.
+ * @type array nodes
+ * @default []
+ * @private
+ */
+ "_anHidden": [],
+
+ /**
+ * Cache of the class name that DataTables has applied to the row, so we
+ * can quickly look at this variable rather than needing to do a DOM check
+ * on className for the nTr property.
+ * @type string
+ * @default Empty string
+ * @private
+ */
+ "_sRowStripe": ""
+ };
+
+
+
+ /**
+ * Template object for the column information object in DataTables. This object
+ * is held in the settings aoColumns array and contains all the information that
+ * DataTables needs about each individual column.
+ *
+ * Note that this object is related to {@link DataTable.defaults.columns}
+ * but this one is the internal data store for DataTables's cache of columns.
+ * It should NOT be manipulated outside of DataTables. Any configuration should
+ * be done through the initialisation options.
+ * @namespace
+ */
+ DataTable.models.oColumn = {
+ /**
+ * A list of the columns that sorting should occur on when this column
+ * is sorted. That this property is an array allows multi-column sorting
+ * to be defined for a column (for example first name / last name columns
+ * would benefit from this). The values are integers pointing to the
+ * columns to be sorted on (typically it will be a single integer pointing
+ * at itself, but that doesn't need to be the case).
+ * @type array
+ */
+ "aDataSort": null,
+
+ /**
+ * Define the sorting directions that are applied to the column, in sequence
+ * as the column is repeatedly sorted upon - i.e. the first value is used
+ * as the sorting direction when the column if first sorted (clicked on).
+ * Sort it again (click again) and it will move on to the next index.
+ * Repeat until loop.
+ * @type array
+ */
+ "asSorting": null,
+
+ /**
+ * Flag to indicate if the column is searchable, and thus should be included
+ * in the filtering or not.
+ * @type boolean
+ */
+ "bSearchable": null,
+
+ /**
+ * Flag to indicate if the column is sortable or not.
+ * @type boolean
+ */
+ "bSortable": null,
+
+ /**
+ * When using fnRender, you have two options for what to do with the data,
+ * and this property serves as the switch. Firstly, you can have the sorting
+ * and filtering use the rendered value (true - default), or you can have
+ * the sorting and filtering us the original value (false).
+ *
+ * *NOTE* It is it is advisable now to use mData as a function and make
+ * use of the 'type' that it gives, allowing (potentially) different data to
+ * be used for sorting, filtering, display and type detection.
+ * @type boolean
+ * @deprecated
+ */
+ "bUseRendered": null,
+
+ /**
+ * Flag to indicate if the column is currently visible in the table or not
+ * @type boolean
+ */
+ "bVisible": null,
+
+ /**
+ * Flag to indicate to the type detection method if the automatic type
+ * detection should be used, or if a column type (sType) has been specified
+ * @type boolean
+ * @default true
+ * @private
+ */
+ "_bAutoType": true,
+
+ /**
+ * Developer definable function that is called whenever a cell is created (Ajax source,
+ * etc) or processed for input (DOM source). This can be used as a compliment to fnRender
+ * allowing you to modify the DOM element (add background colour for example) when the
+ * element is available (since it is not when fnRender is called).
+ * @type function
+ * @param {element} nTd The TD node that has been created
+ * @param {*} sData The Data for the cell
+ * @param {array|object} oData The data for the whole row
+ * @param {int} iRow The row index for the aoData data store
+ * @default null
+ */
+ "fnCreatedCell": null,
+
+ /**
+ * Function to get data from a cell in a column. You should never
+ * access data directly through _aData internally in DataTables - always use
+ * the method attached to this property. It allows mData to function as
+ * required. This function is automatically assigned by the column
+ * initialisation method
+ * @type function
+ * @param {array|object} oData The data array/object for the array
+ * (i.e. aoData[]._aData)
+ * @param {string} sSpecific The specific data type you want to get -
+ * 'display', 'type' 'filter' 'sort'
+ * @returns {*} The data for the cell from the given row's data
+ * @default null
+ */
+ "fnGetData": null,
+
+ /**
+ * Custom display function that will be called for the display of each cell
+ * in this column.
+ * @type function
+ * @param {object} o Object with the following parameters:
+ * @param {int} o.iDataRow The row in aoData
+ * @param {int} o.iDataColumn The column in question
+ * @param {array} o.aData The data for the row in question
+ * @param {object} o.oSettings The settings object for this DataTables instance
+ * @returns {string} The string you which to use in the display
+ * @default null
+ */
+ "fnRender": null,
+
+ /**
+ * Function to set data for a cell in the column. You should never
+ * set the data directly to _aData internally in DataTables - always use
+ * this method. It allows mData to function as required. This function
+ * is automatically assigned by the column initialisation method
+ * @type function
+ * @param {array|object} oData The data array/object for the array
+ * (i.e. aoData[]._aData)
+ * @param {*} sValue Value to set
+ * @default null
+ */
+ "fnSetData": null,
+
+ /**
+ * Property to read the value for the cells in the column from the data
+ * source array / object. If null, then the default content is used, if a
+ * function is given then the return from the function is used.
+ * @type function|int|string|null
+ * @default null
+ */
+ "mData": null,
+
+ /**
+ * Partner property to mData which is used (only when defined) to get
+ * the data - i.e. it is basically the same as mData, but without the
+ * 'set' option, and also the data fed to it is the result from mData.
+ * This is the rendering method to match the data method of mData.
+ * @type function|int|string|null
+ * @default null
+ */
+ "mRender": null,
+
+ /**
+ * Unique header TH/TD element for this column - this is what the sorting
+ * listener is attached to (if sorting is enabled.)
+ * @type node
+ * @default null
+ */
+ "nTh": null,
+
+ /**
+ * Unique footer TH/TD element for this column (if there is one). Not used
+ * in DataTables as such, but can be used for plug-ins to reference the
+ * footer for each column.
+ * @type node
+ * @default null
+ */
+ "nTf": null,
+
+ /**
+ * The class to apply to all TD elements in the table's TBODY for the column
+ * @type string
+ * @default null
+ */
+ "sClass": null,
+
+ /**
+ * When DataTables calculates the column widths to assign to each column,
+ * it finds the longest string in each column and then constructs a
+ * temporary table and reads the widths from that. The problem with this
+ * is that "mmm" is much wider then "iiii", but the latter is a longer
+ * string - thus the calculation can go wrong (doing it properly and putting
+ * it into an DOM object and measuring that is horribly(!) slow). Thus as
+ * a "work around" we provide this option. It will append its value to the
+ * text that is found to be the longest string for the column - i.e. padding.
+ * @type string
+ */
+ "sContentPadding": null,
+
+ /**
+ * Allows a default value to be given for a column's data, and will be used
+ * whenever a null data source is encountered (this can be because mData
+ * is set to null, or because the data source itself is null).
+ * @type string
+ * @default null
+ */
+ "sDefaultContent": null,
+
+ /**
+ * Name for the column, allowing reference to the column by name as well as
+ * by index (needs a lookup to work by name).
+ * @type string
+ */
+ "sName": null,
+
+ /**
+ * Custom sorting data type - defines which of the available plug-ins in
+ * afnSortData the custom sorting will use - if any is defined.
+ * @type string
+ * @default std
+ */
+ "sSortDataType": 'std',
+
+ /**
+ * Class to be applied to the header element when sorting on this column
+ * @type string
+ * @default null
+ */
+ "sSortingClass": null,
+
+ /**
+ * Class to be applied to the header element when sorting on this column -
+ * when jQuery UI theming is used.
+ * @type string
+ * @default null
+ */
+ "sSortingClassJUI": null,
+
+ /**
+ * Title of the column - what is seen in the TH element (nTh).
+ * @type string
+ */
+ "sTitle": null,
+
+ /**
+ * Column sorting and filtering type
+ * @type string
+ * @default null
+ */
+ "sType": null,
+
+ /**
+ * Width of the column
+ * @type string
+ * @default null
+ */
+ "sWidth": null,
+
+ /**
+ * Width of the column when it was first "encountered"
+ * @type string
+ * @default null
+ */
+ "sWidthOrig": null
+ };
+
+
+
+ /**
+ * Initialisation options that can be given to DataTables at initialisation
+ * time.
+ * @namespace
+ */
+ DataTable.defaults = {
+ /**
+ * An array of data to use for the table, passed in at initialisation which
+ * will be used in preference to any data which is already in the DOM. This is
+ * particularly useful for constructing tables purely in Javascript, for
+ * example with a custom Ajax call.
+ * @type array
+ * @default null
+ * @dtopt Option
+ *
+ * @example
+ * // Using a 2D array data source
+ * $(document).ready( function () {
+ * $('#example').dataTable( {
+ * "aaData": [
+ * ['Trident', 'Internet Explorer 4.0', 'Win 95+', 4, 'X'],
+ * ['Trident', 'Internet Explorer 5.0', 'Win 95+', 5, 'C'],
+ * ],
+ * "aoColumns": [
+ * { "sTitle": "Engine" },
+ * { "sTitle": "Browser" },
+ * { "sTitle": "Platform" },
+ * { "sTitle": "Version" },
+ * { "sTitle": "Grade" }
+ * ]
+ * } );
+ * } );
+ *
+ * @example
+ * // Using an array of objects as a data source (mData)
+ * $(document).ready( function () {
+ * $('#example').dataTable( {
+ * "aaData": [
+ * {
+ * "engine": "Trident",
+ * "browser": "Internet Explorer 4.0",
+ * "platform": "Win 95+",
+ * "version": 4,
+ * "grade": "X"
+ * },
+ * {
+ * "engine": "Trident",
+ * "browser": "Internet Explorer 5.0",
+ * "platform": "Win 95+",
+ * "version": 5,
+ * "grade": "C"
+ * }
+ * ],
+ * "aoColumns": [
+ * { "sTitle": "Engine", "mData": "engine" },
+ * { "sTitle": "Browser", "mData": "browser" },
+ * { "sTitle": "Platform", "mData": "platform" },
+ * { "sTitle": "Version", "mData": "version" },
+ * { "sTitle": "Grade", "mData": "grade" }
+ * ]
+ * } );
+ * } );
+ */
+ "aaData": null,
+
+
+ /**
+ * If sorting is enabled, then DataTables will perform a first pass sort on
+ * initialisation. You can define which column(s) the sort is performed upon,
+ * and the sorting direction, with this variable. The aaSorting array should
+ * contain an array for each column to be sorted initially containing the
+ * column's index and a direction string ('asc' or 'desc').
+ * @type array
+ * @default [[0,'asc']]
+ * @dtopt Option
+ *
+ * @example
+ * // Sort by 3rd column first, and then 4th column
+ * $(document).ready( function() {
+ * $('#example').dataTable( {
+ * "aaSorting": [[2,'asc'], [3,'desc']]
+ * } );
+ * } );
+ *
+ * // No initial sorting
+ * $(document).ready( function() {
+ * $('#example').dataTable( {
+ * "aaSorting": []
+ * } );
+ * } );
+ */
+ "aaSorting": [[0, 'asc']],
+
+
+ /**
+ * This parameter is basically identical to the aaSorting parameter, but
+ * cannot be overridden by user interaction with the table. What this means
+ * is that you could have a column (visible or hidden) which the sorting will
+ * always be forced on first - any sorting after that (from the user) will
+ * then be performed as required. This can be useful for grouping rows
+ * together.
+ * @type array
+ * @default null
+ * @dtopt Option
+ *
+ * @example
+ * $(document).ready( function() {
+ * $('#example').dataTable( {
+ * "aaSortingFixed": [[0,'asc']]
+ * } );
+ * } )
+ */
+ "aaSortingFixed": null,
+
+
+ /**
+ * This parameter allows you to readily specify the entries in the length drop
+ * down menu that DataTables shows when pagination is enabled. It can be
+ * either a 1D array of options which will be used for both the displayed
+ * option and the value, or a 2D array which will use the array in the first
+ * position as the value, and the array in the second position as the
+ * displayed options (useful for language strings such as 'All').
+ * @type array
+ * @default [ 10, 25, 50, 100 ]
+ * @dtopt Option
+ *
+ * @example
+ * $(document).ready( function() {
+ * $('#example').dataTable( {
+ * "aLengthMenu": [[10, 25, 50, -1], [10, 25, 50, "All"]]
+ * } );
+ * } );
+ *
+ * @example
+ * // Setting the default display length as well as length menu
+ * // This is likely to be wanted if you remove the '10' option which
+ * // is the iDisplayLength default.
+ * $(document).ready( function() {
+ * $('#example').dataTable( {
+ * "iDisplayLength": 25,
+ * "aLengthMenu": [[25, 50, 100, -1], [25, 50, 100, "All"]]
+ * } );
+ * } );
+ */
+ "aLengthMenu": [10, 25, 50, 100],
+
+
+ /**
+ * The aoColumns option in the initialisation parameter allows you to define
+ * details about the way individual columns behave. For a full list of
+ * column options that can be set, please see
+ * {@link DataTable.defaults.columns}. Note that if you use aoColumns to
+ * define your columns, you must have an entry in the array for every single
+ * column that you have in your table (these can be null if you don't which
+ * to specify any options).
+ * @member
+ */
+ "aoColumns": null,
+
+ /**
+ * Very similar to aoColumns, aoColumnDefs allows you to target a specific
+ * column, multiple columns, or all columns, using the aTargets property of
+ * each object in the array. This allows great flexibility when creating
+ * tables, as the aoColumnDefs arrays can be of any length, targeting the
+ * columns you specifically want. aoColumnDefs may use any of the column
+ * options available: {@link DataTable.defaults.columns}, but it _must_
+ * have aTargets defined in each object in the array. Values in the aTargets
+ * array may be:
+ *
+ * a string - class name will be matched on the TH for the column
+ * 0 or a positive integer - column index counting from the left
+ * a negative integer - column index counting from the right
+ * the string "_all" - all columns (i.e. assign a default)
+ *
+ * @member
+ */
+ "aoColumnDefs": null,
+
+
+ /**
+ * Basically the same as oSearch, this parameter defines the individual column
+ * filtering state at initialisation time. The array must be of the same size
+ * as the number of columns, and each element be an object with the parameters
+ * "sSearch" and "bEscapeRegex" (the latter is optional). 'null' is also
+ * accepted and the default will be used.
+ * @type array
+ * @default []
+ * @dtopt Option
+ *
+ * @example
+ * $(document).ready( function() {
+ * $('#example').dataTable( {
+ * "aoSearchCols": [
+ * null,
+ * { "sSearch": "My filter" },
+ * null,
+ * { "sSearch": "^[0-9]", "bEscapeRegex": false }
+ * ]
+ * } );
+ * } )
+ */
+ "aoSearchCols": [],
+
+
+ /**
+ * An array of CSS classes that should be applied to displayed rows. This
+ * array may be of any length, and DataTables will apply each class
+ * sequentially, looping when required.
+ * @type array
+ * @default null Will take the values determined by the oClasses.sStripe*
+ * options
+ * @dtopt Option
+ *
+ * @example
+ * $(document).ready( function() {
+ * $('#example').dataTable( {
+ * "asStripeClasses": [ 'strip1', 'strip2', 'strip3' ]
+ * } );
+ * } )
+ */
+ "asStripeClasses": null,
+
+
+ /**
+ * Enable or disable automatic column width calculation. This can be disabled
+ * as an optimisation (it takes some time to calculate the widths) if the
+ * tables widths are passed in using aoColumns.
+ * @type boolean
+ * @default true
+ * @dtopt Features
+ *
+ * @example
+ * $(document).ready( function () {
+ * $('#example').dataTable( {
+ * "bAutoWidth": false
+ * } );
+ * } );
+ */
+ "bAutoWidth": true,
+
+
+ /**
+ * Deferred rendering can provide DataTables with a huge speed boost when you
+ * are using an Ajax or JS data source for the table. This option, when set to
+ * true, will cause DataTables to defer the creation of the table elements for
+ * each row until they are needed for a draw - saving a significant amount of
+ * time.
+ * @type boolean
+ * @default false
+ * @dtopt Features
+ *
+ * @example
+ * $(document).ready( function() {
+ * var oTable = $('#example').dataTable( {
+ * "sAjaxSource": "sources/arrays.txt",
+ * "bDeferRender": true
+ * } );
+ * } );
+ */
+ "bDeferRender": false,
+
+
+ /**
+ * Replace a DataTable which matches the given selector and replace it with
+ * one which has the properties of the new initialisation object passed. If no
+ * table matches the selector, then the new DataTable will be constructed as
+ * per normal.
+ * @type boolean
+ * @default false
+ * @dtopt Options
+ *
+ * @example
+ * $(document).ready( function() {
+ * $('#example').dataTable( {
+ * "sScrollY": "200px",
+ * "bPaginate": false
+ * } );
+ *
+ * // Some time later....
+ * $('#example').dataTable( {
+ * "bFilter": false,
+ * "bDestroy": true
+ * } );
+ * } );
+ */
+ "bDestroy": false,
+
+
+ /**
+ * Enable or disable filtering of data. Filtering in DataTables is "smart" in
+ * that it allows the end user to input multiple words (space separated) and
+ * will match a row containing those words, even if not in the order that was
+ * specified (this allow matching across multiple columns). Note that if you
+ * wish to use filtering in DataTables this must remain 'true' - to remove the
+ * default filtering input box and retain filtering abilities, please use
+ * {@link DataTable.defaults.sDom}.
+ * @type boolean
+ * @default true
+ * @dtopt Features
+ *
+ * @example
+ * $(document).ready( function () {
+ * $('#example').dataTable( {
+ * "bFilter": false
+ * } );
+ * } );
+ */
+ "bFilter": true,
+
+
+ /**
+ * Enable or disable the table information display. This shows information
+ * about the data that is currently visible on the page, including information
+ * about filtered data if that action is being performed.
+ * @type boolean
+ * @default true
+ * @dtopt Features
+ *
+ * @example
+ * $(document).ready( function () {
+ * $('#example').dataTable( {
+ * "bInfo": false
+ * } );
+ * } );
+ */
+ "bInfo": true,
+
+
+ /**
+ * Enable jQuery UI ThemeRoller support (required as ThemeRoller requires some
+ * slightly different and additional mark-up from what DataTables has
+ * traditionally used).
+ * @type boolean
+ * @default false
+ * @dtopt Features
+ *
+ * @example
+ * $(document).ready( function() {
+ * $('#example').dataTable( {
+ * "bJQueryUI": true
+ * } );
+ * } );
+ */
+ "bJQueryUI": false,
+
+
+ /**
+ * Allows the end user to select the size of a formatted page from a select
+ * menu (sizes are 10, 25, 50 and 100). Requires pagination (bPaginate).
+ * @type boolean
+ * @default true
+ * @dtopt Features
+ *
+ * @example
+ * $(document).ready( function () {
+ * $('#example').dataTable( {
+ * "bLengthChange": false
+ * } );
+ * } );
+ */
+ "bLengthChange": true,
+
+
+ /**
+ * Enable or disable pagination.
+ * @type boolean
+ * @default true
+ * @dtopt Features
+ *
+ * @example
+ * $(document).ready( function () {
+ * $('#example').dataTable( {
+ * "bPaginate": false
+ * } );
+ * } );
+ */
+ "bPaginate": true,
+
+
+ /**
+ * Enable or disable the display of a 'processing' indicator when the table is
+ * being processed (e.g. a sort). This is particularly useful for tables with
+ * large amounts of data where it can take a noticeable amount of time to sort
+ * the entries.
+ * @type boolean
+ * @default false
+ * @dtopt Features
+ *
+ * @example
+ * $(document).ready( function () {
+ * $('#example').dataTable( {
+ * "bProcessing": true
+ * } );
+ * } );
+ */
+ "bProcessing": false,
+
+
+ /**
+ * Retrieve the DataTables object for the given selector. Note that if the
+ * table has already been initialised, this parameter will cause DataTables
+ * to simply return the object that has already been set up - it will not take
+ * account of any changes you might have made to the initialisation object
+ * passed to DataTables (setting this parameter to true is an acknowledgement
+ * that you understand this). bDestroy can be used to reinitialise a table if
+ * you need.
+ * @type boolean
+ * @default false
+ * @dtopt Options
+ *
+ * @example
+ * $(document).ready( function() {
+ * initTable();
+ * tableActions();
+ * } );
+ *
+ * function initTable ()
+ * {
+ * return $('#example').dataTable( {
+ * "sScrollY": "200px",
+ * "bPaginate": false,
+ * "bRetrieve": true
+ * } );
+ * }
+ *
+ * function tableActions ()
+ * {
+ * var oTable = initTable();
+ * // perform API operations with oTable
+ * }
+ */
+ "bRetrieve": false,
+
+
+ /**
+ * Indicate if DataTables should be allowed to set the padding / margin
+ * etc for the scrolling header elements or not. Typically you will want
+ * this.
+ * @type boolean
+ * @default true
+ * @dtopt Options
+ *
+ * @example
+ * $(document).ready( function() {
+ * $('#example').dataTable( {
+ * "bScrollAutoCss": false,
+ * "sScrollY": "200px"
+ * } );
+ * } );
+ */
+ "bScrollAutoCss": true,
+
+
+ /**
+ * When vertical (y) scrolling is enabled, DataTables will force the height of
+ * the table's viewport to the given height at all times (useful for layout).
+ * However, this can look odd when filtering data down to a small data set,
+ * and the footer is left "floating" further down. This parameter (when
+ * enabled) will cause DataTables to collapse the table's viewport down when
+ * the result set will fit within the given Y height.
+ * @type boolean
+ * @default false
+ * @dtopt Options
+ *
+ * @example
+ * $(document).ready( function() {
+ * $('#example').dataTable( {
+ * "sScrollY": "200",
+ * "bScrollCollapse": true
+ * } );
+ * } );
+ */
+ "bScrollCollapse": false,
+
+
+ /**
+ * Enable infinite scrolling for DataTables (to be used in combination with
+ * sScrollY). Infinite scrolling means that DataTables will continually load
+ * data as a user scrolls through a table, which is very useful for large
+ * dataset. This cannot be used with pagination, which is automatically
+ * disabled. Note - the Scroller extra for DataTables is recommended in
+ * in preference to this option.
+ * @type boolean
+ * @default false
+ * @dtopt Features
+ *
+ * @example
+ * $(document).ready( function() {
+ * $('#example').dataTable( {
+ * "bScrollInfinite": true,
+ * "bScrollCollapse": true,
+ * "sScrollY": "200px"
+ * } );
+ * } );
+ */
+ "bScrollInfinite": false,
+
+
+ /**
+ * Configure DataTables to use server-side processing. Note that the
+ * sAjaxSource parameter must also be given in order to give DataTables a
+ * source to obtain the required data for each draw.
+ * @type boolean
+ * @default false
+ * @dtopt Features
+ * @dtopt Server-side
+ *
+ * @example
+ * $(document).ready( function () {
+ * $('#example').dataTable( {
+ * "bServerSide": true,
+ * "sAjaxSource": "xhr.php"
+ * } );
+ * } );
+ */
+ "bServerSide": false,
+
+
+ /**
+ * Enable or disable sorting of columns. Sorting of individual columns can be
+ * disabled by the "bSortable" option for each column.
+ * @type boolean
+ * @default true
+ * @dtopt Features
+ *
+ * @example
+ * $(document).ready( function () {
+ * $('#example').dataTable( {
+ * "bSort": false
+ * } );
+ * } );
+ */
+ "bSort": true,
+
+
+ /**
+ * Allows control over whether DataTables should use the top (true) unique
+ * cell that is found for a single column, or the bottom (false - default).
+ * This is useful when using complex headers.
+ * @type boolean
+ * @default false
+ * @dtopt Options
+ *
+ * @example
+ * $(document).ready( function() {
+ * $('#example').dataTable( {
+ * "bSortCellsTop": true
+ * } );
+ * } );
+ */
+ "bSortCellsTop": false,
+
+
+ /**
+ * Enable or disable the addition of the classes 'sorting_1', 'sorting_2' and
+ * 'sorting_3' to the columns which are currently being sorted on. This is
+ * presented as a feature switch as it can increase processing time (while
+ * classes are removed and added) so for large data sets you might want to
+ * turn this off.
+ * @type boolean
+ * @default true
+ * @dtopt Features
+ *
+ * @example
+ * $(document).ready( function () {
+ * $('#example').dataTable( {
+ * "bSortClasses": false
+ * } );
+ * } );
+ */
+ "bSortClasses": true,
+
+
+ /**
+ * Enable or disable state saving. When enabled a cookie will be used to save
+ * table display information such as pagination information, display length,
+ * filtering and sorting. As such when the end user reloads the page the
+ * display display will match what thy had previously set up.
+ * @type boolean
+ * @default false
+ * @dtopt Features
+ *
+ * @example
+ * $(document).ready( function () {
+ * $('#example').dataTable( {
+ * "bStateSave": true
+ * } );
+ * } );
+ */
+ "bStateSave": false,
+
+
+ /**
+ * Customise the cookie and / or the parameters being stored when using
+ * DataTables with state saving enabled. This function is called whenever
+ * the cookie is modified, and it expects a fully formed cookie string to be
+ * returned. Note that the data object passed in is a Javascript object which
+ * must be converted to a string (JSON.stringify for example).
+ * @type function
+ * @param {string} sName Name of the cookie defined by DataTables
+ * @param {object} oData Data to be stored in the cookie
+ * @param {string} sExpires Cookie expires string
+ * @param {string} sPath Path of the cookie to set
+ * @returns {string} Cookie formatted string (which should be encoded by
+ * using encodeURIComponent())
+ * @dtopt Callbacks
+ *
+ * @example
+ * $(document).ready( function () {
+ * $('#example').dataTable( {
+ * "fnCookieCallback": function (sName, oData, sExpires, sPath) {
+ * // Customise oData or sName or whatever else here
+ * return sName + "="+JSON.stringify(oData)+"; expires=" + sExpires +"; path=" + sPath;
+ * }
+ * } );
+ * } );
+ */
+ "fnCookieCallback": null,
+
+
+ /**
+ * This function is called when a TR element is created (and all TD child
+ * elements have been inserted), or registered if using a DOM source, allowing
+ * manipulation of the TR element (adding classes etc).
+ * @type function
+ * @param {node} nRow "TR" element for the current row
+ * @param {array} aData Raw data array for this row
+ * @param {int} iDataIndex The index of this row in aoData
+ * @dtopt Callbacks
+ *
+ * @example
+ * $(document).ready( function() {
+ * $('#example').dataTable( {
+ * "fnCreatedRow": function( nRow, aData, iDataIndex ) {
+ * // Bold the grade for all 'A' grade browsers
+ * if ( aData[4] == "A" )
+ * {
+ * $('td:eq(4)', nRow).html( 'A ' );
+ * }
+ * }
+ * } );
+ * } );
+ */
+ "fnCreatedRow": null,
+
+
+ /**
+ * This function is called on every 'draw' event, and allows you to
+ * dynamically modify any aspect you want about the created DOM.
+ * @type function
+ * @param {object} oSettings DataTables settings object
+ * @dtopt Callbacks
+ *
+ * @example
+ * $(document).ready( function() {
+ * $('#example').dataTable( {
+ * "fnDrawCallback": function( oSettings ) {
+ * alert( 'DataTables has redrawn the table' );
+ * }
+ * } );
+ * } );
+ */
+ "fnDrawCallback": null,
+
+
+ /**
+ * Identical to fnHeaderCallback() but for the table footer this function
+ * allows you to modify the table footer on every 'draw' even.
+ * @type function
+ * @param {node} nFoot "TR" element for the footer
+ * @param {array} aData Full table data (as derived from the original HTML)
+ * @param {int} iStart Index for the current display starting point in the
+ * display array
+ * @param {int} iEnd Index for the current display ending point in the
+ * display array
+ * @param {array int} aiDisplay Index array to translate the visual position
+ * to the full data array
+ * @dtopt Callbacks
+ *
+ * @example
+ * $(document).ready( function() {
+ * $('#example').dataTable( {
+ * "fnFooterCallback": function( nFoot, aData, iStart, iEnd, aiDisplay ) {
+ * nFoot.getElementsByTagName('th')[0].innerHTML = "Starting index is "+iStart;
+ * }
+ * } );
+ * } )
+ */
+ "fnFooterCallback": null,
+
+
+ /**
+ * When rendering large numbers in the information element for the table
+ * (i.e. "Showing 1 to 10 of 57 entries") DataTables will render large numbers
+ * to have a comma separator for the 'thousands' units (e.g. 1 million is
+ * rendered as "1,000,000") to help readability for the end user. This
+ * function will override the default method DataTables uses.
+ * @type function
+ * @member
+ * @param {int} iIn number to be formatted
+ * @returns {string} formatted string for DataTables to show the number
+ * @dtopt Callbacks
+ *
+ * @example
+ * $(document).ready( function() {
+ * $('#example').dataTable( {
+ * "fnFormatNumber": function ( iIn ) {
+ * if ( iIn < 1000 ) {
+ * return iIn;
+ * } else {
+ * var
+ * s=(iIn+""),
+ * a=s.split(""), out="",
+ * iLen=s.length;
+ *
+ * for ( var i=0 ; i<iLen ; i++ ) {
+ * if ( i%3 === 0 && i !== 0 ) {
+ * out = "'"+out;
+ * }
+ * out = a[iLen-i-1]+out;
+ * }
+ * }
+ * return out;
+ * };
+ * } );
+ * } );
+ */
+ "fnFormatNumber": function (iIn) {
+ if (iIn < 1000) {
+ // A small optimisation for what is likely to be the majority of use cases
+ return iIn;
+ }
+
+ var s = (iIn + ""), a = s.split(""), out = "", iLen = s.length;
+
+ for (var i = 0; i < iLen; i++) {
+ if (i % 3 === 0 && i !== 0) {
+ out = this.oLanguage.sInfoThousands + out;
+ }
+ out = a[iLen - i - 1] + out;
+ }
+ return out;
+ },
+
+
+ /**
+ * This function is called on every 'draw' event, and allows you to
+ * dynamically modify the header row. This can be used to calculate and
+ * display useful information about the table.
+ * @type function
+ * @param {node} nHead "TR" element for the header
+ * @param {array} aData Full table data (as derived from the original HTML)
+ * @param {int} iStart Index for the current display starting point in the
+ * display array
+ * @param {int} iEnd Index for the current display ending point in the
+ * display array
+ * @param {array int} aiDisplay Index array to translate the visual position
+ * to the full data array
+ * @dtopt Callbacks
+ *
+ * @example
+ * $(document).ready( function() {
+ * $('#example').dataTable( {
+ * "fnHeaderCallback": function( nHead, aData, iStart, iEnd, aiDisplay ) {
+ * nHead.getElementsByTagName('th')[0].innerHTML = "Displaying "+(iEnd-iStart)+" records";
+ * }
+ * } );
+ * } )
+ */
+ "fnHeaderCallback": null,
+
+
+ /**
+ * The information element can be used to convey information about the current
+ * state of the table. Although the internationalisation options presented by
+ * DataTables are quite capable of dealing with most customisations, there may
+ * be times where you wish to customise the string further. This callback
+ * allows you to do exactly that.
+ * @type function
+ * @param {object} oSettings DataTables settings object
+ * @param {int} iStart Starting position in data for the draw
+ * @param {int} iEnd End position in data for the draw
+ * @param {int} iMax Total number of rows in the table (regardless of
+ * filtering)
+ * @param {int} iTotal Total number of rows in the data set, after filtering
+ * @param {string} sPre The string that DataTables has formatted using it's
+ * own rules
+ * @returns {string} The string to be displayed in the information element.
+ * @dtopt Callbacks
+ *
+ * @example
+ * $('#example').dataTable( {
+ * "fnInfoCallback": function( oSettings, iStart, iEnd, iMax, iTotal, sPre ) {
+ * return iStart +" to "+ iEnd;
+ * }
+ * } );
+ */
+ "fnInfoCallback": null,
+
+
+ /**
+ * Called when the table has been initialised. Normally DataTables will
+ * initialise sequentially and there will be no need for this function,
+ * however, this does not hold true when using external language information
+ * since that is obtained using an async XHR call.
+ * @type function
+ * @param {object} oSettings DataTables settings object
+ * @param {object} json The JSON object request from the server - only
+ * present if client-side Ajax sourced data is used
+ * @dtopt Callbacks
+ *
+ * @example
+ * $(document).ready( function() {
+ * $('#example').dataTable( {
+ * "fnInitComplete": function(oSettings, json) {
+ * alert( 'DataTables has finished its initialisation.' );
+ * }
+ * } );
+ * } )
+ */
+ "fnInitComplete": null,
+
+
+ /**
+ * Called at the very start of each table draw and can be used to cancel the
+ * draw by returning false, any other return (including undefined) results in
+ * the full draw occurring).
+ * @type function
+ * @param {object} oSettings DataTables settings object
+ * @returns {boolean} False will cancel the draw, anything else (including no
+ * return) will allow it to complete.
+ * @dtopt Callbacks
+ *
+ * @example
+ * $(document).ready( function() {
+ * $('#example').dataTable( {
+ * "fnPreDrawCallback": function( oSettings ) {
+ * if ( $('#test').val() == 1 ) {
+ * return false;
+ * }
+ * }
+ * } );
+ * } );
+ */
+ "fnPreDrawCallback": null,
+
+
+ /**
+ * This function allows you to 'post process' each row after it have been
+ * generated for each table draw, but before it is rendered on screen. This
+ * function might be used for setting the row class name etc.
+ * @type function
+ * @param {node} nRow "TR" element for the current row
+ * @param {array} aData Raw data array for this row
+ * @param {int} iDisplayIndex The display index for the current table draw
+ * @param {int} iDisplayIndexFull The index of the data in the full list of
+ * rows (after filtering)
+ * @dtopt Callbacks
+ *
+ * @example
+ * $(document).ready( function() {
+ * $('#example').dataTable( {
+ * "fnRowCallback": function( nRow, aData, iDisplayIndex, iDisplayIndexFull ) {
+ * // Bold the grade for all 'A' grade browsers
+ * if ( aData[4] == "A" )
+ * {
+ * $('td:eq(4)', nRow).html( 'A ' );
+ * }
+ * }
+ * } );
+ * } );
+ */
+ "fnRowCallback": null,
+
+
+ /**
+ * This parameter allows you to override the default function which obtains
+ * the data from the server ($.getJSON) so something more suitable for your
+ * application. For example you could use POST data, or pull information from
+ * a Gears or AIR database.
+ * @type function
+ * @member
+ * @param {string} sSource HTTP source to obtain the data from (sAjaxSource)
+ * @param {array} aoData A key/value pair object containing the data to send
+ * to the server
+ * @param {function} fnCallback to be called on completion of the data get
+ * process that will draw the data on the page.
+ * @param {object} oSettings DataTables settings object
+ * @dtopt Callbacks
+ * @dtopt Server-side
+ *
+ * @example
+ * // POST data to server
+ * $(document).ready( function() {
+ * $('#example').dataTable( {
+ * "bProcessing": true,
+ * "bServerSide": true,
+ * "sAjaxSource": "xhr.php",
+ * "fnServerData": function ( sSource, aoData, fnCallback, oSettings ) {
+ * oSettings.jqXHR = $.ajax( {
+ * "dataType": 'json',
+ * "type": "POST",
+ * "url": sSource,
+ * "data": aoData,
+ * "success": fnCallback
+ * } );
+ * }
+ * } );
+ * } );
+ */
+ "fnServerData": function (sUrl, aoData, fnCallback, oSettings) {
+ oSettings.jqXHR = $.ajax({
+ "url": sUrl,
+ "data": aoData,
+ "success": function (json) {
+ if (json.sError) {
+ oSettings.oApi._fnLog(oSettings, 0, json.sError);
+ }
+
+ $(oSettings.oInstance).trigger('xhr', [oSettings, json]);
+ fnCallback(json);
+ },
+ "dataType": "json",
+ "cache": false,
+ "type": oSettings.sServerMethod,
+ "error": function (xhr, error, thrown) {
+ if (error == "parsererror") {
+ oSettings.oApi._fnLog(oSettings, 0, "DataTables warning: JSON data from " +
+ "server could not be parsed. This is caused by a JSON formatting error.");
+ }
+ }
+ });
+ },
+
+
+ /**
+ * It is often useful to send extra data to the server when making an Ajax
+ * request - for example custom filtering information, and this callback
+ * function makes it trivial to send extra information to the server. The
+ * passed in parameter is the data set that has been constructed by
+ * DataTables, and you can add to this or modify it as you require.
+ * @type function
+ * @param {array} aoData Data array (array of objects which are name/value
+ * pairs) that has been constructed by DataTables and will be sent to the
+ * server. In the case of Ajax sourced data with server-side processing
+ * this will be an empty array, for server-side processing there will be a
+ * significant number of parameters!
+ * @returns {undefined} Ensure that you modify the aoData array passed in,
+ * as this is passed by reference.
+ * @dtopt Callbacks
+ * @dtopt Server-side
+ *
+ * @example
+ * $(document).ready( function() {
+ * $('#example').dataTable( {
+ * "bProcessing": true,
+ * "bServerSide": true,
+ * "sAjaxSource": "scripts/server_processing.php",
+ * "fnServerParams": function ( aoData ) {
+ * aoData.push( { "name": "more_data", "value": "my_value" } );
+ * }
+ * } );
+ * } );
+ */
+ "fnServerParams": null,
+
+
+ /**
+ * Load the table state. With this function you can define from where, and how, the
+ * state of a table is loaded. By default DataTables will load from its state saving
+ * cookie, but you might wish to use local storage (HTML5) or a server-side database.
+ * @type function
+ * @member
+ * @param {object} oSettings DataTables settings object
+ * @return {object} The DataTables state object to be loaded
+ * @dtopt Callbacks
+ *
+ * @example
+ * $(document).ready( function() {
+ * $('#example').dataTable( {
+ * "bStateSave": true,
+ * "fnStateLoad": function (oSettings) {
+ * var o;
+ *
+ * // Send an Ajax request to the server to get the data. Note that
+ * // this is a synchronous request.
+ * $.ajax( {
+ * "url": "/state_load",
+ * "async": false,
+ * "dataType": "json",
+ * "success": function (json) {
+ * o = json;
+ * }
+ * } );
+ *
+ * return o;
+ * }
+ * } );
+ * } );
+ */
+ "fnStateLoad": function (oSettings) {
+ var sData = this.oApi._fnReadCookie(oSettings.sCookiePrefix + oSettings.sInstance);
+ var oData;
+
+ try {
+ oData = (typeof $.parseJSON === 'function') ?
+ $.parseJSON(sData) : eval('(' + sData + ')');
+ } catch (e) {
+ oData = null;
+ }
+
+ return oData;
+ },
+
+
+ /**
+ * Callback which allows modification of the saved state prior to loading that state.
+ * This callback is called when the table is loading state from the stored data, but
+ * prior to the settings object being modified by the saved state. Note that for
+ * plug-in authors, you should use the 'stateLoadParams' event to load parameters for
+ * a plug-in.
+ * @type function
+ * @param {object} oSettings DataTables settings object
+ * @param {object} oData The state object that is to be loaded
+ * @dtopt Callbacks
+ *
+ * @example
+ * // Remove a saved filter, so filtering is never loaded
+ * $(document).ready( function() {
+ * $('#example').dataTable( {
+ * "bStateSave": true,
+ * "fnStateLoadParams": function (oSettings, oData) {
+ * oData.oSearch.sSearch = "";
+ * }
+ * } );
+ * } );
+ *
+ * @example
+ * // Disallow state loading by returning false
+ * $(document).ready( function() {
+ * $('#example').dataTable( {
+ * "bStateSave": true,
+ * "fnStateLoadParams": function (oSettings, oData) {
+ * return false;
+ * }
+ * } );
+ * } );
+ */
+ "fnStateLoadParams": null,
+
+
+ /**
+ * Callback that is called when the state has been loaded from the state saving method
+ * and the DataTables settings object has been modified as a result of the loaded state.
+ * @type function
+ * @param {object} oSettings DataTables settings object
+ * @param {object} oData The state object that was loaded
+ * @dtopt Callbacks
+ *
+ * @example
+ * // Show an alert with the filtering value that was saved
+ * $(document).ready( function() {
+ * $('#example').dataTable( {
+ * "bStateSave": true,
+ * "fnStateLoaded": function (oSettings, oData) {
+ * alert( 'Saved filter was: '+oData.oSearch.sSearch );
+ * }
+ * } );
+ * } );
+ */
+ "fnStateLoaded": null,
+
+
+ /**
+ * Save the table state. This function allows you to define where and how the state
+ * information for the table is stored - by default it will use a cookie, but you
+ * might want to use local storage (HTML5) or a server-side database.
+ * @type function
+ * @member
+ * @param {object} oSettings DataTables settings object
+ * @param {object} oData The state object to be saved
+ * @dtopt Callbacks
+ *
+ * @example
+ * $(document).ready( function() {
+ * $('#example').dataTable( {
+ * "bStateSave": true,
+ * "fnStateSave": function (oSettings, oData) {
+ * // Send an Ajax request to the server with the state object
+ * $.ajax( {
+ * "url": "/state_save",
+ * "data": oData,
+ * "dataType": "json",
+ * "method": "POST"
+ * "success": function () {}
+ * } );
+ * }
+ * } );
+ * } );
+ */
+ "fnStateSave": function (oSettings, oData) {
+ this.oApi._fnCreateCookie(
+ oSettings.sCookiePrefix + oSettings.sInstance,
+ this.oApi._fnJsonString(oData),
+ oSettings.iCookieDuration,
+ oSettings.sCookiePrefix,
+ oSettings.fnCookieCallback
+ );
+ },
+
+
+ /**
+ * Callback which allows modification of the state to be saved. Called when the table
+ * has changed state a new state save is required. This method allows modification of
+ * the state saving object prior to actually doing the save, including addition or
+ * other state properties or modification. Note that for plug-in authors, you should
+ * use the 'stateSaveParams' event to save parameters for a plug-in.
+ * @type function
+ * @param {object} oSettings DataTables settings object
+ * @param {object} oData The state object to be saved
+ * @dtopt Callbacks
+ *
+ * @example
+ * // Remove a saved filter, so filtering is never saved
+ * $(document).ready( function() {
+ * $('#example').dataTable( {
+ * "bStateSave": true,
+ * "fnStateSaveParams": function (oSettings, oData) {
+ * oData.oSearch.sSearch = "";
+ * }
+ * } );
+ * } );
+ */
+ "fnStateSaveParams": null,
+
+
+ /**
+ * Duration of the cookie which is used for storing session information. This
+ * value is given in seconds.
+ * @type int
+ * @default 7200 (2 hours)
+ * @dtopt Options
+ *
+ * @example
+ * $(document).ready( function() {
+ * $('#example').dataTable( {
+ * "iCookieDuration": 60*60*24; // 1 day
+ * } );
+ * } )
+ */
+ "iCookieDuration": 7200,
+
+
+ /**
+ * When enabled DataTables will not make a request to the server for the first
+ * page draw - rather it will use the data already on the page (no sorting etc
+ * will be applied to it), thus saving on an XHR at load time. iDeferLoading
+ * is used to indicate that deferred loading is required, but it is also used
+ * to tell DataTables how many records there are in the full table (allowing
+ * the information element and pagination to be displayed correctly). In the case
+ * where a filtering is applied to the table on initial load, this can be
+ * indicated by giving the parameter as an array, where the first element is
+ * the number of records available after filtering and the second element is the
+ * number of records without filtering (allowing the table information element
+ * to be shown correctly).
+ * @type int | array
+ * @default null
+ * @dtopt Options
+ *
+ * @example
+ * // 57 records available in the table, no filtering applied
+ * $(document).ready( function() {
+ * $('#example').dataTable( {
+ * "bServerSide": true,
+ * "sAjaxSource": "scripts/server_processing.php",
+ * "iDeferLoading": 57
+ * } );
+ * } );
+ *
+ * @example
+ * // 57 records after filtering, 100 without filtering (an initial filter applied)
+ * $(document).ready( function() {
+ * $('#example').dataTable( {
+ * "bServerSide": true,
+ * "sAjaxSource": "scripts/server_processing.php",
+ * "iDeferLoading": [ 57, 100 ],
+ * "oSearch": {
+ * "sSearch": "my_filter"
+ * }
+ * } );
+ * } );
+ */
+ "iDeferLoading": null,
+
+
+ /**
+ * Number of rows to display on a single page when using pagination. If
+ * feature enabled (bLengthChange) then the end user will be able to override
+ * this to a custom setting using a pop-up menu.
+ * @type int
+ * @default 10
+ * @dtopt Options
+ *
+ * @example
+ * $(document).ready( function() {
+ * $('#example').dataTable( {
+ * "iDisplayLength": 50
+ * } );
+ * } )
+ */
+ "iDisplayLength": 10,
+
+
+ /**
+ * Define the starting point for data display when using DataTables with
+ * pagination. Note that this parameter is the number of records, rather than
+ * the page number, so if you have 10 records per page and want to start on
+ * the third page, it should be "20".
+ * @type int
+ * @default 0
+ * @dtopt Options
+ *
+ * @example
+ * $(document).ready( function() {
+ * $('#example').dataTable( {
+ * "iDisplayStart": 20
+ * } );
+ * } )
+ */
+ "iDisplayStart": 0,
+
+
+ /**
+ * The scroll gap is the amount of scrolling that is left to go before
+ * DataTables will load the next 'page' of data automatically. You typically
+ * want a gap which is big enough that the scrolling will be smooth for the
+ * user, while not so large that it will load more data than need.
+ * @type int
+ * @default 100
+ * @dtopt Options
+ *
+ * @example
+ * $(document).ready( function() {
+ * $('#example').dataTable( {
+ * "bScrollInfinite": true,
+ * "bScrollCollapse": true,
+ * "sScrollY": "200px",
+ * "iScrollLoadGap": 50
+ * } );
+ * } );
+ */
+ "iScrollLoadGap": 100,
+
+
+ /**
+ * By default DataTables allows keyboard navigation of the table (sorting, paging,
+ * and filtering) by adding a tabindex attribute to the required elements. This
+ * allows you to tab through the controls and press the enter key to activate them.
+ * The tabindex is default 0, meaning that the tab follows the flow of the document.
+ * You can overrule this using this parameter if you wish. Use a value of -1 to
+ * disable built-in keyboard navigation.
+ * @type int
+ * @default 0
+ * @dtopt Options
+ *
+ * @example
+ * $(document).ready( function() {
+ * $('#example').dataTable( {
+ * "iTabIndex": 1
+ * } );
+ * } );
+ */
+ "iTabIndex": 0,
+
+
+ /**
+ * All strings that DataTables uses in the user interface that it creates
+ * are defined in this object, allowing you to modified them individually or
+ * completely replace them all as required.
+ * @namespace
+ */
+ "oLanguage": {
+ /**
+ * Strings that are used for WAI-ARIA labels and controls only (these are not
+ * actually visible on the page, but will be read by screenreaders, and thus
+ * must be internationalised as well).
+ * @namespace
+ */
+ "oAria": {
+ /**
+ * ARIA label that is added to the table headers when the column may be
+ * sorted ascending by activing the column (click or return when focused).
+ * Note that the column header is prefixed to this string.
+ * @type string
+ * @default : activate to sort column ascending
+ * @dtopt Language
+ *
+ * @example
+ * $(document).ready( function() {
+ * $('#example').dataTable( {
+ * "oLanguage": {
+ * "oAria": {
+ * "sSortAscending": " - click/return to sort ascending"
+ * }
+ * }
+ * } );
+ * } );
+ */
+ "sSortAscending": ": activate to sort column ascending",
+
+ /**
+ * ARIA label that is added to the table headers when the column may be
+ * sorted descending by activing the column (click or return when focused).
+ * Note that the column header is prefixed to this string.
+ * @type string
+ * @default : activate to sort column ascending
+ * @dtopt Language
+ *
+ * @example
+ * $(document).ready( function() {
+ * $('#example').dataTable( {
+ * "oLanguage": {
+ * "oAria": {
+ * "sSortDescending": " - click/return to sort descending"
+ * }
+ * }
+ * } );
+ * } );
+ */
+ "sSortDescending": ": activate to sort column descending"
+ },
+
+ /**
+ * Pagination string used by DataTables for the two built-in pagination
+ * control types ("two_button" and "full_numbers")
+ * @namespace
+ */
+ "oPaginate": {
+ /**
+ * Text to use when using the 'full_numbers' type of pagination for the
+ * button to take the user to the first page.
+ * @type string
+ * @default First
+ * @dtopt Language
+ *
+ * @example
+ * $(document).ready( function() {
+ * $('#example').dataTable( {
+ * "oLanguage": {
+ * "oPaginate": {
+ * "sFirst": "First page"
+ * }
+ * }
+ * } );
+ * } );
+ */
+ "sFirst": "First",
+
+
+ /**
+ * Text to use when using the 'full_numbers' type of pagination for the
+ * button to take the user to the last page.
+ * @type string
+ * @default Last
+ * @dtopt Language
+ *
+ * @example
+ * $(document).ready( function() {
+ * $('#example').dataTable( {
+ * "oLanguage": {
+ * "oPaginate": {
+ * "sLast": "Last page"
+ * }
+ * }
+ * } );
+ * } );
+ */
+ "sLast": "Last",
+
+
+ /**
+ * Text to use when using the 'full_numbers' type of pagination for the
+ * button to take the user to the next page.
+ * @type string
+ * @default Next
+ * @dtopt Language
+ *
+ * @example
+ * $(document).ready( function() {
+ * $('#example').dataTable( {
+ * "oLanguage": {
+ * "oPaginate": {
+ * "sNext": "Next page"
+ * }
+ * }
+ * } );
+ * } );
+ */
+ "sNext": "Next",
+
+
+ /**
+ * Text to use when using the 'full_numbers' type of pagination for the
+ * button to take the user to the previous page.
+ * @type string
+ * @default Previous
+ * @dtopt Language
+ *
+ * @example
+ * $(document).ready( function() {
+ * $('#example').dataTable( {
+ * "oLanguage": {
+ * "oPaginate": {
+ * "sPrevious": "Previous page"
+ * }
+ * }
+ * } );
+ * } );
+ */
+ "sPrevious": "Previous"
+ },
+
+ /**
+ * This string is shown in preference to sZeroRecords when the table is
+ * empty of data (regardless of filtering). Note that this is an optional
+ * parameter - if it is not given, the value of sZeroRecords will be used
+ * instead (either the default or given value).
+ * @type string
+ * @default No data available in table
+ * @dtopt Language
+ *
+ * @example
+ * $(document).ready( function() {
+ * $('#example').dataTable( {
+ * "oLanguage": {
+ * "sEmptyTable": "No data available in table"
+ * }
+ * } );
+ * } );
+ */
+ "sEmptyTable": "No data available in table",
+
+
+ /**
+ * This string gives information to the end user about the information that
+ * is current on display on the page. The _START_, _END_ and _TOTAL_
+ * variables are all dynamically replaced as the table display updates, and
+ * can be freely moved or removed as the language requirements change.
+ * @type string
+ * @default Showing _START_ to _END_ of _TOTAL_ entries
+ * @dtopt Language
+ *
+ * @example
+ * $(document).ready( function() {
+ * $('#example').dataTable( {
+ * "oLanguage": {
+ * "sInfo": "Got a total of _TOTAL_ entries to show (_START_ to _END_)"
+ * }
+ * } );
+ * } );
+ */
+ "sInfo": "Showing _START_ to _END_ of _TOTAL_ entries",
+
+
+ /**
+ * Display information string for when the table is empty. Typically the
+ * format of this string should match sInfo.
+ * @type string
+ * @default Showing 0 to 0 of 0 entries
+ * @dtopt Language
+ *
+ * @example
+ * $(document).ready( function() {
+ * $('#example').dataTable( {
+ * "oLanguage": {
+ * "sInfoEmpty": "No entries to show"
+ * }
+ * } );
+ * } );
+ */
+ "sInfoEmpty": "Showing 0 to 0 of 0 entries",
+
+
+ /**
+ * When a user filters the information in a table, this string is appended
+ * to the information (sInfo) to give an idea of how strong the filtering
+ * is. The variable _MAX_ is dynamically updated.
+ * @type string
+ * @default (filtered from _MAX_ total entries)
+ * @dtopt Language
+ *
+ * @example
+ * $(document).ready( function() {
+ * $('#example').dataTable( {
+ * "oLanguage": {
+ * "sInfoFiltered": " - filtering from _MAX_ records"
+ * }
+ * } );
+ * } );
+ */
+ "sInfoFiltered": "(filtered from _MAX_ total entries)",
+
+
+ /**
+ * If can be useful to append extra information to the info string at times,
+ * and this variable does exactly that. This information will be appended to
+ * the sInfo (sInfoEmpty and sInfoFiltered in whatever combination they are
+ * being used) at all times.
+ * @type string
+ * @default Empty string
+ * @dtopt Language
+ *
+ * @example
+ * $(document).ready( function() {
+ * $('#example').dataTable( {
+ * "oLanguage": {
+ * "sInfoPostFix": "All records shown are derived from real information."
+ * }
+ * } );
+ * } );
+ */
+ "sInfoPostFix": "",
+
+
+ /**
+ * DataTables has a build in number formatter (fnFormatNumber) which is used
+ * to format large numbers that are used in the table information. By
+ * default a comma is used, but this can be trivially changed to any
+ * character you wish with this parameter.
+ * @type string
+ * @default ,
+ * @dtopt Language
+ *
+ * @example
+ * $(document).ready( function() {
+ * $('#example').dataTable( {
+ * "oLanguage": {
+ * "sInfoThousands": "'"
+ * }
+ * } );
+ * } );
+ */
+ "sInfoThousands": ",",
+
+
+ /**
+ * Detail the action that will be taken when the drop down menu for the
+ * pagination length option is changed. The '_MENU_' variable is replaced
+ * with a default select list of 10, 25, 50 and 100, and can be replaced
+ * with a custom select box if required.
+ * @type string
+ * @default Show _MENU_ entries
+ * @dtopt Language
+ *
+ * @example
+ * // Language change only
+ * $(document).ready( function() {
+ * $('#example').dataTable( {
+ * "oLanguage": {
+ * "sLengthMenu": "Display _MENU_ records"
+ * }
+ * } );
+ * } );
+ *
+ * @example
+ * // Language and options change
+ * $(document).ready( function() {
+ * $('#example').dataTable( {
+ * "oLanguage": {
+ * "sLengthMenu": 'Display '+
+ * '10 '+
+ * '20 '+
+ * '30 '+
+ * '40 '+
+ * '50 '+
+ * 'All '+
+ * ' records'
+ * }
+ * } );
+ * } );
+ */
+ "sLengthMenu": "Show _MENU_ entries",
+
+
+ /**
+ * When using Ajax sourced data and during the first draw when DataTables is
+ * gathering the data, this message is shown in an empty row in the table to
+ * indicate to the end user the the data is being loaded. Note that this
+ * parameter is not used when loading data by server-side processing, just
+ * Ajax sourced data with client-side processing.
+ * @type string
+ * @default Loading...
+ * @dtopt Language
+ *
+ * @example
+ * $(document).ready( function() {
+ * $('#example').dataTable( {
+ * "oLanguage": {
+ * "sLoadingRecords": "Please wait - loading..."
+ * }
+ * } );
+ * } );
+ */
+ "sLoadingRecords": "Loading...",
+
+
+ /**
+ * Text which is displayed when the table is processing a user action
+ * (usually a sort command or similar).
+ * @type string
+ * @default Processing...
+ * @dtopt Language
+ *
+ * @example
+ * $(document).ready( function() {
+ * $('#example').dataTable( {
+ * "oLanguage": {
+ * "sProcessing": "DataTables is currently busy"
+ * }
+ * } );
+ * } );
+ */
+ "sProcessing": "Processing...",
+
+
+ /**
+ * Details the actions that will be taken when the user types into the
+ * filtering input text box. The variable "_INPUT_", if used in the string,
+ * is replaced with the HTML text box for the filtering input allowing
+ * control over where it appears in the string. If "_INPUT_" is not given
+ * then the input box is appended to the string automatically.
+ * @type string
+ * @default Search:
+ * @dtopt Language
+ *
+ * @example
+ * // Input text box will be appended at the end automatically
+ * $(document).ready( function() {
+ * $('#example').dataTable( {
+ * "oLanguage": {
+ * "sSearch": "Filter records:"
+ * }
+ * } );
+ * } );
+ *
+ * @example
+ * // Specify where the filter should appear
+ * $(document).ready( function() {
+ * $('#example').dataTable( {
+ * "oLanguage": {
+ * "sSearch": "Apply filter _INPUT_ to table"
+ * }
+ * } );
+ * } );
+ */
+ "sSearch": "Search:",
+
+
+ /**
+ * All of the language information can be stored in a file on the
+ * server-side, which DataTables will look up if this parameter is passed.
+ * It must store the URL of the language file, which is in a JSON format,
+ * and the object has the same properties as the oLanguage object in the
+ * initialiser object (i.e. the above parameters). Please refer to one of
+ * the example language files to see how this works in action.
+ * @type string
+ * @default Empty string - i.e. disabled
+ * @dtopt Language
+ *
+ * @example
+ * $(document).ready( function() {
+ * $('#example').dataTable( {
+ * "oLanguage": {
+ * "sUrl": "http://www.sprymedia.co.uk/dataTables/lang.txt"
+ * }
+ * } );
+ * } );
+ */
+ "sUrl": "",
+
+
+ /**
+ * Text shown inside the table records when the is no information to be
+ * displayed after filtering. sEmptyTable is shown when there is simply no
+ * information in the table at all (regardless of filtering).
+ * @type string
+ * @default No matching records found
+ * @dtopt Language
+ *
+ * @example
+ * $(document).ready( function() {
+ * $('#example').dataTable( {
+ * "oLanguage": {
+ * "sZeroRecords": "No records to display"
+ * }
+ * } );
+ * } );
+ */
+ "sZeroRecords": "No matching records found"
+ },
+
+
+ /**
+ * This parameter allows you to have define the global filtering state at
+ * initialisation time. As an object the "sSearch" parameter must be
+ * defined, but all other parameters are optional. When "bRegex" is true,
+ * the search string will be treated as a regular expression, when false
+ * (default) it will be treated as a straight string. When "bSmart"
+ * DataTables will use it's smart filtering methods (to word match at
+ * any point in the data), when false this will not be done.
+ * @namespace
+ * @extends DataTable.models.oSearch
+ * @dtopt Options
+ *
+ * @example
+ * $(document).ready( function() {
+ * $('#example').dataTable( {
+ * "oSearch": {"sSearch": "Initial search"}
+ * } );
+ * } )
+ */
+ "oSearch": $.extend({}, DataTable.models.oSearch),
+
+
+ /**
+ * By default DataTables will look for the property 'aaData' when obtaining
+ * data from an Ajax source or for server-side processing - this parameter
+ * allows that property to be changed. You can use Javascript dotted object
+ * notation to get a data source for multiple levels of nesting.
+ * @type string
+ * @default aaData
+ * @dtopt Options
+ * @dtopt Server-side
+ *
+ * @example
+ * // Get data from { "data": [...] }
+ * $(document).ready( function() {
+ * var oTable = $('#example').dataTable( {
+ * "sAjaxSource": "sources/data.txt",
+ * "sAjaxDataProp": "data"
+ * } );
+ * } );
+ *
+ * @example
+ * // Get data from { "data": { "inner": [...] } }
+ * $(document).ready( function() {
+ * var oTable = $('#example').dataTable( {
+ * "sAjaxSource": "sources/data.txt",
+ * "sAjaxDataProp": "data.inner"
+ * } );
+ * } );
+ */
+ "sAjaxDataProp": "aaData",
+
+
+ /**
+ * You can instruct DataTables to load data from an external source using this
+ * parameter (use aData if you want to pass data in you already have). Simply
+ * provide a url a JSON object can be obtained from. This object must include
+ * the parameter 'aaData' which is the data source for the table.
+ * @type string
+ * @default null
+ * @dtopt Options
+ * @dtopt Server-side
+ *
+ * @example
+ * $(document).ready( function() {
+ * $('#example').dataTable( {
+ * "sAjaxSource": "http://www.sprymedia.co.uk/dataTables/json.php"
+ * } );
+ * } )
+ */
+ "sAjaxSource": null,
+
+
+ /**
+ * This parameter can be used to override the default prefix that DataTables
+ * assigns to a cookie when state saving is enabled.
+ * @type string
+ * @default SpryMedia_DataTables_
+ * @dtopt Options
+ *
+ * @example
+ * $(document).ready( function() {
+ * $('#example').dataTable( {
+ * "sCookiePrefix": "my_datatable_",
+ * } );
+ * } );
+ */
+ "sCookiePrefix": "SpryMedia_DataTables_",
+
+
+ /**
+ * This initialisation variable allows you to specify exactly where in the
+ * DOM you want DataTables to inject the various controls it adds to the page
+ * (for example you might want the pagination controls at the top of the
+ * table). DIV elements (with or without a custom class) can also be added to
+ * aid styling. The follow syntax is used:
+ *
+ * The following options are allowed:
+ *
+ * 'l' - Length changing 'f' - Filtering input
+ * 't' - The table!
+ * 'i' - Information
+ * 'p' - Pagination
+ * 'r' - pRocessing
+ *
+ *
+ * The following constants are allowed:
+ *
+ * 'H' - jQueryUI theme "header" classes ('fg-toolbar ui-widget-header ui-corner-tl ui-corner-tr ui-helper-clearfix')
+ * 'F' - jQueryUI theme "footer" classes ('fg-toolbar ui-widget-header ui-corner-bl ui-corner-br ui-helper-clearfix')
+ *
+ *
+ * The following syntax is expected:
+ *
+ * '<' and '>' - div elements
+ * '<"class" and '>' - div with a class
+ * '<"#id" and '>' - div with an ID
+ *
+ *
+ * Examples:
+ *
+ * '<"wrapper"flipt>'
+ * '<lf<t>ip>'
+ *
+ *
+ *
+ * @type string
+ * @default lfrtip (when bJQueryUI is false) or
+ * <"H"lfr>t<"F"ip> (when bJQueryUI is true)
+ * @dtopt Options
+ *
+ * @example
+ * $(document).ready( function() {
+ * $('#example').dataTable( {
+ * "sDom": '<"top"i>rt<"bottom"flp><"clear">'
+ * } );
+ * } );
+ */
+ "sDom": "lfrtip",
+
+
+ /**
+ * DataTables features two different built-in pagination interaction methods
+ * ('two_button' or 'full_numbers') which present different page controls to
+ * the end user. Further methods can be added using the API (see below).
+ * @type string
+ * @default two_button
+ * @dtopt Options
+ *
+ * @example
+ * $(document).ready( function() {
+ * $('#example').dataTable( {
+ * "sPaginationType": "full_numbers"
+ * } );
+ * } )
+ */
+ "sPaginationType": "two_button",
+
+
+ /**
+ * Enable horizontal scrolling. When a table is too wide to fit into a certain
+ * layout, or you have a large number of columns in the table, you can enable
+ * x-scrolling to show the table in a viewport, which can be scrolled. This
+ * property can be any CSS unit, or a number (in which case it will be treated
+ * as a pixel measurement).
+ * @type string
+ * @default blank string - i.e. disabled
+ * @dtopt Features
+ *
+ * @example
+ * $(document).ready( function() {
+ * $('#example').dataTable( {
+ * "sScrollX": "100%",
+ * "bScrollCollapse": true
+ * } );
+ * } );
+ */
+ "sScrollX": "",
+
+
+ /**
+ * This property can be used to force a DataTable to use more width than it
+ * might otherwise do when x-scrolling is enabled. For example if you have a
+ * table which requires to be well spaced, this parameter is useful for
+ * "over-sizing" the table, and thus forcing scrolling. This property can by
+ * any CSS unit, or a number (in which case it will be treated as a pixel
+ * measurement).
+ * @type string
+ * @default blank string - i.e. disabled
+ * @dtopt Options
+ *
+ * @example
+ * $(document).ready( function() {
+ * $('#example').dataTable( {
+ * "sScrollX": "100%",
+ * "sScrollXInner": "110%"
+ * } );
+ * } );
+ */
+ "sScrollXInner": "",
+
+
+ /**
+ * Enable vertical scrolling. Vertical scrolling will constrain the DataTable
+ * to the given height, and enable scrolling for any data which overflows the
+ * current viewport. This can be used as an alternative to paging to display
+ * a lot of data in a small area (although paging and scrolling can both be
+ * enabled at the same time). This property can be any CSS unit, or a number
+ * (in which case it will be treated as a pixel measurement).
+ * @type string
+ * @default blank string - i.e. disabled
+ * @dtopt Features
+ *
+ * @example
+ * $(document).ready( function() {
+ * $('#example').dataTable( {
+ * "sScrollY": "200px",
+ * "bPaginate": false
+ * } );
+ * } );
+ */
+ "sScrollY": "",
+
+
+ /**
+ * Set the HTTP method that is used to make the Ajax call for server-side
+ * processing or Ajax sourced data.
+ * @type string
+ * @default GET
+ * @dtopt Options
+ * @dtopt Server-side
+ *
+ * @example
+ * $(document).ready( function() {
+ * $('#example').dataTable( {
+ * "bServerSide": true,
+ * "sAjaxSource": "scripts/post.php",
+ * "sServerMethod": "POST"
+ * } );
+ * } );
+ */
+ "sServerMethod": "GET"
+ };
+
+
+
+ /**
+ * Column options that can be given to DataTables at initialisation time.
+ * @namespace
+ */
+ DataTable.defaults.columns = {
+ /**
+ * Allows a column's sorting to take multiple columns into account when
+ * doing a sort. For example first name / last name columns make sense to
+ * do a multi-column sort over the two columns.
+ * @type array
+ * @default null Takes the value of the column index automatically
+ * @dtopt Columns
+ *
+ * @example
+ * // Using aoColumnDefs
+ * $(document).ready( function() {
+ * $('#example').dataTable( {
+ * "aoColumnDefs": [
+ * { "aDataSort": [ 0, 1 ], "aTargets": [ 0 ] },
+ * { "aDataSort": [ 1, 0 ], "aTargets": [ 1 ] },
+ * { "aDataSort": [ 2, 3, 4 ], "aTargets": [ 2 ] }
+ * ]
+ * } );
+ * } );
+ *
+ * @example
+ * // Using aoColumns
+ * $(document).ready( function() {
+ * $('#example').dataTable( {
+ * "aoColumns": [
+ * { "aDataSort": [ 0, 1 ] },
+ * { "aDataSort": [ 1, 0 ] },
+ * { "aDataSort": [ 2, 3, 4 ] },
+ * null,
+ * null
+ * ]
+ * } );
+ * } );
+ */
+ "aDataSort": null,
+
+
+ /**
+ * You can control the default sorting direction, and even alter the behaviour
+ * of the sort handler (i.e. only allow ascending sorting etc) using this
+ * parameter.
+ * @type array
+ * @default [ 'asc', 'desc' ]
+ * @dtopt Columns
+ *
+ * @example
+ * // Using aoColumnDefs
+ * $(document).ready( function() {
+ * $('#example').dataTable( {
+ * "aoColumnDefs": [
+ * { "asSorting": [ "asc" ], "aTargets": [ 1 ] },
+ * { "asSorting": [ "desc", "asc", "asc" ], "aTargets": [ 2 ] },
+ * { "asSorting": [ "desc" ], "aTargets": [ 3 ] }
+ * ]
+ * } );
+ * } );
+ *
+ * @example
+ * // Using aoColumns
+ * $(document).ready( function() {
+ * $('#example').dataTable( {
+ * "aoColumns": [
+ * null,
+ * { "asSorting": [ "asc" ] },
+ * { "asSorting": [ "desc", "asc", "asc" ] },
+ * { "asSorting": [ "desc" ] },
+ * null
+ * ]
+ * } );
+ * } );
+ */
+ "asSorting": ['asc', 'desc'],
+
+
+ /**
+ * Enable or disable filtering on the data in this column.
+ * @type boolean
+ * @default true
+ * @dtopt Columns
+ *
+ * @example
+ * // Using aoColumnDefs
+ * $(document).ready( function() {
+ * $('#example').dataTable( {
+ * "aoColumnDefs": [
+ * { "bSearchable": false, "aTargets": [ 0 ] }
+ * ] } );
+ * } );
+ *
+ * @example
+ * // Using aoColumns
+ * $(document).ready( function() {
+ * $('#example').dataTable( {
+ * "aoColumns": [
+ * { "bSearchable": false },
+ * null,
+ * null,
+ * null,
+ * null
+ * ] } );
+ * } );
+ */
+ "bSearchable": true,
+
+
+ /**
+ * Enable or disable sorting on this column.
+ * @type boolean
+ * @default true
+ * @dtopt Columns
+ *
+ * @example
+ * // Using aoColumnDefs
+ * $(document).ready( function() {
+ * $('#example').dataTable( {
+ * "aoColumnDefs": [
+ * { "bSortable": false, "aTargets": [ 0 ] }
+ * ] } );
+ * } );
+ *
+ * @example
+ * // Using aoColumns
+ * $(document).ready( function() {
+ * $('#example').dataTable( {
+ * "aoColumns": [
+ * { "bSortable": false },
+ * null,
+ * null,
+ * null,
+ * null
+ * ] } );
+ * } );
+ */
+ "bSortable": true,
+
+
+ /**
+ * When using fnRender() for a column, you may wish to use the original data
+ * (before rendering) for sorting and filtering (the default is to used the
+ * rendered data that the user can see). This may be useful for dates etc.
+ *
+ * *NOTE* This property is now deprecated, and it is suggested that you use
+ * mData and / or mRender to render data for the DataTable.
+ * @type boolean
+ * @default true
+ * @dtopt Columns
+ * @deprecated
+ *
+ * @example
+ * // Using aoColumnDefs
+ * $(document).ready( function() {
+ * $('#example').dataTable( {
+ * "aoColumnDefs": [
+ * {
+ * "fnRender": function ( oObj ) {
+ * return oObj.aData[0] +' '+ oObj.aData[3];
+ * },
+ * "bUseRendered": false,
+ * "aTargets": [ 0 ]
+ * }
+ * ]
+ * } );
+ * } );
+ *
+ * @example
+ * // Using aoColumns
+ * $(document).ready( function() {
+ * $('#example').dataTable( {
+ * "aoColumns": [
+ * {
+ * "fnRender": function ( oObj ) {
+ * return oObj.aData[0] +' '+ oObj.aData[3];
+ * },
+ * "bUseRendered": false
+ * },
+ * null,
+ * null,
+ * null,
+ * null
+ * ]
+ * } );
+ * } );
+ */
+ "bUseRendered": true,
+
+
+ /**
+ * Enable or disable the display of this column.
+ * @type boolean
+ * @default true
+ * @dtopt Columns
+ *
+ * @example
+ * // Using aoColumnDefs
+ * $(document).ready( function() {
+ * $('#example').dataTable( {
+ * "aoColumnDefs": [
+ * { "bVisible": false, "aTargets": [ 0 ] }
+ * ] } );
+ * } );
+ *
+ * @example
+ * // Using aoColumns
+ * $(document).ready( function() {
+ * $('#example').dataTable( {
+ * "aoColumns": [
+ * { "bVisible": false },
+ * null,
+ * null,
+ * null,
+ * null
+ * ] } );
+ * } );
+ */
+ "bVisible": true,
+
+
+ /**
+ * Developer definable function that is called whenever a cell is created (Ajax source,
+ * etc) or processed for input (DOM source). This can be used as a compliment to fnRender
+ * allowing you to modify the DOM element (add background colour for example) when the
+ * element is available (since it is not when fnRender is called).
+ * @type function
+ * @param {element} nTd The TD node that has been created
+ * @param {*} sData The Data for the cell
+ * @param {array|object} oData The data for the whole row
+ * @param {int} iRow The row index for the aoData data store
+ * @param {int} iCol The column index for aoColumns
+ * @dtopt Columns
+ *
+ * @example
+ * $(document).ready( function() {
+ * $('#example').dataTable( {
+ * "aoColumnDefs": [ {
+ * "aTargets": [3],
+ * "fnCreatedCell": function (nTd, sData, oData, iRow, iCol) {
+ * if ( sData == "1.7" ) {
+ * $(nTd).css('color', 'blue')
+ * }
+ * }
+ * } ]
+ * });
+ * } );
+ */
+ "fnCreatedCell": null,
+
+
+ /**
+ * Custom display function that will be called for the display of each cell in
+ * this column.
+ * @type function
+ * @param {object} o Object with the following parameters:
+ * @param {int} o.iDataRow The row in aoData
+ * @param {int} o.iDataColumn The column in question
+ * @param {array} o.aData The data for the row in question
+ * @param {object} o.oSettings The settings object for this DataTables instance
+ * @param {object} o.mDataProp The data property used for this column
+ * @param {*} val The current cell value
+ * @returns {string} The string you which to use in the display
+ * @dtopt Columns
+ *
+ * @example
+ * // Using aoColumnDefs
+ * $(document).ready( function() {
+ * $('#example').dataTable( {
+ * "aoColumnDefs": [
+ * {
+ * "fnRender": function ( o, val ) {
+ * return o.aData[0] +' '+ o.aData[3];
+ * },
+ * "aTargets": [ 0 ]
+ * }
+ * ]
+ * } );
+ * } );
+ *
+ * @example
+ * // Using aoColumns
+ * $(document).ready( function() {
+ * $('#example').dataTable( {
+ * "aoColumns": [
+ * { "fnRender": function ( o, val ) {
+ * return o.aData[0] +' '+ o.aData[3];
+ * } },
+ * null,
+ * null,
+ * null,
+ * null
+ * ]
+ * } );
+ * } );
+ */
+ "fnRender": null,
+
+
+ /**
+ * The column index (starting from 0!) that you wish a sort to be performed
+ * upon when this column is selected for sorting. This can be used for sorting
+ * on hidden columns for example.
+ * @type int
+ * @default -1 Use automatically calculated column index
+ * @dtopt Columns
+ *
+ * @example
+ * // Using aoColumnDefs
+ * $(document).ready( function() {
+ * $('#example').dataTable( {
+ * "aoColumnDefs": [
+ * { "iDataSort": 1, "aTargets": [ 0 ] }
+ * ]
+ * } );
+ * } );
+ *
+ * @example
+ * // Using aoColumns
+ * $(document).ready( function() {
+ * $('#example').dataTable( {
+ * "aoColumns": [
+ * { "iDataSort": 1 },
+ * null,
+ * null,
+ * null,
+ * null
+ * ]
+ * } );
+ * } );
+ */
+ "iDataSort": -1,
+
+
+ /**
+ * This parameter has been replaced by mData in DataTables to ensure naming
+ * consistency. mDataProp can still be used, as there is backwards compatibility
+ * in DataTables for this option, but it is strongly recommended that you use
+ * mData in preference to mDataProp.
+ * @name DataTable.defaults.columns.mDataProp
+ */
+
+
+ /**
+ * This property can be used to read data from any JSON data source property,
+ * including deeply nested objects / properties. mData can be given in a
+ * number of different ways which effect its behaviour:
+ *
+ * integer - treated as an array index for the data source. This is the
+ * default that DataTables uses (incrementally increased for each column).
+ * string - read an object property from the data source. Note that you can
+ * use Javascript dotted notation to read deep properties / arrays from the
+ * data source.
+ * null - the sDefaultContent option will be used for the cell (null
+ * by default, so you will need to specify the default content you want -
+ * typically an empty string). This can be useful on generated columns such
+ * as edit / delete action columns.
+ * function - the function given will be executed whenever DataTables
+ * needs to set or get the data for a cell in the column. The function
+ * takes three parameters:
+ *
+ * {array|object} The data source for the row
+ * {string} The type call data requested - this will be 'set' when
+ * setting data or 'filter', 'display', 'type', 'sort' or undefined when
+ * gathering data. Note that when undefined is given for the type
+ * DataTables expects to get the raw data for the object back
+ * {*} Data to set when the second parameter is 'set'.
+ *
+ * The return value from the function is not required when 'set' is the type
+ * of call, but otherwise the return is what will be used for the data
+ * requested.
+ *
+ *
+ * Note that prior to DataTables 1.9.2 mData was called mDataProp. The name change
+ * reflects the flexibility of this property and is consistent with the naming of
+ * mRender. If 'mDataProp' is given, then it will still be used by DataTables, as
+ * it automatically maps the old name to the new if required.
+ * @type string|int|function|null
+ * @default null Use automatically calculated column index
+ * @dtopt Columns
+ *
+ * @example
+ * // Read table data from objects
+ * $(document).ready( function() {
+ * var oTable = $('#example').dataTable( {
+ * "sAjaxSource": "sources/deep.txt",
+ * "aoColumns": [
+ * { "mData": "engine" },
+ * { "mData": "browser" },
+ * { "mData": "platform.inner" },
+ * { "mData": "platform.details.0" },
+ * { "mData": "platform.details.1" }
+ * ]
+ * } );
+ * } );
+ *
+ * @example
+ * // Using mData as a function to provide different information for
+ * // sorting, filtering and display. In this case, currency (price)
+ * $(document).ready( function() {
+ * var oTable = $('#example').dataTable( {
+ * "aoColumnDefs": [ {
+ * "aTargets": [ 0 ],
+ * "mData": function ( source, type, val ) {
+ * if (type === 'set') {
+ * source.price = val;
+ * // Store the computed dislay and filter values for efficiency
+ * source.price_display = val=="" ? "" : "$"+numberFormat(val);
+ * source.price_filter = val=="" ? "" : "$"+numberFormat(val)+" "+val;
+ * return;
+ * }
+ * else if (type === 'display') {
+ * return source.price_display;
+ * }
+ * else if (type === 'filter') {
+ * return source.price_filter;
+ * }
+ * // 'sort', 'type' and undefined all just use the integer
+ * return source.price;
+ * }
+ * } ]
+ * } );
+ * } );
+ */
+ "mData": null,
+
+
+ /**
+ * This property is the rendering partner to mData and it is suggested that
+ * when you want to manipulate data for display (including filtering, sorting etc)
+ * but not altering the underlying data for the table, use this property. mData
+ * can actually do everything this property can and more, but this parameter is
+ * easier to use since there is no 'set' option. Like mData is can be given
+ * in a number of different ways to effect its behaviour, with the addition of
+ * supporting array syntax for easy outputting of arrays (including arrays of
+ * objects):
+ *
+ * integer - treated as an array index for the data source. This is the
+ * default that DataTables uses (incrementally increased for each column).
+ * string - read an object property from the data source. Note that you can
+ * use Javascript dotted notation to read deep properties / arrays from the
+ * data source and also array brackets to indicate that the data reader should
+ * loop over the data source array. When characters are given between the array
+ * brackets, these characters are used to join the data source array together.
+ * For example: "accounts[, ].name" would result in a comma separated list with
+ * the 'name' value from the 'accounts' array of objects.
+ * function - the function given will be executed whenever DataTables
+ * needs to set or get the data for a cell in the column. The function
+ * takes three parameters:
+ *
+ * {array|object} The data source for the row (based on mData)
+ * {string} The type call data requested - this will be 'filter', 'display',
+ * 'type' or 'sort'.
+ * {array|object} The full data source for the row (not based on mData)
+ *
+ * The return value from the function is what will be used for the data
+ * requested.
+ *
+ * @type string|int|function|null
+ * @default null Use mData
+ * @dtopt Columns
+ *
+ * @example
+ * // Create a comma separated list from an array of objects
+ * $(document).ready( function() {
+ * var oTable = $('#example').dataTable( {
+ * "sAjaxSource": "sources/deep.txt",
+ * "aoColumns": [
+ * { "mData": "engine" },
+ * { "mData": "browser" },
+ * {
+ * "mData": "platform",
+ * "mRender": "[, ].name"
+ * }
+ * ]
+ * } );
+ * } );
+ *
+ * @example
+ * // Use as a function to create a link from the data source
+ * $(document).ready( function() {
+ * var oTable = $('#example').dataTable( {
+ * "aoColumnDefs": [
+ * {
+ * "aTargets": [ 0 ],
+ * "mData": "download_link",
+ * "mRender": function ( data, type, full ) {
+ * return 'Download ';
+ * }
+ * ]
+ * } );
+ * } );
+ */
+ "mRender": null,
+
+
+ /**
+ * Change the cell type created for the column - either TD cells or TH cells. This
+ * can be useful as TH cells have semantic meaning in the table body, allowing them
+ * to act as a header for a row (you may wish to add scope='row' to the TH elements).
+ * @type string
+ * @default td
+ * @dtopt Columns
+ *
+ * @example
+ * // Make the first column use TH cells
+ * $(document).ready( function() {
+ * var oTable = $('#example').dataTable( {
+ * "aoColumnDefs": [ {
+ * "aTargets": [ 0 ],
+ * "sCellType": "th"
+ * } ]
+ * } );
+ * } );
+ */
+ "sCellType": "td",
+
+
+ /**
+ * Class to give to each cell in this column.
+ * @type string
+ * @default Empty string
+ * @dtopt Columns
+ *
+ * @example
+ * // Using aoColumnDefs
+ * $(document).ready( function() {
+ * $('#example').dataTable( {
+ * "aoColumnDefs": [
+ * { "sClass": "my_class", "aTargets": [ 0 ] }
+ * ]
+ * } );
+ * } );
+ *
+ * @example
+ * // Using aoColumns
+ * $(document).ready( function() {
+ * $('#example').dataTable( {
+ * "aoColumns": [
+ * { "sClass": "my_class" },
+ * null,
+ * null,
+ * null,
+ * null
+ * ]
+ * } );
+ * } );
+ */
+ "sClass": "",
+
+ /**
+ * When DataTables calculates the column widths to assign to each column,
+ * it finds the longest string in each column and then constructs a
+ * temporary table and reads the widths from that. The problem with this
+ * is that "mmm" is much wider then "iiii", but the latter is a longer
+ * string - thus the calculation can go wrong (doing it properly and putting
+ * it into an DOM object and measuring that is horribly(!) slow). Thus as
+ * a "work around" we provide this option. It will append its value to the
+ * text that is found to be the longest string for the column - i.e. padding.
+ * Generally you shouldn't need this, and it is not documented on the
+ * general DataTables.net documentation
+ * @type string
+ * @default Empty string
+ * @dtopt Columns
+ *
+ * @example
+ * // Using aoColumns
+ * $(document).ready( function() {
+ * $('#example').dataTable( {
+ * "aoColumns": [
+ * null,
+ * null,
+ * null,
+ * {
+ * "sContentPadding": "mmm"
+ * }
+ * ]
+ * } );
+ * } );
+ */
+ "sContentPadding": "",
+
+
+ /**
+ * Allows a default value to be given for a column's data, and will be used
+ * whenever a null data source is encountered (this can be because mData
+ * is set to null, or because the data source itself is null).
+ * @type string
+ * @default null
+ * @dtopt Columns
+ *
+ * @example
+ * // Using aoColumnDefs
+ * $(document).ready( function() {
+ * $('#example').dataTable( {
+ * "aoColumnDefs": [
+ * {
+ * "mData": null,
+ * "sDefaultContent": "Edit",
+ * "aTargets": [ -1 ]
+ * }
+ * ]
+ * } );
+ * } );
+ *
+ * @example
+ * // Using aoColumns
+ * $(document).ready( function() {
+ * $('#example').dataTable( {
+ * "aoColumns": [
+ * null,
+ * null,
+ * null,
+ * {
+ * "mData": null,
+ * "sDefaultContent": "Edit"
+ * }
+ * ]
+ * } );
+ * } );
+ */
+ "sDefaultContent": null,
+
+
+ /**
+ * This parameter is only used in DataTables' server-side processing. It can
+ * be exceptionally useful to know what columns are being displayed on the
+ * client side, and to map these to database fields. When defined, the names
+ * also allow DataTables to reorder information from the server if it comes
+ * back in an unexpected order (i.e. if you switch your columns around on the
+ * client-side, your server-side code does not also need updating).
+ * @type string
+ * @default Empty string
+ * @dtopt Columns
+ *
+ * @example
+ * // Using aoColumnDefs
+ * $(document).ready( function() {
+ * $('#example').dataTable( {
+ * "aoColumnDefs": [
+ * { "sName": "engine", "aTargets": [ 0 ] },
+ * { "sName": "browser", "aTargets": [ 1 ] },
+ * { "sName": "platform", "aTargets": [ 2 ] },
+ * { "sName": "version", "aTargets": [ 3 ] },
+ * { "sName": "grade", "aTargets": [ 4 ] }
+ * ]
+ * } );
+ * } );
+ *
+ * @example
+ * // Using aoColumns
+ * $(document).ready( function() {
+ * $('#example').dataTable( {
+ * "aoColumns": [
+ * { "sName": "engine" },
+ * { "sName": "browser" },
+ * { "sName": "platform" },
+ * { "sName": "version" },
+ * { "sName": "grade" }
+ * ]
+ * } );
+ * } );
+ */
+ "sName": "",
+
+
+ /**
+ * Defines a data source type for the sorting which can be used to read
+ * real-time information from the table (updating the internally cached
+ * version) prior to sorting. This allows sorting to occur on user editable
+ * elements such as form inputs.
+ * @type string
+ * @default std
+ * @dtopt Columns
+ *
+ * @example
+ * // Using aoColumnDefs
+ * $(document).ready( function() {
+ * $('#example').dataTable( {
+ * "aoColumnDefs": [
+ * { "sSortDataType": "dom-text", "aTargets": [ 2, 3 ] },
+ * { "sType": "numeric", "aTargets": [ 3 ] },
+ * { "sSortDataType": "dom-select", "aTargets": [ 4 ] },
+ * { "sSortDataType": "dom-checkbox", "aTargets": [ 5 ] }
+ * ]
+ * } );
+ * } );
+ *
+ * @example
+ * // Using aoColumns
+ * $(document).ready( function() {
+ * $('#example').dataTable( {
+ * "aoColumns": [
+ * null,
+ * null,
+ * { "sSortDataType": "dom-text" },
+ * { "sSortDataType": "dom-text", "sType": "numeric" },
+ * { "sSortDataType": "dom-select" },
+ * { "sSortDataType": "dom-checkbox" }
+ * ]
+ * } );
+ * } );
+ */
+ "sSortDataType": "std",
+
+
+ /**
+ * The title of this column.
+ * @type string
+ * @default null Derived from the 'TH' value for this column in the
+ * original HTML table.
+ * @dtopt Columns
+ *
+ * @example
+ * // Using aoColumnDefs
+ * $(document).ready( function() {
+ * $('#example').dataTable( {
+ * "aoColumnDefs": [
+ * { "sTitle": "My column title", "aTargets": [ 0 ] }
+ * ]
+ * } );
+ * } );
+ *
+ * @example
+ * // Using aoColumns
+ * $(document).ready( function() {
+ * $('#example').dataTable( {
+ * "aoColumns": [
+ * { "sTitle": "My column title" },
+ * null,
+ * null,
+ * null,
+ * null
+ * ]
+ * } );
+ * } );
+ */
+ "sTitle": null,
+
+
+ /**
+ * The type allows you to specify how the data for this column will be sorted.
+ * Four types (string, numeric, date and html (which will strip HTML tags
+ * before sorting)) are currently available. Note that only date formats
+ * understood by Javascript's Date() object will be accepted as type date. For
+ * example: "Mar 26, 2008 5:03 PM". May take the values: 'string', 'numeric',
+ * 'date' or 'html' (by default). Further types can be adding through
+ * plug-ins.
+ * @type string
+ * @default null Auto-detected from raw data
+ * @dtopt Columns
+ *
+ * @example
+ * // Using aoColumnDefs
+ * $(document).ready( function() {
+ * $('#example').dataTable( {
+ * "aoColumnDefs": [
+ * { "sType": "html", "aTargets": [ 0 ] }
+ * ]
+ * } );
+ * } );
+ *
+ * @example
+ * // Using aoColumns
+ * $(document).ready( function() {
+ * $('#example').dataTable( {
+ * "aoColumns": [
+ * { "sType": "html" },
+ * null,
+ * null,
+ * null,
+ * null
+ * ]
+ * } );
+ * } );
+ */
+ "sType": null,
+
+
+ /**
+ * Defining the width of the column, this parameter may take any CSS value
+ * (3em, 20px etc). DataTables apples 'smart' widths to columns which have not
+ * been given a specific width through this interface ensuring that the table
+ * remains readable.
+ * @type string
+ * @default null Automatic
+ * @dtopt Columns
+ *
+ * @example
+ * // Using aoColumnDefs
+ * $(document).ready( function() {
+ * $('#example').dataTable( {
+ * "aoColumnDefs": [
+ * { "sWidth": "20%", "aTargets": [ 0 ] }
+ * ]
+ * } );
+ * } );
+ *
+ * @example
+ * // Using aoColumns
+ * $(document).ready( function() {
+ * $('#example').dataTable( {
+ * "aoColumns": [
+ * { "sWidth": "20%" },
+ * null,
+ * null,
+ * null,
+ * null
+ * ]
+ * } );
+ * } );
+ */
+ "sWidth": null
+ };
+
+
+
+ /**
+ * DataTables settings object - this holds all the information needed for a
+ * given table, including configuration, data and current application of the
+ * table options. DataTables does not have a single instance for each DataTable
+ * with the settings attached to that instance, but rather instances of the
+ * DataTable "class" are created on-the-fly as needed (typically by a
+ * $().dataTable() call) and the settings object is then applied to that
+ * instance.
+ *
+ * Note that this object is related to {@link DataTable.defaults} but this
+ * one is the internal data store for DataTables's cache of columns. It should
+ * NOT be manipulated outside of DataTables. Any configuration should be done
+ * through the initialisation options.
+ * @namespace
+ * @todo Really should attach the settings object to individual instances so we
+ * don't need to create new instances on each $().dataTable() call (if the
+ * table already exists). It would also save passing oSettings around and
+ * into every single function. However, this is a very significant
+ * architecture change for DataTables and will almost certainly break
+ * backwards compatibility with older installations. This is something that
+ * will be done in 2.0.
+ */
+ DataTable.models.oSettings = {
+ /**
+ * Primary features of DataTables and their enablement state.
+ * @namespace
+ */
+ "oFeatures": {
+
+ /**
+ * Flag to say if DataTables should automatically try to calculate the
+ * optimum table and columns widths (true) or not (false).
+ * Note that this parameter will be set by the initialisation routine. To
+ * set a default use {@link DataTable.defaults}.
+ * @type boolean
+ */
+ "bAutoWidth": null,
+
+ /**
+ * Delay the creation of TR and TD elements until they are actually
+ * needed by a driven page draw. This can give a significant speed
+ * increase for Ajax source and Javascript source data, but makes no
+ * difference at all fro DOM and server-side processing tables.
+ * Note that this parameter will be set by the initialisation routine. To
+ * set a default use {@link DataTable.defaults}.
+ * @type boolean
+ */
+ "bDeferRender": null,
+
+ /**
+ * Enable filtering on the table or not. Note that if this is disabled
+ * then there is no filtering at all on the table, including fnFilter.
+ * To just remove the filtering input use sDom and remove the 'f' option.
+ * Note that this parameter will be set by the initialisation routine. To
+ * set a default use {@link DataTable.defaults}.
+ * @type boolean
+ */
+ "bFilter": null,
+
+ /**
+ * Table information element (the 'Showing x of y records' div) enable
+ * flag.
+ * Note that this parameter will be set by the initialisation routine. To
+ * set a default use {@link DataTable.defaults}.
+ * @type boolean
+ */
+ "bInfo": null,
+
+ /**
+ * Present a user control allowing the end user to change the page size
+ * when pagination is enabled.
+ * Note that this parameter will be set by the initialisation routine. To
+ * set a default use {@link DataTable.defaults}.
+ * @type boolean
+ */
+ "bLengthChange": null,
+
+ /**
+ * Pagination enabled or not. Note that if this is disabled then length
+ * changing must also be disabled.
+ * Note that this parameter will be set by the initialisation routine. To
+ * set a default use {@link DataTable.defaults}.
+ * @type boolean
+ */
+ "bPaginate": null,
+
+ /**
+ * Processing indicator enable flag whenever DataTables is enacting a
+ * user request - typically an Ajax request for server-side processing.
+ * Note that this parameter will be set by the initialisation routine. To
+ * set a default use {@link DataTable.defaults}.
+ * @type boolean
+ */
+ "bProcessing": null,
+
+ /**
+ * Server-side processing enabled flag - when enabled DataTables will
+ * get all data from the server for every draw - there is no filtering,
+ * sorting or paging done on the client-side.
+ * Note that this parameter will be set by the initialisation routine. To
+ * set a default use {@link DataTable.defaults}.
+ * @type boolean
+ */
+ "bServerSide": null,
+
+ /**
+ * Sorting enablement flag.
+ * Note that this parameter will be set by the initialisation routine. To
+ * set a default use {@link DataTable.defaults}.
+ * @type boolean
+ */
+ "bSort": null,
+
+ /**
+ * Apply a class to the columns which are being sorted to provide a
+ * visual highlight or not. This can slow things down when enabled since
+ * there is a lot of DOM interaction.
+ * Note that this parameter will be set by the initialisation routine. To
+ * set a default use {@link DataTable.defaults}.
+ * @type boolean
+ */
+ "bSortClasses": null,
+
+ /**
+ * State saving enablement flag.
+ * Note that this parameter will be set by the initialisation routine. To
+ * set a default use {@link DataTable.defaults}.
+ * @type boolean
+ */
+ "bStateSave": null
+ },
+
+
+ /**
+ * Scrolling settings for a table.
+ * @namespace
+ */
+ "oScroll": {
+ /**
+ * Indicate if DataTables should be allowed to set the padding / margin
+ * etc for the scrolling header elements or not. Typically you will want
+ * this.
+ * Note that this parameter will be set by the initialisation routine. To
+ * set a default use {@link DataTable.defaults}.
+ * @type boolean
+ */
+ "bAutoCss": null,
+
+ /**
+ * When the table is shorter in height than sScrollY, collapse the
+ * table container down to the height of the table (when true).
+ * Note that this parameter will be set by the initialisation routine. To
+ * set a default use {@link DataTable.defaults}.
+ * @type boolean
+ */
+ "bCollapse": null,
+
+ /**
+ * Infinite scrolling enablement flag. Now deprecated in favour of
+ * using the Scroller plug-in.
+ * Note that this parameter will be set by the initialisation routine. To
+ * set a default use {@link DataTable.defaults}.
+ * @type boolean
+ */
+ "bInfinite": null,
+
+ /**
+ * Width of the scrollbar for the web-browser's platform. Calculated
+ * during table initialisation.
+ * @type int
+ * @default 0
+ */
+ "iBarWidth": 0,
+
+ /**
+ * Space (in pixels) between the bottom of the scrolling container and
+ * the bottom of the scrolling viewport before the next page is loaded
+ * when using infinite scrolling.
+ * Note that this parameter will be set by the initialisation routine. To
+ * set a default use {@link DataTable.defaults}.
+ * @type int
+ */
+ "iLoadGap": null,
+
+ /**
+ * Viewport width for horizontal scrolling. Horizontal scrolling is
+ * disabled if an empty string.
+ * Note that this parameter will be set by the initialisation routine. To
+ * set a default use {@link DataTable.defaults}.
+ * @type string
+ */
+ "sX": null,
+
+ /**
+ * Width to expand the table to when using x-scrolling. Typically you
+ * should not need to use this.
+ * Note that this parameter will be set by the initialisation routine. To
+ * set a default use {@link DataTable.defaults}.
+ * @type string
+ * @deprecated
+ */
+ "sXInner": null,
+
+ /**
+ * Viewport height for vertical scrolling. Vertical scrolling is disabled
+ * if an empty string.
+ * Note that this parameter will be set by the initialisation routine. To
+ * set a default use {@link DataTable.defaults}.
+ * @type string
+ */
+ "sY": null
+ },
+
+ /**
+ * Language information for the table.
+ * @namespace
+ * @extends DataTable.defaults.oLanguage
+ */
+ "oLanguage": {
+ /**
+ * Information callback function. See
+ * {@link DataTable.defaults.fnInfoCallback}
+ * @type function
+ * @default null
+ */
+ "fnInfoCallback": null
+ },
+
+ /**
+ * Browser support parameters
+ * @namespace
+ */
+ "oBrowser": {
+ /**
+ * Indicate if the browser incorrectly calculates width:100% inside a
+ * scrolling element (IE6/7)
+ * @type boolean
+ * @default false
+ */
+ "bScrollOversize": false
+ },
+
+ /**
+ * Array referencing the nodes which are used for the features. The
+ * parameters of this object match what is allowed by sDom - i.e.
+ *
+ * 'l' - Length changing
+ * 'f' - Filtering input
+ * 't' - The table!
+ * 'i' - Information
+ * 'p' - Pagination
+ * 'r' - pRocessing
+ *
+ * @type array
+ * @default []
+ */
+ "aanFeatures": [],
+
+ /**
+ * Store data information - see {@link DataTable.models.oRow} for detailed
+ * information.
+ * @type array
+ * @default []
+ */
+ "aoData": [],
+
+ /**
+ * Array of indexes which are in the current display (after filtering etc)
+ * @type array
+ * @default []
+ */
+ "aiDisplay": [],
+
+ /**
+ * Array of indexes for display - no filtering
+ * @type array
+ * @default []
+ */
+ "aiDisplayMaster": [],
+
+ /**
+ * Store information about each column that is in use
+ * @type array
+ * @default []
+ */
+ "aoColumns": [],
+
+ /**
+ * Store information about the table's header
+ * @type array
+ * @default []
+ */
+ "aoHeader": [],
+
+ /**
+ * Store information about the table's footer
+ * @type array
+ * @default []
+ */
+ "aoFooter": [],
+
+ /**
+ * Search data array for regular expression searching
+ * @type array
+ * @default []
+ */
+ "asDataSearch": [],
+
+ /**
+ * Store the applied global search information in case we want to force a
+ * research or compare the old search to a new one.
+ * Note that this parameter will be set by the initialisation routine. To
+ * set a default use {@link DataTable.defaults}.
+ * @namespace
+ * @extends DataTable.models.oSearch
+ */
+ "oPreviousSearch": {},
+
+ /**
+ * Store the applied search for each column - see
+ * {@link DataTable.models.oSearch} for the format that is used for the
+ * filtering information for each column.
+ * @type array
+ * @default []
+ */
+ "aoPreSearchCols": [],
+
+ /**
+ * Sorting that is applied to the table. Note that the inner arrays are
+ * used in the following manner:
+ *
+ * Index 0 - column number
+ * Index 1 - current sorting direction
+ * Index 2 - index of asSorting for this column
+ *
+ * Note that this parameter will be set by the initialisation routine. To
+ * set a default use {@link DataTable.defaults}.
+ * @type array
+ * @todo These inner arrays should really be objects
+ */
+ "aaSorting": null,
+
+ /**
+ * Sorting that is always applied to the table (i.e. prefixed in front of
+ * aaSorting).
+ * Note that this parameter will be set by the initialisation routine. To
+ * set a default use {@link DataTable.defaults}.
+ * @type array|null
+ * @default null
+ */
+ "aaSortingFixed": null,
+
+ /**
+ * Classes to use for the striping of a table.
+ * Note that this parameter will be set by the initialisation routine. To
+ * set a default use {@link DataTable.defaults}.
+ * @type array
+ * @default []
+ */
+ "asStripeClasses": null,
+
+ /**
+ * If restoring a table - we should restore its striping classes as well
+ * @type array
+ * @default []
+ */
+ "asDestroyStripes": [],
+
+ /**
+ * If restoring a table - we should restore its width
+ * @type int
+ * @default 0
+ */
+ "sDestroyWidth": 0,
+
+ /**
+ * Callback functions array for every time a row is inserted (i.e. on a draw).
+ * @type array
+ * @default []
+ */
+ "aoRowCallback": [],
+
+ /**
+ * Callback functions for the header on each draw.
+ * @type array
+ * @default []
+ */
+ "aoHeaderCallback": [],
+
+ /**
+ * Callback function for the footer on each draw.
+ * @type array
+ * @default []
+ */
+ "aoFooterCallback": [],
+
+ /**
+ * Array of callback functions for draw callback functions
+ * @type array
+ * @default []
+ */
+ "aoDrawCallback": [],
+
+ /**
+ * Array of callback functions for row created function
+ * @type array
+ * @default []
+ */
+ "aoRowCreatedCallback": [],
+
+ /**
+ * Callback functions for just before the table is redrawn. A return of
+ * false will be used to cancel the draw.
+ * @type array
+ * @default []
+ */
+ "aoPreDrawCallback": [],
+
+ /**
+ * Callback functions for when the table has been initialised.
+ * @type array
+ * @default []
+ */
+ "aoInitComplete": [],
+
+
+ /**
+ * Callbacks for modifying the settings to be stored for state saving, prior to
+ * saving state.
+ * @type array
+ * @default []
+ */
+ "aoStateSaveParams": [],
+
+ /**
+ * Callbacks for modifying the settings that have been stored for state saving
+ * prior to using the stored values to restore the state.
+ * @type array
+ * @default []
+ */
+ "aoStateLoadParams": [],
+
+ /**
+ * Callbacks for operating on the settings object once the saved state has been
+ * loaded
+ * @type array
+ * @default []
+ */
+ "aoStateLoaded": [],
+
+ /**
+ * Cache the table ID for quick access
+ * @type string
+ * @default Empty string
+ */
+ "sTableId": "",
+
+ /**
+ * The TABLE node for the main table
+ * @type node
+ * @default null
+ */
+ "nTable": null,
+
+ /**
+ * Permanent ref to the thead element
+ * @type node
+ * @default null
+ */
+ "nTHead": null,
+
+ /**
+ * Permanent ref to the tfoot element - if it exists
+ * @type node
+ * @default null
+ */
+ "nTFoot": null,
+
+ /**
+ * Permanent ref to the tbody element
+ * @type node
+ * @default null
+ */
+ "nTBody": null,
+
+ /**
+ * Cache the wrapper node (contains all DataTables controlled elements)
+ * @type node
+ * @default null
+ */
+ "nTableWrapper": null,
+
+ /**
+ * Indicate if when using server-side processing the loading of data
+ * should be deferred until the second draw.
+ * Note that this parameter will be set by the initialisation routine. To
+ * set a default use {@link DataTable.defaults}.
+ * @type boolean
+ * @default false
+ */
+ "bDeferLoading": false,
+
+ /**
+ * Indicate if all required information has been read in
+ * @type boolean
+ * @default false
+ */
+ "bInitialised": false,
+
+ /**
+ * Information about open rows. Each object in the array has the parameters
+ * 'nTr' and 'nParent'
+ * @type array
+ * @default []
+ */
+ "aoOpenRows": [],
+
+ /**
+ * Dictate the positioning of DataTables' control elements - see
+ * {@link DataTable.model.oInit.sDom}.
+ * Note that this parameter will be set by the initialisation routine. To
+ * set a default use {@link DataTable.defaults}.
+ * @type string
+ * @default null
+ */
+ "sDom": null,
+
+ /**
+ * Which type of pagination should be used.
+ * Note that this parameter will be set by the initialisation routine. To
+ * set a default use {@link DataTable.defaults}.
+ * @type string
+ * @default two_button
+ */
+ "sPaginationType": "two_button",
+
+ /**
+ * The cookie duration (for bStateSave) in seconds.
+ * Note that this parameter will be set by the initialisation routine. To
+ * set a default use {@link DataTable.defaults}.
+ * @type int
+ * @default 0
+ */
+ "iCookieDuration": 0,
+
+ /**
+ * The cookie name prefix.
+ * Note that this parameter will be set by the initialisation routine. To
+ * set a default use {@link DataTable.defaults}.
+ * @type string
+ * @default Empty string
+ */
+ "sCookiePrefix": "",
+
+ /**
+ * Callback function for cookie creation.
+ * Note that this parameter will be set by the initialisation routine. To
+ * set a default use {@link DataTable.defaults}.
+ * @type function
+ * @default null
+ */
+ "fnCookieCallback": null,
+
+ /**
+ * Array of callback functions for state saving. Each array element is an
+ * object with the following parameters:
+ *
+ * function:fn - function to call. Takes two parameters, oSettings
+ * and the JSON string to save that has been thus far created. Returns
+ * a JSON string to be inserted into a json object
+ * (i.e. '"param": [ 0, 1, 2]')
+ * string:sName - name of callback
+ *
+ * @type array
+ * @default []
+ */
+ "aoStateSave": [],
+
+ /**
+ * Array of callback functions for state loading. Each array element is an
+ * object with the following parameters:
+ *
+ * function:fn - function to call. Takes two parameters, oSettings
+ * and the object stored. May return false to cancel state loading
+ * string:sName - name of callback
+ *
+ * @type array
+ * @default []
+ */
+ "aoStateLoad": [],
+
+ /**
+ * State that was loaded from the cookie. Useful for back reference
+ * @type object
+ * @default null
+ */
+ "oLoadedState": null,
+
+ /**
+ * Source url for AJAX data for the table.
+ * Note that this parameter will be set by the initialisation routine. To
+ * set a default use {@link DataTable.defaults}.
+ * @type string
+ * @default null
+ */
+ "sAjaxSource": null,
+
+ /**
+ * Property from a given object from which to read the table data from. This
+ * can be an empty string (when not server-side processing), in which case
+ * it is assumed an an array is given directly.
+ * Note that this parameter will be set by the initialisation routine. To
+ * set a default use {@link DataTable.defaults}.
+ * @type string
+ */
+ "sAjaxDataProp": null,
+
+ /**
+ * Note if draw should be blocked while getting data
+ * @type boolean
+ * @default true
+ */
+ "bAjaxDataGet": true,
+
+ /**
+ * The last jQuery XHR object that was used for server-side data gathering.
+ * This can be used for working with the XHR information in one of the
+ * callbacks
+ * @type object
+ * @default null
+ */
+ "jqXHR": null,
+
+ /**
+ * Function to get the server-side data.
+ * Note that this parameter will be set by the initialisation routine. To
+ * set a default use {@link DataTable.defaults}.
+ * @type function
+ */
+ "fnServerData": null,
+
+ /**
+ * Functions which are called prior to sending an Ajax request so extra
+ * parameters can easily be sent to the server
+ * @type array
+ * @default []
+ */
+ "aoServerParams": [],
+
+ /**
+ * Send the XHR HTTP method - GET or POST (could be PUT or DELETE if
+ * required).
+ * Note that this parameter will be set by the initialisation routine. To
+ * set a default use {@link DataTable.defaults}.
+ * @type string
+ */
+ "sServerMethod": null,
+
+ /**
+ * Format numbers for display.
+ * Note that this parameter will be set by the initialisation routine. To
+ * set a default use {@link DataTable.defaults}.
+ * @type function
+ */
+ "fnFormatNumber": null,
+
+ /**
+ * List of options that can be used for the user selectable length menu.
+ * Note that this parameter will be set by the initialisation routine. To
+ * set a default use {@link DataTable.defaults}.
+ * @type array
+ * @default []
+ */
+ "aLengthMenu": null,
+
+ /**
+ * Counter for the draws that the table does. Also used as a tracker for
+ * server-side processing
+ * @type int
+ * @default 0
+ */
+ "iDraw": 0,
+
+ /**
+ * Indicate if a redraw is being done - useful for Ajax
+ * @type boolean
+ * @default false
+ */
+ "bDrawing": false,
+
+ /**
+ * Draw index (iDraw) of the last error when parsing the returned data
+ * @type int
+ * @default -1
+ */
+ "iDrawError": -1,
+
+ /**
+ * Paging display length
+ * @type int
+ * @default 10
+ */
+ "_iDisplayLength": 10,
+
+ /**
+ * Paging start point - aiDisplay index
+ * @type int
+ * @default 0
+ */
+ "_iDisplayStart": 0,
+
+ /**
+ * Paging end point - aiDisplay index. Use fnDisplayEnd rather than
+ * this property to get the end point
+ * @type int
+ * @default 10
+ * @private
+ */
+ "_iDisplayEnd": 10,
+
+ /**
+ * Server-side processing - number of records in the result set
+ * (i.e. before filtering), Use fnRecordsTotal rather than
+ * this property to get the value of the number of records, regardless of
+ * the server-side processing setting.
+ * @type int
+ * @default 0
+ * @private
+ */
+ "_iRecordsTotal": 0,
+
+ /**
+ * Server-side processing - number of records in the current display set
+ * (i.e. after filtering). Use fnRecordsDisplay rather than
+ * this property to get the value of the number of records, regardless of
+ * the server-side processing setting.
+ * @type boolean
+ * @default 0
+ * @private
+ */
+ "_iRecordsDisplay": 0,
+
+ /**
+ * Flag to indicate if jQuery UI marking and classes should be used.
+ * Note that this parameter will be set by the initialisation routine. To
+ * set a default use {@link DataTable.defaults}.
+ * @type boolean
+ */
+ "bJUI": null,
+
+ /**
+ * The classes to use for the table
+ * @type object
+ * @default {}
+ */
+ "oClasses": {},
+
+ /**
+ * Flag attached to the settings object so you can check in the draw
+ * callback if filtering has been done in the draw. Deprecated in favour of
+ * events.
+ * @type boolean
+ * @default false
+ * @deprecated
+ */
+ "bFiltered": false,
+
+ /**
+ * Flag attached to the settings object so you can check in the draw
+ * callback if sorting has been done in the draw. Deprecated in favour of
+ * events.
+ * @type boolean
+ * @default false
+ * @deprecated
+ */
+ "bSorted": false,
+
+ /**
+ * Indicate that if multiple rows are in the header and there is more than
+ * one unique cell per column, if the top one (true) or bottom one (false)
+ * should be used for sorting / title by DataTables.
+ * Note that this parameter will be set by the initialisation routine. To
+ * set a default use {@link DataTable.defaults}.
+ * @type boolean
+ */
+ "bSortCellsTop": null,
+
+ /**
+ * Initialisation object that is used for the table
+ * @type object
+ * @default null
+ */
+ "oInit": null,
+
+ /**
+ * Destroy callback functions - for plug-ins to attach themselves to the
+ * destroy so they can clean up markup and events.
+ * @type array
+ * @default []
+ */
+ "aoDestroyCallback": [],
+
+
+ /**
+ * Get the number of records in the current record set, before filtering
+ * @type function
+ */
+ "fnRecordsTotal": function () {
+ if (this.oFeatures.bServerSide) {
+ return parseInt(this._iRecordsTotal, 10);
+ } else {
+ return this.aiDisplayMaster.length;
+ }
+ },
+
+ /**
+ * Get the number of records in the current record set, after filtering
+ * @type function
+ */
+ "fnRecordsDisplay": function () {
+ if (this.oFeatures.bServerSide) {
+ return parseInt(this._iRecordsDisplay, 10);
+ } else {
+ return this.aiDisplay.length;
+ }
+ },
+
+ /**
+ * Set the display end point - aiDisplay index
+ * @type function
+ * @todo Should do away with _iDisplayEnd and calculate it on-the-fly here
+ */
+ "fnDisplayEnd": function () {
+ if (this.oFeatures.bServerSide) {
+ if (this.oFeatures.bPaginate === false || this._iDisplayLength == -1) {
+ return this._iDisplayStart + this.aiDisplay.length;
+ } else {
+ return Math.min(this._iDisplayStart + this._iDisplayLength,
+ this._iRecordsDisplay);
+ }
+ } else {
+ return this._iDisplayEnd;
+ }
+ },
+
+ /**
+ * The DataTables object for this table
+ * @type object
+ * @default null
+ */
+ "oInstance": null,
+
+ /**
+ * Unique identifier for each instance of the DataTables object. If there
+ * is an ID on the table node, then it takes that value, otherwise an
+ * incrementing internal counter is used.
+ * @type string
+ * @default null
+ */
+ "sInstance": null,
+
+ /**
+ * tabindex attribute value that is added to DataTables control elements, allowing
+ * keyboard navigation of the table and its controls.
+ */
+ "iTabIndex": 0,
+
+ /**
+ * DIV container for the footer scrolling table if scrolling
+ */
+ "nScrollHead": null,
+
+ /**
+ * DIV container for the footer scrolling table if scrolling
+ */
+ "nScrollFoot": null
+ };
+
+ /**
+ * Extension object for DataTables that is used to provide all extension options.
+ *
+ * Note that the DataTable.ext object is available through
+ * jQuery.fn.dataTable.ext where it may be accessed and manipulated. It is
+ * also aliased to jQuery.fn.dataTableExt for historic reasons.
+ * @namespace
+ * @extends DataTable.models.ext
+ */
+ DataTable.ext = $.extend(true, {}, DataTable.models.ext);
+
+ $.extend(DataTable.ext.oStdClasses, {
+ "sTable": "dataTable",
+
+ /* Two buttons buttons */
+ "sPagePrevEnabled": "paginate_enabled_previous",
+ "sPagePrevDisabled": "paginate_disabled_previous",
+ "sPageNextEnabled": "paginate_enabled_next",
+ "sPageNextDisabled": "paginate_disabled_next",
+ "sPageJUINext": "",
+ "sPageJUIPrev": "",
+
+ /* Full numbers paging buttons */
+ "sPageButton": "paginate_button",
+ "sPageButtonActive": "paginate_active",
+ "sPageButtonStaticDisabled": "paginate_button paginate_button_disabled",
+ "sPageFirst": "first",
+ "sPagePrevious": "previous",
+ "sPageNext": "next",
+ "sPageLast": "last",
+
+ /* Striping classes */
+ "sStripeOdd": "odd",
+ "sStripeEven": "even",
+
+ /* Empty row */
+ "sRowEmpty": "dataTables_empty",
+
+ /* Features */
+ "sWrapper": "dataTables_wrapper",
+ "sFilter": "dataTables_filter",
+ "sInfo": "dataTables_info",
+ "sPaging": "dataTables_paginate paging_", /* Note that the type is postfixed */
+ "sLength": "dataTables_length",
+ "sProcessing": "dataTables_processing",
+
+ /* Sorting */
+ "sSortAsc": "sorting_asc",
+ "sSortDesc": "sorting_desc",
+ "sSortable": "sorting", /* Sortable in both directions */
+ "sSortableAsc": "sorting_asc_disabled",
+ "sSortableDesc": "sorting_desc_disabled",
+ "sSortableNone": "sorting_disabled",
+ "sSortColumn": "sorting_", /* Note that an int is postfixed for the sorting order */
+ "sSortJUIAsc": "",
+ "sSortJUIDesc": "",
+ "sSortJUI": "",
+ "sSortJUIAscAllowed": "",
+ "sSortJUIDescAllowed": "",
+ "sSortJUIWrapper": "",
+ "sSortIcon": "",
+
+ /* Scrolling */
+ "sScrollWrapper": "dataTables_scroll",
+ "sScrollHead": "dataTables_scrollHead",
+ "sScrollHeadInner": "dataTables_scrollHeadInner",
+ "sScrollBody": "dataTables_scrollBody",
+ "sScrollFoot": "dataTables_scrollFoot",
+ "sScrollFootInner": "dataTables_scrollFootInner",
+
+ /* Misc */
+ "sFooterTH": "",
+ "sJUIHeader": "",
+ "sJUIFooter": ""
+ });
+
+
+ $.extend(DataTable.ext.oJUIClasses, DataTable.ext.oStdClasses, {
+ /* Two buttons buttons */
+ "sPagePrevEnabled": "fg-button ui-button ui-state-default ui-corner-left",
+ "sPagePrevDisabled": "fg-button ui-button ui-state-default ui-corner-left ui-state-disabled",
+ "sPageNextEnabled": "fg-button ui-button ui-state-default ui-corner-right",
+ "sPageNextDisabled": "fg-button ui-button ui-state-default ui-corner-right ui-state-disabled",
+ "sPageJUINext": "ui-icon ui-icon-circle-arrow-e",
+ "sPageJUIPrev": "ui-icon ui-icon-circle-arrow-w",
+
+ /* Full numbers paging buttons */
+ "sPageButton": "fg-button ui-button ui-state-default",
+ "sPageButtonActive": "fg-button ui-button ui-state-default ui-state-disabled",
+ "sPageButtonStaticDisabled": "fg-button ui-button ui-state-default ui-state-disabled",
+ "sPageFirst": "first ui-corner-tl ui-corner-bl",
+ "sPageLast": "last ui-corner-tr ui-corner-br",
+
+ /* Features */
+ "sPaging": "dataTables_paginate fg-buttonset ui-buttonset fg-buttonset-multi " +
+ "ui-buttonset-multi paging_", /* Note that the type is postfixed */
+
+ /* Sorting */
+ "sSortAsc": "ui-state-default",
+ "sSortDesc": "ui-state-default",
+ "sSortable": "ui-state-default",
+ "sSortableAsc": "ui-state-default",
+ "sSortableDesc": "ui-state-default",
+ "sSortableNone": "ui-state-default",
+ "sSortJUIAsc": "css_right ui-icon ui-icon-triangle-1-n",
+ "sSortJUIDesc": "css_right ui-icon ui-icon-triangle-1-s",
+ "sSortJUI": "css_right ui-icon ui-icon-carat-2-n-s",
+ "sSortJUIAscAllowed": "css_right ui-icon ui-icon-carat-1-n",
+ "sSortJUIDescAllowed": "css_right ui-icon ui-icon-carat-1-s",
+ "sSortJUIWrapper": "DataTables_sort_wrapper",
+ "sSortIcon": "DataTables_sort_icon",
+
+ /* Scrolling */
+ "sScrollHead": "dataTables_scrollHead ui-state-default",
+ "sScrollFoot": "dataTables_scrollFoot ui-state-default",
+
+ /* Misc */
+ "sFooterTH": "ui-state-default",
+ "sJUIHeader": "fg-toolbar ui-toolbar ui-widget-header ui-corner-tl ui-corner-tr ui-helper-clearfix",
+ "sJUIFooter": "fg-toolbar ui-toolbar ui-widget-header ui-corner-bl ui-corner-br ui-helper-clearfix"
+ });
+
+
+ /*
+ * Variable: oPagination
+ * Purpose:
+ * Scope: jQuery.fn.dataTableExt
+ */
+ $.extend(DataTable.ext.oPagination, {
+ /*
+ * Variable: two_button
+ * Purpose: Standard two button (forward/back) pagination
+ * Scope: jQuery.fn.dataTableExt.oPagination
+ */
+ "two_button": {
+ /*
+ * Function: oPagination.two_button.fnInit
+ * Purpose: Initialise dom elements required for pagination with forward/back buttons only
+ * Returns: -
+ * Inputs: object:oSettings - dataTables settings object
+ * node:nPaging - the DIV which contains this pagination control
+ * function:fnCallbackDraw - draw function which must be called on update
+ */
+ "fnInit": function (oSettings, nPaging, fnCallbackDraw) {
+ var oLang = oSettings.oLanguage.oPaginate;
+ var oClasses = oSettings.oClasses;
+ var fnClickHandler = function (e) {
+ if (oSettings.oApi._fnPageChange(oSettings, e.data.action)) {
+ fnCallbackDraw(oSettings);
+ }
+ };
+
+ var sAppend = (!oSettings.bJUI) ?
+ '' + oLang.sPrevious + ' ' +
+ '' + oLang.sNext + ' '
+ :
+ '' + oLang.sFirst + ' ' +
+ '' + oLang.sPrevious + ' ' +
+ '' + oLang.sNext + ' ' +
+ '' + oLang.sLast + ' '
+ );
+ var els = $('a', nPaging);
+ var nFirst = els[0],
+ nPrev = els[1],
+ nNext = els[2],
+ nLast = els[3];
+
+ oSettings.oApi._fnBindAction(nFirst, { action: "first" }, fnClickHandler);
+ oSettings.oApi._fnBindAction(nPrev, { action: "previous" }, fnClickHandler);
+ oSettings.oApi._fnBindAction(nNext, { action: "next" }, fnClickHandler);
+ oSettings.oApi._fnBindAction(nLast, { action: "last" }, fnClickHandler);
+
+ /* ID the first elements only */
+ if (!oSettings.aanFeatures.p) {
+ nPaging.id = oSettings.sTableId + '_paginate';
+ nFirst.id = oSettings.sTableId + '_first';
+ nPrev.id = oSettings.sTableId + '_previous';
+ nNext.id = oSettings.sTableId + '_next';
+ nLast.id = oSettings.sTableId + '_last';
+ }
+ },
+
+ /*
+ * Function: oPagination.full_numbers.fnUpdate
+ * Purpose: Update the list of page buttons shows
+ * Returns: -
+ * Inputs: object:oSettings - dataTables settings object
+ * function:fnCallbackDraw - draw function to call on page change
+ */
+ "fnUpdate": function (oSettings, fnCallbackDraw) {
+ if (!oSettings.aanFeatures.p) {
+ return;
+ }
+
+ var iPageCount = DataTable.ext.oPagination.iFullNumbersShowPages;
+ var iPageCountHalf = Math.floor(iPageCount / 2);
+ var iPages = Math.ceil((oSettings.fnRecordsDisplay()) / oSettings._iDisplayLength);
+ var iCurrentPage = Math.ceil(oSettings._iDisplayStart / oSettings._iDisplayLength) + 1;
+ var sList = "";
+ var iStartButton, iEndButton, i, iLen;
+ var oClasses = oSettings.oClasses;
+ var anButtons, anStatic, nPaginateList;
+ var an = oSettings.aanFeatures.p;
+ var fnBind = function (j) {
+ oSettings.oApi._fnBindAction(this, { "page": j + iStartButton - 1 }, function (e) {
+ /* Use the information in the element to jump to the required page */
+ oSettings.oApi._fnPageChange(oSettings, e.data.page);
+ fnCallbackDraw(oSettings);
+ e.preventDefault();
+ });
+ };
+
+ /* Pages calculation */
+ if (oSettings._iDisplayLength === -1) {
+ iStartButton = 1;
+ iEndButton = 1;
+ iCurrentPage = 1;
+ }
+ else if (iPages < iPageCount) {
+ iStartButton = 1;
+ iEndButton = iPages;
+ }
+ else if (iCurrentPage <= iPageCountHalf) {
+ iStartButton = 1;
+ iEndButton = iPageCount;
+ }
+ else if (iCurrentPage >= (iPages - iPageCountHalf)) {
+ iStartButton = iPages - iPageCount + 1;
+ iEndButton = iPages;
+ }
+ else {
+ iStartButton = iCurrentPage - Math.ceil(iPageCount / 2) + 1;
+ iEndButton = iStartButton + iPageCount - 1;
+ }
+
+
+ /* Build the dynamic list */
+ for (i = iStartButton; i <= iEndButton; i++) {
+ sList += (iCurrentPage !== i) ?
+ '' + oSettings.fnFormatNumber(i) + ' ' :
+ '' + oSettings.fnFormatNumber(i) + ' ';
+ }
+
+ /* Loop over each instance of the pager */
+ for (i = 0, iLen = an.length; i < iLen; i++) {
+ if (an[i].childNodes.length === 0) {
+ continue;
+ }
+
+ /* Build up the dynamic list first - html and listeners */
+ $('span:eq(0)', an[i])
+ .html(sList)
+ .children('a').each(fnBind);
+
+ /* Update the permanent button's classes */
+ anButtons = an[i].getElementsByTagName('a');
+ anStatic = [
+ anButtons[0], anButtons[1],
+ anButtons[anButtons.length - 2], anButtons[anButtons.length - 1]
+ ];
+
+ $(anStatic).removeClass(oClasses.sPageButton + " " + oClasses.sPageButtonActive + " " + oClasses.sPageButtonStaticDisabled);
+ $([anStatic[0], anStatic[1]]).addClass(
+ (iCurrentPage == 1) ?
+ oClasses.sPageButtonStaticDisabled :
+ oClasses.sPageButton
+ );
+ $([anStatic[2], anStatic[3]]).addClass(
+ (iPages === 0 || iCurrentPage === iPages || oSettings._iDisplayLength === -1) ?
+ oClasses.sPageButtonStaticDisabled :
+ oClasses.sPageButton
+ );
+ }
+ }
+ }
+ });
+
+ $.extend(DataTable.ext.oSort, {
+ /*
+ * text sorting
+ */
+ "string-pre": function (a) {
+ if (typeof a != 'string') {
+ a = (a !== null && a.toString) ? a.toString() : '';
+ }
+ return a.toLowerCase();
+ },
+
+ "string-asc": function (x, y) {
+ return ((x < y) ? -1 : ((x > y) ? 1 : 0));
+ },
+
+ "string-desc": function (x, y) {
+ return ((x < y) ? 1 : ((x > y) ? -1 : 0));
+ },
+
+
+ /*
+ * html sorting (ignore html tags)
+ */
+ "html-pre": function (a) {
+ return a.replace(/<.*?>/g, "").toLowerCase();
+ },
+
+ "html-asc": function (x, y) {
+ return ((x < y) ? -1 : ((x > y) ? 1 : 0));
+ },
+
+ "html-desc": function (x, y) {
+ return ((x < y) ? 1 : ((x > y) ? -1 : 0));
+ },
+
+
+ /*
+ * date sorting
+ */
+ "date-pre": function (a) {
+ var x = Date.parse(a);
+
+ if (isNaN(x) || x === "") {
+ x = Date.parse("01/01/1970 00:00:00");
+ }
+ return x;
+ },
+
+ "date-asc": function (x, y) {
+ return x - y;
+ },
+
+ "date-desc": function (x, y) {
+ return y - x;
+ },
+
+
+ /*
+ * numerical sorting
+ */
+ "numeric-pre": function (a) {
+ return (a == "-" || a === "") ? 0 : a * 1;
+ },
+
+ "numeric-asc": function (x, y) {
+ return x - y;
+ },
+
+ "numeric-desc": function (x, y) {
+ return y - x;
+ }
+ });
+
+
+ $.extend(DataTable.ext.aTypes, [
+ /*
+ * Function: -
+ * Purpose: Check to see if a string is numeric
+ * Returns: string:'numeric' or null
+ * Inputs: mixed:sText - string to check
+ */
+ function (sData) {
+ /* Allow zero length strings as a number */
+ if (typeof sData === 'number') {
+ return 'numeric';
+ }
+ else if (typeof sData !== 'string') {
+ return null;
+ }
+
+ var sValidFirstChars = "0123456789-";
+ var sValidChars = "0123456789.";
+ var Char;
+ var bDecimal = false;
+
+ /* Check for a valid first char (no period and allow negatives) */
+ Char = sData.charAt(0);
+ if (sValidFirstChars.indexOf(Char) == -1) {
+ return null;
+ }
+
+ /* Check all the other characters are valid */
+ for (var i = 1; i < sData.length; i++) {
+ Char = sData.charAt(i);
+ if (sValidChars.indexOf(Char) == -1) {
+ return null;
+ }
+
+ /* Only allowed one decimal place... */
+ if (Char == ".") {
+ if (bDecimal) {
+ return null;
+ }
+ bDecimal = true;
+ }
+ }
+
+ return 'numeric';
+ },
+
+ /*
+ * Function: -
+ * Purpose: Check to see if a string is actually a formatted date
+ * Returns: string:'date' or null
+ * Inputs: string:sText - string to check
+ */
+ function (sData) {
+ var iParse = Date.parse(sData);
+ if ((iParse !== null && !isNaN(iParse)) || (typeof sData === 'string' && sData.length === 0)) {
+ return 'date';
+ }
+ return null;
+ },
+
+ /*
+ * Function: -
+ * Purpose: Check to see if a string should be treated as an HTML string
+ * Returns: string:'html' or null
+ * Inputs: string:sText - string to check
+ */
+ function (sData) {
+ if (typeof sData === 'string' && sData.indexOf('<') != -1 && sData.indexOf('>') != -1) {
+ return 'html';
+ }
+ return null;
+ }
+ ]);
+
+
+ // jQuery aliases
+ $.fn.DataTable = DataTable;
+ $.fn.dataTable = DataTable;
+ $.fn.dataTableSettings = DataTable.settings;
+ $.fn.dataTableExt = DataTable.ext;
+
+
+ // Information about events fired by DataTables - for documentation.
+ /**
+ * Draw event, fired whenever the table is redrawn on the page, at the same point as
+ * fnDrawCallback. This may be useful for binding events or performing calculations when
+ * the table is altered at all.
+ * @name DataTable#draw
+ * @event
+ * @param {event} e jQuery event object
+ * @param {object} o DataTables settings object {@link DataTable.models.oSettings}
+ */
+
+ /**
+ * Filter event, fired when the filtering applied to the table (using the build in global
+ * global filter, or column filters) is altered.
+ * @name DataTable#filter
+ * @event
+ * @param {event} e jQuery event object
+ * @param {object} o DataTables settings object {@link DataTable.models.oSettings}
+ */
+
+ /**
+ * Page change event, fired when the paging of the table is altered.
+ * @name DataTable#page
+ * @event
+ * @param {event} e jQuery event object
+ * @param {object} o DataTables settings object {@link DataTable.models.oSettings}
+ */
+
+ /**
+ * Sort event, fired when the sorting applied to the table is altered.
+ * @name DataTable#sort
+ * @event
+ * @param {event} e jQuery event object
+ * @param {object} o DataTables settings object {@link DataTable.models.oSettings}
+ */
+
+ /**
+ * DataTables initialisation complete event, fired when the table is fully drawn,
+ * including Ajax data loaded, if Ajax data is required.
+ * @name DataTable#init
+ * @event
+ * @param {event} e jQuery event object
+ * @param {object} oSettings DataTables settings object
+ * @param {object} json The JSON object request from the server - only
+ * present if client-side Ajax sourced data is used
+ */
+
+ /**
+ * State save event, fired when the table has changed state a new state save is required.
+ * This method allows modification of the state saving object prior to actually doing the
+ * save, including addition or other state properties (for plug-ins) or modification
+ * of a DataTables core property.
+ * @name DataTable#stateSaveParams
+ * @event
+ * @param {event} e jQuery event object
+ * @param {object} oSettings DataTables settings object
+ * @param {object} json The state information to be saved
+ */
+
+ /**
+ * State load event, fired when the table is loading state from the stored data, but
+ * prior to the settings object being modified by the saved state - allowing modification
+ * of the saved state is required or loading of state for a plug-in.
+ * @name DataTable#stateLoadParams
+ * @event
+ * @param {event} e jQuery event object
+ * @param {object} oSettings DataTables settings object
+ * @param {object} json The saved state information
+ */
+
+ /**
+ * State loaded event, fired when state has been loaded from stored data and the settings
+ * object has been modified by the loaded data.
+ * @name DataTable#stateLoaded
+ * @event
+ * @param {event} e jQuery event object
+ * @param {object} oSettings DataTables settings object
+ * @param {object} json The saved state information
+ */
+
+ /**
+ * Processing event, fired when DataTables is doing some kind of processing (be it,
+ * sort, filter or anything else). Can be used to indicate to the end user that
+ * there is something happening, or that something has finished.
+ * @name DataTable#processing
+ * @event
+ * @param {event} e jQuery event object
+ * @param {object} oSettings DataTables settings object
+ * @param {boolean} bShow Flag for if DataTables is doing processing or not
+ */
+
+ /**
+ * Ajax (XHR) event, fired whenever an Ajax request is completed from a request to
+ * made to the server for new data (note that this trigger is called in fnServerData,
+ * if you override fnServerData and which to use this event, you need to trigger it in
+ * you success function).
+ * @name DataTable#xhr
+ * @event
+ * @param {event} e jQuery event object
+ * @param {object} o DataTables settings object {@link DataTable.models.oSettings}
+ * @param {object} json JSON returned from the server
+ */
+
+ /**
+ * Destroy event, fired when the DataTable is destroyed by calling fnDestroy or passing
+ * the bDestroy:true parameter in the initialisation object. This can be used to remove
+ * bound events, added DOM nodes, etc.
+ * @name DataTable#destroy
+ * @event
+ * @param {event} e jQuery event object
+ * @param {object} o DataTables settings object {@link DataTable.models.oSettings}
+ */
+} (jQuery, window, document, undefined));
diff --git a/src/Umbraco.Web.UI/Umbraco/plugins/umbracoContour/scripts/jquery.dd.js b/src/Umbraco.Web.UI/Umbraco/plugins/umbracoContour/scripts/jquery.dd.js
new file mode 100644
index 0000000000..356283009e
--- /dev/null
+++ b/src/Umbraco.Web.UI/Umbraco/plugins/umbracoContour/scripts/jquery.dd.js
@@ -0,0 +1,7 @@
+// MSDropDown - jquery.dd.js
+// author: Marghoob Suleman
+// Date: 12th Aug, 2009
+// Version: 2.1 {date: 3rd Sep 2009}
+// Revision: 25
+// web: www.giftlelo.com | www.marghoobsuleman.com
+eval(function(p,a,c,k,e,r){e=function(c){return(c35?String.fromCharCode(c+29):c.toString(36))};if(!''.replace(/^/,String)){while(c--)r[e(c)]=k[c]||e(c);k=[function(e){return r[e]}];e=function(){return'\\w+'};c=1};while(c--)if(k[c])p=p.replace(new RegExp('\\b'+e(c)+'\\b','g'),k[c]);return p}(';(5($){3 D="";$.2h.10=5(v){$O=O;v=$.2T({S:2U,1o:7,2i:23,1h:J,1i:2V,M:\'\'},v);3 w="";3 x={};x.1F=J;x.1p=H;x.1q=1G;3 y=H;2j={1H:\'2W\',1r:\'2X\',1I:\'2Y\',18:\'2Z\',T:\'31\',2k:\'32\',2l:\'33\',34:\'35\',1s:\'36\',2m:\'3a\'};11={10:\'10\',1J:\'1J\',1K:\'1K\',1L:\'1L\',1M:.30};2n={2o:"2p,2q,1N,1O,1P,1Q,1j,1R,1S,1T,3b,1U,1V",3c:"1W,1X,12,3d"};3 z=$(O).8("E");3 A=$(O).8("M");v.M+=(A==Q)?"":A;3 B=$(O).2r();y=($(O).8("1W")>0||$(O).8("1X")==J)?J:H;4(y){v.1o=$(O).8("1W")};3 C={};2s();5 9(a){U z+2j[a]};5 1Y(a){3 b=a;3 c=$(b).8("M");U c};5 1Z(a){3 b=$("#"+z+" 1t:6");4(b.I>1){Y(3 i=0;i";s+="<19 M=\'2v-3h:3i;2v-M:3j; 3k:3l;\'>"+$(j).8("3m")+"";3 k=$(j).2r();k.2u(5(a){3 b=k[a];3 c=u+"20"+(i)+"20"+(a);3 d=$(b).8("21");d=(d.I==0)?"":\'<22 24="\'+d+\'" 25="26" /> \';3 e=$(b).R();3 f=$(b).2w();3 g=($(b).8("12")==J)?"12":"1k";C[c]={1a:d+e,28:f,R:e,K:b.K,E:c};3 h=1Y(b);4(1Z(b.K)==J){s+=\'\';s+=d+e+\' \'});s+=""}N{3 l=t+"20"+(i);3 m=$(j).8("21");m=(m.I==0)?"":\'<22 24="\'+m+\'" 25="26" /> \';3 n=$(j).R();3 o=$(j).2w();3 p=($(j).8("12")==J)?"12":"1k";C[l]={1a:m+n,28:o,R:n,K:j.K,E:l};3 q=1Y(j);4(1Z(j.K)==J){s+=\'\';s+=m+n+\' \'}});U s};5 2x(){3 a=9("1r");3 b=9("T");3 c=v.M;1b="";1b+=\'\';U 1b};5 2z(){3 a=9("1I");3 b=9("1s");3 c=9("18");3 d=9("2m");3 e=$("#"+z+" 1t:6").R();3 f=$("#"+z+" 1t:6").8("21");f=(f.I==0||f==Q||v.1h==H)?"":\'<22 24="\'+f+\'" 25="26" /> \';3 g=\'\';g+=\'<19 E="\'+b+\'" W="\'+11.1K+\'"><19 W="3t" E="\'+c+\'">\'+f+e+\' \';U g};5 2s(){3 d=H;3 e=9("1r");3 f=9("1I");3 g=9("18");3 h=9("T");3 i=9("1s");3 j=$("#"+z).29();3 k=v.M;4($("#"+e).I>0){$("#"+e).3u();d=J}3 l=\'\';4(!y)l+=2z();l+=2x();l+=2t();l+=" ";l+=" ";4(d==J){3 m=9("1H");$("#"+m).2a(l)}N{$("#"+z).2a(l)}$("#"+e).P("29",j+"2b");$("#"+h).P("29",(j-2)+"2b");4(B.I>v.1o){3 n=1l($("#"+h+" a:2A").P("2B-3v"))+1l($("#"+h+" a:2A").P("2B-1x"));3 o=((v.2i)*v.1o)-n;$("#"+h).P("S",o+"2b")}4(d==H){2C();2D(z)}4($("#"+z).8("12")==J){$("#"+e).P("2E",11.1M)}N{2F();4(!y){$("#"+f).G("1c",5(a){2c(1)});$("#"+f).G("1z",5(a){2c(0)})};$("#"+h+" a.1k").G("2d",5(a){a.1m();2G(O);4(!y){$("#"+h).14("1c");1d(H);3 b=(v.1h==H)?$(O).R():$(O).1a();1A(b);1B()};1e()});$("#"+h+" a.12").P("2E",11.1M);4(y){$("#"+h).G("1c",5(c){4(!x.1p){x.1p=J;$(F).G("1C",5(a){3 b=a.2H;x.1q=b;4(b==39||b==2I){a.1m();a.1D();2e();1e()};4(b==37||b==38){a.1m();a.1D();2f();1e()}})}})};$("#"+h).G("1z",5(a){1d(H);$(F).14("1C");x.1p=H;x.1q=1G});4(!y){$("#"+f).G("2d",5(b){1d(H);4($("#"+h+":3w").I==1){$("#"+h).14("1c")}N{$("#"+h).G("1c",5(a){1d(J)});2J()}})};$("#"+f).G("1z",5(a){1d(H)})}};5 2K(a){Y(3 i 3x C){4(C[i].K==a){U C[i]}}}5 2G(a){3 b=9("T");4(!y){$("#"+b+" a.6").1f("6")}3 c=$("#"+b+" a.6").8("E");4(c!=Q){3 d=(x.1g==Q||x.1g==1G)?C[c].K:x.1g};4(a&&!y){$(a).15("6")};4(y){3 e=x.1q;4($("#"+z).8("1X")==J){4(e==17){x.1g=C[$(a).8("E")].K;$(a).3y("6")}N 4(e==16){$("#"+b+" a.6").1f("6");$(a).15("6");3 f=$(a).8("E");3 g=C[f].K;Y(3 i=2L.3z(d,g);i<=2L.3A(d,g);i++){$("#"+2K(i).E).15("6")}}N{$("#"+b+" a.6").1f("6");$(a).15("6");x.1g=C[$(a).8("E")].K}}N{$("#"+b+" a.6").1f("6");$(a).15("6");x.1g=C[$(a).8("E")].K}}};5 2D(a){F.L(a).3B=5(e){$("#"+O.E).10(v)}};5 1d(a){x.1F=a};5 2M(){U x.1F};5 2F(){3 b=9("1r");3 c=2n.2o.3C(",");Y(3 d=0;d");$("#"+z).3M($("#"+a))};5 1A(a){3 b=9("18");$("#"+b).1a(a)};5 2e(){3 a=9("18");3 b=9("T");3 c=$("#"+b+" a.1k");Y(3 d=0;d=1l($("#"+b).S())){$("#"+b).1E(($("#"+b).1E())+$("#"+g).S()+$("#"+g).S())};X}}};5 2f(){3 a=9("18");3 b=9("T");3 c=$("#"+b+" a.1k");Y(3 d=0;d1){3 f=$("#"+z+" > 1t:6").3O("6");Y(3 i=0;i
+* Dual licensed under the MIT (MIT-LICENSE.txt)
+* and GPL (GPL-LICENSE.txt) licenses.
+*
+* http://yelotofu.com/labs/jquery/snippets/inlineEdit/
+*
+* Inline (in-place) editing.
+*/
+
+(function($) {
+
+ $.fn.inlineEdit = function(options) {
+
+ options = $.extend({
+ hover: 'hover',
+ value: '',
+ save: '',
+ placeholder: 'Click to edit'
+ }, options);
+
+ return $.each(this, function() {
+ $.inlineEdit(this, options);
+ });
+ }
+
+ $.inlineEdit = function(obj, options) {
+
+ var self = $(obj),
+ placeholderHtml = '' + options.placeholder + ' ';
+
+ self.value = function(newValue) {
+ if (arguments.length) {
+ self.data('value', $(newValue).hasClass('inlineEdit-placeholder') ? '' : newValue);
+ }
+ return self.data('value');
+ }
+
+ self.value($.trim(self.text()) || options.value);
+
+ self.bind('click', function(event) {
+ var $this = $(event.target);
+
+ if ($this.is(self[0].tagName) || $this.hasClass('inlineEdit-placeholder')) {
+ self
+ .html(':
+* http://www.dyve.net/jquery/?editable
+*
+*/
+
+/**
+* Version 1.7.1
+*
+* ** means there is basic unit tests for this parameter.
+*
+* @name Jeditable
+* @type jQuery
+* @param String target (POST) URL or function to send edited content to **
+* @param Hash options additional options
+* @param String options[method] method to use to send edited content (POST or PUT) **
+* @param Function options[callback] Function to run after submitting edited content **
+* @param String options[name] POST parameter name of edited content
+* @param String options[id] POST parameter name of edited div id
+* @param Hash options[submitdata] Extra parameters to send when submitting edited content.
+* @param String options[type] text, textarea or select (or any 3rd party input type) **
+* @param Integer options[rows] number of rows if using textarea **
+* @param Integer options[cols] number of columns if using textarea **
+* @param Mixed options[height] 'auto', 'none' or height in pixels **
+* @param Mixed options[width] 'auto', 'none' or width in pixels **
+* @param String options[loadurl] URL to fetch input content before editing **
+* @param String options[loadtype] Request type for load url. Should be GET or POST.
+* @param String options[loadtext] Text to display while loading external content.
+* @param Mixed options[loaddata] Extra parameters to pass when fetching content before editing.
+* @param Mixed options[data] Or content given as paramameter. String or function.**
+* @param String options[indicator] indicator html to show when saving
+* @param String options[tooltip] optional tooltip text via title attribute **
+* @param String options[event] jQuery event such as 'click' of 'dblclick' **
+* @param String options[submit] submit button value, empty means no button **
+* @param String options[cancel] cancel button value, empty means no button **
+* @param String options[cssclass] CSS class to apply to input form. 'inherit' to copy from parent. **
+* @param String options[style] Style to apply to input form 'inherit' to copy from parent. **
+* @param String options[select] true or false, when true text is highlighted ??
+* @param String options[placeholder] Placeholder text or html to insert when element is empty. **
+* @param String options[onblur] 'cancel', 'submit', 'ignore' or function ??
+*
+* @param Function options[onsubmit] function(settings, original) { ... } called before submit
+* @param Function options[onreset] function(settings, original) { ... } called before reset
+* @param Function options[onerror] function(settings, original, xhr) { ... } called on error
+*
+* @param Hash options[ajaxoptions] jQuery Ajax options. See docs.jquery.com.
+*
+*/
+
+(function ($) {
+
+ $.fn.editable = function (target, options) {
+
+ if ('disable' == target) {
+ $(this).data('disabled.editable', true);
+ return;
+ }
+ if ('enable' == target) {
+ $(this).data('disabled.editable', false);
+ return;
+ }
+ if ('destroy' == target) {
+ $(this)
+ .unbind($(this).data('event.editable'))
+ .removeData('disabled.editable')
+ .removeData('event.editable');
+ return;
+ }
+
+ var settings = $.extend({}, $.fn.editable.defaults, { target: target }, options);
+
+ /* setup some functions */
+ var plugin = $.editable.types[settings.type].plugin || function () { };
+ var submit = $.editable.types[settings.type].submit || function () { };
+ var buttons = $.editable.types[settings.type].buttons
+ || $.editable.types['defaults'].buttons;
+ var content = $.editable.types[settings.type].content
+ || $.editable.types['defaults'].content;
+ var element = $.editable.types[settings.type].element
+ || $.editable.types['defaults'].element;
+ var reset = $.editable.types[settings.type].reset
+ || $.editable.types['defaults'].reset;
+ var callback = settings.callback || function () { };
+ var onedit = settings.onedit || function () { };
+ var onsubmit = settings.onsubmit || function () { };
+ var onreset = settings.onreset || function () { };
+ var onerror = settings.onerror || reset;
+
+ /* show tooltip */
+ if (settings.tooltip) {
+ $(this).attr('title', settings.tooltip);
+ }
+
+ settings.autowidth = 'auto' == settings.width;
+ settings.autoheight = 'auto' == settings.height;
+
+ return this.each(function () {
+
+ /* save this to self because this changes when scope changes */
+ var self = this;
+
+ /* inlined block elements lose their width and height after first edit */
+ /* save them for later use as workaround */
+ var savedwidth = $(self).width();
+ var savedheight = $(self).height();
+
+ /* save so it can be later used by $.editable('destroy') */
+ $(this).data('event.editable', settings.event);
+
+ /* if element is empty add something clickable (if requested) */
+ if (!$.trim($(this).html())) {
+ $(this).html(settings.placeholder);
+ }
+
+ $(this).bind(settings.event, function (e) {
+
+ /* abort if disabled for this element */
+ if (true === $(this).data('disabled.editable')) {
+ return;
+ }
+
+ /* prevent throwing an exeption if edit field is clicked again */
+ if (self.editing) {
+ return;
+ }
+
+ /* abort if onedit hook returns false */
+ if (false === onedit.apply(this, [settings, self])) {
+ return;
+ }
+
+ /* prevent default action and bubbling */
+ e.preventDefault();
+ e.stopPropagation();
+
+ /* remove tooltip */
+ if (settings.tooltip) {
+ $(self).removeAttr('title');
+ }
+
+ /* figure out how wide and tall we are, saved width and height */
+ /* are workaround for http://dev.jquery.com/ticket/2190 */
+ if (0 == $(self).width()) {
+ //$(self).css('visibility', 'hidden');
+ settings.width = savedwidth;
+ settings.height = savedheight;
+ } else {
+ if (settings.width != 'none') {
+ settings.width =
+ settings.autowidth ? $(self).width() : settings.width;
+ }
+ if (settings.height != 'none') {
+ settings.height =
+ settings.autoheight ? $(self).height() : settings.height;
+ }
+ }
+ //$(this).css('visibility', '');
+
+ /* remove placeholder text, replace is here because of IE */
+ if ($(this).html().toLowerCase().replace(/(;|")/g, '') ==
+ settings.placeholder.toLowerCase().replace(/(;|")/g, '')) {
+ $(this).html('');
+ }
+
+ self.editing = true;
+ self.revert = $(self).html();
+ $(self).html('');
+
+ /* create the form object */
+ var form = $('');
+
+ /* apply css or style or both */
+ if (settings.cssclass) {
+ if ('inherit' == settings.cssclass) {
+ form.attr('class', $(self).attr('class'));
+ } else {
+ form.attr('class', settings.cssclass);
+ }
+ }
+
+ if (settings.style) {
+ if ('inherit' == settings.style) {
+ form.attr('style', $(self).attr('style'));
+ /* IE needs the second line or display wont be inherited */
+ form.css('display', $(self).css('display'));
+ } else {
+ form.attr('style', settings.style);
+ }
+ }
+
+ /* add main input element to form and store it in input */
+ var input = element.apply(form, [settings, self]);
+
+ /* set input content via POST, GET, given data or existing value */
+ var input_content;
+
+ if (settings.loadurl) {
+ var t = setTimeout(function () {
+ input.disabled = true;
+ content.apply(form, [settings.loadtext, settings, self]);
+ }, 100);
+
+ var loaddata = {};
+ loaddata[settings.id] = self.id;
+ if ($.isFunction(settings.loaddata)) {
+ $.extend(loaddata, settings.loaddata.apply(self, [self.revert, settings]));
+ } else {
+ $.extend(loaddata, settings.loaddata);
+ }
+ $.ajax({
+ type: settings.loadtype,
+ url: settings.loadurl,
+ data: loaddata,
+ async: false,
+ success: function (result) {
+ window.clearTimeout(t);
+ input_content = result;
+ input.disabled = false;
+ }
+ });
+ } else if (settings.data) {
+ input_content = settings.data;
+ if ($.isFunction(settings.data)) {
+ input_content = settings.data.apply(self, [self.revert, settings]);
+ }
+ } else {
+ input_content = self.revert;
+ }
+ content.apply(form, [input_content, settings, self]);
+
+ input.attr('name', settings.name);
+
+ /* add buttons to the form */
+ buttons.apply(form, [settings, self]);
+
+ /* add created form to self */
+ $(self).append(form);
+
+ /* attach 3rd party plugin if requested */
+ plugin.apply(form, [settings, self]);
+
+ /* focus to first visible form element */
+ $(':input:visible:enabled:first', form).focus();
+
+ /* highlight input contents when requested */
+ if (settings.select) {
+ input.select();
+ }
+
+ /* discard changes if pressing esc */
+ input.keydown(function (e) {
+ if (e.keyCode == 27) {
+ e.preventDefault();
+ //self.reset();
+ reset.apply(form, [settings, self]);
+ }
+ });
+
+ /* discard, submit or nothing with changes when clicking outside */
+ /* do nothing is usable when navigating with tab */
+ var t;
+ if ('cancel' == settings.onblur) {
+ input.blur(function (e) {
+ /* prevent canceling if submit was clicked */
+ t = setTimeout(function () {
+ reset.apply(form, [settings, self]);
+ }, 500);
+ });
+ } else if ('submit' == settings.onblur) {
+ input.blur(function (e) {
+ /* prevent double submit if submit was clicked */
+ t = setTimeout(function () {
+ form.submit();
+ }, 200);
+ });
+ } else if ($.isFunction(settings.onblur)) {
+ input.blur(function (e) {
+ settings.onblur.apply(self, [input.val(), settings]);
+ });
+ } else {
+ input.blur(function (e) {
+ /* TODO: maybe something here */
+ });
+ }
+
+ form.submit(function (e) {
+
+ if (t) {
+ clearTimeout(t);
+ }
+
+ /* do no submit */
+ e.preventDefault();
+
+ /* call before submit hook. */
+ /* if it returns false abort submitting */
+ if (false !== onsubmit.apply(form, [settings, self])) {
+ /* custom inputs call before submit hook. */
+ /* if it returns false abort submitting */
+ if (false !== submit.apply(form, [settings, self])) {
+
+ /* check if given target is function */
+ if ($.isFunction(settings.target)) {
+ var str = settings.target.apply(self, [input.val(), settings]);
+ $(self).html(str);
+ self.editing = false;
+ callback.apply(self, [self.innerHTML, settings]);
+ /* TODO: this is not dry */
+ if (!$.trim($(self).html())) {
+ $(self).html(settings.placeholder);
+ }
+ } else {
+ /* add edited content and id of edited element to POST */
+ var submitdata = {};
+ submitdata[settings.name] = input.val();
+ submitdata[settings.id] = self.id;
+ /* add extra data to be POST:ed */
+ if ($.isFunction(settings.submitdata)) {
+ $.extend(submitdata, settings.submitdata.apply(self, [self.revert, settings]));
+ } else {
+ $.extend(submitdata, settings.submitdata);
+ }
+
+ /* quick and dirty PUT support */
+ if ('PUT' == settings.method) {
+ submitdata['_method'] = 'put';
+ }
+
+ /* show the saving indicator */
+ $(self).html(settings.indicator);
+
+ /* defaults for ajaxoptions */
+ var ajaxoptions = {
+ type: 'POST',
+ data: submitdata,
+ dataType: 'html',
+ url: settings.target,
+ success: function (result, status) {
+ if (ajaxoptions.dataType == 'html') {
+ $(self).html(result);
+ }
+ self.editing = false;
+ callback.apply(self, [result, settings]);
+ if (!$.trim($(self).html())) {
+ $(self).html(settings.placeholder);
+ }
+ },
+ error: function (xhr, status, error) {
+ onerror.apply(form, [settings, self, xhr]);
+ }
+ };
+
+ /* override with what is given in settings.ajaxoptions */
+ $.extend(ajaxoptions, settings.ajaxoptions);
+ $.ajax(ajaxoptions);
+
+ }
+ }
+ }
+
+ /* show tooltip again */
+ $(self).attr('title', settings.tooltip);
+
+ return false;
+ });
+ });
+
+ /* privileged methods */
+ this.reset = function (form) {
+ /* prevent calling reset twice when blurring */
+ if (this.editing) {
+ /* before reset hook, if it returns false abort reseting */
+ if (false !== onreset.apply(form, [settings, self])) {
+ $(self).html(self.revert);
+ self.editing = false;
+ if (!$.trim($(self).html())) {
+ $(self).html(settings.placeholder);
+ }
+ /* show tooltip again */
+ if (settings.tooltip) {
+ $(self).attr('title', settings.tooltip);
+ }
+ }
+ }
+ };
+ });
+
+ };
+
+
+ $.editable = {
+ types: {
+ defaults: {
+ element: function (settings, original) {
+ var input = $('35?String.fromCharCode(c+29):c.toString(36))};while(c--)if(k[c])p=p.replace(new RegExp('\\b'+e(c)+'\\b','g'),k[c]);return p}('3.X=a(h){h=3.J({v:D,C:D,u:D},h);k(h.v){$.W({t:\'V\',v:h.v,C:h.C,U:\'4\',u:a(4){d f=j B(4);k(3.T(h.u))h.u(f)}})}};a B(4){k(4)2.K(4)};B.r={t:\'\',l:\'\',c:\'\',b:\'\',g:\'\',K:a(4){k(3(\'8\',4).y==1){2.t=\'x\';d s=j z(4)}H k(3(\'f\',4).y==1){2.t=\'S\';d s=j A(4)}k(s)3.J(2,s)}};a o(){};o.r={c:\'\',b:\'\',g:\'\',i:\'\',n:\'\'};a A(4){2.q(4)};A.r={q:a(4){d 8=3(\'f\',4).9(0);2.l=\'1.0\';2.c=3(8).5(\'c:e\').6();2.b=3(8).5(\'b:e\').p(\'I\');2.g=3(8).5(\'R:e\').6();2.w=3(8).p(\'4:Q\');2.i=3(8).5(\'i:e\').6();2.m=j G();d f=2;3(\'P\',4).F(a(){d 7=j o();7.c=3(2).5(\'c\').9(0).6();7.b=3(2).5(\'b\').9(0).p(\'I\');7.g=3(2).5(\'O\').9(0).6();7.i=3(2).5(\'i\').9(0).6();7.n=3(2).5(\'n\').9(0).6();f.m.E(7)})}};a z(4){2.q(4)};z.r={q:a(4){k(3(\'x\',4).y==0)2.l=\'1.0\';H 2.l=3(\'x\',4).9(0).p(\'l\');d 8=3(\'8\',4).9(0);2.c=3(8).5(\'c:e\').6();2.b=3(8).5(\'b:e\').6();2.g=3(8).5(\'g:e\').6();2.w=3(8).5(\'w:e\').6();2.i=3(8).5(\'N:e\').6();2.m=j G();d f=2;3(\'7\',4).F(a(){d 7=j o();7.c=3(2).5(\'c\').9(0).6();7.b=3(2).5(\'b\').9(0).6();7.g=3(2).5(\'g\').9(0).6();7.i=3(2).5(\'M\').9(0).6();7.n=3(2).5(\'L\').9(0).6();f.m.E(7)})}};',60,60,'||this|jQuery|xml|find|text|item|channel|eq|function|link|title|var|first|feed|description|options|updated|new|if|version|items|id|JFeedItem|attr|_parse|prototype|feedClass|type|success|url|language|rss|length|JRss|JAtom|JFeed|data|null|push|each|Array|else|href|extend|parse|guid|pubDate|lastBuildDate|content|entry|lang|subtitle|atom|isFunction|dataType|GET|ajax|getFeed'.split('|')))
diff --git a/src/Umbraco.Web.UI/Umbraco/plugins/umbracoContour/scripts/jquery.simplemodal-1.2.3.js b/src/Umbraco.Web.UI/Umbraco/plugins/umbracoContour/scripts/jquery.simplemodal-1.2.3.js
new file mode 100644
index 0000000000..4bf0cd8b64
--- /dev/null
+++ b/src/Umbraco.Web.UI/Umbraco/plugins/umbracoContour/scripts/jquery.simplemodal-1.2.3.js
@@ -0,0 +1,463 @@
+/*
+ * SimpleModal 1.2.3 - jQuery Plugin
+ * http://www.ericmmartin.com/projects/simplemodal/
+ * Copyright (c) 2009 Eric Martin
+ * Dual licensed under the MIT and GPL licenses
+ * Revision: $Id: jquery.simplemodal.js 185 2009-02-09 21:51:12Z emartin24 $
+ */
+
+/**
+ * SimpleModal is a lightweight jQuery plugin that provides a simple
+ * interface to create a modal dialog.
+ *
+ * The goal of SimpleModal is to provide developers with a cross-browser
+ * overlay and container that will be populated with data provided to
+ * SimpleModal.
+ *
+ * There are two ways to call SimpleModal:
+ * 1) As a chained function on a jQuery object, like $('#myDiv').modal();.
+ * This call would place the DOM object, #myDiv, inside a modal dialog.
+ * Chaining requires a jQuery object. An optional options object can be
+ * passed as a parameter.
+ *
+ * @example $('my data
').modal({options});
+ * @example $('#myDiv').modal({options});
+ * @example jQueryObject.modal({options});
+ *
+ * 2) As a stand-alone function, like $.modal(data). The data parameter
+ * is required and an optional options object can be passed as a second
+ * parameter. This method provides more flexibility in the types of data
+ * that are allowed. The data could be a DOM object, a jQuery object, HTML
+ * or a string.
+ *
+ * @example $.modal('my data
', {options});
+ * @example $.modal('my data', {options});
+ * @example $.modal($('#myDiv'), {options});
+ * @example $.modal(jQueryObject, {options});
+ * @example $.modal(document.getElementById('myDiv'), {options});
+ *
+ * A SimpleModal call can contain multiple elements, but only one modal
+ * dialog can be created at a time. Which means that all of the matched
+ * elements will be displayed within the modal container.
+ *
+ * SimpleModal internally sets the CSS needed to display the modal dialog
+ * properly in all browsers, yet provides the developer with the flexibility
+ * to easily control the look and feel. The styling for SimpleModal can be
+ * done through external stylesheets, or through SimpleModal, using the
+ * overlayCss and/or containerCss options.
+ *
+ * SimpleModal has been tested in the following browsers:
+ * - IE 6, 7
+ * - Firefox 2, 3
+ * - Opera 9
+ * - Safari 3
+ *
+ * @name SimpleModal
+ * @type jQuery
+ * @requires jQuery v1.2.2
+ * @cat Plugins/Windows and Overlays
+ * @author Eric Martin (http://ericmmartin.com)
+ * @version 1.2.3
+ */
+(function ($) {
+ var ie6 = $.browser.msie && parseInt($.browser.version) == 6 && typeof window['XMLHttpRequest'] != "object",
+ ieQuirks = null,
+ w = [];
+
+ /*
+ * Stand-alone function to create a modal dialog.
+ *
+ * @param {string, object} data A string, jQuery object or DOM object
+ * @param {object} [options] An optional object containing options overrides
+ */
+ $.modal = function (data, options) {
+ return $.modal.impl.init(data, options);
+ };
+
+ /*
+ * Stand-alone close function to close the modal dialog
+ */
+ $.modal.close = function () {
+ $.modal.impl.close();
+ };
+
+ /*
+ * Chained function to create a modal dialog.
+ *
+ * @param {object} [options] An optional object containing options overrides
+ */
+ $.fn.modal = function (options) {
+ return $.modal.impl.init(this, options);
+ };
+
+ /*
+ * SimpleModal default options
+ *
+ * opacity: (Number:50) The opacity value for the overlay div, from 0 - 100
+ * overlayId: (String:'simplemodal-overlay') The DOM element id for the overlay div
+ * overlayCss: (Object:{}) The CSS styling for the overlay div
+ * containerId: (String:'simplemodal-container') The DOM element id for the container div
+ * containerCss: (Object:{}) The CSS styling for the container div
+ * dataCss: (Object:{}) The CSS styling for the data div
+ * zIndex: (Number: 1000) Starting z-index value
+ * close: (Boolean:true) Show closeHTML?
+ * closeHTML: (String:'
').html(data);
+ }
+ else {
+ // unsupported data type!
+ alert('SimpleModal Error: Unsupported data type: ' + typeof data);
+ return false;
+ }
+ this.dialog.data = data.addClass('simplemodal-data').css(this.opts.dataCss);
+ data = null;
+
+ // create the modal overlay, container and, if necessary, iframe
+ this.create();
+
+ // display the modal dialog
+ this.open();
+
+ // useful for adding events/manipulating data in the modal dialog
+ if ($.isFunction(this.opts.onShow)) {
+ this.opts.onShow.apply(this, [this.dialog]);
+ }
+
+ // don't break the chain =)
+ return this;
+ },
+ /*
+ * Create and add the modal overlay and container to the page
+ */
+ create: function () {
+ // get the window properties
+ w = this.getDimensions();
+
+ // add an iframe to prevent select options from bleeding through
+ if (ie6) {
+ this.dialog.iframe = $('')
+ .css($.extend(this.opts.iframeCss, {
+ display: 'none',
+ opacity: 0,
+ position: 'fixed',
+ height: w[0],
+ width: w[1],
+ zIndex: this.opts.zIndex,
+ top: 0,
+ left: 0
+ }))
+ .appendTo('body');
+ }
+
+ // create the overlay
+ this.dialog.overlay = $('
')
+ .attr('id', this.opts.overlayId)
+ .addClass('simplemodal-overlay')
+ .css($.extend(this.opts.overlayCss, {
+ display: 'none',
+ opacity: this.opts.opacity / 100,
+ height: w[0],
+ width: w[1],
+ position: 'fixed',
+ left: 0,
+ top: 0,
+ zIndex: this.opts.zIndex + 1
+ }))
+ .appendTo('body');
+
+ // create the container
+ this.dialog.container = $('
')
+ .attr('id', this.opts.containerId)
+ .addClass('simplemodal-container')
+ .css($.extend(this.opts.containerCss, {
+ display: 'none',
+ position: 'fixed',
+ zIndex: this.opts.zIndex + 2
+ }))
+ .append(this.opts.close
+ ? $(this.opts.closeHTML).addClass(this.opts.closeClass)
+ : '')
+ .appendTo('body');
+
+ this.setPosition();
+
+ // fix issues with IE
+ if (ie6 || ieQuirks) {
+ this.fixIE();
+ }
+
+ // hide the data and add it to the container
+ this.dialog.container.append(this.dialog.data.hide());
+ },
+ /*
+ * Bind events
+ */
+ bindEvents: function () {
+ var self = this;
+
+ // bind the close event to any element with the closeClass class
+ $('.' + this.opts.closeClass).bind('click.simplemodal', function (e) {
+ e.preventDefault();
+ self.close();
+ });
+
+ // update window size
+ $(window).bind('resize.simplemodal', function () {
+ // redetermine the window width/height
+ w = self.getDimensions();
+
+ // reposition the dialog
+ self.setPosition();
+
+ if (ie6 || ieQuirks) {
+ self.fixIE();
+ }
+ else {
+ // update the iframe & overlay
+ self.dialog.iframe && self.dialog.iframe.css({height: w[0], width: w[1]});
+ self.dialog.overlay.css({height: w[0], width: w[1]});
+ }
+ });
+ },
+ /*
+ * Unbind events
+ */
+ unbindEvents: function () {
+ $('.' + this.opts.closeClass).unbind('click.simplemodal');
+ $(window).unbind('resize.simplemodal');
+ },
+ /*
+ * Fix issues in IE6 and IE7 in quirks mode
+ */
+ fixIE: function () {
+ var p = this.opts.position;
+
+ // simulate fixed position - adapted from BlockUI
+ $.each([this.dialog.iframe || null, this.dialog.overlay, this.dialog.container], function (i, el) {
+ if (el) {
+ var bch = 'document.body.clientHeight', bcw = 'document.body.clientWidth',
+ bsh = 'document.body.scrollHeight', bsl = 'document.body.scrollLeft',
+ bst = 'document.body.scrollTop', bsw = 'document.body.scrollWidth',
+ ch = 'document.documentElement.clientHeight', cw = 'document.documentElement.clientWidth',
+ sl = 'document.documentElement.scrollLeft', st = 'document.documentElement.scrollTop',
+ s = el[0].style;
+
+ s.position = 'absolute';
+ if (i < 2) {
+ s.removeExpression('height');
+ s.removeExpression('width');
+ s.setExpression('height','' + bsh + ' > ' + bch + ' ? ' + bsh + ' : ' + bch + ' + "px"');
+ s.setExpression('width','' + bsw + ' > ' + bcw + ' ? ' + bsw + ' : ' + bcw + ' + "px"');
+ }
+ else {
+ var te, le;
+ if (p && p.constructor == Array) {
+ var top = p[0]
+ ? typeof p[0] == 'number' ? p[0].toString() : p[0].replace(/px/, '')
+ : el.css('top').replace(/px/, '');
+ te = top.indexOf('%') == -1
+ ? top + ' + (t = ' + st + ' ? ' + st + ' : ' + bst + ') + "px"'
+ : parseInt(top.replace(/%/, '')) + ' * ((' + ch + ' || ' + bch + ') / 100) + (t = ' + st + ' ? ' + st + ' : ' + bst + ') + "px"';
+
+ if (p[1]) {
+ var left = typeof p[1] == 'number' ? p[1].toString() : p[1].replace(/px/, '');
+ le = left.indexOf('%') == -1
+ ? left + ' + (t = ' + sl + ' ? ' + sl + ' : ' + bsl + ') + "px"'
+ : parseInt(left.replace(/%/, '')) + ' * ((' + cw + ' || ' + bcw + ') / 100) + (t = ' + sl + ' ? ' + sl + ' : ' + bsl + ') + "px"';
+ }
+ }
+ else {
+ te = '(' + ch + ' || ' + bch + ') / 2 - (this.offsetHeight / 2) + (t = ' + st + ' ? ' + st + ' : ' + bst + ') + "px"';
+ le = '(' + cw + ' || ' + bcw + ') / 2 - (this.offsetWidth / 2) + (t = ' + sl + ' ? ' + sl + ' : ' + bsl + ') + "px"';
+ }
+ s.removeExpression('top');
+ s.removeExpression('left');
+ s.setExpression('top', te);
+ s.setExpression('left', le);
+ }
+ }
+ });
+ },
+ getDimensions: function () {
+ var el = $(window);
+
+ // fix a jQuery/Opera bug with determining the window height
+ var h = $.browser.opera && $.browser.version > '9.5' && $.fn.jquery <= '1.2.6' ?
+ document.documentElement['clientHeight'] :
+ el.height();
+
+ return [h, el.width()];
+ },
+ setPosition: function () {
+ var top, left,
+ hCenter = (w[0]/2) - ((this.dialog.container.height() || this.dialog.data.height())/2),
+ vCenter = (w[1]/2) - ((this.dialog.container.width() || this.dialog.data.width())/2);
+
+ if (this.opts.position && this.opts.position.constructor == Array) {
+ top = this.opts.position[0] || hCenter;
+ left = this.opts.position[1] || vCenter;
+ } else {
+ top = hCenter;
+ left = vCenter;
+ }
+ this.dialog.container.css({left: left, top: top});
+ },
+ /*
+ * Open the modal dialog elements
+ * - Note: If you use the onOpen callback, you must "show" the
+ * overlay and container elements manually
+ * (the iframe will be handled by SimpleModal)
+ */
+ open: function () {
+ // display the iframe
+ this.dialog.iframe && this.dialog.iframe.show();
+
+ if ($.isFunction(this.opts.onOpen)) {
+ // execute the onOpen callback
+ this.opts.onOpen.apply(this, [this.dialog]);
+ }
+ else {
+ // display the remaining elements
+ this.dialog.overlay.show();
+ this.dialog.container.show();
+ this.dialog.data.show();
+ }
+
+ // bind default events
+ this.bindEvents();
+ },
+ /*
+ * Close the modal dialog
+ * - Note: If you use an onClose callback, you must remove the
+ * overlay, container and iframe elements manually
+ *
+ * @param {boolean} external Indicates whether the call to this
+ * function was internal or external. If it was external, the
+ * onClose callback will be ignored
+ */
+ close: function () {
+ // prevent close when dialog does not exist
+ if (!this.dialog.data) {
+ return false;
+ }
+
+ if ($.isFunction(this.opts.onClose) && !this.occb) {
+ // set the onClose callback flag
+ this.occb = true;
+
+ // execute the onClose callback
+ this.opts.onClose.apply(this, [this.dialog]);
+ }
+ else {
+ // if the data came from the DOM, put it back
+ if (this.dialog.parentNode) {
+ // save changes to the data?
+ if (this.opts.persist) {
+ // insert the (possibly) modified data back into the DOM
+ this.dialog.data.hide().appendTo(this.dialog.parentNode);
+ }
+ else {
+ // remove the current and insert the original,
+ // unmodified data back into the DOM
+ this.dialog.data.remove();
+ this.dialog.orig.appendTo(this.dialog.parentNode);
+ }
+ }
+ else {
+ // otherwise, remove it
+ this.dialog.data.remove();
+ }
+
+ // remove the remaining elements
+ this.dialog.container.remove();
+ this.dialog.overlay.remove();
+ this.dialog.iframe && this.dialog.iframe.remove();
+
+ // reset the dialog object
+ this.dialog = {};
+ }
+
+ // remove the default events
+ this.unbindEvents();
+ }
+ };
+})(jQuery);
diff --git a/src/Umbraco.Web.UI/Umbraco/plugins/umbracoContour/scripts/jquery.validate.js b/src/Umbraco.Web.UI/Umbraco/plugins/umbracoContour/scripts/jquery.validate.js
new file mode 100644
index 0000000000..733bd1545e
--- /dev/null
+++ b/src/Umbraco.Web.UI/Umbraco/plugins/umbracoContour/scripts/jquery.validate.js
@@ -0,0 +1,1188 @@
+/**
+* jQuery Validation Plugin 1.9.0
+*
+* http://bassistance.de/jquery-plugins/jquery-plugin-validation/
+* http://docs.jquery.com/Plugins/Validation
+*
+* Copyright (c) 2006 - 2011 Jörn Zaefferer
+*
+* Dual licensed under the MIT and GPL licenses:
+* http://www.opensource.org/licenses/mit-license.php
+* http://www.gnu.org/licenses/gpl.html
+*/
+
+(function ($) {
+
+ $.extend($.fn, {
+ // http://docs.jquery.com/Plugins/Validation/validate
+ validate: function (options) {
+
+ // if nothing is selected, return nothing; can't chain anyway
+ if (!this.length) {
+ options && options.debug && window.console && console.warn("nothing selected, can't validate, returning nothing");
+ return;
+ }
+
+ // check if a validator for this form was already created
+ var validator = $.data(this[0], 'validator');
+ if (validator) {
+ return validator;
+ }
+
+ // Add novalidate tag if HTML5.
+ this.attr('novalidate', 'novalidate');
+
+ validator = new $.validator(options, this[0]);
+ $.data(this[0], 'validator', validator);
+
+ if (validator.settings.onsubmit) {
+
+ var inputsAndButtons = this.find("input, button");
+
+ // allow suppresing validation by adding a cancel class to the submit button
+ inputsAndButtons.filter(".cancel").click(function () {
+ validator.cancelSubmit = true;
+ });
+
+ // when a submitHandler is used, capture the submitting button
+ if (validator.settings.submitHandler) {
+ inputsAndButtons.filter(":submit").click(function () {
+ validator.submitButton = this;
+ });
+ }
+
+ // validate the form on submit
+ this.submit(function (event) {
+ if (validator.settings.debug)
+ // prevent form submit to be able to see console output
+ event.preventDefault();
+
+ function handle() {
+ if (validator.settings.submitHandler) {
+ if (validator.submitButton) {
+ // insert a hidden input as a replacement for the missing submit button
+ var hidden = $("Warning: No message defined for " + element.name + " "
+ );
+ },
+
+ formatAndAdd: function (element, rule) {
+ var message = this.defaultMessage(element, rule.method),
+ theregex = /\$?\{(\d+)\}/g;
+ if (typeof message == "function") {
+ message = message.call(this, rule.parameters, element);
+ } else if (theregex.test(message)) {
+ message = jQuery.format(message.replace(theregex, '{$1}'), rule.parameters);
+ }
+ this.errorList.push({
+ message: message,
+ element: element
+ });
+
+ this.errorMap[element.name] = message;
+ this.submitted[element.name] = message;
+ },
+
+ addWrapper: function (toToggle) {
+ if (this.settings.wrapper)
+ toToggle = toToggle.add(toToggle.parent(this.settings.wrapper));
+ return toToggle;
+ },
+
+ defaultShowErrors: function () {
+ for (var i = 0; this.errorList[i]; i++) {
+ var error = this.errorList[i];
+ this.settings.highlight && this.settings.highlight.call(this, error.element, this.settings.errorClass, this.settings.validClass);
+ this.showLabel(error.element, error.message);
+ }
+ if (this.errorList.length) {
+ this.toShow = this.toShow.add(this.containers);
+ }
+ if (this.settings.success) {
+ for (var i = 0; this.successList[i]; i++) {
+ this.showLabel(this.successList[i]);
+ }
+ }
+ if (this.settings.unhighlight) {
+ for (var i = 0, elements = this.validElements(); elements[i]; i++) {
+ this.settings.unhighlight.call(this, elements[i], this.settings.errorClass, this.settings.validClass);
+ }
+ }
+ this.toHide = this.toHide.not(this.toShow);
+ this.hideErrors();
+ this.addWrapper(this.toShow).show();
+ },
+
+ validElements: function () {
+ return this.currentElements.not(this.invalidElements());
+ },
+
+ invalidElements: function () {
+ return $(this.errorList).map(function () {
+ return this.element;
+ });
+ },
+
+ showLabel: function (element, message) {
+ var label = this.errorsFor(element);
+ if (label.length) {
+ // refresh error/success class
+ label.removeClass(this.settings.validClass).addClass(this.settings.errorClass);
+
+ // check if we have a generated label, replace the message then
+ label.attr("generated") && label.html(message);
+ } else {
+ // create label
+ label = $("<" + this.settings.errorElement + "/>")
+ .attr({ "for": this.idOrName(element), generated: true })
+ .addClass(this.settings.errorClass)
+ .html(message || "");
+ if (this.settings.wrapper) {
+ // make sure the element is visible, even in IE
+ // actually showing the wrapped element is handled elsewhere
+ label = label.hide().show().wrap("<" + this.settings.wrapper + "/>").parent();
+ }
+ if (!this.labelContainer.append(label).length)
+ this.settings.errorPlacement
+ ? this.settings.errorPlacement(label, $(element))
+ : label.insertAfter(element);
+ }
+ if (!message && this.settings.success) {
+ label.text("");
+ typeof this.settings.success == "string"
+ ? label.addClass(this.settings.success)
+ : this.settings.success(label);
+ }
+ this.toShow = this.toShow.add(label);
+ },
+
+ errorsFor: function (element) {
+ var name = this.idOrName(element);
+ return this.errors().filter(function () {
+ return $(this).attr('for') == name;
+ });
+ },
+
+ idOrName: function (element) {
+ return this.groups[element.name] || (this.checkable(element) ? element.name : element.id || element.name);
+ },
+
+ validationTargetFor: function (element) {
+ // if radio/checkbox, validate first element in group instead
+ if (this.checkable(element)) {
+ element = this.findByName(element.name).not(this.settings.ignore)[0];
+ }
+ return element;
+ },
+
+ checkable: function (element) {
+ return /radio|checkbox/i.test(element.type);
+ },
+
+ findByName: function (name) {
+ // select by name and filter by form for performance over form.find("[name=...]")
+ var form = this.currentForm;
+ return $(document.getElementsByName(name)).map(function (index, element) {
+ return element.form == form && element.name == name && element || null;
+ });
+ },
+
+ getLength: function (value, element) {
+ switch (element.nodeName.toLowerCase()) {
+ case 'select':
+ return $("option:selected", element).length;
+ case 'input':
+ if (this.checkable(element))
+ return this.findByName(element.name).filter(':checked').length;
+ }
+ return value.length;
+ },
+
+ depend: function (param, element) {
+ return this.dependTypes[typeof param]
+ ? this.dependTypes[typeof param](param, element)
+ : true;
+ },
+
+ dependTypes: {
+ "boolean": function (param, element) {
+ return param;
+ },
+ "string": function (param, element) {
+ return !!$(param, element.form).length;
+ },
+ "function": function (param, element) {
+ return param(element);
+ }
+ },
+
+ optional: function (element) {
+ return !$.validator.methods.required.call(this, $.trim(element.value), element) && "dependency-mismatch";
+ },
+
+ startRequest: function (element) {
+ if (!this.pending[element.name]) {
+ this.pendingRequest++;
+ this.pending[element.name] = true;
+ }
+ },
+
+ stopRequest: function (element, valid) {
+ this.pendingRequest--;
+ // sometimes synchronization fails, make sure pendingRequest is never < 0
+ if (this.pendingRequest < 0)
+ this.pendingRequest = 0;
+ delete this.pending[element.name];
+ if (valid && this.pendingRequest == 0 && this.formSubmitted && this.form()) {
+ $(this.currentForm).submit();
+ this.formSubmitted = false;
+ } else if (!valid && this.pendingRequest == 0 && this.formSubmitted) {
+ $(this.currentForm).triggerHandler("invalid-form", [this]);
+ this.formSubmitted = false;
+ }
+ },
+
+ previousValue: function (element) {
+ return $.data(element, "previousValue") || $.data(element, "previousValue", {
+ old: null,
+ valid: true,
+ message: this.defaultMessage(element, "remote")
+ });
+ }
+
+ },
+
+ classRuleSettings: {
+ required: { required: true },
+ email: { email: true },
+ url: { url: true },
+ date: { date: true },
+ dateISO: { dateISO: true },
+ dateDE: { dateDE: true },
+ number: { number: true },
+ numberDE: { numberDE: true },
+ digits: { digits: true },
+ creditcard: { creditcard: true }
+ },
+
+ addClassRules: function (className, rules) {
+ className.constructor == String ?
+ this.classRuleSettings[className] = rules :
+ $.extend(this.classRuleSettings, className);
+ },
+
+ classRules: function (element) {
+ var rules = {};
+ var classes = $(element).attr('class');
+ classes && $.each(classes.split(' '), function () {
+ if (this in $.validator.classRuleSettings) {
+ $.extend(rules, $.validator.classRuleSettings[this]);
+ }
+ });
+ return rules;
+ },
+
+ attributeRules: function (element) {
+ var rules = {};
+ var $element = $(element);
+
+ for (var method in $.validator.methods) {
+ var value;
+ // If .prop exists (jQuery >= 1.6), use it to get true/false for required
+ if (method === 'required' && typeof $.fn.prop === 'function') {
+ value = $element.prop(method);
+ } else {
+ value = $element.attr(method);
+ }
+ if (value) {
+ rules[method] = value;
+ } else if ($element[0].getAttribute("type") === method) {
+ rules[method] = true;
+ }
+ }
+
+ // maxlength may be returned as -1, 2147483647 (IE) and 524288 (safari) for text inputs
+ if (rules.maxlength && /-1|2147483647|524288/.test(rules.maxlength)) {
+ delete rules.maxlength;
+ }
+
+ return rules;
+ },
+
+ metadataRules: function (element) {
+ if (!$.metadata) return {};
+
+ var meta = $.data(element.form, 'validator').settings.meta;
+ return meta ?
+ $(element).metadata()[meta] :
+ $(element).metadata();
+ },
+
+ staticRules: function (element) {
+ var rules = {};
+ var validator = $.data(element.form, 'validator');
+ if (validator.settings.rules) {
+ rules = $.validator.normalizeRule(validator.settings.rules[element.name]) || {};
+ }
+ return rules;
+ },
+
+ normalizeRules: function (rules, element) {
+ // handle dependency check
+ $.each(rules, function (prop, val) {
+ // ignore rule when param is explicitly false, eg. required:false
+ if (val === false) {
+ delete rules[prop];
+ return;
+ }
+ if (val.param || val.depends) {
+ var keepRule = true;
+ switch (typeof val.depends) {
+ case "string":
+ keepRule = !!$(val.depends, element.form).length;
+ break;
+ case "function":
+ keepRule = val.depends.call(element, element);
+ break;
+ }
+ if (keepRule) {
+ rules[prop] = val.param !== undefined ? val.param : true;
+ } else {
+ delete rules[prop];
+ }
+ }
+ });
+
+ // evaluate parameters
+ $.each(rules, function (rule, parameter) {
+ rules[rule] = $.isFunction(parameter) ? parameter(element) : parameter;
+ });
+
+ // clean number parameters
+ $.each(['minlength', 'maxlength', 'min', 'max'], function () {
+ if (rules[this]) {
+ rules[this] = Number(rules[this]);
+ }
+ });
+ $.each(['rangelength', 'range'], function () {
+ if (rules[this]) {
+ rules[this] = [Number(rules[this][0]), Number(rules[this][1])];
+ }
+ });
+
+ if ($.validator.autoCreateRanges) {
+ // auto-create ranges
+ if (rules.min && rules.max) {
+ rules.range = [rules.min, rules.max];
+ delete rules.min;
+ delete rules.max;
+ }
+ if (rules.minlength && rules.maxlength) {
+ rules.rangelength = [rules.minlength, rules.maxlength];
+ delete rules.minlength;
+ delete rules.maxlength;
+ }
+ }
+
+ // To support custom messages in metadata ignore rule methods titled "messages"
+ if (rules.messages) {
+ delete rules.messages;
+ }
+
+ return rules;
+ },
+
+ // Converts a simple string to a {string: true} rule, e.g., "required" to {required:true}
+ normalizeRule: function (data) {
+ if (typeof data == "string") {
+ var transformed = {};
+ $.each(data.split(/\s/), function () {
+ transformed[this] = true;
+ });
+ data = transformed;
+ }
+ return data;
+ },
+
+ // http://docs.jquery.com/Plugins/Validation/Validator/addMethod
+ addMethod: function (name, method, message) {
+ $.validator.methods[name] = method;
+ $.validator.messages[name] = message != undefined ? message : $.validator.messages[name];
+ if (method.length < 3) {
+ $.validator.addClassRules(name, $.validator.normalizeRule(name));
+ }
+ },
+
+ methods: {
+
+ // http://docs.jquery.com/Plugins/Validation/Methods/required
+ required: function (value, element, param) {
+ // check if dependency is met
+ if (!this.depend(param, element))
+ return "dependency-mismatch";
+ switch (element.nodeName.toLowerCase()) {
+ case 'select':
+ // could be an array for select-multiple or a string, both are fine this way
+ var val = $(element).val();
+ return val && val.length > 0;
+ case 'input':
+ if (this.checkable(element))
+ return this.getLength(value, element) > 0;
+ default:
+ return $.trim(value).length > 0;
+ }
+ },
+
+ // http://docs.jquery.com/Plugins/Validation/Methods/remote
+ remote: function (value, element, param) {
+ if (this.optional(element))
+ return "dependency-mismatch";
+
+ var previous = this.previousValue(element);
+ if (!this.settings.messages[element.name])
+ this.settings.messages[element.name] = {};
+ previous.originalMessage = this.settings.messages[element.name].remote;
+ this.settings.messages[element.name].remote = previous.message;
+
+ param = typeof param == "string" && { url: param} || param;
+
+ if (this.pending[element.name]) {
+ return "pending";
+ }
+ if (previous.old === value) {
+ return previous.valid;
+ }
+
+ previous.old = value;
+ var validator = this;
+ this.startRequest(element);
+ var data = {};
+ data[element.name] = value;
+ $.ajax($.extend(true, {
+ url: param,
+ mode: "abort",
+ port: "validate" + element.name,
+ dataType: "json",
+ data: data,
+ success: function (response) {
+ validator.settings.messages[element.name].remote = previous.originalMessage;
+ var valid = response === true;
+ if (valid) {
+ var submitted = validator.formSubmitted;
+ validator.prepareElement(element);
+ validator.formSubmitted = submitted;
+ validator.successList.push(element);
+ validator.showErrors();
+ } else {
+ var errors = {};
+ var message = response || validator.defaultMessage(element, "remote");
+ errors[element.name] = previous.message = $.isFunction(message) ? message(value) : message;
+ validator.showErrors(errors);
+ }
+ previous.valid = valid;
+ validator.stopRequest(element, valid);
+ }
+ }, param));
+ return "pending";
+ },
+
+ // http://docs.jquery.com/Plugins/Validation/Methods/minlength
+ minlength: function (value, element, param) {
+ return this.optional(element) || this.getLength($.trim(value), element) >= param;
+ },
+
+ // http://docs.jquery.com/Plugins/Validation/Methods/maxlength
+ maxlength: function (value, element, param) {
+ return this.optional(element) || this.getLength($.trim(value), element) <= param;
+ },
+
+ // http://docs.jquery.com/Plugins/Validation/Methods/rangelength
+ rangelength: function (value, element, param) {
+ var length = this.getLength($.trim(value), element);
+ return this.optional(element) || (length >= param[0] && length <= param[1]);
+ },
+
+ // http://docs.jquery.com/Plugins/Validation/Methods/min
+ min: function (value, element, param) {
+ return this.optional(element) || value >= param;
+ },
+
+ // http://docs.jquery.com/Plugins/Validation/Methods/max
+ max: function (value, element, param) {
+ return this.optional(element) || value <= param;
+ },
+
+ // http://docs.jquery.com/Plugins/Validation/Methods/range
+ range: function (value, element, param) {
+ return this.optional(element) || (value >= param[0] && value <= param[1]);
+ },
+
+ // http://docs.jquery.com/Plugins/Validation/Methods/email
+ email: function (value, element) {
+ // contributed by Scott Gonzalez: http://projects.scottsplayground.com/email_address_validation/
+ return this.optional(element) || /^((([a-z]|\d|[!#\$%&'\*\+\-\/=\?\^_`{\|}~]|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])+(\.([a-z]|\d|[!#\$%&'\*\+\-\/=\?\^_`{\|}~]|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])+)*)|((\x22)((((\x20|\x09)*(\x0d\x0a))?(\x20|\x09)+)?(([\x01-\x08\x0b\x0c\x0e-\x1f\x7f]|\x21|[\x23-\x5b]|[\x5d-\x7e]|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])|(\\([\x01-\x09\x0b\x0c\x0d-\x7f]|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF]))))*(((\x20|\x09)*(\x0d\x0a))?(\x20|\x09)+)?(\x22)))@((([a-z]|\d|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])|(([a-z]|\d|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])([a-z]|\d|-|\.|_|~|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])*([a-z]|\d|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])))\.)+(([a-z]|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])|(([a-z]|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])([a-z]|\d|-|\.|_|~|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])*([a-z]|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])))$/i.test(value);
+ },
+
+ // http://docs.jquery.com/Plugins/Validation/Methods/url
+ url: function (value, element) {
+ // contributed by Scott Gonzalez: http://projects.scottsplayground.com/iri/
+ return this.optional(element) || /^(https?|ftp):\/\/(((([a-z]|\d|-|\.|_|~|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])|(%[\da-f]{2})|[!\$&'\(\)\*\+,;=]|:)*@)?(((\d|[1-9]\d|1\d\d|2[0-4]\d|25[0-5])\.(\d|[1-9]\d|1\d\d|2[0-4]\d|25[0-5])\.(\d|[1-9]\d|1\d\d|2[0-4]\d|25[0-5])\.(\d|[1-9]\d|1\d\d|2[0-4]\d|25[0-5]))|((([a-z]|\d|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])|(([a-z]|\d|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])([a-z]|\d|-|\.|_|~|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])*([a-z]|\d|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])))\.)+(([a-z]|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])|(([a-z]|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])([a-z]|\d|-|\.|_|~|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])*([a-z]|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])))\.?)(:\d*)?)(\/((([a-z]|\d|-|\.|_|~|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])|(%[\da-f]{2})|[!\$&'\(\)\*\+,;=]|:|@)+(\/(([a-z]|\d|-|\.|_|~|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])|(%[\da-f]{2})|[!\$&'\(\)\*\+,;=]|:|@)*)*)?)?(\?((([a-z]|\d|-|\.|_|~|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])|(%[\da-f]{2})|[!\$&'\(\)\*\+,;=]|:|@)|[\uE000-\uF8FF]|\/|\?)*)?(\#((([a-z]|\d|-|\.|_|~|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])|(%[\da-f]{2})|[!\$&'\(\)\*\+,;=]|:|@)|\/|\?)*)?$/i.test(value);
+ },
+
+ // http://docs.jquery.com/Plugins/Validation/Methods/date
+ date: function (value, element) {
+ return this.optional(element) || !/Invalid|NaN/.test(new Date(value));
+ },
+
+ // http://docs.jquery.com/Plugins/Validation/Methods/dateISO
+ dateISO: function (value, element) {
+ return this.optional(element) || /^\d{4}[\/-]\d{1,2}[\/-]\d{1,2}$/.test(value);
+ },
+
+ // http://docs.jquery.com/Plugins/Validation/Methods/number
+ number: function (value, element) {
+ return this.optional(element) || /^-?(?:\d+|\d{1,3}(?:,\d{3})+)(?:\.\d+)?$/.test(value);
+ },
+
+ // http://docs.jquery.com/Plugins/Validation/Methods/digits
+ digits: function (value, element) {
+ return this.optional(element) || /^\d+$/.test(value);
+ },
+
+ // http://docs.jquery.com/Plugins/Validation/Methods/creditcard
+ // based on http://en.wikipedia.org/wiki/Luhn
+ creditcard: function (value, element) {
+ if (this.optional(element))
+ return "dependency-mismatch";
+ // accept only spaces, digits and dashes
+ if (/[^0-9 -]+/.test(value))
+ return false;
+ var nCheck = 0,
+ nDigit = 0,
+ bEven = false;
+
+ value = value.replace(/\D/g, "");
+
+ for (var n = value.length - 1; n >= 0; n--) {
+ var cDigit = value.charAt(n);
+ var nDigit = parseInt(cDigit, 10);
+ if (bEven) {
+ if ((nDigit *= 2) > 9)
+ nDigit -= 9;
+ }
+ nCheck += nDigit;
+ bEven = !bEven;
+ }
+
+ return (nCheck % 10) == 0;
+ },
+
+ // http://docs.jquery.com/Plugins/Validation/Methods/accept
+ accept: function (value, element, param) {
+ param = typeof param == "string" ? param.replace(/,/g, '|') : "png|jpe?g|gif";
+ return this.optional(element) || value.match(new RegExp(".(" + param + ")$", "i"));
+ },
+
+ // http://docs.jquery.com/Plugins/Validation/Methods/equalTo
+ equalTo: function (value, element, param) {
+ // bind to the blur event of the target in order to revalidate whenever the target field is updated
+ // TODO find a way to bind the event just once, avoiding the unbind-rebind overhead
+ var target = $(param).unbind(".validate-equalTo").bind("blur.validate-equalTo", function () {
+ $(element).valid();
+ });
+ return value == target.val();
+ }
+
+ }
+
+ });
+
+ // deprecated, use $.validator.format instead
+ $.format = $.validator.format;
+
+})(jQuery);
+
+// ajax mode: abort
+// usage: $.ajax({ mode: "abort"[, port: "uniqueport"]});
+// if mode:"abort" is used, the previous request on that port (port can be undefined) is aborted via XMLHttpRequest.abort()
+; (function ($) {
+ var pendingRequests = {};
+ // Use a prefilter if available (1.5+)
+ if ($.ajaxPrefilter) {
+ $.ajaxPrefilter(function (settings, _, xhr) {
+ var port = settings.port;
+ if (settings.mode == "abort") {
+ if (pendingRequests[port]) {
+ pendingRequests[port].abort();
+ }
+ pendingRequests[port] = xhr;
+ }
+ });
+ } else {
+ // Proxy ajax
+ var ajax = $.ajax;
+ $.ajax = function (settings) {
+ var mode = ("mode" in settings ? settings : $.ajaxSettings).mode,
+ port = ("port" in settings ? settings : $.ajaxSettings).port;
+ if (mode == "abort") {
+ if (pendingRequests[port]) {
+ pendingRequests[port].abort();
+ }
+ return (pendingRequests[port] = ajax.apply(this, arguments));
+ }
+ return ajax.apply(this, arguments);
+ };
+ }
+})(jQuery);
+
+// provides cross-browser focusin and focusout events
+// IE has native support, in other browsers, use event caputuring (neither bubbles)
+
+// provides delegate(type: String, delegate: Selector, handler: Callback) plugin for easier event delegation
+// handler is only called when $(event.target).is(delegate), in the scope of the jquery-object for event.target
+; (function ($) {
+ // only implement if not provided by jQuery core (since 1.4)
+ // TODO verify if jQuery 1.4's implementation is compatible with older jQuery special-event APIs
+ if (!jQuery.event.special.focusin && !jQuery.event.special.focusout && document.addEventListener) {
+ $.each({
+ focus: 'focusin',
+ blur: 'focusout'
+ }, function (original, fix) {
+ $.event.special[fix] = {
+ setup: function () {
+ this.addEventListener(original, handler, true);
+ },
+ teardown: function () {
+ this.removeEventListener(original, handler, true);
+ },
+ handler: function (e) {
+ arguments[0] = $.event.fix(e);
+ arguments[0].type = fix;
+ return $.event.handle.apply(this, arguments);
+ }
+ };
+ function handler(e) {
+ e = $.event.fix(e);
+ e.type = fix;
+ return $.event.handle.call(this, e);
+ }
+ });
+ };
+ $.extend($.fn, {
+ validateDelegate: function (delegate, type, handler) {
+ return this.bind(type, function (event) {
+ var target = $(event.target);
+ if (target.is(delegate)) {
+ return handler.apply(target, arguments);
+ }
+ });
+ }
+ });
+})(jQuery);
diff --git a/src/Umbraco.Web.UI/Umbraco/plugins/umbracoContour/scripts/jquery.validate.min.js b/src/Umbraco.Web.UI/Umbraco/plugins/umbracoContour/scripts/jquery.validate.min.js
new file mode 100644
index 0000000000..b07c2ab2da
--- /dev/null
+++ b/src/Umbraco.Web.UI/Umbraco/plugins/umbracoContour/scripts/jquery.validate.min.js
@@ -0,0 +1,53 @@
+/**
+* Note: While Microsoft is not the author of this file, Microsoft is
+* offering you a license subject to the terms of the Microsoft Software
+* License Terms for Microsoft ASP.NET Model View Controller 3.
+* Microsoft reserves all other rights. The notices below are provided
+* for informational purposes only and are not the license terms under
+* which Microsoft distributed this file.
+*
+* jQuery Validation Plugin 1.8.0
+*
+* http://bassistance.de/jquery-plugins/jquery-plugin-validation/
+* http://docs.jquery.com/Plugins/Validation
+*
+* Copyright (c) 2006 - 2011 Jörn Zaefferer
+*/
+(function(c){c.extend(c.fn,{validate:function(a){if(this.length){var b=c.data(this[0],"validator");if(b)return b;b=new c.validator(a,this[0]);c.data(this[0],"validator",b);if(b.settings.onsubmit){this.find("input, button").filter(".cancel").click(function(){b.cancelSubmit=true});b.settings.submitHandler&&this.find("input, button").filter(":submit").click(function(){b.submitButton=this});this.submit(function(d){function e(){if(b.settings.submitHandler){if(b.submitButton)var f=c("Warning: No message defined for "+a.name+"")},formatAndAdd:function(a,b){var d=this.defaultMessage(a,b.method),e=/\$?\{(\d+)\}/g;if(typeof d=="function")d=d.call(this,b.parameters,a);else if(e.test(d))d=jQuery.format(d.replace(e,"{$1}"),b.parameters);this.errorList.push({message:d,
+element:a});this.errorMap[a.name]=d;this.submitted[a.name]=d},addWrapper:function(a){if(this.settings.wrapper)a=a.add(a.parent(this.settings.wrapper));return a},defaultShowErrors:function(){for(var a=0;this.errorList[a];a++){var b=this.errorList[a];this.settings.highlight&&this.settings.highlight.call(this,b.element,this.settings.errorClass,this.settings.validClass);this.showLabel(b.element,b.message)}if(this.errorList.length)this.toShow=this.toShow.add(this.containers);if(this.settings.success)for(a=
+0;this.successList[a];a++)this.showLabel(this.successList[a]);if(this.settings.unhighlight){a=0;for(b=this.validElements();b[a];a++)this.settings.unhighlight.call(this,b[a],this.settings.errorClass,this.settings.validClass)}this.toHide=this.toHide.not(this.toShow);this.hideErrors();this.addWrapper(this.toShow).show()},validElements:function(){return this.currentElements.not(this.invalidElements())},invalidElements:function(){return c(this.errorList).map(function(){return this.element})},showLabel:function(a,
+b){var d=this.errorsFor(a);if(d.length){d.removeClass().addClass(this.settings.errorClass);d.attr("generated")&&d.html(b)}else{d=c("<"+this.settings.errorElement+"/>").attr({"for":this.idOrName(a),generated:true}).addClass(this.settings.errorClass).html(b||"");if(this.settings.wrapper)d=d.hide().show().wrap("<"+this.settings.wrapper+"/>").parent();this.labelContainer.append(d).length||(this.settings.errorPlacement?this.settings.errorPlacement(d,c(a)):d.insertAfter(a))}if(!b&&this.settings.success){d.text("");
+typeof this.settings.success=="string"?d.addClass(this.settings.success):this.settings.success(d)}this.toShow=this.toShow.add(d)},errorsFor:function(a){var b=this.idOrName(a);return this.errors().filter(function(){return c(this).attr("for")==b})},idOrName:function(a){return this.groups[a.name]||(this.checkable(a)?a.name:a.id||a.name)},checkable:function(a){return/radio|checkbox/i.test(a.type)},findByName:function(a){var b=this.currentForm;return c(document.getElementsByName(a)).map(function(d,e){return e.form==
+b&&e.name==a&&e||null})},getLength:function(a,b){switch(b.nodeName.toLowerCase()){case "select":return c("option:selected",b).length;case "input":if(this.checkable(b))return this.findByName(b.name).filter(":checked").length}return a.length},depend:function(a,b){return this.dependTypes[typeof a]?this.dependTypes[typeof a](a,b):true},dependTypes:{"boolean":function(a){return a},string:function(a,b){return!!c(a,b.form).length},"function":function(a,b){return a(b)}},optional:function(a){return!c.validator.methods.required.call(this,
+c.trim(a.value),a)&&"dependency-mismatch"},startRequest:function(a){if(!this.pending[a.name]){this.pendingRequest++;this.pending[a.name]=true}},stopRequest:function(a,b){this.pendingRequest--;if(this.pendingRequest<0)this.pendingRequest=0;delete this.pending[a.name];if(b&&this.pendingRequest==0&&this.formSubmitted&&this.form()){c(this.currentForm).submit();this.formSubmitted=false}else if(!b&&this.pendingRequest==0&&this.formSubmitted){c(this.currentForm).triggerHandler("invalid-form",[this]);this.formSubmitted=
+false}},previousValue:function(a){return c.data(a,"previousValue")||c.data(a,"previousValue",{old:null,valid:true,message:this.defaultMessage(a,"remote")})}},classRuleSettings:{required:{required:true},email:{email:true},url:{url:true},date:{date:true},dateISO:{dateISO:true},dateDE:{dateDE:true},number:{number:true},numberDE:{numberDE:true},digits:{digits:true},creditcard:{creditcard:true}},addClassRules:function(a,b){a.constructor==String?this.classRuleSettings[a]=b:c.extend(this.classRuleSettings,
+a)},classRules:function(a){var b={};(a=c(a).attr("class"))&&c.each(a.split(" "),function(){this in c.validator.classRuleSettings&&c.extend(b,c.validator.classRuleSettings[this])});return b},attributeRules:function(a){var b={};a=c(a);for(var d in c.validator.methods){var e=a.attr(d);if(e)b[d]=e}b.maxlength&&/-1|2147483647|524288/.test(b.maxlength)&&delete b.maxlength;return b},metadataRules:function(a){if(!c.metadata)return{};var b=c.data(a.form,"validator").settings.meta;return b?c(a).metadata()[b]:
+c(a).metadata()},staticRules:function(a){var b={},d=c.data(a.form,"validator");if(d.settings.rules)b=c.validator.normalizeRule(d.settings.rules[a.name])||{};return b},normalizeRules:function(a,b){c.each(a,function(d,e){if(e===false)delete a[d];else if(e.param||e.depends){var f=true;switch(typeof e.depends){case "string":f=!!c(e.depends,b.form).length;break;case "function":f=e.depends.call(b,b)}if(f)a[d]=e.param!==undefined?e.param:true;else delete a[d]}});c.each(a,function(d,e){a[d]=c.isFunction(e)?
+e(b):e});c.each(["minlength","maxlength","min","max"],function(){if(a[this])a[this]=Number(a[this])});c.each(["rangelength","range"],function(){if(a[this])a[this]=[Number(a[this][0]),Number(a[this][1])]});if(c.validator.autoCreateRanges){if(a.min&&a.max){a.range=[a.min,a.max];delete a.min;delete a.max}if(a.minlength&&a.maxlength){a.rangelength=[a.minlength,a.maxlength];delete a.minlength;delete a.maxlength}}a.messages&&delete a.messages;return a},normalizeRule:function(a){if(typeof a=="string"){var b=
+{};c.each(a.split(/\s/),function(){b[this]=true});a=b}return a},addMethod:function(a,b,d){c.validator.methods[a]=b;c.validator.messages[a]=d!=undefined?d:c.validator.messages[a];b.length<3&&c.validator.addClassRules(a,c.validator.normalizeRule(a))},methods:{required:function(a,b,d){if(!this.depend(d,b))return"dependency-mismatch";switch(b.nodeName.toLowerCase()){case "select":return(a=c(b).val())&&a.length>0;case "input":if(this.checkable(b))return this.getLength(a,b)>0;default:return c.trim(a).length>
+0}},remote:function(a,b,d){if(this.optional(b))return"dependency-mismatch";var e=this.previousValue(b);this.settings.messages[b.name]||(this.settings.messages[b.name]={});e.originalMessage=this.settings.messages[b.name].remote;this.settings.messages[b.name].remote=e.message;d=typeof d=="string"&&{url:d}||d;if(this.pending[b.name])return"pending";if(e.old===a)return e.valid;e.old=a;var f=this;this.startRequest(b);var g={};g[b.name]=a;c.ajax(c.extend(true,{url:d,mode:"abort",port:"validate"+b.name,
+dataType:"json",data:g,success:function(h){f.settings.messages[b.name].remote=e.originalMessage;var j=h===true;if(j){var i=f.formSubmitted;f.prepareElement(b);f.formSubmitted=i;f.successList.push(b);f.showErrors()}else{i={};h=h||f.defaultMessage(b,"remote");i[b.name]=e.message=c.isFunction(h)?h(a):h;f.showErrors(i)}e.valid=j;f.stopRequest(b,j)}},d));return"pending"},minlength:function(a,b,d){return this.optional(b)||this.getLength(c.trim(a),b)>=d},maxlength:function(a,b,d){return this.optional(b)||
+this.getLength(c.trim(a),b)<=d},rangelength:function(a,b,d){a=this.getLength(c.trim(a),b);return this.optional(b)||a>=d[0]&&a<=d[1]},min:function(a,b,d){return this.optional(b)||a>=d},max:function(a,b,d){return this.optional(b)||a<=d},range:function(a,b,d){return this.optional(b)||a>=d[0]&&a<=d[1]},email:function(a,b){return this.optional(b)||/^((([a-z]|\d|[!#\$%&'\*\+\-\/=\?\^_`{\|}~]|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])+(\.([a-z]|\d|[!#\$%&'\*\+\-\/=\?\^_`{\|}~]|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])+)*)|((\x22)((((\x20|\x09)*(\x0d\x0a))?(\x20|\x09)+)?(([\x01-\x08\x0b\x0c\x0e-\x1f\x7f]|\x21|[\x23-\x5b]|[\x5d-\x7e]|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])|(\\([\x01-\x09\x0b\x0c\x0d-\x7f]|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF]))))*(((\x20|\x09)*(\x0d\x0a))?(\x20|\x09)+)?(\x22)))@((([a-z]|\d|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])|(([a-z]|\d|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])([a-z]|\d|-|\.|_|~|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])*([a-z]|\d|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])))\.)+(([a-z]|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])|(([a-z]|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])([a-z]|\d|-|\.|_|~|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])*([a-z]|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])))\.?$/i.test(a)},
+url:function(a,b){return this.optional(b)||/^(https?|ftp):\/\/(((([a-z]|\d|-|\.|_|~|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])|(%[\da-f]{2})|[!\$&'\(\)\*\+,;=]|:)*@)?(((\d|[1-9]\d|1\d\d|2[0-4]\d|25[0-5])\.(\d|[1-9]\d|1\d\d|2[0-4]\d|25[0-5])\.(\d|[1-9]\d|1\d\d|2[0-4]\d|25[0-5])\.(\d|[1-9]\d|1\d\d|2[0-4]\d|25[0-5]))|((([a-z]|\d|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])|(([a-z]|\d|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])([a-z]|\d|-|\.|_|~|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])*([a-z]|\d|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])))\.)+(([a-z]|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])|(([a-z]|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])([a-z]|\d|-|\.|_|~|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])*([a-z]|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])))\.?)(:\d*)?)(\/((([a-z]|\d|-|\.|_|~|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])|(%[\da-f]{2})|[!\$&'\(\)\*\+,;=]|:|@)+(\/(([a-z]|\d|-|\.|_|~|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])|(%[\da-f]{2})|[!\$&'\(\)\*\+,;=]|:|@)*)*)?)?(\?((([a-z]|\d|-|\.|_|~|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])|(%[\da-f]{2})|[!\$&'\(\)\*\+,;=]|:|@)|[\uE000-\uF8FF]|\/|\?)*)?(\#((([a-z]|\d|-|\.|_|~|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])|(%[\da-f]{2})|[!\$&'\(\)\*\+,;=]|:|@)|\/|\?)*)?$/i.test(a)},
+date:function(a,b){return this.optional(b)||!/Invalid|NaN/.test(new Date(a))},dateISO:function(a,b){return this.optional(b)||/^\d{4}[\/-]\d{1,2}[\/-]\d{1,2}$/.test(a)},number:function(a,b){return this.optional(b)||/^-?(?:\d+|\d{1,3}(?:,\d{3})+)(?:\.\d+)?$/.test(a)},digits:function(a,b){return this.optional(b)||/^\d+$/.test(a)},creditcard:function(a,b){if(this.optional(b))return"dependency-mismatch";if(/[^0-9-]+/.test(a))return false;var d=0,e=0,f=false;a=a.replace(/\D/g,"");for(var g=a.length-1;g>=
+0;g--){e=a.charAt(g);e=parseInt(e,10);if(f)if((e*=2)>9)e-=9;d+=e;f=!f}return d%10==0},accept:function(a,b,d){d=typeof d=="string"?d.replace(/,/g,"|"):"png|jpe?g|gif";return this.optional(b)||a.match(RegExp(".("+d+")$","i"))},equalTo:function(a,b,d){d=c(d).unbind(".validate-equalTo").bind("blur.validate-equalTo",function(){c(b).valid()});return a==d.val()}}});c.format=c.validator.format})(jQuery);
+(function(c){var a={};if(c.ajaxPrefilter)c.ajaxPrefilter(function(d,e,f){e=d.port;if(d.mode=="abort"){a[e]&&a[e].abort();a[e]=f}});else{var b=c.ajax;c.ajax=function(d){var e=("port"in d?d:c.ajaxSettings).port;if(("mode"in d?d:c.ajaxSettings).mode=="abort"){a[e]&&a[e].abort();return a[e]=b.apply(this,arguments)}return b.apply(this,arguments)}}})(jQuery);
+(function(c){!jQuery.event.special.focusin&&!jQuery.event.special.focusout&&document.addEventListener&&c.each({focus:"focusin",blur:"focusout"},function(a,b){function d(e){e=c.event.fix(e);e.type=b;return c.event.handle.call(this,e)}c.event.special[b]={setup:function(){this.addEventListener(a,d,true)},teardown:function(){this.removeEventListener(a,d,true)},handler:function(e){arguments[0]=c.event.fix(e);arguments[0].type=b;return c.event.handle.apply(this,arguments)}}});c.extend(c.fn,{validateDelegate:function(a,
+b,d){return this.bind(b,function(e){var f=c(e.target);if(f.is(a))return d.apply(f,arguments)})}})})(jQuery);
diff --git a/src/Umbraco.Web.UI/Umbraco/plugins/umbracoContour/scripts/jquery.validate.unobtrusive.min.js b/src/Umbraco.Web.UI/Umbraco/plugins/umbracoContour/scripts/jquery.validate.unobtrusive.min.js
new file mode 100644
index 0000000000..e0d8fd5c15
--- /dev/null
+++ b/src/Umbraco.Web.UI/Umbraco/plugins/umbracoContour/scripts/jquery.validate.unobtrusive.min.js
@@ -0,0 +1,5 @@
+/*
+** Unobtrusive validation support library for jQuery and jQuery Validate
+** Copyright (C) Microsoft Corporation. All rights reserved.
+*/
+(function(a){var d=a.validator,b,f="unobtrusiveValidation";function c(a,b,c){a.rules[b]=c;if(a.message)a.messages[b]=a.message}function i(a){return a.replace(/^\s+|\s+$/g,"").split(/\s*,\s*/g)}function g(a){return a.substr(0,a.lastIndexOf(".")+1)}function e(a,b){if(a.indexOf("*.")===0)a=a.replace("*.",b);return a}function l(c,d){var b=a(this).find("[data-valmsg-for='"+d[0].name+"']"),e=a.parseJSON(b.attr("data-valmsg-replace"))!==false;b.removeClass("field-validation-valid").addClass("field-validation-error");c.data("unobtrusiveContainer",b);if(e){b.empty();c.removeClass("input-validation-error").appendTo(b)}else c.hide()}function k(e,d){var c=a(this).find("[data-valmsg-summary=true]"),b=c.find("ul");if(b&&b.length&&d.errorList.length){b.empty();c.addClass("validation-summary-errors").removeClass("validation-summary-valid");a.each(d.errorList,function(){a("Add mapping ").insertBefore(lastfield);
+
+ //show remove on existing mappings
+ jQuery("div.mapping").not("div.mapping:last").children("a").show();
+
+ //make sure changes are also stored
+ jQuery("div.mapping").not("div.mapping:last").each(function () {
+ jQuery("select, input.alias, input.value", this).change(function () {
+ storeValues();
+ });
+ });
+})
+
+
+function removeValue(link){
+
+ var clone = jQuery(link).parent().clone();
+ jQuery(link).parent().remove();
+
+ var mapper = jQuery("#fieldMapper");
+
+ if(jQuery("div.mapping", mapper).length == 0){
+ jQuery("input", clone).val("");
+ jQuery("select", clone).val("");
+ jQuery("a", clone).hide();
+
+ clone.appendTo(mapper);
+ }
+
+ storeValues();
+}
+
+function pickfield(select) {
+
+ var control = jQuery(select);
+
+ if (control.val() == "__setValue") {
+ jQuery("input.value", control.parent()).show();
+ jQuery("select", control.parent()).hide();
+ }
+
+
+}
+
+function addValue(){
+
+ var mapper = jQuery("#fieldMapper");
+ var field = jQuery("div.mapping:first", mapper);
+
+ jQuery("a", mapper).show();
+
+ var clone = field.clone();
+ jQuery("input", clone).val("");
+ jQuery("select", clone).val("").show();
+ jQuery("input.value", clone).hide();
+ jQuery("a", clone).hide();
+
+ jQuery(".addmapping").appendTo(mapper);
+ clone.appendTo(mapper);
+
+ storeValues();
+}
+
+function storeValues(){
+
+ var mapper = jQuery("#fieldMapper");
+
+ var hiddenField = jQuery("#fieldmapperValues");
+ var vals = "";
+
+ jQuery("div.mapping", mapper).each(function(){
+ var alias = jQuery("input.alias", this).val();
+
+ if(alias != ""){
+ var field = jQuery("select", this).val();
+ var defaultVal = jQuery("input.value", this).val();
+
+ vals += alias + "," + field + "," + defaultVal + ";";
+ }
+
+ })
+
+
+ hiddenField.val(vals);
+ }
\ No newline at end of file
diff --git a/src/Umbraco.Web.UI/Umbraco/plugins/umbracoContour/scripts/umbracoforms.formpickercreateformdialog.eventhandlers.js b/src/Umbraco.Web.UI/Umbraco/plugins/umbracoContour/scripts/umbracoforms.formpickercreateformdialog.eventhandlers.js
new file mode 100644
index 0000000000..0f6584f594
--- /dev/null
+++ b/src/Umbraco.Web.UI/Umbraco/plugins/umbracoContour/scripts/umbracoforms.formpickercreateformdialog.eventhandlers.js
@@ -0,0 +1,37 @@
+myDesignSurface.addEventListener("SaveDesign", "savedesign", function(formguid, design) {
+
+
+ var formname = $("#" + formname_id).val();
+ var formmanualapproval = $("#" + formmanualapproval_id).attr('checked');
+ var formsubmitmessage = $("#" + formsubmitmessage_id).val();
+ var formsubmitpage = $("#" + formsubmitpage_id + " .picker input").val();
+ var formshowvalsum = $("#" + formshowvalidationsum_id).attr('checked');
+ var formhidefieldval = $("#" + formhidefieldvalidation_id).attr('checked');
+
+ var formrequirederrormessage = $("#" + formrequirederrormessage_id).val();
+ var forminvaliderrormessage = $("#" + forminvaliderrormessage_id).val();
+
+ var formfieldindicationtype = 0;
+
+ if ($("#" + formmandatoryonly_id).attr('checked')) {
+ formfieldindicationtype = 1;
+ }
+ if ($("#" + formoptionalonly_id).attr('checked')) {
+ formfieldindicationtype = 2;
+ }
+
+ var formindicator = $("#" + formindicator_id).val();
+ var formdisablestylesheet = $("#" + formdisablestylesheet_id).attr('checked');
+
+ //Call save method of designer webservice
+ Umbraco.Forms.UI.Webservices.Designer.Save(formguid, formname, formmanualapproval, formsubmitmessage, formsubmitpage, formrequirederrormessage, forminvaliderrormessage, formshowvalsum, formhidefieldval, design, formfieldindicationtype, formindicator, formdisablestylesheet, SaveSucces, SaveFailure);
+});
+
+
+
+function SaveSucces(retVal) {
+ jQuery("#submitbutton").attr("disabled", false);
+}
+function SaveFailure(retVal) {
+ alert("Failed to save form");
+}
\ No newline at end of file
diff --git a/src/Umbraco.Web.UI/Umbraco/plugins/umbracoContour/scripts/umbracoforms.js b/src/Umbraco.Web.UI/Umbraco/plugins/umbracoContour/scripts/umbracoforms.js
new file mode 100644
index 0000000000..d64b3f4dde
--- /dev/null
+++ b/src/Umbraco.Web.UI/Umbraco/plugins/umbracoContour/scripts/umbracoforms.js
@@ -0,0 +1,1808 @@
+var myDesignSurface = new DesignSurface();
+var pageguid = 0;
+var fieldsetguid = 0;
+var fieldguid = 0;
+var currentpage = 0;
+var addfield = true;
+var fieldToUpdate;
+var fieldToUpdatePrevalues;
+
+$(document).ready(function () {
+
+
+ // $("#designsurface").sortable({
+ // handle: '.handle',
+ // update: function() {
+
+ // var sortorder = $('#designsurface').sortable('serialize');
+ // myDesignSurface.UpdatePageSortOrder(sortorder);
+ // }
+ // });
+
+
+ $(".fieldsetcontainer").sortable({
+ handle: '.handle',
+ connectWith: '.fieldsetcontainer'
+ });
+
+ $(".fieldcontainer").sortable({
+ handle: '.handle',
+ connectWith: '.fieldcontainer'
+ });
+
+ $("#" + addpage_id).click(function () {
+
+ ShowAddPageDialog();
+
+ });
+
+ ToggleAddFieldsetAction();
+ ToggleAddFieldAction();
+
+ $(".CancelModal").click(function () {
+ CloseDialog();
+ });
+
+ $("#addprevalue").click(function () {
+
+ AddPrevalue();
+ });
+
+ $("#editaddprevalue").click(function () {
+
+ EditAddPrevalue();
+ });
+
+ $("#fieldpageselect").change(function () {
+ $('#fieldfieldsetselect').children().remove();
+
+ $("#" + $("#fieldpageselect").val() + " .fieldset").each(function () {
+ var text = $(this).children(".fieldsetname").text();
+ var value = $(this).attr("id");
+ $("#fieldfieldsetselect").append($("" + $(this).attr("fieldcaption") + " ");
+ });
+}
+//function DimHiddenFields() {
+// $(".field").each(function () {
+// if ($(this).attr("") == "0" && ($(this).attr("fieldenablecondition") == "True" || $(this).attr("fieldenablecondition") == "true")) {
+// $(".fieldexamplelabel", $(this)).addClass("grey");
+// }
+// });
+//}
+function AddUpdateField() {
+
+ if (addfield) {
+
+ AddField();
+ }
+ else {
+ UpdateField(fieldToUpdate);
+ }
+}
+
+function SetFieldHover() {
+
+ $('.field').hover(function() {
+
+ $(this).addClass('activefield');
+
+ }, function() {
+
+ $(this).removeClass('activefield');
+
+ });
+
+}
+
+function SetPrevalueHover() {
+
+
+
+ $("#editprevaluelist li").live({
+ mouseenter:
+ function () {
+ $(this).addClass('activeprevalue');
+ },
+ mouseleave:
+ function () {
+ $(this).removeClass('activeprevalue');
+ }
+ }
+ );
+
+}
+
+
+function ShowPage(page) {
+ currentpage = page;
+ $(".page").hide();
+ $(".page:nth-child(" + currentpage + ")").show();
+
+ if (currentpage == 1) {
+ $("#stepnavprev").hide();
+
+ } else {
+ $("#stepnavprev").show();
+ }
+ if ($(".page").size() == currentpage) {
+ $("#stepnavnext").hide();
+ $("#stepnavnew").show();
+ }
+ else {
+ $("#stepnavnext").show();
+ $("#stepnavnew").hide();
+ }
+
+}
+function ShowNextPage() {
+
+
+
+ $(".page:nth-child(" + currentpage + ")").hide();
+ currentpage++;
+ $(".page:nth-child(" + currentpage + ")").show();
+
+ if (currentpage > 1) {
+ $("#stepnavprev").show();
+ }
+ else {
+ $("#stepnavprev").hide();
+ }
+ if ($(".page").size() == currentpage) {
+ $("#stepnavnext").hide();
+ $("#stepnavnew").show();
+ }
+}
+
+function ShowPreviousPage() {
+
+ if (currentpage > 1) {
+ $(".page:nth-child(" + currentpage + ")").hide();
+ currentpage--;
+ }
+ $(".page:nth-child(" + currentpage + ")").show();
+
+ if($(".page").size() == currentpage)
+ {
+ $("#stepnavnext").hide();
+ $("#stepnavnew").show();
+ }
+ else
+ {
+ $("#stepnavnext").show();
+ $("#stepnavnew").hide();
+ }
+ if (currentpage == 1) {
+ $("#stepnavprev").hide();
+
+ }
+}
+function SetupStepsNavigation() {
+
+ if($(".page").size() == 0)
+ {
+ $("#stepnavprev").hide();
+ $("#stepnavnext").hide();
+ $("#stepnavnew").show();
+ }
+ else if ($(".page").size() == 1) {
+
+ currentpage = 1;
+ $(".page:nth-child(1)").show();
+ $("#stepnavprev").hide();
+ $("#stepnavnext").hide();
+ $("#stepnavnew").show();
+
+ $(".page .pageheader .delete").hide();
+ }
+ else {
+
+ currentpage = 1;
+ $(".page:nth-child(1)").show();
+ $("#stepnavprev").hide();
+ $("#stepnavnew").hide();
+ $("#stepnavnext").show();
+ }
+
+}
+
+function ToggleAddFieldsetAction() {
+
+ $("#" + addfieldset_id).unbind('click');
+
+ if ($('#designsurface').children().size() > 0) {
+ $("#" + addfieldset_id).removeClass("disabled");
+ $("#" + addfieldset_id).click(function() {
+ ShowAddFieldsetDialog(null);
+ });
+ }
+ else {
+
+ $("#" + addfieldset_id).addClass("disabled");
+
+ $("#" + addfieldset_id).click(function(e) {
+ e.preventDefault();
+ });
+
+ }
+}
+
+function ToggleAddFieldAction() {
+
+ $("#" + addfield_id).unbind('click');
+
+ if ($(".fieldset").size() > 0) {
+ $("#" + addfield_id).removeClass("disabled");
+ $("#" + addfield_id).click(function() {
+ ShowAddFieldDialog(null);
+ });
+ }
+ else {
+
+ $("#" + addfield_id).addClass("disabled");
+
+ $("#" + addfield_id).click(function(e) {
+ e.preventDefault();
+ });
+
+ }
+}
+
+function CloseDialog() {
+ $.modal.close();
+}
+
+function ShowAddPageDialog()
+{
+ /* Set Captions */
+ $('#PageModal h1').text(lang_addpage);
+ $('#PageModal #pageform .submit').attr('value', lang_addpage);
+
+ /* Clear Fields */
+ $('#NewPageName').val('');
+
+ /* Show Modal */
+ //$('#PageModal').modal();
+
+ //auto add
+
+ //$('#PageModal').appendTo("#designsurface");
+ //$('#PageModal').show();
+
+ $('#cancelpageaction').click(function() {
+ $('#PageModal').prependTo("#modals");
+ });
+
+ /* Set Focus */
+ $('#NewPageName').focus();
+
+ var form = $('#pageform').get(0);
+ $.removeData(form, 'validator');
+ $('#pageform').unbind('submit');
+
+ $("#pageform").validate({ submitHandler: function() {
+ AddPage();
+
+ }
+ });
+
+ //auto add
+ $("#NewPageName").val("Edit form step")
+ AddPage();
+}
+
+function AddPage() {
+
+ var pagenumber = pageguid;
+ pageguid = pageguid + 1;
+
+ var pagename = $("#NewPageName").val();
+ var pageid = "page_" + pagenumber;
+
+ $("#designsurface").append("");
+
+ $(".fieldsetcontainer").sortable({
+ connectWith: '.fieldsetcontainer',
+ handle : '.handle',
+ update : function () {
+ var sortorder = $('#fieldsetcontainer' + pageid).sortable('serialize');
+ myDesignSurface.UpdateFieldsetSortOrder(pageid, sortorder);
+ }
+ });
+
+ ToggleAddFieldsetAction();
+
+ //CloseDialog();
+ $('#PageModal').prependTo("#modals");
+
+ $('.editable').editable(function(value, settings) {$(this).html(value);},{ onblur: 'submit', tooltip: 'Click to edit', cssclass: 'inlineEditor'});
+
+ myDesignSurface.AddPage(pageid,pagename);
+
+ ShowNextPage();
+
+ $(".page .pageheader .delete").show();
+
+ //auto inline edit;
+ $('#' + pageid + " .pageheader .editable").click();
+
+}
+
+function ShowUpdatePageDialog(page) {
+
+
+ /* Set Captions */
+ $('#PageModal h1').text(lang_updatepage);
+ $('#PageModal #pageform .submit').attr('value',lang_updatepage);
+
+ /* Set Current Values */
+ $('#NewPageName').val($('#' + page + ' .pagename').text());
+
+
+ //$('#PageModal').modal();
+ $('#PageModal').prependTo("#" + page + " .pageeditcontainer");
+ $('#PageModal').show();
+
+ $('#cancelpageaction').click(function() {
+ $('#PageModal').prependTo("#modals");
+ });
+
+ /* Set Focus */
+ $('#NewPageName').focus();
+
+
+ var form = $('#pageform').get(0);
+ $.removeData(form, 'validator');
+ $('#pageform').unbind('submit');
+
+
+ $("#pageform").validate({ submitHandler: function() {
+
+ UpdatePage(page);
+
+ }
+ });
+}
+
+function UpdatePage(page)
+{
+ var newname = $('#NewPageName').val();
+
+ $('#' + page + ' .pagename').text(newname);
+
+ //CloseDialog();
+ $('#PageModal').prependTo("#modals");
+
+
+ $('.editable').editable(function(value, settings) {$(this).html(value);},{ onblur: 'submit', tooltip: 'Click to edit', cssclass: 'inlineEditor'});
+
+ myDesignSurface.UpdatePage(page,newname);
+}
+
+function DeletePage(page)
+{
+ if(ConfirmDelete())
+ {
+ $("#" + page).hide('blind', {}, 500, function() {
+
+
+ $('#PageModal').prependTo("#modals");
+ $('#FieldSetModal').prependTo("#modals");
+ $('#FieldModal').prependTo("#modals");
+
+ $("#" + page).remove();
+
+ if ($(".page").size() == 1) {
+ $(".page .pageheader .delete").hide();
+ }
+
+ ShowPreviousPage();
+ ToggleAddFieldsetAction();
+ myDesignSurface.DeletePage(page);
+ });
+
+
+ }
+}
+
+
+function ConfirmDelete()
+{
+ if (confirm(lang_deleteconfirm)==true)
+ return true;
+ else
+ return false;
+}
+
+function ShowAddFieldsetDialog(page) {
+
+ /* Show page selection */
+ $("#fieldsetpageselectcontainer").show();
+
+ /* Set Captions */
+ $('#FieldsetModal h1').text(lang_addfieldset);
+ $('#FieldsetModal #fieldsetform .submit').attr('value',lang_addfieldset);
+
+ /* Clear Fields */
+ $('#NewFieldsetName').val('');
+
+ if (page != null) {
+
+ $('#fieldsetpageselectcontainer').hide();
+
+ $('#cancelfieldsetaction').click(function() {
+ $('#FieldsetModal').prependTo("#modals");
+ $('#FieldsetModal').hide();
+ });
+
+ //auto add
+ //$('#FieldsetModal').appendTo("#" + page);
+ //$('#FieldsetModal').show();
+ }
+ else {
+ // auto add
+ //$('#fieldsetpageselectcontainer').show();
+ //$('#FieldsetModal').modal();
+ }
+
+ /* Set Focus */
+ $('#NewFieldsetName').focus();
+
+ $(".page").each(function() {
+ var text = $(this).children(".pagename").text();
+ var value = $(this).attr("id");
+ $("#pageselect").append($("
Add Field ");
+
+
+
+
+ $(".fieldcontainer").sortable({
+ connectWith: '.fieldcontainer',
+ handle : '.handle',
+ update : function () {
+ //$('#designsurface').sortable('serialize');
+ //alert('field sort order updated');
+ myDesignSurface.UpdateFieldSortOrder("todo","todo");
+ }
+ });
+
+ ToggleAddFieldAction();
+
+ CloseDialog();
+ $('#FieldsetModal').prependTo("#modals");
+ $('#FieldsetModal').hide();
+
+
+ $('.editable').editable(function(value, settings) {$(this).html(value);},{ onblur: 'submit', tooltip: 'Click to edit', cssclass: 'inlineEditor'});
+
+
+ //auto inline edit;
+ $('#' + newfieldsetid + " .fieldsetheader .editable").click();
+
+
+ myDesignSurface.AddFieldset(page,newfieldsetid,fieldsetname);
+}
+
+function ShowUpdateFieldsetDialog(fieldset) {
+
+ /* Hide page selection */
+ $("#fieldsetpageselectcontainer").hide();
+
+ /* Set Captions */
+ $('#FieldsetModal h1').text(lang_updatefieldset);
+ $('#FieldsetModal #fieldsetform .submit').attr('value',lang_updatefieldset);
+
+ /* Set Current Values */
+ $('#NewFieldsetName').val($('#' + fieldset + ' .fieldsetname').text());
+
+ //$('#FieldsetModal').modal();
+ $('#FieldsetModal').prependTo("#" + fieldset + " .fieldseteditcontainer");
+ $('#FieldsetModal').show();
+
+ $('#cancelfieldsetaction').click(function() {
+ $('#FieldsetModal').prependTo("#modals");
+ $('#FieldsetModal').hide();
+ });
+
+ /* Set Focus */
+ $('#NewFieldsetName').focus();
+
+ var form = $('#fieldsetform').get(0);
+ $.removeData(form, 'validator');
+ $('#fieldsetform').unbind('submit');
+
+ $("#fieldsetform").validate({submitHandler: function() {
+ UpdateFieldset(fieldset);
+
+ }});
+}
+
+function UpdateFieldset(fieldset)
+{
+ var newname = $('#NewFieldsetName').val();
+
+ $('#' + fieldset+ ' .fieldsetname').text(newname);
+
+ //CloseDialog();
+ $('#FieldsetModal').prependTo("#modals");
+ $('#FieldsetModal').hide();
+
+ $('.editable').editable(function(value, settings) {$(this).html(value);},{ onblur: 'submit', tooltip: 'Click to edit', cssclass: 'inlineEditor'});
+
+ myDesignSurface.UpdateFieldset(fieldset,newname);
+}
+
+function DeleteFieldset(fieldset)
+{
+ if(ConfirmDelete())
+ {
+ $("#" + fieldset).hide('blind', {}, 500, function() {
+ $('#FieldsetModal').prependTo("#modals");
+ $('#FieldModal').prependTo("#modals");
+ $("#" + fieldset).remove();
+ ToggleAddFieldAction();
+ myDesignSurface.DeleteFieldset(fieldset);
+ });
+
+
+ }
+}
+
+
+function ShowAddFieldDialog(fieldset) {
+
+ /* Show fieldset selection */
+ $("#fieldfieldsetselectcontainer").show();
+
+ //hide additional settings
+ $('#fieldadditionalsettings').hide();
+
+ $('#fieldconditions').hide();
+
+ /* Set Captions */
+ $('#FieldModal h1').text(lang_addfield);
+ $('#FieldModal #fieldform .submit').attr('value',lang_addfield);
+
+ /* Clear Fields */
+ $('#fieldcaption').val('');
+ //$('#fieldtype').selectedIndex = -1;
+
+ //$("#fieldtype option:first").attr('selected', 'selected');
+ $("#fieldtype option:[value='3f92e01b-29e2-4a30-bf33-9df5580ed52c']").attr('selected', 'selected');
+
+ //show fieldtype specific settings
+ ShowFieldTypeSpecificSettings('3f92e01b-29e2-4a30-bf33-9df5580ed52c');
+
+
+ $('#fieldmandatory').attr('checked', false);
+ $('#fieldregex').val('');
+ $('#fieldprevalueslist').children().remove();
+
+ $('#fieldprevalues').hide();
+
+ $("#fieldtooltip").val('');
+
+ $("#fieldrequirederrormessage").val('');
+ $("#fieldinvaliderrormessage").val('');
+
+ $("#fieldrequirederrormessagecontainer").hide();
+
+ //Set standard prevalue type
+ $('#prevaluestype').val('');
+
+ if (fieldset != null) {
+
+ $("#fieldfieldsetselectcontainer").hide();
+
+ $('#cancelfieldaction').click(function() {
+ $('#FieldModal').prependTo("#modals");
+ });
+
+ $('#FieldModal').appendTo("#" + fieldset);
+ $('#FieldModal').show();
+ }
+ else {
+ $("#fieldfieldsetselectcontainer").show();
+ $('#FieldModal').modal();
+ }
+
+ //Scroll to field modal
+ var fmPos = $("#FieldModal").position().top;
+ jQuery(".tabpagescrollinglayer").animate({ scrollTop: fmPos }, "slow");
+
+ /* Set Focus */
+ $('#fieldcaption').focus();
+
+ $(".page").each(function() {
+ var text = $(this).children(".pagename").text();
+ var value = $(this).attr("id");
+ if ($(this).children(".fieldsetcontainer").children().size() > 0) {
+ $("#fieldpageselect").append($("" + mandatorycontent + " ";
+
+
+
+ $(fieldcontainer).append("");
+
+ $(fieldcontainer).append("
");
+
+
+ $("#"+newfieldid).attr('fieldcaption',fieldcaption);
+ $("#"+newfieldid).attr('fieldtype',fieldtype);
+ $("#"+newfieldid).attr('fieldmandatory',fieldmandatory);
+ $("#" + newfieldid).attr('fieldregex', fieldregex);
+ $("#" + newfieldid).attr('fieldtooltip', fieldtooltip);
+
+ $("#" + newfieldid).attr('fieldrequirederrormessage', fieldrequirederrormessage);
+ $("#" + newfieldid).attr('fieldinvaliderrormessage', fieldinvaliderrormessage);
+
+ //does it allow regex
+ if ($("#fieldtype option:selected").attr('regex') == "1") {
+ $("#" + newfieldid).attr('fieldsupportsregex', '1');
+ }
+ else {
+ $("#" + newfieldid).attr('fieldsupportsregex', '0');
+ }
+
+ //does it have prevalues
+ if($("#fieldtype option:selected").attr('prevalues') == "1")
+ {
+ $("#"+newfieldid).attr('fieldsupportsprevalues','1');
+ }
+ else
+ {
+ $("#" + newfieldid).attr('fieldsupportsprevalues', '0');
+ $("#" + newfieldid + " .fieldeditprevalues").hide();
+
+ }
+
+ $("#" + newfieldid).attr('fieldenablecondition', fieldenablecondition);
+ $("#" + newfieldid).attr('fieldconditionactiontype', fieldconditionactiontype);
+ $("#" + newfieldid).attr('fieldconditionlogictype', fieldconditionlogictype);
+
+
+ myDesignSurface.AddField(fieldsetid,newfieldid,fieldcaption,fieldtype,fieldmandatory,fieldregex);
+
+ //condition rules
+ var conditionrulescontainer = '#' + newfieldid + ' .fieldconditionrules';
+
+ $("#fieldrules").children().each(function () {
+ var rulefield = $(".fieldruleselect", $(this)).val();
+ var ruleoperator = $(".fieldruleoperator", $(this)).val();
+ var rulevalue = $(".fieldrulevalue", $(this)).val();
+
+ $(conditionrulescontainer).append("" + rulevalue + "
");
+ });
+
+
+
+ var prevaluecontainer = '#' + newfieldid + ' .fieldprevalues';
+
+
+
+ var myPrevalues = new Array();
+ var prevaluecount = 0;
+
+ if ($("#fieldtype option:selected").attr('prevalues') == "1") {
+ $(prevaluecontainer).attr('type', $("#prevaluestype option:selected").val());
+ $(prevaluecontainer).attr('crud', $("#prevaluestype option:selected").attr('crud'));
+ }
+
+ $("#fieldprevalueslist").children().each(function() {
+ var child = $(this);
+
+ var relattr = "";
+ if (child.attr("rel") != undefined) {
+ relattr = "rel='" + child.attr("rel") + "'";
+ };
+
+ var prevalue = child.children(":first-child").text();
+ var prevalueid = child.attr("id");
+
+ $(prevaluecontainer).append("" + prevalue + "
");
+
+
+ //todo
+ //myDesignSurface.AddPrevalue(fieldid,prevalueid,value);
+
+ myPrevalues[prevaluecount] = prevalue;
+ prevaluecount++;
+ });
+
+
+
+ //additional settings
+ SaveAdditionalSettings(newfieldid);
+
+
+
+ //Field Preview
+ $("#" + newfieldid + " .fieldexample").append("" + fieldcaption + " " + " " + mandatory + "" + prevalue + " " + lang_delete + " handle " + mandatorycontent + " ";
+
+
+ //does it allow regex
+ if ($("#fieldtype option:selected").attr('regex') == "1") {
+ $("#" + field).attr('fieldsupportsregex', '1');
+ }
+ else {
+ $("#" + field).attr('fieldsupportsregex', '0');
+ }
+
+ //condition rules
+ $("#fieldrules").children().each(function () {
+ var rulefield = $(".fieldruleselect", $(this)).val();
+ var ruleoperator = $(".fieldruleoperator", $(this)).val();
+ var rulevalue = $(".fieldrulevalue", $(this)).val();
+
+ $(conditionrulescontainer).append("" + rulevalue + "
");
+ });
+
+ var myPrevalues = new Array();
+ var prevaluecount = 0;
+ //does it have prevalues
+ if($("#fieldtype option:selected").attr('prevalues') == "1") {
+
+ //$("#" + field + " .fieldeditprevalues").show();
+ $("#" + field).attr('fieldsupportsprevalues', '1');
+
+ if ($("#fieldtype option:selected").attr('prevalues') == "1") {
+ $("#" + field + " .fieldprevalues").attr('type', $("#prevaluestype option:selected").val());
+ $("#" + field + " .fieldprevalues").attr('crud', $("#prevaluestype option:selected").attr('crud'));
+ }
+
+
+
+ $("#fieldprevalueslist").children().each(function() {
+ var child = $(this);
+
+ var prevalue = child.children(":first-child").text();
+ var prevalueid = child.attr("id");
+
+ var relattr = "";
+ if (child.attr("rel") != undefined) {
+ relattr = "rel='" + child.attr("rel") + "'";
+ };
+
+ $(prevaluecontainer).append("" + prevalue + "
");
+
+
+ //todo
+ //myDesignSurface.AddPrevalue(fieldid,prevalueid,value);
+
+ myPrevalues[prevaluecount] = prevalue;
+ prevaluecount++;
+
+ });
+
+
+
+
+
+
+ }
+ else
+ {
+ $("#" + field).attr('fieldsupportsprevalues', '0');
+ //$("#" + field + " .fieldeditprevalues").hide();
+ }
+
+ $('#' + field + ' .fieldexample').append("" + newcaption + " " + " " + mandatory + "" + prevalue + " " + lang_delete + " handle " + prevalue + " " + lang_delete + " handle " + prevalue + " " + lang_delete + " handle " + prevalue + "
");
+
+
+ myPrevalues[prevaluecount] = prevalue;
+ prevaluecount++;
+
+ });
+
+
+ $('#PreValueModal').prependTo("#modals");
+
+ var label = $('#' + field + ' .fieldexample .fieldexamplelabel');
+
+ $('#' + field + ' .fieldexample').children().remove();
+ $('#' + field + ' .fieldexample').text("");
+
+ $('#' + field + ' .fieldexample').append(label);
+
+ $('#' + field + ' .fieldexample').append("
");
+
+ cloneEditContainer.insertAfter(clone);
+
+ SetFieldHover();
+}
+
+function ShowFieldTypeSpecificSettings(fieldtype) {
+
+ // move previous onesjquery
+ $("#ftSpecificSettingsContainer").append($("#fieldadditionalsettings .ftSpecificSettings"));
+
+ //clear values
+ $("#ftSettingsContainer" + fieldtype + " .ftAdditionalSetting .formControl").each(function () {
+
+ var tagname = $('":first-child', this).tagName().toLowerCase();
+
+
+ switch (tagname) {
+ case "input":
+ if ($('input', this).attr('type') == 'text') {
+ $('input', this).val('');
+ }
+
+ if ($('input', this).attr('type') == 'checkbox') {
+ $('input', this).attr('checked', false);
+ }
+ break;
+ case "span":
+
+
+
+ var pickerId = $('input', this).attr('id').replace('_ContentIdValue_1', '');
+ pickerId = pickerId.replace('_ContentIdValue_2', '');
+ pickerId = pickerId.replace('_ContentIdValue_3', '');
+ pickerId = pickerId.replace('_ContentIdValue_4', '');
+ pickerId = pickerId.replace('_ContentIdValue_5', '');
+ pickerId = pickerId.replace('_ContentIdValue_0', '');
+ pickerId = pickerId.replace('_ContentIdValue', '');
+ clearPickerValue(pickerId);
+
+ break;
+ default:
+ try { $('":first-child', this).val(''); } catch (err) { }
+ }
+
+ });
+
+ //show correct ones
+ $('#fieldadditionalsettings').append($('#ftSettingsContainer' + fieldtype));
+
+
+}
+
+function LoadAdditionalSettings(field) {
+
+ $("#" + field + " .fieldadditionalsettings").children().each(function () {
+
+
+ SetInputValue($(":first-child", "#fieldadditionalsettings .ftAdditionalSetting:[rel=" + $(this).attr('rel') + "] .formControl"), $(this).html());
+ });
+}
+
+function SetInputValue(input, value) {
+
+ var tagname =input.tagName().toLowerCase();
+
+ switch (tagname) {
+ case "input":
+ if (input.attr('type') == 'text') {
+ input.val(value);
+ }
+
+ if (input.attr('type') == 'checkbox') {
+ if (value == "true" || value == "checked") {
+ input.attr('checked', true);
+ } else {
+ input.attr('checked', false);
+ }
+ }
+ break;
+ case "select":
+ input.val(value);
+ break;
+ case "span":
+
+ if ($(':first-child', input).attr('class') == "picker") {
+ var picker = $(':first-child', input);
+
+ if(value == null || value == '') {
+ var pickerId = $('input', picker).attr('id').replace('_ContentIdValue_1', '');
+ pickerId = pickerId.replace('_ContentIdValue_2', '');
+ pickerId = pickerId.replace('_ContentIdValue_3', '');
+ pickerId = pickerId.replace('_ContentIdValue_4', '');
+ pickerId = pickerId.replace('_ContentIdValue_5', '');
+ pickerId = pickerId.replace('_ContentIdValue_0', '');
+ pickerId = pickerId.replace('_ContentIdValue', '');
+ clearPickerValue(pickerId);
+ }
+ else
+ {
+ var pickerId = $('input', picker).attr('id').replace('_ContentIdValue_1', '');
+ pickerId = pickerId.replace('_ContentIdValue_2', '');
+ pickerId = pickerId.replace('_ContentIdValue_3', '');
+ pickerId = pickerId.replace('_ContentIdValue_4', '');
+ pickerId = pickerId.replace('_ContentIdValue_5', '');
+ pickerId = pickerId.replace('_ContentIdValue_0', '');
+ pickerId = pickerId.replace('_ContentIdValue', '');
+ setPickerValue(pickerId, value);
+ }
+ }
+ break;
+ default:
+ try{input.val(value);}catch(err){}
+ break;
+ }
+}
+
+function clearPickerValue(pickerClientId) {
+
+ if (Umbraco.Controls.TreePicker.inst[pickerClientId] != null) {
+ Umbraco.Controls.TreePicker.inst[pickerClientId].ClearSelection();
+ }
+}
+
+function setPickerValue(pickerClientId, value) {
+
+ if (Umbraco.Controls.TreePicker.inst[pickerClientId] != null) {
+ var currentpicker = Umbraco.Controls.TreePicker.inst[pickerClientId];
+
+ var jsonObj = [];
+ jsonObj.outVal = value;
+ currentpicker.SaveSelection(jsonObj);
+ }
+
+ //$("#" + currentpicker._itemIdValueClientID).val(value);
+
+ //$.ajax({
+ // type: "POST",
+ // url: currentpicker._webServiceUrl,
+ // data: '{ "nodeId": ' + value + ' }',
+ // contentType: "application/json; charset=utf-8",
+ // dataType: "json",
+ // success: function (msg) {
+ // $("#" + currentpicker._itemTitleClientID).html(msg.d);
+ // $("#" + currentpicker._itemTitleClientID).parent().show();
+ // }
+ //});
+
+
+}
+
+function SaveAdditionalSettings(field) {
+
+ $("#" + field + " .fieldadditionalsettings").children().remove();
+
+ $("#fieldadditionalsettings .ftAdditionalSetting .formControl").each(function () {
+
+ var settingvalue = "";
+
+ var tagname = $(':first-child', this).tagName().toLowerCase();
+
+
+ switch (tagname) {
+ case "input":
+ if ($(':first-child', this).attr('type') == 'text') {
+ settingvalue = $('input', this).val();
+ }
+
+ if ($(':first-child', this).attr('type') == 'checkbox') {
+ settingvalue = $('input', this).attr('checked');
+ }
+ break;
+ case "span":
+ if ($(':first-child', $(':first-child', this)).attr('class') == "picker") {
+ var picker = $(':first-child', $(':first-child', this));
+
+ settingvalue = $('input', picker).val();
+ }
+ break
+ case "select":
+ settingvalue = $('select', this).val();
+ break;
+ default:
+ try { settingvalue = $(':first-child', this).val(); } catch (err) { }
+ }
+
+
+ $("#" + field + " .fieldadditionalsettings").append("" + settingvalue + "
");
+ });
+}
+
+
+$.fn.tagName = function () {
+ return this.get(0).tagName;
+}
diff --git a/src/Umbraco.Web.UI/Umbraco/plugins/umbracoContour/scripts/umbracoforms.limitedmode.js b/src/Umbraco.Web.UI/Umbraco/plugins/umbracoContour/scripts/umbracoforms.limitedmode.js
new file mode 100644
index 0000000000..e1a29fae1e
--- /dev/null
+++ b/src/Umbraco.Web.UI/Umbraco/plugins/umbracoContour/scripts/umbracoforms.limitedmode.js
@@ -0,0 +1,96 @@
+// Can't add fields
+// Can't delete fields
+// Can't delete pages that have fields
+// Can't delete fieldsets that have fields
+// Can't crud prevalues
+$(document).ready(function() {
+ LimitEditor();
+
+
+myDesignSurface.addEventListener("UpdateFieldsetSortOrder", "updatefieldsetsortorder", function(id, sortorder) {
+ LimitEditor();
+});
+
+myDesignSurface.addEventListener("UpdateFieldSortOrder", "updatefieldsortorder", function(id, sortorder) {
+ LimitEditor();
+});
+
+myDesignSurface.addEventListener("AddFieldset", "addfieldset", function(pageid, id, name) {
+ LimitEditor();
+});
+
+myDesignSurface.addEventListener("AddPage", "addpage", function(id, name) {
+ LimitEditor();
+});
+
+myDesignSurface.addEventListener("UpdateField", "updatefield", function(id,name,type,mandatory,regex) {
+ $(".fieldeditprevalues").hide();
+});
+
+myDesignSurface.addEventListener("ShowUpdateFieldDialog", "showupdatefielddialog", function (field) {
+
+ if ($('#' + field).attr('fieldmandatory').toLowerCase() == 'true' || $('#' + field).attr('fieldmandatory') == '1') {
+ $("#fieldmandatory").attr('disabled', true);
+ }
+ else {
+ $("#fieldmandatory").attr('disabled', false);
+ }
+
+});
+
+});
+
+function LimitEditor() {
+
+ //remove page add/navigation
+ $("#stepsnavigation").hide();
+
+ // remove field delete
+ $("#designsurface .field .delete").remove();
+
+ //remove field copy
+ $("#designsurface .field .copy").remove();
+
+ //fieldset delete
+ $("#designsurface .fieldset").each(function() {
+
+ if($(this).children(".fieldcontainer").children(".field").size() > 0){
+
+ $(this).children(".fieldsetheader").children(".delete").hide();
+ }
+ else{
+ $(this).children(".fieldsetheader").children(".delete").show();
+ }
+ });
+
+ //page delete
+ $("#designsurface .page").each(function() {
+ if ($("#" + $(this).attr('id') + " .field").children().size() > 0) {
+
+ $(this).children(".delete").hide();
+ }
+ else {
+ $(this).children(".delete").show();
+ }
+
+ });
+
+
+ //field add
+ //remove menu addfield button
+ $("#" + addfield_id).remove();
+ //remove add field on fieldsets
+ $("#designsurface .fieldset .add").remove();
+ $("#designsurface .fieldset .addfield").remove();
+
+
+ //can't change fieldtype on field
+ $("#fieldtype").attr('disabled', true);
+
+ //not possible to edit prevalues
+ $(".fieldeditprevalues").hide();
+
+
+ //disable prevaluetype select
+ $("#prevaluestype").attr("disabled", "disabled");
+}
diff --git a/src/Umbraco.Web.UI/Umbraco/plugins/umbracoContour/scripts/umbracoforms.readonlymode.js b/src/Umbraco.Web.UI/Umbraco/plugins/umbracoContour/scripts/umbracoforms.readonlymode.js
new file mode 100644
index 0000000000..5e08306b74
--- /dev/null
+++ b/src/Umbraco.Web.UI/Umbraco/plugins/umbracoContour/scripts/umbracoforms.readonlymode.js
@@ -0,0 +1,22 @@
+$(document).ready(function() {
+ ReadOnlyEditor();
+});
+
+function ReadOnlyEditor() {
+
+ //menu buttons
+ $(".sl").remove();
+
+ $("#designsurface .add").remove();
+ $("#designsurface .delete").remove();
+ $("#designsurface .copy").remove();
+ $("#designsurface .update").remove();
+ $("#designsurface .handle").remove();
+
+ $("#designsurface .addfield").remove();
+
+ //not possible to edit prevalues
+ $("#designsurface .fieldeditprevalues").remove();
+
+ $("#stepsnavigation").hide();
+}
\ No newline at end of file
diff --git a/src/Umbraco.Web.UI/Umbraco/plugins/umbracoContour/templates/Comment form.ucf b/src/Umbraco.Web.UI/Umbraco/plugins/umbracoContour/templates/Comment form.ucf
new file mode 100644
index 0000000000..aec5cc04ce
--- /dev/null
+++ b/src/Umbraco.Web.UI/Umbraco/plugins/umbracoContour/templates/Comment form.ucf
@@ -0,0 +1,141 @@
+
+
\ No newline at end of file
diff --git a/src/Umbraco.Web.UI/Umbraco/plugins/umbracoContour/templates/Contact form.ucf b/src/Umbraco.Web.UI/Umbraco/plugins/umbracoContour/templates/Contact form.ucf
new file mode 100644
index 0000000000..2c2de40a66
--- /dev/null
+++ b/src/Umbraco.Web.UI/Umbraco/plugins/umbracoContour/templates/Contact form.ucf
@@ -0,0 +1,115 @@
+
+
\ No newline at end of file
diff --git a/src/Umbraco.Web.UI/Umbraco/plugins/umbracoContour/test.asmx b/src/Umbraco.Web.UI/Umbraco/plugins/umbracoContour/test.asmx
new file mode 100644
index 0000000000..d6ade97e53
--- /dev/null
+++ b/src/Umbraco.Web.UI/Umbraco/plugins/umbracoContour/test.asmx
@@ -0,0 +1 @@
+<%@ WebService Language="C#" CodeBehind="test.asmx.cs" Class="Umbraco.Forms.UI.Webservices.test" %>
diff --git a/src/Umbraco.Web.UI/Umbraco/plugins/umbracoContour/tinymce/insertForm.aspx b/src/Umbraco.Web.UI/Umbraco/plugins/umbracoContour/tinymce/insertForm.aspx
new file mode 100644
index 0000000000..c2efa37c5f
--- /dev/null
+++ b/src/Umbraco.Web.UI/Umbraco/plugins/umbracoContour/tinymce/insertForm.aspx
@@ -0,0 +1,64 @@
+<%@ Page Language="C#" AutoEventWireup="true" CodeBehind="insertForm.aspx.cs" Inherits="Umbraco.Forms.UI.Pages.tinymce3.insertForm" %>
+
+
+
+
+
+ Insert form
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
diff --git a/src/Umbraco.Web.UI/Umbraco/plugins/umbracoContour/webservices/RecordActions.aspx b/src/Umbraco.Web.UI/Umbraco/plugins/umbracoContour/webservices/RecordActions.aspx
new file mode 100644
index 0000000000..0fb4403da6
--- /dev/null
+++ b/src/Umbraco.Web.UI/Umbraco/plugins/umbracoContour/webservices/RecordActions.aspx
@@ -0,0 +1 @@
+<%@ Page Language="C#" AutoEventWireup="true" CodeBehind="RecordActions.aspx.cs" Inherits="Umbraco.Forms.UI.Webservices.RecordActions" %>
\ No newline at end of file
diff --git a/src/Umbraco.Web.UI/Umbraco/plugins/umbracoContour/webservices/Records.aspx b/src/Umbraco.Web.UI/Umbraco/plugins/umbracoContour/webservices/Records.aspx
new file mode 100644
index 0000000000..1fc80cabc1
--- /dev/null
+++ b/src/Umbraco.Web.UI/Umbraco/plugins/umbracoContour/webservices/Records.aspx
@@ -0,0 +1 @@
+<%@ Page Language="C#" AutoEventWireup="true" CodeBehind="Records.aspx.cs" Inherits="Umbraco.Forms.UI.Webservices.Records" %>
\ No newline at end of file
diff --git a/src/Umbraco.Web.UI/Umbraco/plugins/umbracoContour/xslt/DataTables_json.xslt b/src/Umbraco.Web.UI/Umbraco/plugins/umbracoContour/xslt/DataTables_json.xslt
new file mode 100644
index 0000000000..df48c15a0f
--- /dev/null
+++ b/src/Umbraco.Web.UI/Umbraco/plugins/umbracoContour/xslt/DataTables_json.xslt
@@ -0,0 +1,85 @@
+
+
+
+
+ function date2number(s) { return Number(new Date(s)); }
+
+
+
+
+
+ { "iTotalDisplayRecords": "
+
+
+
+
+
+
+
+ ,
+
+
+
+
+
+
+
+
+
+ ,"
+
+
+ ,
+ "
+
+
+ "
+
+
+ "
+
+
+
+
+
+
+
+ ],
+
+ ]}
+
+
+
+
+
+
\ No newline at end of file
diff --git a/src/Umbraco.Web.UI/Umbraco/plugins/umbracoContour/xslt/DataTables_json_medtrust.xslt b/src/Umbraco.Web.UI/Umbraco/plugins/umbracoContour/xslt/DataTables_json_medtrust.xslt
new file mode 100644
index 0000000000..fecdfea043
--- /dev/null
+++ b/src/Umbraco.Web.UI/Umbraco/plugins/umbracoContour/xslt/DataTables_json_medtrust.xslt
@@ -0,0 +1,82 @@
+
+
+
+
+
+
+ { "iTotalDisplayRecords": "
+
+
+
+
+
+
+
+ ,
+
+
+
+
+
+
+
+
+
+ ,"
+
+ ,
+ "
+
+
+ "
+
+
+ "
+
+
+
+
+
+
+
+ ],
+
+ ]}
+
+
+
+
+
+
\ No newline at end of file
diff --git a/src/Umbraco.Web.UI/Umbraco/plugins/umbracoContour/xslt/Html.xslt b/src/Umbraco.Web.UI/Umbraco/plugins/umbracoContour/xslt/Html.xslt
new file mode 100644
index 0000000000..76214ad008
--- /dev/null
+++ b/src/Umbraco.Web.UI/Umbraco/plugins/umbracoContour/xslt/Html.xslt
@@ -0,0 +1,96 @@
+
+
+
+
+
+
+
+
+ Export of data from umbraco forms
+
+
+
+
+ Export of data from umbraco forms
+
+
+
+ State
+
+
+ Submitted
+
+
+ Page ID
+
+
+ IP
+
+
+ Member Key
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ ,
+
+
+
+
+
+
+
+
+
+
+
+
+
+
diff --git a/src/Umbraco.Web.UI/Umbraco/plugins/umbracoContour/xslt/excel.xslt b/src/Umbraco.Web.UI/Umbraco/plugins/umbracoContour/xslt/excel.xslt
new file mode 100644
index 0000000000..2126548511
--- /dev/null
+++ b/src/Umbraco.Web.UI/Umbraco/plugins/umbracoContour/xslt/excel.xslt
@@ -0,0 +1,21 @@
+
+
+
+
+"State","Submitted","PageId","IP","MemberId"," "
"" " " "
+
+
+
+
+
+
+
\ No newline at end of file
diff --git a/src/Umbraco.Web.UI/Umbraco/plugins/umbracoContour/xslt/postAsXmlSample.xslt b/src/Umbraco.Web.UI/Umbraco/plugins/umbracoContour/xslt/postAsXmlSample.xslt
new file mode 100644
index 0000000000..f692ee5acd
--- /dev/null
+++ b/src/Umbraco.Web.UI/Umbraco/plugins/umbracoContour/xslt/postAsXmlSample.xslt
@@ -0,0 +1,40 @@
+
+
+
+
+
+
+
+
+ 1
+ 1
+ 1
+ new
+
+
+
+
+
+
+
+
+
diff --git a/src/Umbraco.Web.UI/Umbraco/plugins/umbracoContour/xslt/sendXsltEmailSample.xslt b/src/Umbraco.Web.UI/Umbraco/plugins/umbracoContour/xslt/sendXsltEmailSample.xslt
new file mode 100644
index 0000000000..67ba9cb2ec
--- /dev/null
+++ b/src/Umbraco.Web.UI/Umbraco/plugins/umbracoContour/xslt/sendXsltEmailSample.xslt
@@ -0,0 +1,45 @@
+
+
+
+
+
+ Intro
+
+ Hello, this is a sample email using xslt to convert a record into a custom email
+
+
+ the fields
+
+
+
+
+ Caption:
+
+
+
+
+
+
+ The actual xml
+
+
+
+
+
diff --git a/src/Umbraco.Web.UI/Umbraco/plugins/umbracoContour/xslt/xml.xslt b/src/Umbraco.Web.UI/Umbraco/plugins/umbracoContour/xslt/xml.xslt
new file mode 100644
index 0000000000..d3d3e23302
--- /dev/null
+++ b/src/Umbraco.Web.UI/Umbraco/plugins/umbracoContour/xslt/xml.xslt
@@ -0,0 +1,18 @@
+
+
+
+
+
+
+
diff --git a/src/Umbraco.Web.UI/Umbraco/xslt/templates/Schema2/UmbracoContourListComments.xslt b/src/Umbraco.Web.UI/Umbraco/xslt/templates/Schema2/UmbracoContourListComments.xslt
new file mode 100644
index 0000000000..606a171ebe
--- /dev/null
+++ b/src/Umbraco.Web.UI/Umbraco/xslt/templates/Schema2/UmbracoContourListComments.xslt
@@ -0,0 +1,65 @@
+
+
+]>
+
+
+
+
+
+
+
+
+
+
+
+
+ No comments
+
+
+ 1 comment
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ Says:
+
+
+
+
+
+
+
+
+
+
+
\ No newline at end of file
diff --git a/src/Umbraco.Web.UI/Umbraco/xslt/templates/UmbracoContourListComments.xslt b/src/Umbraco.Web.UI/Umbraco/xslt/templates/UmbracoContourListComments.xslt
new file mode 100644
index 0000000000..e08ee63b4f
--- /dev/null
+++ b/src/Umbraco.Web.UI/Umbraco/xslt/templates/UmbracoContourListComments.xslt
@@ -0,0 +1,59 @@
+
+ ]>
+
+
+
+
+
+
+
+
+
+
+
+
+ No comments
+
+
+ 1 comment
+
+
+
+
+
+
+
+
+
+
+
+
\ No newline at end of file
diff --git a/src/Umbraco.Web.UI/config/Dashboard.config b/src/Umbraco.Web.UI/config/Dashboard.config
index 54d953dc51..6b88e00379 100644
--- a/src/Umbraco.Web.UI/config/Dashboard.config
+++ b/src/Umbraco.Web.UI/config/Dashboard.config
@@ -47,7 +47,6 @@
-
translator
@@ -61,24 +60,17 @@
views/dashboard/startupdashboardkits.html
-
- editor
- writer
-
-
+ editor writer
views/dashboard/startupdashboardvideos.html
-
/umbraco/dashboard/latestEdits.ascx
-
/umbraco/dashboard/changepassword.ascx
-
-
/umbraco/dashboard/ExamineManagement.ascx
+
+
+
+
+ /umbraco/plugins/umbracocontour/formsdashboard.ascx
+
+
\ No newline at end of file
diff --git a/src/Umbraco.Web.UI/config/applications.config b/src/Umbraco.Web.UI/config/applications.config
index 2a6da37bae..b0b3ed2300 100644
--- a/src/Umbraco.Web.UI/config/applications.config
+++ b/src/Umbraco.Web.UI/config/applications.config
@@ -7,4 +7,5 @@
@@ -252,36 +252,34 @@
-
-
- /create/DLRScripting.ascx
-
-
-
-
-
- /create/DLRScripting.ascx
-
-
-
-
-
-
- /create/DLRScripting.ascx
-
-
-
-
-
-
- /create/DLRScripting.ascx
-
-
-
+
+
+ /create/DLRScripting.ascx
+
+
+
+
+
+ /create/DLRScripting.ascx
+
+
+
+
+
+ /create/DLRScripting.ascx
+
+
+
+
+
+ /create/DLRScripting.ascx
+
+
+
/create/script.ascx
@@ -304,7 +302,6 @@
-
/create/simple.ascx
@@ -341,22 +338,44 @@
-
-
-
+
+
/Create/PartialView.ascx
-
-
-
-
-
- /Create/PartialViewMacro.ascx
-
-
-
-
+
+
+
+
+
+ /Create/PartialViewMacro.ascx
+
+
+
+
+
+ /plugins/umbracocontour/createform.ascx
+
+
+
+
+
+ /create/simple.ascx
+
+
+
+
+
+ /create/simple.ascx
+
+
+
\ No newline at end of file
diff --git a/src/Umbraco.Web.UI/umbraco/config/lang/en.xml b/src/Umbraco.Web.UI/umbraco/config/lang/en.xml
index 9b10e43236..951a594b68 100644
--- a/src/Umbraco.Web.UI/umbraco/config/lang/en.xml
+++ b/src/Umbraco.Web.UI/umbraco/config/lang/en.xml
@@ -1,4 +1,4 @@
-
+
umbraco
@@ -35,6 +35,11 @@
Send to publication
Translate
Update
+ Export form
+ Import form
+ Archive form
+ Unarchive form
+ Default value
Permission denied.
@@ -48,19 +53,15 @@
New domain '%0%' has been created
Domain '%0%' is deleted
Domain '%0%' has already been assigned
-
-
+ should be avoided. Better use the culture setting above.]]>
Domain '%0%' has been updated
Edit Current Domains
Inherit
Culture
-
- or inherit culture from parent nodes. Will also apply
+ or inherit culture from parent nodes. Will also apply
Domains
To change the document type for the selected content, first select from the list of valid types for this location.
Then confirm and/or amend the mapping of properties from the current type to the new, and click Save.
- The content has been re-published.
+ The content has been re-published.
Current Property
Current type
The document type cannot be changed, as there are no alternatives valid for this location.
- Document Type Changed
+ Document Type Changed
Map Properties
Map to Property
New Template
New Type
- none
+ none
Content
Select New Document Type
The document type of the selected content has been successfully changed to [new type] and the following properties mapped:
to
Could not complete property mapping as one or more properties have more than one mapping defined.
- Only alternate types valid for the current location are displayed.
-
+ Only alternate types valid for the current location are displayed.
+
About this page
Alias
@@ -207,24 +208,18 @@
The website cache will be refreshed. All published content will be updated, while unpublished content will stay unpublished.
Number of columns
Number of rows
-
- Set a placeholder id by setting an ID on your placeholder you can inject content into this template from child templates,
- by refering this ID using a <asp:content /> element.]]>
-
-
- Select a placeholder id from the list below. You can only
- choose Id's from the current template's master.]]>
-
+ Set a placeholder id by setting an ID on your placeholder you can inject content into this template from child templates,
+ by refering this ID using a <asp:content /> element.]]>
+ Select a placeholder id from the list below. You can only
+ choose Id's from the current template's master.]]>
Click on the image to see full size
Pick item
View Cache Item
- %0%' below
+ ]]>
Culture Name
Could not save the web.config file. Please modify the connection string manually.
Your database has been found and is identified as
Database configuration
-
- install button to install the Umbraco %0% database
- ]]>
-
+ ]]>
Next to proceed.]]>
-
- Database not found! Please check that the information in the "connection string" of the “web.config” file is correct.
+ Database not found! Please check that the information in the "connection string" of the “web.config” file is correct.
To proceed, please edit the "web.config" file (using Visual Studio or your favourite text editor), scroll to the bottom, add the connection string for your database in the key named "umbracoDbDSN" and save the file.
Click the retry button when
done.
- More information on editing web.config here.
]]>
-
-
-
+ More information on editing web.config here.]]>
+
Please contact your ISP if necessary.
- If you're installing on a local machine or server you might need information from your system administrator.]]>
-
-
-
+
Press the upgrade button to upgrade your database to Umbraco %0%
Don't worry - no content will be deleted and everything will continue working afterwards!
- ]]>
-
-
- Press Next to
- proceed. ]]>
-
+ ]]>
+ Press Next to
+ proceed. ]]>
next to continue the configuration wizard]]>
The Default users’ password needs to be changed!]]>
The Default user has been disabled or has no access to umbraco!No further actions needs to be taken. Click Next to proceed.]]>
The Default user's password has been successfully changed since the installation!No further actions needs to be taken. Click Next to proceed.]]>
The password is changed!
-
-
umbraco creates a default user with a login ('admin') and password ('default') . It's important that the password is
changed to something unique.
@@ -436,64 +420,48 @@
This step will check the default user's password and suggest if it needs to be changed.
- ]]>
-
+ ]]>
Get a great start, watch our introduction videos
By clicking the next button (or modifying the umbracoConfigurationStatus in web.config), you accept the license for this software as specified in the box below. Notice that this umbraco distribution consists of two different licenses, the open source MIT license for the framework and the umbraco freeware license that covers the UI.
Not installed yet.
Affected files and folders
More information on setting up permissions for umbraco here
You need to grant ASP.NET modify permissions to the following files/folders
-
- Your permission settings are almost perfect!
+ Your permission settings are almost perfect!
How to Resolve
Click here to read the text version
video tutorial on setting up folder permissions for umbraco or read the text version.]]>
-
- Your permission settings might be an issue!
+ Your permission settings might be an issue!
-
- Your permission settings are not ready for umbraco!
+ You can run umbraco without problems, but you will not be able to create folders or install packages which are recommended to take full advantage of umbraco.]]>
+ Your permission settings are not ready for umbraco!
-
- Your permission settings are perfect!
+ In order to run umbraco, you'll need to update your permission settings.]]>
+ Your permission settings are perfect!
Resolving folder issue
Follow this link for more information on problems with ASP.NET and creating folders
Setting up folder permissions
-
-
-
+ ]]>
I want to start from scratch
-
- learn how)
You can still choose to install Runway later on. Please go to the Developer section and choose Packages.
- ]]>
-
+ ]]>
You’ve just set up a clean Umbraco platform. What do you want to do next?
Runway is installed
-
-
This is our list of recommended modules, check off the ones you would like to install, or view the full list of modules
- ]]>
-
+ ]]>
Only recommended for experienced users
I want to start with a simple website
-
-
"Runway" is a simple website providing some basic document types and templates. The installer can set up Runway for you automatically,
but you can easily edit, extend or remove it. It’s not necessary and you can perfectly use Umbraco without it. However,
@@ -504,8 +472,7 @@
Included with Runway: Home page, Getting Started page, Installing Modules page.Optional Modules: Top Navigation, Sitemap, Contact, Gallery.
- ]]>
-
+ ]]>
What is Runway
Step 1/5 Accept license
Step 2/5: Database configuration
@@ -513,36 +480,24 @@
Step 4/5: Check umbraco security
Step 5/5: Umbraco is ready to get you started
Thank you for choosing umbraco
-
- Browse your new site
-You installed Runway, so why not see how your new website looks.]]>
-
-
- Further help and information
-Get help from our award winning community, browse the documentation or watch some free videos on how to build a simple site, how to use packages and a quick guide to the umbraco terminology]]>
-
+ Browse your new site
+You installed Runway, so why not see how your new website looks.]]>
+ Further help and information
+Get help from our award winning community, browse the documentation or watch some free videos on how to build a simple site, how to use packages and a quick guide to the umbraco terminology]]>
Umbraco %0% is installed and ready for use
-
- /web.config file and update the AppSetting key umbracoConfigurationStatus in the bottom to the value of '%0%' .]]>
-
-
- started instantly by clicking the "Launch Umbraco" button below. new to umbraco ,
-you can find plenty of resources on our getting started pages.]]>
-
-
- Launch Umbraco
-To manage your website, simply open the umbraco back office and start adding content, updating the templates and stylesheets or add new functionality]]>
-
+ /web.config file and update the AppSetting key umbracoConfigurationStatus in the bottom to the value of '%0%' .]]>
+ started instantly by clicking the "Launch Umbraco" button below. new to umbraco ,
+you can find plenty of resources on our getting started pages.]]>
+ Launch Umbraco
+To manage your website, simply open the umbraco back office and start adding content, updating the templates and stylesheets or add new functionality]]>
Connection to database failed.
Umbraco Version 3
Umbraco Version 4
Watch
-
- umbraco %0% for a fresh install or upgrading from version 3.0.
+ umbraco %0% for a fresh install or upgrading from version 3.0.
"next" to start the wizard.]]>
-
+ Press "next" to start the wizard.]]>
Culture Code
@@ -577,8 +532,7 @@ To manage your website, simply open the umbraco back office and start adding con
Edit your notification for %0%
-
-
-
-
- Hi %0%
+ ]]>
+ Hi %0%
This is an automated mail to inform you that the task '%1%'
has been performed on the page '%2%'
Have a nice day!
]]>
-
+ ]]>
[%0%] Notification about %1% performed on %2%
Notifications
-
button and locating the package. umbraco packages usually have a ".umb" or ".zip" extension.
- ]]>
-
+ ]]>
Author
Demonstration
Documentation
Package meta data
Package name
Package doesn't contain any items
-
-
+ No upgrades available
Package options
Package readme
@@ -653,11 +600,9 @@ To manage your website, simply open the umbraco back office and start adding con
Package was uninstalled
The package was successfully uninstalled
Uninstall package
-
-
+
Notice: any documents, media etc depending on the items you remove, will stop working, and could lead to system instability,
- so uninstall with caution. If in doubt, contact the package author.]]>
-
+ so uninstall with caution. If in doubt, contact the package author.]]>
Download update from the repository
Upgrade package
Upgrade instructions
@@ -691,32 +636,24 @@ To manage your website, simply open the umbraco back office and start adding con
If you just want to setup simple protection using a single login and password
-
-
-
-
+
-
-
-
+
-
+ ]]>
Include unpublished child pages
Publishing in progress - please wait...
%0% out of %1% pages have been published...
%0% has been published
%0% and subpages have been published
Publish %0% and all its subpages
-
- ok to publish %0% and thereby making it's content publicly available.ok to publish %0% and thereby making it's content publicly available.publish all children below.
- ]]>
-
+ ]]>
Add external link
@@ -755,6 +692,7 @@ To manage your website, simply open the umbraco back office and start adding con
Statistics
Translation
Users
+ Umbraco Contour
Default template
@@ -883,12 +821,10 @@ To manage your website, simply open the umbraco back office and start adding con
Tasks assigned to you
-
- assigned to you. To see a detailed view including comments, click on "Details" or just the page name.
+ assigned to you. To see a detailed view including comments, click on "Details" or just the page name.
You can also download the page as XML directly by clicking the "Download Xml" link.
+ ]]>
close task
Translation details
Download all translation tasks as xml
@@ -896,8 +832,7 @@ To manage your website, simply open the umbraco back office and start adding con
Download xml DTD
Fields
Include subpages
-
-
-
+ ]]>
[%0%] Translation task for %1%
No translator users found. Please create a translator user before you start sending content to translation
Tasks created by you
-
- created by you. To see a detailed view including comments,
+ created by you. To see a detailed view including comments,
click on "Details" or just the page name. You can also download the page as XML directly by clicking the "Download Xml" link.
To close a translation task, please go to the Details view and click the "Close" button.
- ]]>
-
+ ]]>
The page '%0%' has been send to translation
Send the page '%0%' to translation
Assigned by
@@ -1010,4 +942,4 @@ To manage your website, simply open the umbraco back office and start adding con
User types
Writer
-
+
\ No newline at end of file
");
+ $("#fieldrules").append($(clone));
+
+ $("#fieldruleaddoperator").val($("#fieldruleaddoperator option:first").val());
+ $("#fieldruleadd").val($("#fieldruleadd option:first").val());
+ $("#fieldruleaddvalue").val("");
+ });
+
+ $(".removefieldrule").live("click", function () { $(this).parent().remove(); });
+
+ $('#fieldenableconditions').change(function () {
+ $("#fieldconditions").toggle();
+ });
+
+ FillFieldDropDown();
+
+// DimHiddenFields();
+});
+
+function FillFieldDropDown() {
+ $("#fieldruleadd").children().remove();
+ $(".field").each(function () {
+ $("#fieldruleadd").append("");
+ });
+}
+//function DimHiddenFields() {
+// $(".field").each(function () {
+// if ($(this).attr("") == "0" && ($(this).attr("fieldenablecondition") == "True" || $(this).attr("fieldenablecondition") == "true")) {
+// $(".fieldexamplelabel", $(this)).addClass("grey");
+// }
+// });
+//}
+function AddUpdateField() {
+
+ if (addfield) {
+
+ AddField();
+ }
+ else {
+ UpdateField(fieldToUpdate);
+ }
+}
+
+function SetFieldHover() {
+
+ $('.field').hover(function() {
+
+ $(this).addClass('activefield');
+
+ }, function() {
+
+ $(this).removeClass('activefield');
+
+ });
+
+}
+
+function SetPrevalueHover() {
+
+
+
+ $("#editprevaluelist li").live({
+ mouseenter:
+ function () {
+ $(this).addClass('activeprevalue');
+ },
+ mouseleave:
+ function () {
+ $(this).removeClass('activeprevalue');
+ }
+ }
+ );
+
+}
+
+
+function ShowPage(page) {
+ currentpage = page;
+ $(".page").hide();
+ $(".page:nth-child(" + currentpage + ")").show();
+
+ if (currentpage == 1) {
+ $("#stepnavprev").hide();
+
+ } else {
+ $("#stepnavprev").show();
+ }
+ if ($(".page").size() == currentpage) {
+ $("#stepnavnext").hide();
+ $("#stepnavnew").show();
+ }
+ else {
+ $("#stepnavnext").show();
+ $("#stepnavnew").hide();
+ }
+
+}
+function ShowNextPage() {
+
+
+
+ $(".page:nth-child(" + currentpage + ")").hide();
+ currentpage++;
+ $(".page:nth-child(" + currentpage + ")").show();
+
+ if (currentpage > 1) {
+ $("#stepnavprev").show();
+ }
+ else {
+ $("#stepnavprev").hide();
+ }
+ if ($(".page").size() == currentpage) {
+ $("#stepnavnext").hide();
+ $("#stepnavnew").show();
+ }
+}
+
+function ShowPreviousPage() {
+
+ if (currentpage > 1) {
+ $(".page:nth-child(" + currentpage + ")").hide();
+ currentpage--;
+ }
+ $(".page:nth-child(" + currentpage + ")").show();
+
+ if($(".page").size() == currentpage)
+ {
+ $("#stepnavnext").hide();
+ $("#stepnavnew").show();
+ }
+ else
+ {
+ $("#stepnavnext").show();
+ $("#stepnavnew").hide();
+ }
+ if (currentpage == 1) {
+ $("#stepnavprev").hide();
+
+ }
+}
+function SetupStepsNavigation() {
+
+ if($(".page").size() == 0)
+ {
+ $("#stepnavprev").hide();
+ $("#stepnavnext").hide();
+ $("#stepnavnew").show();
+ }
+ else if ($(".page").size() == 1) {
+
+ currentpage = 1;
+ $(".page:nth-child(1)").show();
+ $("#stepnavprev").hide();
+ $("#stepnavnext").hide();
+ $("#stepnavnew").show();
+
+ $(".page .pageheader .delete").hide();
+ }
+ else {
+
+ currentpage = 1;
+ $(".page:nth-child(1)").show();
+ $("#stepnavprev").hide();
+ $("#stepnavnew").hide();
+ $("#stepnavnext").show();
+ }
+
+}
+
+function ToggleAddFieldsetAction() {
+
+ $("#" + addfieldset_id).unbind('click');
+
+ if ($('#designsurface').children().size() > 0) {
+ $("#" + addfieldset_id).removeClass("disabled");
+ $("#" + addfieldset_id).click(function() {
+ ShowAddFieldsetDialog(null);
+ });
+ }
+ else {
+
+ $("#" + addfieldset_id).addClass("disabled");
+
+ $("#" + addfieldset_id).click(function(e) {
+ e.preventDefault();
+ });
+
+ }
+}
+
+function ToggleAddFieldAction() {
+
+ $("#" + addfield_id).unbind('click');
+
+ if ($(".fieldset").size() > 0) {
+ $("#" + addfield_id).removeClass("disabled");
+ $("#" + addfield_id).click(function() {
+ ShowAddFieldDialog(null);
+ });
+ }
+ else {
+
+ $("#" + addfield_id).addClass("disabled");
+
+ $("#" + addfield_id).click(function(e) {
+ e.preventDefault();
+ });
+
+ }
+}
+
+function CloseDialog() {
+ $.modal.close();
+}
+
+function ShowAddPageDialog()
+{
+ /* Set Captions */
+ $('#PageModal h1').text(lang_addpage);
+ $('#PageModal #pageform .submit').attr('value', lang_addpage);
+
+ /* Clear Fields */
+ $('#NewPageName').val('');
+
+ /* Show Modal */
+ //$('#PageModal').modal();
+
+ //auto add
+
+ //$('#PageModal').appendTo("#designsurface");
+ //$('#PageModal').show();
+
+ $('#cancelpageaction').click(function() {
+ $('#PageModal').prependTo("#modals");
+ });
+
+ /* Set Focus */
+ $('#NewPageName').focus();
+
+ var form = $('#pageform').get(0);
+ $.removeData(form, 'validator');
+ $('#pageform').unbind('submit');
+
+ $("#pageform").validate({ submitHandler: function() {
+ AddPage();
+
+ }
+ });
+
+ //auto add
+ $("#NewPageName").val("Edit form step")
+ AddPage();
+}
+
+function AddPage() {
+
+ var pagenumber = pageguid;
+ pageguid = pageguid + 1;
+
+ var pagename = $("#NewPageName").val();
+ var pageid = "page_" + pagenumber;
+
+ $("#designsurface").append("